This is the mail archive of the
glibc-cvs@sourceware.org
mailing list for the glibc project.
GNU C Library master sources branch siddhesh/benchmarks created. glibc-2.18-901-g9749af6
- From: siddhesh at sourceware dot org
- To: glibc-cvs at sourceware dot org
- Date: 5 Feb 2014 11:23:05 -0000
- Subject: GNU C Library master sources branch siddhesh/benchmarks created. glibc-2.18-901-g9749af6
This is an automated email from the git hooks/post-receive script. It was
generated because a ref change was pushed to the repository containing
the project "GNU C Library master sources".
The branch, siddhesh/benchmarks has been created
at 9749af672ed40292e11ceccc4f78e740db4eecfb (commit)
- Log -----------------------------------------------------------------
http://sourceware.org/git/gitweb.cgi?p=glibc.git;a=commitdiff;h=9749af672ed40292e11ceccc4f78e740db4eecfb
commit 9749af672ed40292e11ceccc4f78e740db4eecfb
Author: Siddhesh Poyarekar <siddhesh@redhat.com>
Date: Wed Feb 5 16:49:46 2014 +0530
Validate bench.out against a JSON schema
diff --git a/benchtests/Makefile b/benchtests/Makefile
index a43a754..a6647fa 100644
--- a/benchtests/Makefile
+++ b/benchtests/Makefile
@@ -136,6 +136,8 @@ bench-func: $(binaries-bench)
mv -f $(objpfx)bench.out $(objpfx)bench.out.old; \
fi; \
mv -f $(objpfx)bench.out-tmp $(objpfx)bench.out
+ $(.)scripts/validate_benchout.py $(objpfx)bench.out \
+ $(.)scripts/benchout.schema.json
$(binaries-bench) $(binaries-benchset): %: %.o \
$(sort $(filter $(common-objpfx)lib%,$(link-libc))) \
diff --git a/benchtests/scripts/benchout.schema.json b/benchtests/scripts/benchout.schema.json
new file mode 100644
index 0000000..3a6c5cd
--- /dev/null
+++ b/benchtests/scripts/benchout.schema.json
@@ -0,0 +1,57 @@
+{
+ "title": "benchmark",
+ "type": "object",
+ "properties": {
+ "machine": {
+ "type": "object",
+ "properties": {
+ "vendor-id": {"type": "string"},
+ "cpu-family": {"type": "number"},
+ "model": {"type": "number"},
+ "cpu-cores": {"type": "number"},
+ "processors": {"type": "number"},
+ "cache-size": {"type": "number"},
+ "memory": {"type": "number"},
+ "swap": {"type": "number"}
+ },
+ "required": ["vendor-id", "cpu-family", "model", "cpu-cores",
+ "processors", "cache-size", "memory", "swap"]
+ },
+ "functions": {
+ "title": "Associative array of functions",
+ "type": "object",
+ "patternProperties": {
+ "^[_a-zA-Z][_a-zA-Z0-9]+$": {
+ "title": "Function names",
+ "type": "object",
+ "properties": {
+ "timing-type": {"type": "string"}
+ },
+ "required": ["timing-type"],
+ "patternProperties": {
+ "^[_a-zA-Z0-9]*$": {
+ "title": "Function variants",
+ "type": "object",
+ "properties": {
+ "duration": {"type": "number"},
+ "iterations": {"type": "number"},
+ "max": {"type": "number"},
+ "min": {"type": "number"},
+ "timings": {
+ "type": "array",
+ "items": {"type": "number"}
+ }
+ },
+ "required": ["duration", "iterations", "max", "min"],
+ "additionalProperties": false
+ }
+ },
+ "additionalProperties": false
+ }
+ },
+ "minProperties": 1
+ }
+ },
+ "required": ["machine", "functions"],
+ "additionalProperties": false
+}
diff --git a/benchtests/scripts/validate_benchout.py b/benchtests/scripts/validate_benchout.py
new file mode 100755
index 0000000..b6a34e2
--- /dev/null
+++ b/benchtests/scripts/validate_benchout.py
@@ -0,0 +1,78 @@
+#!/usr/bin/python
+# Copyright (C) 2014 Free Software Foundation, Inc.
+# This file is part of the GNU C Library.
+#
+# The GNU C Library is free software; you can redistribute it and/or
+# modify it under the terms of the GNU Lesser General Public
+# License as published by the Free Software Foundation; either
+# version 2.1 of the License, or (at your option) any later version.
+#
+# The GNU C Library is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
+# Lesser General Public License for more details.
+#
+# You should have received a copy of the GNU Lesser General Public
+# License along with the GNU C Library; if not, see
+# <http://www.gnu.org/licenses/>.
+"""Benchmark output validator
+
+Given a benchmark output file in json format and a benchmark schema file,
+validate the output against the schema.
+"""
+
+from __future__ import print_function
+import jsonschema
+import json
+import sys
+import os
+
+
+def validate_bench(benchfile, schemafile):
+ """Validate benchmark file
+
+ Validate a benchmark output file against a JSON schema.
+
+ Args:
+ benchfile: The file name of the bench.out file.
+ schemafile: The file name of the JSON schema file to validate
+ bench.out against.
+
+ Exceptions:
+ jsonschema.ValidationError: When bench.out is not valid
+ jsonschema.SchemaError: When the JSON schema is not valid
+ IOError: If any of the files are not found.
+ """
+ with open(benchfile, 'r') as bfile:
+ with open(schemafile, 'r') as sfile:
+ bench = json.load(bfile)
+ schema = json.load(sfile)
+ jsonschema.validate(bench, schema)
+
+ # If we reach here, we're all good.
+ print("Benchmark output in %s is valid." % benchfile)
+
+
+def main(args):
+ """Main entry point
+
+ Args:
+ args: The command line arguments to the program
+
+ Returns:
+ 0 on success or a non-zero failure code
+
+ Exceptions:
+ Exceptions thrown by validate_bench
+ """
+ if len(args) != 2:
+ print("Usage: %s <bench.out file> <bench.out schema>" % sys.argv[0],
+ file=sys.stderr)
+ return os.EX_USAGE
+
+ validate_bench(args[0], args[1])
+ return os.EX_OK
+
+
+if __name__ == '__main__':
+ sys.exit(main(sys.argv[1:]))
http://sourceware.org/git/gitweb.cgi?p=glibc.git;a=commitdiff;h=ca3e834f15af830ab6d240f3270f7e1a903ed3f8
commit ca3e834f15af830ab6d240f3270f7e1a903ed3f8
Author: Siddhesh Poyarekar <siddhesh@redhat.com>
Date: Wed Feb 5 15:57:22 2014 +0530
benchtests: move machine-info.sh into benchtests/scripts/
diff --git a/benchtests/Makefile b/benchtests/Makefile
index 57c40fe..a43a754 100644
--- a/benchtests/Makefile
+++ b/benchtests/Makefile
@@ -121,7 +121,7 @@ bench-set: $(binaries-benchset)
bench-func: $(binaries-bench)
{ echo "{"; \
echo " \"machine\":"; \
- ./machine-info.sh; \
+ $(.)scripts/machine-info.sh; \
echo " ,\"functions\": {"; \
for run in $^; do \
if ! [ "x$${run}" = "x$<" ]; then \
diff --git a/benchtests/machine-info.sh b/benchtests/scripts/machine-info.sh
similarity index 100%
rename from benchtests/machine-info.sh
rename to benchtests/scripts/machine-info.sh
http://sourceware.org/git/gitweb.cgi?p=glibc.git;a=commitdiff;h=706a60f32d8cf683841ae51693f5e551436c82fc
commit 706a60f32d8cf683841ae51693f5e551436c82fc
Author: Siddhesh Poyarekar <siddhesh@redhat.com>
Date: Wed Feb 5 15:55:10 2014 +0530
benchtests: Move bench.py to benchtests/scripts/
diff --git a/benchtests/Makefile b/benchtests/Makefile
index 0886a45..57c40fe 100644
--- a/benchtests/Makefile
+++ b/benchtests/Makefile
@@ -146,5 +146,5 @@ $(objpfx)bench-%.c: %-inputs $(bench-deps)
{ if [ -n "$($*-INCLUDE)" ]; then \
cat $($*-INCLUDE); \
fi; \
- $(..)scripts/bench.py $(patsubst %-inputs,%,$<); } > $@-tmp
+ $(.)scripts/bench.py $(patsubst %-inputs,%,$<); } > $@-tmp
mv -f $@-tmp $@
diff --git a/scripts/bench.py b/benchtests/scripts/bench.py
similarity index 100%
rename from scripts/bench.py
rename to benchtests/scripts/bench.py
http://sourceware.org/git/gitweb.cgi?p=glibc.git;a=commitdiff;h=6e830a79dfc66f8c9b6ae49c1235ce40e4bc0328
commit 6e830a79dfc66f8c9b6ae49c1235ce40e4bc0328
Author: Siddhesh Poyarekar <siddhesh@redhat.com>
Date: Wed Feb 5 15:50:31 2014 +0530
benchtests: Mention a constraint on a valid variant name
diff --git a/benchtests/README b/benchtests/README
index 2a940fa..ebccaf7 100644
--- a/benchtests/README
+++ b/benchtests/README
@@ -78,7 +78,8 @@ the same file by using the `name' directive that looks something like this:
##name: 240bit
See the pow-inputs file for an example of what such a partitioned input file
-would look like.
+would look like. The valid value is a string that can contain numbers,
+alphabets and underscores.
Benchmark Sets:
==============
http://sourceware.org/git/gitweb.cgi?p=glibc.git;a=commitdiff;h=9c259cce38ee580737bde71c54aa400bb261342a
commit 9c259cce38ee580737bde71c54aa400bb261342a
Author: Siddhesh Poyarekar <siddhesh@redhat.com>
Date: Tue Feb 4 21:31:23 2014 +0530
Actually do json output
diff --git a/benchtests/Makefile b/benchtests/Makefile
index 0e0704a..0886a45 100644
--- a/benchtests/Makefile
+++ b/benchtests/Makefile
@@ -114,13 +114,23 @@ bench-set: $(binaries-benchset)
$(run-bench) > $${run}.out; \
done
+# Build and execute the benchmark functions. This target generates JSON
+# formatted bench.out. Each of the programs produce independent JSON output,
+# so one could even execute them individually and process it using any JSON
+# capable language or tool.
bench-func: $(binaries-bench)
{ echo "{"; \
+ echo " \"machine\":"; \
./machine-info.sh; \
+ echo " ,\"functions\": {"; \
for run in $^; do \
+ if ! [ "x$${run}" = "x$<" ]; then \
+ echo ","; \
+ fi; \
echo "Running $${run}" >&2; \
$(run-bench) $(DETAILED_OPT); \
done; \
+ echo " }"; \
echo "}"; } > $(objpfx)bench.out-tmp; \
if [ -f $(objpfx)bench.out ]; then \
mv -f $(objpfx)bench.out $(objpfx)bench.out.old; \
diff --git a/benchtests/bench-skeleton.c b/benchtests/bench-skeleton.c
index 1a124a2..656d508 100644
--- a/benchtests/bench-skeleton.c
+++ b/benchtests/bench-skeleton.c
@@ -64,11 +64,13 @@ main (int argc, char **argv)
iters = 1000 * res;
- if (detailed)
- printf ("%s\n", FUNCNAME);
+ /* Begin function. */
+ printf ("\"%s\": {\n", FUNCNAME);
+ printf ("\"timing-type\": \"%s\"\n", TIMING_TYPE);
for (int v = 0; v < NUM_VARIANTS; v++)
{
+ putc (',', stdout);
/* Run for approximately DURATION seconds. */
clock_gettime (CLOCK_MONOTONIC_RAW, &runtime);
runtime.tv_sec += DURATION;
@@ -117,18 +119,27 @@ main (int argc, char **argv)
d_total_s = total;
d_iters = iters;
- if (!detailed)
- {
- TIMING_PRINT_STATS (VARIANT (v), d_total_s, d_iters, d_total_i, max,
- min);
- }
- else
+ printf ("\"%s\": {\n", VARIANT (v));
+ printf ("\"duration\": %g, \"iterations\": %g, "
+ "\"max\": %g, \"min\": %g\n",
+ d_total_s, d_total_i, max / d_iters, min / d_iters);
+
+ if (detailed)
{
- printf ("\t%s\n", VARIANT (v));
+ printf (",\n\"timings\": [");
for (int i = 0; i < NUM_SAMPLES (v); i++)
- printf ("\t\t%g\n", RESULT (v, i));
+ {
+ if (i > 0)
+ putc (',', stdout);
+ printf ("%g", RESULT (v, i));
+ }
+ puts ("]");
}
+ puts ("}");
}
+ /* End function. */
+ puts ("}");
+
return 0;
}
diff --git a/benchtests/bench-timing.h b/benchtests/bench-timing.h
index 13fc946..ccde601 100644
--- a/benchtests/bench-timing.h
+++ b/benchtests/bench-timing.h
@@ -25,6 +25,8 @@
hp_timing_t _dl_hp_timing_overhead;
typedef hp_timing_t timing_t;
+# define TIMING_TYPE "hp_timing"
+
# define TIMING_INIT(res) \
({ \
HP_TIMING_DIFF_INIT(); \
@@ -35,16 +37,13 @@ typedef hp_timing_t timing_t;
# define TIMING_DIFF(diff, start, end) HP_TIMING_DIFF ((diff), (start), (end))
# define TIMING_ACCUM(sum, diff) HP_TIMING_ACCUM_NT ((sum), (diff))
-# define TIMING_PRINT_STATS(func, d_total_s, d_iters, d_total_i, max, min) \
- printf ("%s: ITERS:%g: TOTAL:%gMcy, MAX:%gcy, MIN:%gcy, %g calls/Mcy\n", \
- (func), (d_total_i), (d_total_s) * 1e-6, (max) / (d_iters), \
- (min) / (d_iters), 1e6 * (d_total_i) / (d_total_s));
-
#else
#include <time.h>
typedef uint64_t timing_t;
+# define TIMING_TYPE "clock_gettime"
+
/* Measure the resolution of the clock so we can scale the number of
benchmark iterations by this value. */
# define TIMING_INIT(res) \
@@ -64,11 +63,6 @@ typedef uint64_t timing_t;
# define TIMING_DIFF(diff, start, end) (diff) = (end) - (start)
# define TIMING_ACCUM(sum, diff) (sum) += (diff)
-# define TIMING_PRINT_STATS(func, d_total_s, d_iters, d_total_i, max, min) \
- printf ("%s: ITERS:%g: TOTAL:%gs, MAX:%gns, MIN:%gns, %g iter/s\n", \
- (func), (d_total_i), (d_total_s) * 1e-9, (max) / (d_iters), \
- (min) / (d_iters), 1e9 * (d_total_i) / (d_total_s))
-
#endif
#define TIMING_PRINT_MEAN(d_total_s, d_iters) \
diff --git a/benchtests/machine-info.sh b/benchtests/machine-info.sh
index 041da30..3e51f1c 100755
--- a/benchtests/machine-info.sh
+++ b/benchtests/machine-info.sh
@@ -1,12 +1,14 @@
#!/bin/sh
# Simple script to get some basic machine information
-sed -n -e 's/vendor_id[ \t]\+:\(.*\)/ "vendor-id": \1,/p' \
- -e 's/cpu family[ \t]\+:\(.*\)/ "cpu-family": \1,/p' \
- -e 's/\(model\)[ \t]\+:\(.*\)/ "\1": \1,/p' \
- -e 's/cpu cores[ \t]\+:\(.*\)/ "cpu-cores": \1,/p' \
- -e 's/cache size[ \t]\+:\([0-9]\+\).*/ "cache-size": \1,/p' \
+echo "{"
+sed -n -e 's/vendor_id[ \t]\+: \(.*\)/ "vendor-id": "\1",/p' \
+ -e 's/cpu family[ \t]\+: \(.*\)/ "cpu-family": \1,/p' \
+ -e 's/\(model\)[ \t]\+: \(.*\)/ "\1": \2,/p' \
+ -e 's/cpu cores[ \t]\+: \(.*\)/ "cpu-cores": \1,/p' \
+ -e 's/cache size[ \t]\+: \([0-9]\+\).*/ "cache-size": \1,/p' \
-e 's/MemTotal:[ \t]\+\([0-9]\+\).*/ "memory": \1,/p' \
-e 's/SwapTotal:[ \t]\+\([0-9]\+\).*/ "swap": \1,/p' \
/proc/cpuinfo /proc/meminfo | sort -u
-echo " \"processors\": $(grep -c 'processor' /proc/cpuinfo),"
+echo " \"processors\": $(grep -c 'processor' /proc/cpuinfo)"
+echo "}"
diff --git a/scripts/bench.py b/scripts/bench.py
index 11f616f..2a5d250 100755
--- a/scripts/bench.py
+++ b/scripts/bench.py
@@ -176,7 +176,7 @@ def _print_arg_data(func, directives, all_vals):
# Members for the variants structure list that we will
# print later.
- variants.append(' {"%s(%s)", %d, in%d},' % (func, k, len(vals), i))
+ variants.append(' {"%s", %d, in%d},' % (k, len(vals), i))
print(ARGS_TEMPLATE % {'argnum': i, 'num_args': len(vals),
'args': '\n'.join(out)})
http://sourceware.org/git/gitweb.cgi?p=glibc.git;a=commitdiff;h=909a952c995852c8193dabf306ac2d51d3418fd0
commit 909a952c995852c8193dabf306ac2d51d3418fd0
Author: David Holsgrove <david.holsgrove@xilinx.com>
Date: Tue Feb 4 09:30:34 2014 +1000
microblaze: Update libm-test-ulps
Update libm-test-ulps for microblaze, and remove unneeded copy
libm-test-ulps_new.
ports/ChangeLog.microblaze
2014-02-04 David Holsgrove <david.holsgrove@xilinx.com>
* sysdeps/microblaze/libm-test-ulps: Update.
* sysdeps/microblaze/libm-test-ulps_new: Deleted redundant file.
Signed-off-by: David Holsgrove <david.holsgrove@xilinx.com>
diff --git a/ports/ChangeLog.microblaze b/ports/ChangeLog.microblaze
index 93c311e..6a25659 100644
--- a/ports/ChangeLog.microblaze
+++ b/ports/ChangeLog.microblaze
@@ -1,5 +1,10 @@
2014-02-04 David Holsgrove <david.holsgrove@xilinx.com>
+ * sysdeps/microblaze/libm-test-ulps: Update.
+ * sysdeps/microblaze/libm-test-ulps_new: Delete redundant file.
+
+2014-02-04 David Holsgrove <david.holsgrove@xilinx.com>
+
[BZ #15705]
* sysdeps/unix/sysv/linux/microblaze/mmap64.c: New file.
diff --git a/ports/sysdeps/microblaze/libm-test-ulps b/ports/sysdeps/microblaze/libm-test-ulps
index 9820f51..60bdc47 100644
--- a/ports/sysdeps/microblaze/libm-test-ulps
+++ b/ports/sysdeps/microblaze/libm-test-ulps
@@ -1,21 +1,52 @@
# Begin of automatic generation
+# acosh
+Test "acosh (0x6.4p+4)":
+double: 1
+idouble: 1
+Test "acosh (0xf.ffffffffffff8p+1020)":
+double: 1
+
+# asinh
+Test "asinh (-0xf.ffffffffffff8p+1020)":
+double: 1
+Test "asinh (0xap+0)":
+float: 1
+ifloat: 1
+Test "asinh (0xf.ffffffffffff8p+1020)":
+double: 1
+
# atan2
-Test "atan2 (-0.75, -1.0)":
+Test "atan2 (-0x1.effe82p-8, -0x7.57d1d8p-12)":
float: 1
ifloat: 1
-Test "atan2 (-max_value, -min_value)":
+Test "atan2 (-0xcp-4, -0x1p+0)":
float: 1
ifloat: 1
-Test "atan2 (0.75, -1.0)":
+Test "atan2 (-0xf.fffffp+124, -0x4p-128)":
float: 1
ifloat: 1
-Test "atan2 (1.390625, 0.9296875)":
+Test "atan2 (-0xf.fffffp+124, -0x8p-152)":
+float: 1
+ifloat: 1
+Test "atan2 (0x1.64p+0, 0xe.ep-4)":
+float: 1
+ifloat: 1
+Test "atan2 (0xcp-4, -0x1p+0)":
+float: 1
+ifloat: 1
+Test "atan2 (0xf.fffffp+124, -0x4p-128)":
+float: 1
+ifloat: 1
+Test "atan2 (0xf.fffffp+124, -0x8p-152)":
float: 1
ifloat: 1
# atanh
-Test "atanh (0.75)":
+Test "atanh (-0xcp-4)":
+float: 1
+ifloat: 1
+Test "atanh (0xcp-4)":
float: 1
ifloat: 1
@@ -64,27 +95,619 @@ ifloat: 1
Test "Imaginary part of: cacos (-0 - 1.5 i)":
double: 1
idouble: 1
+Test "Real part of: cacos (-0.25 + 1.0 i)":
+double: 1
+float: 1
+idouble: 1
+ifloat: 1
+Test "Imaginary part of: cacos (-0.25 + 1.0 i)":
+float: 1
+ifloat: 1
+Test "Real part of: cacos (-0.25 - 1.0 i)":
+double: 1
+float: 1
+idouble: 1
+ifloat: 1
+Test "Imaginary part of: cacos (-0.25 - 1.0 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cacos (-0.5 + 0x1.fp-129 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: cacos (-0.5 + 0x1p-105 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: cacos (-0.5 + 0x1p-112 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: cacos (-0.5 + 0x1p-23 i)":
+double: 1
+idouble: 1
+Test "Real part of: cacos (-0.5 + 1.0 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cacos (-0.5 + 1.0 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: cacos (-0.5 - 0x1.fp-129 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: cacos (-0.5 - 0x1p-105 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: cacos (-0.5 - 0x1p-112 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: cacos (-0.5 - 0x1p-23 i)":
+double: 1
+idouble: 1
+Test "Real part of: cacos (-0.5 - 1.0 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cacos (-0.5 - 1.0 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: cacos (-0x0.fffffffffffff8p0 + 0x1p-52 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: cacos (-0x0.fffffffffffff8p0 - 0x1p-52 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: cacos (-0x0.ffffffp0 + 0x1p-23 i)":
+float: 2
+ifloat: 2
+Test "Imaginary part of: cacos (-0x0.ffffffp0 - 0x1p-23 i)":
+float: 2
+ifloat: 2
+Test "Imaginary part of: cacos (-0x1.000002p0 + 0x1p-23 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cacos (-0x1.000002p0 - 0x1p-23 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cacos (-0x1.fp-10 + 1.0 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: cacos (-0x1.fp-10 - 1.0 i)":
+double: 1
+idouble: 1
+Test "Real part of: cacos (-0x1.fp-100 + 1.0 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cacos (-0x1.fp-100 + 1.0 i)":
+double: 1
+float: 1
+idouble: 1
+ifloat: 1
+Test "Real part of: cacos (-0x1.fp-100 - 1.0 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cacos (-0x1.fp-100 - 1.0 i)":
+double: 1
+float: 1
+idouble: 1
+ifloat: 1
+Test "Imaginary part of: cacos (-0x1.fp-1000 + 1.0 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: cacos (-0x1.fp-1000 - 1.0 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: cacos (-0x1.fp-1025 + 1.0 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: cacos (-0x1.fp-1025 + 1.5 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: cacos (-0x1.fp-1025 - 1.0 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: cacos (-0x1.fp-1025 - 1.5 i)":
+double: 1
+idouble: 1
+Test "Real part of: cacos (-0x1.fp-129 + 0.5 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cacos (-0x1.fp-129 + 0.5 i)":
+float: 1
+ifloat: 1
+Test "Real part of: cacos (-0x1.fp-129 + 0x0.ffffffp0 i)":
+float: 1
+ifloat: 1
+Test "Real part of: cacos (-0x1.fp-129 + 0x1.000002p0 i)":
+float: 1
+ifloat: 1
+Test "Real part of: cacos (-0x1.fp-129 + 0x1.fp-129 i)":
+float: 1
+ifloat: 1
+Test "Real part of: cacos (-0x1.fp-129 + 0x1p-23 i)":
+float: 1
+ifloat: 1
+Test "Real part of: cacos (-0x1.fp-129 + 1.0 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cacos (-0x1.fp-129 + 1.0 i)":
+double: 1
+float: 1
+idouble: 1
+ifloat: 1
+Test "Real part of: cacos (-0x1.fp-129 + 1.5 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cacos (-0x1.fp-129 + 1.5 i)":
+double: 1
+idouble: 1
+Test "Real part of: cacos (-0x1.fp-129 - 0.5 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cacos (-0x1.fp-129 - 0.5 i)":
+float: 1
+ifloat: 1
+Test "Real part of: cacos (-0x1.fp-129 - 0x0.ffffffp0 i)":
+float: 1
+ifloat: 1
+Test "Real part of: cacos (-0x1.fp-129 - 0x1.000002p0 i)":
+float: 1
+ifloat: 1
+Test "Real part of: cacos (-0x1.fp-129 - 0x1.fp-129 i)":
+float: 1
+ifloat: 1
+Test "Real part of: cacos (-0x1.fp-129 - 0x1p-23 i)":
+float: 1
+ifloat: 1
+Test "Real part of: cacos (-0x1.fp-129 - 1.0 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cacos (-0x1.fp-129 - 1.0 i)":
+double: 1
+float: 1
+idouble: 1
+ifloat: 1
+Test "Real part of: cacos (-0x1.fp-129 - 1.5 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cacos (-0x1.fp-129 - 1.5 i)":
+double: 1
+idouble: 1
+Test "Real part of: cacos (-0x1.fp-30 + 1.0 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cacos (-0x1.fp-30 + 1.0 i)":
+double: 1
+float: 1
+idouble: 1
+ifloat: 1
+Test "Real part of: cacos (-0x1.fp-30 - 1.0 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cacos (-0x1.fp-30 - 1.0 i)":
+double: 1
+float: 1
+idouble: 1
+ifloat: 1
+Test "Real part of: cacos (-0x1p-105 + 0.0 i)":
+float: 1
+ifloat: 1
+Test "Real part of: cacos (-0x1p-105 + 0.5 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cacos (-0x1p-105 + 0.5 i)":
+float: 1
+ifloat: 1
+Test "Real part of: cacos (-0x1p-105 + 0x1p-105 i)":
+float: 1
+ifloat: 1
+Test "Real part of: cacos (-0x1p-105 - 0.0 i)":
+float: 1
+ifloat: 1
+Test "Real part of: cacos (-0x1p-105 - 0.5 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cacos (-0x1p-105 - 0.5 i)":
+float: 1
+ifloat: 1
+Test "Real part of: cacos (-0x1p-105 - 0x1p-105 i)":
+float: 1
+ifloat: 1
+Test "Real part of: cacos (-0x1p-112 + 0.0 i)":
+float: 1
+ifloat: 1
+Test "Real part of: cacos (-0x1p-112 + 0.5 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cacos (-0x1p-112 + 0.5 i)":
+float: 1
+ifloat: 1
+Test "Real part of: cacos (-0x1p-112 + 0x1p-112 i)":
+float: 1
+ifloat: 1
+Test "Real part of: cacos (-0x1p-112 - 0.0 i)":
+float: 1
+ifloat: 1
+Test "Real part of: cacos (-0x1p-112 - 0.5 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cacos (-0x1p-112 - 0.5 i)":
+float: 1
+ifloat: 1
+Test "Real part of: cacos (-0x1p-112 - 0x1p-112 i)":
+float: 1
+ifloat: 1
+Test "Real part of: cacos (-0x1p-23 + 0.0 i)":
+float: 1
+ifloat: 1
+Test "Real part of: cacos (-0x1p-23 + 0.5 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cacos (-0x1p-23 + 0.5 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cacos (-0x1p-23 + 0x0.ffffffp0 i)":
+double: 1
+idouble: 1
+Test "Real part of: cacos (-0x1p-23 + 0x1.fp-129 i)":
+float: 1
+ifloat: 1
+Test "Real part of: cacos (-0x1p-23 + 0x1p-23 i)":
+float: 1
+ifloat: 1
+Test "Real part of: cacos (-0x1p-23 - 0.0 i)":
+float: 1
+ifloat: 1
+Test "Real part of: cacos (-0x1p-23 - 0.5 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cacos (-0x1p-23 - 0.5 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cacos (-0x1p-23 - 0x0.ffffffp0 i)":
+double: 1
+idouble: 1
+Test "Real part of: cacos (-0x1p-23 - 0x1.fp-129 i)":
+float: 1
+ifloat: 1
+Test "Real part of: cacos (-0x1p-23 - 0x1p-23 i)":
+float: 1
+ifloat: 1
+Test "Real part of: cacos (-0x1p-52 + 0.0 i)":
+float: 1
+ifloat: 1
+Test "Real part of: cacos (-0x1p-52 + 0.5 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cacos (-0x1p-52 + 0.5 i)":
+float: 1
+ifloat: 1
+Test "Real part of: cacos (-0x1p-52 + 0x1p-52 i)":
+float: 1
+ifloat: 1
+Test "Real part of: cacos (-0x1p-52 - 0.0 i)":
+float: 1
+ifloat: 1
+Test "Real part of: cacos (-0x1p-52 - 0.5 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cacos (-0x1p-52 - 0.5 i)":
+float: 1
+ifloat: 1
+Test "Real part of: cacos (-0x1p-52 - 0x1p-52 i)":
+float: 1
+ifloat: 1
+Test "Real part of: cacos (-0x1p-63 + 0.0 i)":
+float: 1
+ifloat: 1
+Test "Real part of: cacos (-0x1p-63 + 0.5 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cacos (-0x1p-63 + 0.5 i)":
+float: 1
+ifloat: 1
+Test "Real part of: cacos (-0x1p-63 + 0x1p-63 i)":
+float: 1
+ifloat: 1
+Test "Real part of: cacos (-0x1p-63 - 0.0 i)":
+float: 1
+ifloat: 1
+Test "Real part of: cacos (-0x1p-63 - 0.5 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cacos (-0x1p-63 - 0.5 i)":
+float: 1
+ifloat: 1
+Test "Real part of: cacos (-0x1p-63 - 0x1p-63 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cacos (-1.0 + 0.5 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cacos (-1.0 + 0x1.fp-10 i)":
+float: 1
+ifloat: 1
Test "Real part of: cacos (-1.0 + 0x1p50 i)":
float: 1
ifloat: 1
+Test "Imaginary part of: cacos (-1.0 - 0.5 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cacos (-1.0 - 0x1.fp-10 i)":
+float: 1
+ifloat: 1
Test "Real part of: cacos (-1.0 - 0x1p50 i)":
float: 1
ifloat: 1
Test "Real part of: cacos (-2 - 3 i)":
float: 1
ifloat: 1
+Test "Imaginary part of: cacos (0.25 + 1.0 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cacos (0.25 - 1.0 i)":
+float: 1
+ifloat: 1
Test "Real part of: cacos (0.5 + +0 i)":
double: 1
idouble: 1
+Test "Real part of: cacos (0.5 + 0x1.fp-1025 i)":
+double: 1
+idouble: 1
+Test "Real part of: cacos (0.5 + 0x1.fp-129 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: cacos (0.5 + 0x1.fp-129 i)":
+double: 1
+idouble: 1
+Test "Real part of: cacos (0.5 + 0x1p-105 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: cacos (0.5 + 0x1p-105 i)":
+double: 1
+idouble: 1
+Test "Real part of: cacos (0.5 + 0x1p-112 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: cacos (0.5 + 0x1p-112 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: cacos (0.5 + 0x1p-23 i)":
+double: 1
+idouble: 1
+Test "Real part of: cacos (0.5 + 0x1p-52 i)":
+double: 1
+idouble: 1
+Test "Real part of: cacos (0.5 + 0x1p-63 i)":
+double: 1
+idouble: 1
+Test "Real part of: cacos (0.5 + 1.0 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cacos (0.5 + 1.0 i)":
+double: 1
+idouble: 1
Test "Real part of: cacos (0.5 - 0 i)":
double: 1
idouble: 1
+Test "Real part of: cacos (0.5 - 0x1.fp-1025 i)":
+double: 1
+idouble: 1
+Test "Real part of: cacos (0.5 - 0x1.fp-129 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: cacos (0.5 - 0x1.fp-129 i)":
+double: 1
+idouble: 1
+Test "Real part of: cacos (0.5 - 0x1p-105 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: cacos (0.5 - 0x1p-105 i)":
+double: 1
+idouble: 1
+Test "Real part of: cacos (0.5 - 0x1p-112 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: cacos (0.5 - 0x1p-112 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: cacos (0.5 - 0x1p-23 i)":
+double: 1
+idouble: 1
+Test "Real part of: cacos (0.5 - 0x1p-52 i)":
+double: 1
+idouble: 1
+Test "Real part of: cacos (0.5 - 0x1p-63 i)":
+double: 1
+idouble: 1
+Test "Real part of: cacos (0.5 - 1.0 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cacos (0.5 - 1.0 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: cacos (0x0.fffffffffffff8p0 + 0x1p-52 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: cacos (0x0.fffffffffffff8p0 - 0x1p-52 i)":
+double: 1
+idouble: 1
+Test "Real part of: cacos (0x0.ffffffp0 + 0.0 i)":
+float: 1
+ifloat: 1
+Test "Real part of: cacos (0x0.ffffffp0 + 0x1.fp-129 i)":
+float: 1
+ifloat: 1
+Test "Real part of: cacos (0x0.ffffffp0 + 0x1p-23 i)":
+float: 2
+ifloat: 2
+Test "Imaginary part of: cacos (0x0.ffffffp0 + 0x1p-23 i)":
+float: 2
+ifloat: 2
+Test "Real part of: cacos (0x0.ffffffp0 - 0.0 i)":
+float: 1
+ifloat: 1
+Test "Real part of: cacos (0x0.ffffffp0 - 0x1.fp-129 i)":
+float: 1
+ifloat: 1
+Test "Real part of: cacos (0x0.ffffffp0 - 0x1p-23 i)":
+float: 2
+ifloat: 2
+Test "Imaginary part of: cacos (0x0.ffffffp0 - 0x1p-23 i)":
+float: 2
+ifloat: 2
+Test "Real part of: cacos (0x1.0000000000001p0 + 0x1p-52 i)":
+double: 1
+idouble: 1
+Test "Real part of: cacos (0x1.0000000000001p0 - 0x1p-52 i)":
+double: 1
+idouble: 1
+Test "Real part of: cacos (0x1.000002p0 + 0x1p-23 i)":
+float: 2
+ifloat: 2
+Test "Imaginary part of: cacos (0x1.000002p0 + 0x1p-23 i)":
+float: 1
+ifloat: 1
+Test "Real part of: cacos (0x1.000002p0 - 0x1p-23 i)":
+float: 2
+ifloat: 2
+Test "Imaginary part of: cacos (0x1.000002p0 - 0x1p-23 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cacos (0x1.fp-10 + 1.0 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: cacos (0x1.fp-10 - 1.0 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: cacos (0x1.fp-100 + 1.0 i)":
+double: 1
+float: 1
+idouble: 1
+ifloat: 1
+Test "Imaginary part of: cacos (0x1.fp-100 - 1.0 i)":
+double: 1
+float: 1
+idouble: 1
+ifloat: 1
+Test "Imaginary part of: cacos (0x1.fp-1000 + 1.0 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: cacos (0x1.fp-1000 - 1.0 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: cacos (0x1.fp-1025 + 1.0 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: cacos (0x1.fp-1025 + 1.5 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: cacos (0x1.fp-1025 - 1.0 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: cacos (0x1.fp-1025 - 1.5 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: cacos (0x1.fp-129 + 0.5 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cacos (0x1.fp-129 + 1.0 i)":
+double: 1
+float: 1
+idouble: 1
+ifloat: 1
+Test "Imaginary part of: cacos (0x1.fp-129 + 1.5 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: cacos (0x1.fp-129 - 0.5 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cacos (0x1.fp-129 - 1.0 i)":
+double: 1
+float: 1
+idouble: 1
+ifloat: 1
+Test "Imaginary part of: cacos (0x1.fp-129 - 1.5 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: cacos (0x1.fp-30 + 1.0 i)":
+double: 1
+float: 1
+idouble: 1
+ifloat: 1
+Test "Imaginary part of: cacos (0x1.fp-30 - 1.0 i)":
+double: 1
+float: 1
+idouble: 1
+ifloat: 1
Test "Imaginary part of: cacos (0x1.fp1023 + 0x1.fp1023 i)":
double: 1
idouble: 1
Test "Imaginary part of: cacos (0x1.fp127 + 0x1.fp127 i)":
double: 1
idouble: 1
+Test "Imaginary part of: cacos (0x1p-105 + 0.5 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cacos (0x1p-105 - 0.5 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cacos (0x1p-112 + 0.5 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cacos (0x1p-112 - 0.5 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cacos (0x1p-23 + 0.5 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cacos (0x1p-23 + 0x0.ffffffp0 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: cacos (0x1p-23 - 0.5 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cacos (0x1p-23 - 0x0.ffffffp0 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: cacos (0x1p-52 + 0.5 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cacos (0x1p-52 - 0.5 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cacos (0x1p-63 + 0.5 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cacos (0x1p-63 - 0.5 i)":
+float: 1
+ifloat: 1
+Test "Real part of: cacos (1.0 + 0.25 i)":
+double: 1
+idouble: 1
+Test "Real part of: cacos (1.0 + 0.5 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cacos (1.0 + 0.5 i)":
+float: 1
+ifloat: 1
+Test "Real part of: cacos (1.0 + 0x1.fp-10 i)":
+float: 2
+ifloat: 2
+Test "Imaginary part of: cacos (1.0 + 0x1.fp-10 i)":
+float: 1
+ifloat: 1
+Test "Real part of: cacos (1.0 - 0.25 i)":
+double: 1
+idouble: 1
+Test "Real part of: cacos (1.0 - 0.5 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cacos (1.0 - 0.5 i)":
+float: 1
+ifloat: 1
+Test "Real part of: cacos (1.0 - 0x1.fp-10 i)":
+float: 2
+ifloat: 2
+Test "Imaginary part of: cacos (1.0 - 0x1.fp-10 i)":
+float: 1
+ifloat: 1
# cacosh
Test "Real part of: cacosh (+0 + 0.5 i)":
@@ -131,27 +754,619 @@ ifloat: 1
Test "Real part of: cacosh (-0 - 1.5 i)":
double: 1
idouble: 1
-Test "Imaginary part of: cacosh (-0.5 + +0 i)":
+Test "Real part of: cacosh (-0.25 + 1.0 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cacosh (-0.25 + 1.0 i)":
+double: 1
+float: 1
+idouble: 1
+ifloat: 1
+Test "Real part of: cacosh (-0.25 - 1.0 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cacosh (-0.25 - 1.0 i)":
+double: 1
+float: 1
+idouble: 1
+ifloat: 1
+Test "Real part of: cacosh (-0.5 + 0x1.fp-129 i)":
+double: 1
+idouble: 1
+Test "Real part of: cacosh (-0.5 + 0x1p-105 i)":
+double: 1
+idouble: 1
+Test "Real part of: cacosh (-0.5 + 0x1p-112 i)":
double: 1
idouble: 1
-Test "Imaginary part of: cacosh (-0.5 - 0 i)":
+Test "Real part of: cacosh (-0.5 + 0x1p-23 i)":
double: 1
idouble: 1
-Test "Real part of: cacosh (-1.5 + +0 i)":
+Test "Real part of: cacosh (-0.5 + 1.0 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: cacosh (-0.5 + 1.0 i)":
float: 1
ifloat: 1
-Test "Real part of: cacosh (-1.5 - 0 i)":
+Test "Real part of: cacosh (-0.5 - 0x1.fp-129 i)":
+double: 1
+idouble: 1
+Test "Real part of: cacosh (-0.5 - 0x1p-105 i)":
+double: 1
+idouble: 1
+Test "Real part of: cacosh (-0.5 - 0x1p-112 i)":
+double: 1
+idouble: 1
+Test "Real part of: cacosh (-0.5 - 0x1p-23 i)":
+double: 1
+idouble: 1
+Test "Real part of: cacosh (-0.5 - 1.0 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: cacosh (-0.5 - 1.0 i)":
+float: 1
+ifloat: 1
+Test "Real part of: cacosh (-0x0.fffffffffffff8p0 + 0x1p-52 i)":
+double: 1
+idouble: 1
+Test "Real part of: cacosh (-0x0.fffffffffffff8p0 - 0x1p-52 i)":
+double: 1
+idouble: 1
+Test "Real part of: cacosh (-0x0.ffffffp0 + 0x1p-23 i)":
+float: 2
+ifloat: 2
+Test "Real part of: cacosh (-0x0.ffffffp0 - 0x1p-23 i)":
+float: 2
+ifloat: 2
+Test "Real part of: cacosh (-0x1.000002p0 + 0x1p-23 i)":
+float: 1
+ifloat: 1
+Test "Real part of: cacosh (-0x1.000002p0 - 0x1p-23 i)":
+float: 1
+ifloat: 1
+Test "Real part of: cacosh (-0x1.fp-10 + 1.0 i)":
+double: 1
+idouble: 1
+Test "Real part of: cacosh (-0x1.fp-10 - 1.0 i)":
+double: 1
+idouble: 1
+Test "Real part of: cacosh (-0x1.fp-100 + 1.0 i)":
+double: 1
+float: 1
+idouble: 1
+ifloat: 1
+Test "Imaginary part of: cacosh (-0x1.fp-100 + 1.0 i)":
+float: 1
+ifloat: 1
+Test "Real part of: cacosh (-0x1.fp-100 - 1.0 i)":
+double: 1
+float: 1
+idouble: 1
+ifloat: 1
+Test "Imaginary part of: cacosh (-0x1.fp-100 - 1.0 i)":
+float: 1
+ifloat: 1
+Test "Real part of: cacosh (-0x1.fp-1000 + 1.0 i)":
+double: 1
+idouble: 1
+Test "Real part of: cacosh (-0x1.fp-1000 - 1.0 i)":
+double: 1
+idouble: 1
+Test "Real part of: cacosh (-0x1.fp-1025 + 1.0 i)":
+double: 1
+idouble: 1
+Test "Real part of: cacosh (-0x1.fp-1025 + 1.5 i)":
+double: 1
+idouble: 1
+Test "Real part of: cacosh (-0x1.fp-1025 - 1.0 i)":
+double: 1
+idouble: 1
+Test "Real part of: cacosh (-0x1.fp-1025 - 1.5 i)":
+double: 1
+idouble: 1
+Test "Real part of: cacosh (-0x1.fp-129 + 0.5 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cacosh (-0x1.fp-129 + 0.5 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cacosh (-0x1.fp-129 + 0x0.ffffffp0 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cacosh (-0x1.fp-129 + 0x1.000002p0 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cacosh (-0x1.fp-129 + 0x1.fp-129 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cacosh (-0x1.fp-129 + 0x1p-23 i)":
+float: 1
+ifloat: 1
+Test "Real part of: cacosh (-0x1.fp-129 + 1.0 i)":
+double: 1
+float: 1
+idouble: 1
+ifloat: 1
+Test "Imaginary part of: cacosh (-0x1.fp-129 + 1.0 i)":
+float: 1
+ifloat: 1
+Test "Real part of: cacosh (-0x1.fp-129 + 1.5 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: cacosh (-0x1.fp-129 + 1.5 i)":
+float: 1
+ifloat: 1
+Test "Real part of: cacosh (-0x1.fp-129 - 0.5 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cacosh (-0x1.fp-129 - 0.5 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cacosh (-0x1.fp-129 - 0x0.ffffffp0 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cacosh (-0x1.fp-129 - 0x1.000002p0 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cacosh (-0x1.fp-129 - 0x1.fp-129 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cacosh (-0x1.fp-129 - 0x1p-23 i)":
+float: 1
+ifloat: 1
+Test "Real part of: cacosh (-0x1.fp-129 - 1.0 i)":
+double: 1
+float: 1
+idouble: 1
+ifloat: 1
+Test "Imaginary part of: cacosh (-0x1.fp-129 - 1.0 i)":
+float: 1
+ifloat: 1
+Test "Real part of: cacosh (-0x1.fp-129 - 1.5 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: cacosh (-0x1.fp-129 - 1.5 i)":
+float: 1
+ifloat: 1
+Test "Real part of: cacosh (-0x1.fp-30 + 1.0 i)":
+double: 1
+float: 1
+idouble: 1
+ifloat: 1
+Test "Imaginary part of: cacosh (-0x1.fp-30 + 1.0 i)":
+float: 1
+ifloat: 1
+Test "Real part of: cacosh (-0x1.fp-30 - 1.0 i)":
+double: 1
+float: 1
+idouble: 1
+ifloat: 1
+Test "Imaginary part of: cacosh (-0x1.fp-30 - 1.0 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cacosh (-0x1p-105 + 0.0 i)":
+float: 1
+ifloat: 1
+Test "Real part of: cacosh (-0x1p-105 + 0.5 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cacosh (-0x1p-105 + 0.5 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cacosh (-0x1p-105 + 0x1p-105 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cacosh (-0x1p-105 - 0.0 i)":
+float: 1
+ifloat: 1
+Test "Real part of: cacosh (-0x1p-105 - 0.5 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cacosh (-0x1p-105 - 0.5 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cacosh (-0x1p-105 - 0x1p-105 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cacosh (-0x1p-112 + 0.0 i)":
+float: 1
+ifloat: 1
+Test "Real part of: cacosh (-0x1p-112 + 0.5 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cacosh (-0x1p-112 + 0.5 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cacosh (-0x1p-112 + 0x1p-112 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cacosh (-0x1p-112 - 0.0 i)":
+float: 1
+ifloat: 1
+Test "Real part of: cacosh (-0x1p-112 - 0.5 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cacosh (-0x1p-112 - 0.5 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cacosh (-0x1p-112 - 0x1p-112 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cacosh (-0x1p-23 + 0.0 i)":
+float: 1
+ifloat: 1
+Test "Real part of: cacosh (-0x1p-23 + 0.5 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cacosh (-0x1p-23 + 0.5 i)":
+float: 1
+ifloat: 1
+Test "Real part of: cacosh (-0x1p-23 + 0x0.ffffffp0 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: cacosh (-0x1p-23 + 0x1.fp-129 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cacosh (-0x1p-23 + 0x1p-23 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cacosh (-0x1p-23 - 0.0 i)":
+float: 1
+ifloat: 1
+Test "Real part of: cacosh (-0x1p-23 - 0.5 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cacosh (-0x1p-23 - 0.5 i)":
+float: 1
+ifloat: 1
+Test "Real part of: cacosh (-0x1p-23 - 0x0.ffffffp0 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: cacosh (-0x1p-23 - 0x1.fp-129 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cacosh (-0x1p-23 - 0x1p-23 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cacosh (-0x1p-52 + 0.0 i)":
+float: 1
+ifloat: 1
+Test "Real part of: cacosh (-0x1p-52 + 0.5 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cacosh (-0x1p-52 + 0.5 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cacosh (-0x1p-52 + 0x1p-52 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cacosh (-0x1p-52 - 0.0 i)":
+float: 1
+ifloat: 1
+Test "Real part of: cacosh (-0x1p-52 - 0.5 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cacosh (-0x1p-52 - 0.5 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cacosh (-0x1p-52 - 0x1p-52 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cacosh (-0x1p-63 + 0.0 i)":
+float: 1
+ifloat: 1
+Test "Real part of: cacosh (-0x1p-63 + 0.5 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cacosh (-0x1p-63 + 0.5 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cacosh (-0x1p-63 + 0x1p-63 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cacosh (-0x1p-63 - 0.0 i)":
+float: 1
+ifloat: 1
+Test "Real part of: cacosh (-0x1p-63 - 0.5 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cacosh (-0x1p-63 - 0.5 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cacosh (-0x1p-63 - 0x1p-63 i)":
+float: 1
+ifloat: 1
+Test "Real part of: cacosh (-1.0 + 0.5 i)":
+float: 1
+ifloat: 1
+Test "Real part of: cacosh (-1.0 + 0x1.fp-10 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cacosh (-1.0 + 0x1p50 i)":
+float: 1
+ifloat: 1
+Test "Real part of: cacosh (-1.0 - 0.5 i)":
+float: 1
+ifloat: 1
+Test "Real part of: cacosh (-1.0 - 0x1.fp-10 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cacosh (-1.0 - 0x1p50 i)":
float: 1
ifloat: 1
Test "Imaginary part of: cacosh (-2 - 3 i)":
float: 1
ifloat: 1
-Test "Real part of: cacosh (1.5 + +0 i)":
+Test "Real part of: cacosh (0.25 + 1.0 i)":
+float: 1
+ifloat: 1
+Test "Real part of: cacosh (0.25 - 1.0 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cacosh (0.5 + +0 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: cacosh (0.5 + 0x1.fp-1025 i)":
+double: 1
+idouble: 1
+Test "Real part of: cacosh (0.5 + 0x1.fp-129 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: cacosh (0.5 + 0x1.fp-129 i)":
+double: 1
+idouble: 1
+Test "Real part of: cacosh (0.5 + 0x1p-105 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: cacosh (0.5 + 0x1p-105 i)":
+double: 1
+idouble: 1
+Test "Real part of: cacosh (0.5 + 0x1p-112 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: cacosh (0.5 + 0x1p-112 i)":
+double: 1
+idouble: 1
+Test "Real part of: cacosh (0.5 + 0x1p-23 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: cacosh (0.5 + 0x1p-52 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: cacosh (0.5 + 0x1p-63 i)":
+double: 1
+idouble: 1
+Test "Real part of: cacosh (0.5 + 1.0 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: cacosh (0.5 + 1.0 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cacosh (0.5 - 0 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: cacosh (0.5 - 0x1.fp-1025 i)":
+double: 1
+idouble: 1
+Test "Real part of: cacosh (0.5 - 0x1.fp-129 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: cacosh (0.5 - 0x1.fp-129 i)":
+double: 1
+idouble: 1
+Test "Real part of: cacosh (0.5 - 0x1p-105 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: cacosh (0.5 - 0x1p-105 i)":
+double: 1
+idouble: 1
+Test "Real part of: cacosh (0.5 - 0x1p-112 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: cacosh (0.5 - 0x1p-112 i)":
+double: 1
+idouble: 1
+Test "Real part of: cacosh (0.5 - 0x1p-23 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: cacosh (0.5 - 0x1p-52 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: cacosh (0.5 - 0x1p-63 i)":
+double: 1
+idouble: 1
+Test "Real part of: cacosh (0.5 - 1.0 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: cacosh (0.5 - 1.0 i)":
+float: 1
+ifloat: 1
+Test "Real part of: cacosh (0x0.fffffffffffff8p0 + 0x1p-52 i)":
+double: 1
+idouble: 1
+Test "Real part of: cacosh (0x0.fffffffffffff8p0 - 0x1p-52 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: cacosh (0x0.ffffffp0 + 0.0 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cacosh (0x0.ffffffp0 + 0x1.fp-129 i)":
+float: 1
+ifloat: 1
+Test "Real part of: cacosh (0x0.ffffffp0 + 0x1p-23 i)":
+float: 2
+ifloat: 2
+Test "Imaginary part of: cacosh (0x0.ffffffp0 + 0x1p-23 i)":
+float: 2
+ifloat: 2
+Test "Imaginary part of: cacosh (0x0.ffffffp0 - 0.0 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cacosh (0x0.ffffffp0 - 0x1.fp-129 i)":
+float: 1
+ifloat: 1
+Test "Real part of: cacosh (0x0.ffffffp0 - 0x1p-23 i)":
+float: 2
+ifloat: 2
+Test "Imaginary part of: cacosh (0x0.ffffffp0 - 0x1p-23 i)":
+float: 2
+ifloat: 2
+Test "Imaginary part of: cacosh (0x1.0000000000001p0 + 0x1p-52 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: cacosh (0x1.0000000000001p0 - 0x1p-52 i)":
+double: 1
+idouble: 1
+Test "Real part of: cacosh (0x1.000002p0 + 0x1p-23 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cacosh (0x1.000002p0 + 0x1p-23 i)":
+float: 2
+ifloat: 2
+Test "Real part of: cacosh (0x1.000002p0 - 0x1p-23 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cacosh (0x1.000002p0 - 0x1p-23 i)":
+float: 2
+ifloat: 2
+Test "Real part of: cacosh (0x1.fp-10 + 1.0 i)":
+double: 1
+idouble: 1
+Test "Real part of: cacosh (0x1.fp-10 - 1.0 i)":
+double: 1
+idouble: 1
+Test "Real part of: cacosh (0x1.fp-100 + 1.0 i)":
+double: 1
+float: 1
+idouble: 1
+ifloat: 1
+Test "Real part of: cacosh (0x1.fp-100 - 1.0 i)":
+double: 1
+float: 1
+idouble: 1
+ifloat: 1
+Test "Real part of: cacosh (0x1.fp-1000 + 1.0 i)":
+double: 1
+idouble: 1
+Test "Real part of: cacosh (0x1.fp-1000 - 1.0 i)":
+double: 1
+idouble: 1
+Test "Real part of: cacosh (0x1.fp-1025 + 1.0 i)":
+double: 1
+idouble: 1
+Test "Real part of: cacosh (0x1.fp-1025 + 1.5 i)":
+double: 1
+idouble: 1
+Test "Real part of: cacosh (0x1.fp-1025 - 1.0 i)":
+double: 1
+idouble: 1
+Test "Real part of: cacosh (0x1.fp-1025 - 1.5 i)":
+double: 1
+idouble: 1
+Test "Real part of: cacosh (0x1.fp-129 + 0.5 i)":
+float: 1
+ifloat: 1
+Test "Real part of: cacosh (0x1.fp-129 + 1.0 i)":
+double: 1
+float: 1
+idouble: 1
+ifloat: 1
+Test "Real part of: cacosh (0x1.fp-129 + 1.5 i)":
+double: 1
+idouble: 1
+Test "Real part of: cacosh (0x1.fp-129 - 0.5 i)":
float: 1
ifloat: 1
-Test "Real part of: cacosh (1.5 - 0 i)":
+Test "Real part of: cacosh (0x1.fp-129 - 1.0 i)":
+double: 1
float: 1
+idouble: 1
ifloat: 1
+Test "Real part of: cacosh (0x1.fp-129 - 1.5 i)":
+double: 1
+idouble: 1
+Test "Real part of: cacosh (0x1.fp-30 + 1.0 i)":
+double: 1
+float: 1
+idouble: 1
+ifloat: 1
+Test "Real part of: cacosh (0x1.fp-30 - 1.0 i)":
+double: 1
+float: 1
+idouble: 1
+ifloat: 1
+Test "Real part of: cacosh (0x1.fp1023 + 0x1.fp1023 i)":
+double: 1
+idouble: 1
+Test "Real part of: cacosh (0x1.fp127 + 0x1.fp127 i)":
+double: 1
+idouble: 1
+Test "Real part of: cacosh (0x1p-105 + 0.5 i)":
+float: 1
+ifloat: 1
+Test "Real part of: cacosh (0x1p-105 - 0.5 i)":
+float: 1
+ifloat: 1
+Test "Real part of: cacosh (0x1p-112 + 0.5 i)":
+float: 1
+ifloat: 1
+Test "Real part of: cacosh (0x1p-112 - 0.5 i)":
+float: 1
+ifloat: 1
+Test "Real part of: cacosh (0x1p-23 + 0.5 i)":
+float: 1
+ifloat: 1
+Test "Real part of: cacosh (0x1p-23 + 0x0.ffffffp0 i)":
+double: 1
+idouble: 1
+Test "Real part of: cacosh (0x1p-23 - 0.5 i)":
+float: 1
+ifloat: 1
+Test "Real part of: cacosh (0x1p-23 - 0x0.ffffffp0 i)":
+double: 1
+idouble: 1
+Test "Real part of: cacosh (0x1p-52 + 0.5 i)":
+float: 1
+ifloat: 1
+Test "Real part of: cacosh (0x1p-52 - 0.5 i)":
+float: 1
+ifloat: 1
+Test "Real part of: cacosh (0x1p-63 + 0.5 i)":
+float: 1
+ifloat: 1
+Test "Real part of: cacosh (0x1p-63 - 0.5 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cacosh (1.0 + 0.25 i)":
+double: 1
+idouble: 1
+Test "Real part of: cacosh (1.0 + 0.5 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cacosh (1.0 + 0.5 i)":
+float: 1
+ifloat: 1
+Test "Real part of: cacosh (1.0 + 0x1.fp-10 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cacosh (1.0 + 0x1.fp-10 i)":
+float: 2
+ifloat: 2
+Test "Imaginary part of: cacosh (1.0 - 0.25 i)":
+double: 1
+idouble: 1
+Test "Real part of: cacosh (1.0 - 0.5 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cacosh (1.0 - 0.5 i)":
+float: 1
+ifloat: 1
+Test "Real part of: cacosh (1.0 - 0x1.fp-10 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cacosh (1.0 - 0x1.fp-10 i)":
+float: 2
+ifloat: 2
# casin
Test "Imaginary part of: casin (+0 + 0.5 i)":
@@ -198,47 +1413,729 @@ ifloat: 1
Test "Imaginary part of: casin (-0 - 1.5 i)":
double: 1
idouble: 1
+Test "Imaginary part of: casin (-0.25 + 1.0 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: casin (-0.25 - 1.0 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: casin (-0.5 + 0x1.fp-129 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: casin (-0.5 + 0x1p-105 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: casin (-0.5 + 0x1p-112 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: casin (-0.5 + 0x1p-23 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: casin (-0.5 + 1.0 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: casin (-0.5 - 0x1.fp-129 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: casin (-0.5 - 0x1p-105 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: casin (-0.5 - 0x1p-112 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: casin (-0.5 - 0x1p-23 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: casin (-0.5 - 1.0 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: casin (-0x0.fffffffffffff8p0 + 0x1p-52 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: casin (-0x0.fffffffffffff8p0 - 0x1p-52 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: casin (-0x0.ffffffp0 + 0x1p-23 i)":
+float: 2
+ifloat: 2
+Test "Imaginary part of: casin (-0x0.ffffffp0 - 0x1p-23 i)":
+float: 2
+ifloat: 2
+Test "Imaginary part of: casin (-0x1.000002p0 + 0x1p-23 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: casin (-0x1.000002p0 - 0x1p-23 i)":
+float: 1
+ifloat: 1
+Test "Real part of: casin (-0x1.fp-10 + 1.0 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: casin (-0x1.fp-10 + 1.0 i)":
+double: 1
+idouble: 1
+Test "Real part of: casin (-0x1.fp-10 - 1.0 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: casin (-0x1.fp-10 - 1.0 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: casin (-0x1.fp-100 + 1.0 i)":
+double: 1
+float: 1
+idouble: 1
+ifloat: 1
+Test "Imaginary part of: casin (-0x1.fp-100 - 1.0 i)":
+double: 1
+float: 1
+idouble: 1
+ifloat: 1
+Test "Imaginary part of: casin (-0x1.fp-1000 + 1.0 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: casin (-0x1.fp-1000 - 1.0 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: casin (-0x1.fp-1025 + 1.0 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: casin (-0x1.fp-1025 + 1.5 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: casin (-0x1.fp-1025 - 1.0 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: casin (-0x1.fp-1025 - 1.5 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: casin (-0x1.fp-129 + 0.5 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: casin (-0x1.fp-129 + 1.0 i)":
+double: 1
+float: 1
+idouble: 1
+ifloat: 1
+Test "Imaginary part of: casin (-0x1.fp-129 + 1.5 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: casin (-0x1.fp-129 - 0.5 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: casin (-0x1.fp-129 - 1.0 i)":
+double: 1
+float: 1
+idouble: 1
+ifloat: 1
+Test "Imaginary part of: casin (-0x1.fp-129 - 1.5 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: casin (-0x1.fp-30 + 1.0 i)":
+double: 1
+float: 1
+idouble: 1
+ifloat: 1
+Test "Imaginary part of: casin (-0x1.fp-30 - 1.0 i)":
+double: 1
+float: 1
+idouble: 1
+ifloat: 1
+Test "Imaginary part of: casin (-0x1p-105 + 0.5 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: casin (-0x1p-105 - 0.5 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: casin (-0x1p-112 + 0.5 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: casin (-0x1p-112 - 0.5 i)":
+float: 1
+ifloat: 1
+Test "Real part of: casin (-0x1p-23 + 0.5 i)":
+double: 1
+float: 1
+idouble: 1
+ifloat: 1
+Test "Imaginary part of: casin (-0x1p-23 + 0.5 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: casin (-0x1p-23 + 0x0.ffffffp0 i)":
+double: 1
+idouble: 1
+Test "Real part of: casin (-0x1p-23 + 0x1.000002p0 i)":
+double: 1
+float: 1
+idouble: 1
+ifloat: 1
+Test "Real part of: casin (-0x1p-23 - 0.5 i)":
+double: 1
+float: 1
+idouble: 1
+ifloat: 1
+Test "Imaginary part of: casin (-0x1p-23 - 0.5 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: casin (-0x1p-23 - 0x0.ffffffp0 i)":
+double: 1
+idouble: 1
+Test "Real part of: casin (-0x1p-23 - 0x1.000002p0 i)":
+double: 1
+float: 1
+idouble: 1
+ifloat: 1
+Test "Imaginary part of: casin (-0x1p-52 + 0.5 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: casin (-0x1p-52 - 0.5 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: casin (-0x1p-63 + 0.5 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: casin (-0x1p-63 - 0.5 i)":
+float: 1
+ifloat: 1
+Test "Real part of: casin (-1.0 + 0.25 i)":
+double: 1
+idouble: 1
+Test "Real part of: casin (-1.0 + 0.5 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: casin (-1.0 + 0.5 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: casin (-1.0 + 0x1.fp-10 i)":
+float: 1
+ifloat: 1
+Test "Real part of: casin (-1.0 - 0.25 i)":
+double: 1
+idouble: 1
+Test "Real part of: casin (-1.0 - 0.5 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: casin (-1.0 - 0.5 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: casin (-1.0 - 0x1.fp-10 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: casin (0.25 + 1.0 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: casin (0.25 - 1.0 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: casin (0.5 + 0x1.fp-129 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: casin (0.5 + 0x1p-105 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: casin (0.5 + 0x1p-112 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: casin (0.5 + 0x1p-23 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: casin (0.5 + 1.0 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: casin (0.5 - 0x1.fp-129 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: casin (0.5 - 0x1p-105 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: casin (0.5 - 0x1p-112 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: casin (0.5 - 0x1p-23 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: casin (0.5 - 1.0 i)":
+double: 1
+idouble: 1
Test "Real part of: casin (0.75 + 1.25 i)":
double: 1
float: 1
idouble: 1
ifloat: 1
+Test "Imaginary part of: casin (0x0.fffffffffffff8p0 + 0x1p-52 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: casin (0x0.fffffffffffff8p0 - 0x1p-52 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: casin (0x0.ffffffp0 + 0x1p-23 i)":
+float: 2
+ifloat: 2
+Test "Imaginary part of: casin (0x0.ffffffp0 - 0x1p-23 i)":
+float: 2
+ifloat: 2
+Test "Imaginary part of: casin (0x1.000002p0 + 0x1p-23 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: casin (0x1.000002p0 - 0x1p-23 i)":
+float: 1
+ifloat: 1
+Test "Real part of: casin (0x1.fp-10 + 1.0 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: casin (0x1.fp-10 + 1.0 i)":
+double: 1
+idouble: 1
+Test "Real part of: casin (0x1.fp-10 - 1.0 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: casin (0x1.fp-10 - 1.0 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: casin (0x1.fp-100 + 1.0 i)":
+double: 1
+float: 1
+idouble: 1
+ifloat: 1
+Test "Imaginary part of: casin (0x1.fp-100 - 1.0 i)":
+double: 1
+float: 1
+idouble: 1
+ifloat: 1
+Test "Imaginary part of: casin (0x1.fp-1000 + 1.0 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: casin (0x1.fp-1000 - 1.0 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: casin (0x1.fp-1025 + 1.0 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: casin (0x1.fp-1025 + 1.5 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: casin (0x1.fp-1025 - 1.0 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: casin (0x1.fp-1025 - 1.5 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: casin (0x1.fp-129 + 0.5 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: casin (0x1.fp-129 + 1.0 i)":
+double: 1
+float: 1
+idouble: 1
+ifloat: 1
+Test "Imaginary part of: casin (0x1.fp-129 + 1.5 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: casin (0x1.fp-129 - 0.5 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: casin (0x1.fp-129 - 1.0 i)":
+double: 1
+float: 1
+idouble: 1
+ifloat: 1
+Test "Imaginary part of: casin (0x1.fp-129 - 1.5 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: casin (0x1.fp-30 + 1.0 i)":
+double: 1
+float: 1
+idouble: 1
+ifloat: 1
+Test "Imaginary part of: casin (0x1.fp-30 - 1.0 i)":
+double: 1
+float: 1
+idouble: 1
+ifloat: 1
Test "Imaginary part of: casin (0x1.fp1023 + 0x1.fp1023 i)":
double: 1
idouble: 1
Test "Imaginary part of: casin (0x1.fp127 + 0x1.fp127 i)":
double: 1
idouble: 1
+Test "Imaginary part of: casin (0x1p-105 + 0.5 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: casin (0x1p-105 - 0.5 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: casin (0x1p-112 + 0.5 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: casin (0x1p-112 - 0.5 i)":
+float: 1
+ifloat: 1
+Test "Real part of: casin (0x1p-23 + 0.5 i)":
+double: 1
+float: 1
+idouble: 1
+ifloat: 1
+Test "Imaginary part of: casin (0x1p-23 + 0.5 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: casin (0x1p-23 + 0x0.ffffffp0 i)":
+double: 1
+idouble: 1
+Test "Real part of: casin (0x1p-23 + 0x1.000002p0 i)":
+double: 1
+float: 1
+idouble: 1
+ifloat: 1
+Test "Real part of: casin (0x1p-23 - 0.5 i)":
+double: 1
+float: 1
+idouble: 1
+ifloat: 1
+Test "Imaginary part of: casin (0x1p-23 - 0.5 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: casin (0x1p-23 - 0x0.ffffffp0 i)":
+double: 1
+idouble: 1
+Test "Real part of: casin (0x1p-23 - 0x1.000002p0 i)":
+double: 1
+float: 1
+idouble: 1
+ifloat: 1
+Test "Imaginary part of: casin (0x1p-52 + 0.5 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: casin (0x1p-52 - 0.5 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: casin (0x1p-63 + 0.5 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: casin (0x1p-63 - 0.5 i)":
+float: 1
+ifloat: 1
+Test "Real part of: casin (1.0 + 0.25 i)":
+double: 1
+idouble: 1
+Test "Real part of: casin (1.0 + 0.5 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: casin (1.0 + 0.5 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: casin (1.0 + 0x1.fp-10 i)":
+float: 1
+ifloat: 1
+Test "Real part of: casin (1.0 - 0.25 i)":
+double: 1
+idouble: 1
+Test "Real part of: casin (1.0 - 0.5 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: casin (1.0 - 0.5 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: casin (1.0 - 0x1.fp-10 i)":
+float: 1
+ifloat: 1
# casinh
+Test "Imaginary part of: casinh (-0.25 + 1.0 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: casinh (-0.25 - 1.0 i)":
+double: 1
+idouble: 1
Test "Real part of: casinh (-0.5 + +0 i)":
float: 1
ifloat: 1
+Test "Real part of: casinh (-0.5 + 0x1.fp-129 i)":
+float: 1
+ifloat: 1
+Test "Real part of: casinh (-0.5 + 0x1p-105 i)":
+float: 1
+ifloat: 1
+Test "Real part of: casinh (-0.5 + 0x1p-112 i)":
+float: 1
+ifloat: 1
+Test "Real part of: casinh (-0.5 + 0x1p-23 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: casinh (-0.5 + 0x1p-23 i)":
+double: 1
+float: 1
+idouble: 1
+ifloat: 1
+Test "Real part of: casinh (-0.5 + 0x1p-52 i)":
+float: 1
+ifloat: 1
+Test "Real part of: casinh (-0.5 + 0x1p-63 i)":
+float: 1
+ifloat: 1
+Test "Real part of: casinh (-0.5 + 1.0 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: casinh (-0.5 + 1.0 i)":
+float: 1
+ifloat: 1
Test "Real part of: casinh (-0.5 - 0 i)":
float: 1
ifloat: 1
+Test "Real part of: casinh (-0.5 - 0x1.fp-129 i)":
+float: 1
+ifloat: 1
+Test "Real part of: casinh (-0.5 - 0x1p-105 i)":
+float: 1
+ifloat: 1
+Test "Real part of: casinh (-0.5 - 0x1p-112 i)":
+float: 1
+ifloat: 1
+Test "Real part of: casinh (-0.5 - 0x1p-23 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: casinh (-0.5 - 0x1p-23 i)":
+double: 1
+float: 1
+idouble: 1
+ifloat: 1
+Test "Real part of: casinh (-0.5 - 0x1p-52 i)":
+float: 1
+ifloat: 1
+Test "Real part of: casinh (-0.5 - 0x1p-63 i)":
+float: 1
+ifloat: 1
+Test "Real part of: casinh (-0.5 - 1.0 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: casinh (-0.5 - 1.0 i)":
+float: 1
+ifloat: 1
+Test "Real part of: casinh (-0x0.ffffffp0 + 0x1p-23 i)":
+double: 1
+idouble: 1
+Test "Real part of: casinh (-0x0.ffffffp0 - 0x1p-23 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: casinh (-0x1.000002p0 + 0x1p-23 i)":
+double: 1
+float: 1
+idouble: 1
+ifloat: 1
+Test "Imaginary part of: casinh (-0x1.000002p0 - 0x1p-23 i)":
+double: 1
+float: 1
+idouble: 1
+ifloat: 1
+Test "Real part of: casinh (-0x1.fp-10 + 1.0 i)":
+float: 1
+ifloat: 1
+Test "Real part of: casinh (-0x1.fp-10 - 1.0 i)":
+float: 1
+ifloat: 1
+Test "Real part of: casinh (-0x1.fp-129 + 0.5 i)":
+double: 1
+idouble: 1
+Test "Real part of: casinh (-0x1.fp-129 - 0.5 i)":
+double: 1
+idouble: 1
+Test "Real part of: casinh (-0x1p-105 + 0.5 i)":
+double: 1
+idouble: 1
+Test "Real part of: casinh (-0x1p-105 - 0.5 i)":
+double: 1
+idouble: 1
+Test "Real part of: casinh (-0x1p-112 + 0.5 i)":
+double: 1
+idouble: 1
+Test "Real part of: casinh (-0x1p-112 - 0.5 i)":
+double: 1
+idouble: 1
+Test "Real part of: casinh (-0x1p-23 + 0.5 i)":
+double: 1
+idouble: 1
+Test "Real part of: casinh (-0x1p-23 + 0x0.ffffffp0 i)":
+float: 2
+ifloat: 2
+Test "Real part of: casinh (-0x1p-23 + 0x1.000002p0 i)":
+float: 1
+ifloat: 1
+Test "Real part of: casinh (-0x1p-23 - 0.5 i)":
+double: 1
+idouble: 1
+Test "Real part of: casinh (-0x1p-23 - 0x0.ffffffp0 i)":
+float: 2
+ifloat: 2
+Test "Real part of: casinh (-0x1p-23 - 0x1.000002p0 i)":
+float: 1
+ifloat: 1
+Test "Real part of: casinh (-0x1p-52 + 0x0.fffffffffffff8p0 i)":
+double: 1
+idouble: 1
+Test "Real part of: casinh (-0x1p-52 - 0x0.fffffffffffff8p0 i)":
+double: 1
+idouble: 1
Test "Real part of: casinh (-1.0 + +0 i)":
double: 1
float: 1
idouble: 1
ifloat: 1
+Test "Real part of: casinh (-1.0 + 0.25 i)":
+float: 1
+ifloat: 1
+Test "Real part of: casinh (-1.0 + 0.5 i)":
+double: 1
+idouble: 1
+Test "Real part of: casinh (-1.0 + 0x1.fp-10 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: casinh (-1.0 + 0x1.fp-10 i)":
+float: 1
+ifloat: 1
+Test "Real part of: casinh (-1.0 + 0x1.fp-100 i)":
+double: 1
+float: 1
+idouble: 1
+ifloat: 1
+Test "Real part of: casinh (-1.0 + 0x1.fp-1000 i)":
+double: 1
+idouble: 1
+Test "Real part of: casinh (-1.0 + 0x1.fp-1025 i)":
+double: 1
+idouble: 1
+Test "Real part of: casinh (-1.0 + 0x1.fp-129 i)":
+double: 1
+float: 1
+idouble: 1
+ifloat: 1
+Test "Real part of: casinh (-1.0 + 0x1.fp-30 i)":
+double: 1
+float: 1
+idouble: 1
+ifloat: 1
Test "Real part of: casinh (-1.0 - 0 i)":
double: 1
float: 1
idouble: 1
ifloat: 1
+Test "Real part of: casinh (-1.0 - 0.25 i)":
+float: 1
+ifloat: 1
+Test "Real part of: casinh (-1.0 - 0.5 i)":
+double: 1
+idouble: 1
+Test "Real part of: casinh (-1.0 - 0x1.fp-10 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: casinh (-1.0 - 0x1.fp-10 i)":
+float: 1
+ifloat: 1
+Test "Real part of: casinh (-1.0 - 0x1.fp-100 i)":
+double: 1
+float: 1
+idouble: 1
+ifloat: 1
+Test "Real part of: casinh (-1.0 - 0x1.fp-1000 i)":
+double: 1
+idouble: 1
+Test "Real part of: casinh (-1.0 - 0x1.fp-1025 i)":
+double: 1
+idouble: 1
+Test "Real part of: casinh (-1.0 - 0x1.fp-129 i)":
+double: 1
+float: 1
+idouble: 1
+ifloat: 1
+Test "Real part of: casinh (-1.0 - 0x1.fp-30 i)":
+double: 1
+float: 1
+idouble: 1
+ifloat: 1
Test "Real part of: casinh (-1.5 + +0 i)":
double: 1
idouble: 1
+Test "Real part of: casinh (-1.5 + 0x1.fp-1025 i)":
+double: 1
+idouble: 1
+Test "Real part of: casinh (-1.5 + 0x1.fp-129 i)":
+double: 1
+idouble: 1
Test "Real part of: casinh (-1.5 - 0 i)":
double: 1
idouble: 1
+Test "Real part of: casinh (-1.5 - 0x1.fp-1025 i)":
+double: 1
+idouble: 1
+Test "Real part of: casinh (-1.5 - 0x1.fp-129 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: casinh (0.25 + 1.0 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: casinh (0.25 - 1.0 i)":
+double: 1
+idouble: 1
Test "Real part of: casinh (0.5 + +0 i)":
float: 1
ifloat: 1
+Test "Real part of: casinh (0.5 + 0x1.fp-129 i)":
+float: 1
+ifloat: 1
+Test "Real part of: casinh (0.5 + 0x1p-105 i)":
+float: 1
+ifloat: 1
+Test "Real part of: casinh (0.5 + 0x1p-112 i)":
+float: 1
+ifloat: 1
+Test "Real part of: casinh (0.5 + 0x1p-23 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: casinh (0.5 + 0x1p-23 i)":
+double: 1
+float: 1
+idouble: 1
+ifloat: 1
+Test "Real part of: casinh (0.5 + 0x1p-52 i)":
+float: 1
+ifloat: 1
+Test "Real part of: casinh (0.5 + 0x1p-63 i)":
+float: 1
+ifloat: 1
+Test "Real part of: casinh (0.5 + 1.0 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: casinh (0.5 + 1.0 i)":
+float: 1
+ifloat: 1
Test "Real part of: casinh (0.5 - 0 i)":
float: 1
ifloat: 1
+Test "Real part of: casinh (0.5 - 0x1.fp-129 i)":
+float: 1
+ifloat: 1
+Test "Real part of: casinh (0.5 - 0x1p-105 i)":
+float: 1
+ifloat: 1
+Test "Real part of: casinh (0.5 - 0x1p-112 i)":
+float: 1
+ifloat: 1
+Test "Real part of: casinh (0.5 - 0x1p-23 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: casinh (0.5 - 0x1p-23 i)":
+double: 1
+float: 1
+idouble: 1
+ifloat: 1
+Test "Real part of: casinh (0.5 - 0x1p-52 i)":
+float: 1
+ifloat: 1
+Test "Real part of: casinh (0.5 - 0x1p-63 i)":
+float: 1
+ifloat: 1
+Test "Real part of: casinh (0.5 - 1.0 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: casinh (0.5 - 1.0 i)":
+float: 1
+ifloat: 1
Test "Real part of: casinh (0.75 + 1.25 i)":
float: 1
ifloat: 1
@@ -247,240 +2144,1070 @@ double: 1
float: 1
idouble: 1
ifloat: 1
+Test "Real part of: casinh (0x0.ffffffp0 + 0x1p-23 i)":
+double: 1
+idouble: 1
+Test "Real part of: casinh (0x0.ffffffp0 - 0x1p-23 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: casinh (0x1.000002p0 + 0x1p-23 i)":
+double: 1
+float: 1
+idouble: 1
+ifloat: 1
+Test "Imaginary part of: casinh (0x1.000002p0 - 0x1p-23 i)":
+double: 1
+float: 1
+idouble: 1
+ifloat: 1
+Test "Real part of: casinh (0x1.fp-10 + 1.0 i)":
+float: 1
+ifloat: 1
+Test "Real part of: casinh (0x1.fp-10 - 1.0 i)":
+float: 1
+ifloat: 1
+Test "Real part of: casinh (0x1.fp-129 + 0.5 i)":
+double: 1
+idouble: 1
+Test "Real part of: casinh (0x1.fp-129 - 0.5 i)":
+double: 1
+idouble: 1
Test "Real part of: casinh (0x1.fp1023 + 0x1.fp1023 i)":
double: 1
idouble: 1
Test "Real part of: casinh (0x1.fp127 + 0x1.fp127 i)":
double: 1
idouble: 1
+Test "Real part of: casinh (0x1p-105 + 0.5 i)":
+double: 1
+idouble: 1
+Test "Real part of: casinh (0x1p-105 - 0.5 i)":
+double: 1
+idouble: 1
+Test "Real part of: casinh (0x1p-112 + 0.5 i)":
+double: 1
+idouble: 1
+Test "Real part of: casinh (0x1p-112 - 0.5 i)":
+double: 1
+idouble: 1
+Test "Real part of: casinh (0x1p-23 + 0.5 i)":
+double: 1
+idouble: 1
+Test "Real part of: casinh (0x1p-23 + 0x0.ffffffp0 i)":
+float: 2
+ifloat: 2
+Test "Real part of: casinh (0x1p-23 + 0x1.000002p0 i)":
+float: 1
+ifloat: 1
+Test "Real part of: casinh (0x1p-23 - 0.5 i)":
+double: 1
+idouble: 1
+Test "Real part of: casinh (0x1p-23 - 0x0.ffffffp0 i)":
+float: 2
+ifloat: 2
+Test "Real part of: casinh (0x1p-23 - 0x1.000002p0 i)":
+float: 1
+ifloat: 1
+Test "Real part of: casinh (0x1p-52 + 0x0.fffffffffffff8p0 i)":
+double: 1
+idouble: 1
+Test "Real part of: casinh (0x1p-52 - 0x0.fffffffffffff8p0 i)":
+double: 1
+idouble: 1
Test "Real part of: casinh (1.0 + +0 i)":
double: 1
float: 1
idouble: 1
ifloat: 1
+Test "Real part of: casinh (1.0 + 0.25 i)":
+float: 1
+ifloat: 1
+Test "Real part of: casinh (1.0 + 0.5 i)":
+double: 1
+idouble: 1
+Test "Real part of: casinh (1.0 + 0x1.fp-10 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: casinh (1.0 + 0x1.fp-10 i)":
+float: 1
+ifloat: 1
+Test "Real part of: casinh (1.0 + 0x1.fp-100 i)":
+double: 1
+float: 1
+idouble: 1
+ifloat: 1
+Test "Real part of: casinh (1.0 + 0x1.fp-1000 i)":
+double: 1
+idouble: 1
+Test "Real part of: casinh (1.0 + 0x1.fp-1025 i)":
+double: 1
+idouble: 1
+Test "Real part of: casinh (1.0 + 0x1.fp-129 i)":
+double: 1
+float: 1
+idouble: 1
+ifloat: 1
+Test "Real part of: casinh (1.0 + 0x1.fp-30 i)":
+double: 1
+float: 1
+idouble: 1
+ifloat: 1
Test "Real part of: casinh (1.0 - 0 i)":
double: 1
float: 1
idouble: 1
ifloat: 1
+Test "Real part of: casinh (1.0 - 0.25 i)":
+float: 1
+ifloat: 1
+Test "Real part of: casinh (1.0 - 0.5 i)":
+double: 1
+idouble: 1
+Test "Real part of: casinh (1.0 - 0x1.fp-10 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: casinh (1.0 - 0x1.fp-10 i)":
+float: 1
+ifloat: 1
+Test "Real part of: casinh (1.0 - 0x1.fp-100 i)":
+double: 1
+float: 1
+idouble: 1
+ifloat: 1
+Test "Real part of: casinh (1.0 - 0x1.fp-1000 i)":
+double: 1
+idouble: 1
+Test "Real part of: casinh (1.0 - 0x1.fp-1025 i)":
+double: 1
+idouble: 1
+Test "Real part of: casinh (1.0 - 0x1.fp-129 i)":
+double: 1
+float: 1
+idouble: 1
+ifloat: 1
+Test "Real part of: casinh (1.0 - 0x1.fp-30 i)":
+double: 1
+float: 1
+idouble: 1
+ifloat: 1
Test "Real part of: casinh (1.5 + +0 i)":
double: 1
idouble: 1
+Test "Real part of: casinh (1.5 + 0x1.fp-1025 i)":
+double: 1
+idouble: 1
+Test "Real part of: casinh (1.5 + 0x1.fp-129 i)":
+double: 1
+idouble: 1
Test "Real part of: casinh (1.5 - 0 i)":
double: 1
idouble: 1
+Test "Real part of: casinh (1.5 - 0x1.fp-1025 i)":
+double: 1
+idouble: 1
+Test "Real part of: casinh (1.5 - 0x1.fp-129 i)":
+double: 1
+idouble: 1
# catan
+Test "Imaginary part of: catan (-0x0.fffffffffffff8p0 + 0x1p-27 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: catan (-0x0.ffffffp0 + 0x1p-13 i)":
+double: 1
+float: 1
+idouble: 1
+ifloat: 1
+Test "Imaginary part of: catan (-0x1.0000000000001p0 - 0x1p-27 i)":
+double: 1
+idouble: 1
+Test "Real part of: catan (-0x1.000002p0 + 0x1p-126 i)":
+float: 1
+ifloat: 1
+Test "Real part of: catan (-0x1.000002p0 + 0x1p-13 i)":
+float: 1
+ifloat: 1
+Test "Real part of: catan (-0x1.000002p0 - 0x1p-126 i)":
+float: 1
+ifloat: 1
+Test "Real part of: catan (-0x1.000002p0 - 0x1p-13 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: catan (-0x1.000002p0 - 0x1p-13 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: catan (-0x1.fp1023 + 0x1.fp1023 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: catan (-0x1.fp1023 - 0x1.fp1023 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: catan (-0x1.fp127 + 0x1.fp127 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: catan (-0x1.fp127 - 0x1.fp127 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: catan (-0x1p-1020 + 1.0 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: catan (-0x1p-1020 - 1.0 i)":
+double: 1
+idouble: 1
+Test "Real part of: catan (-0x1p-13 + 0x1.000002p0 i)":
+float: 1
+ifloat: 1
+Test "Real part of: catan (-0x1p-13 + 1.0 i)":
+float: 1
+ifloat: 1
+Test "Real part of: catan (-0x1p-13 - 0x1.000002p0 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: catan (-0x1p-13 - 0x1.000002p0 i)":
+float: 1
+ifloat: 1
+Test "Real part of: catan (-0x1p-13 - 1.0 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: catan (-0x1p-54 + 1.0 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: catan (-0x1p-54 - 1.0 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: catan (-0x1p-57 + 1.0 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: catan (-0x1p-57 - 1.0 i)":
+float: 1
+ifloat: 1
+Test "Real part of: catan (-1.0 + 0x1p-13 i)":
+float: 1
+ifloat: 1
+Test "Real part of: catan (-1.0 - 0x1p-13 i)":
+float: 1
+ifloat: 1
Test "Imaginary part of: catan (-2 - 3 i)":
double: 1
float: 1
idouble: 1
ifloat: 1
+Test "Imaginary part of: catan (0x0.fffffffffffff8p0 + 0x1p-27 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: catan (0x0.ffffffp0 + 0x1p-13 i)":
+double: 1
+float: 1
+idouble: 1
+ifloat: 1
+Test "Imaginary part of: catan (0x1.0000000000001p0 - 0x1p-27 i)":
+double: 1
+idouble: 1
+Test "Real part of: catan (0x1.000002p0 + 0x1p-126 i)":
+float: 1
+ifloat: 1
+Test "Real part of: catan (0x1.000002p0 + 0x1p-13 i)":
+float: 1
+ifloat: 1
+Test "Real part of: catan (0x1.000002p0 - 0x1p-126 i)":
+float: 1
+ifloat: 1
+Test "Real part of: catan (0x1.000002p0 - 0x1p-13 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: catan (0x1.000002p0 - 0x1p-13 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: catan (0x1.fp1023 + 0x1.fp1023 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: catan (0x1.fp1023 - 0x1.fp1023 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: catan (0x1.fp127 + 0x1.fp127 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: catan (0x1.fp127 - 0x1.fp127 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: catan (0x1p-1020 + 1.0 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: catan (0x1p-1020 - 1.0 i)":
+double: 1
+idouble: 1
+Test "Real part of: catan (0x1p-13 + 0x1.000002p0 i)":
+float: 1
+ifloat: 1
+Test "Real part of: catan (0x1p-13 + 1.0 i)":
+float: 1
+ifloat: 1
+Test "Real part of: catan (0x1p-13 - 0x1.000002p0 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: catan (0x1p-13 - 0x1.000002p0 i)":
+float: 1
+ifloat: 1
+Test "Real part of: catan (0x1p-13 - 1.0 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: catan (0x1p-54 + 1.0 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: catan (0x1p-54 - 1.0 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: catan (0x1p-57 + 1.0 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: catan (0x1p-57 - 1.0 i)":
+float: 1
+ifloat: 1
+Test "Real part of: catan (1.0 + 0x1p-13 i)":
+float: 1
+ifloat: 1
+Test "Real part of: catan (1.0 - 0x1p-13 i)":
+float: 1
+ifloat: 1
# catanh
+Test "Real part of: catanh (-0x1.000002p0 + 0x1p-13 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: catanh (-0x1.000002p0 + 0x1p-13 i)":
+float: 1
+ifloat: 1
+Test "Real part of: catanh (-0x1.000002p0 - 0x1p-13 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: catanh (-0x1.000002p0 - 0x1p-13 i)":
+float: 1
+ifloat: 1
+Test "Real part of: catanh (-0x1.fp1023 + 0x1.fp1023 i)":
+double: 1
+idouble: 1
+Test "Real part of: catanh (-0x1.fp1023 - 0x1.fp1023 i)":
+double: 1
+idouble: 1
+Test "Real part of: catanh (-0x1.fp127 + 0x1.fp127 i)":
+double: 1
+idouble: 1
+Test "Real part of: catanh (-0x1.fp127 - 0x1.fp127 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: catanh (-0x1p-126 + 0x1.000002p0 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: catanh (-0x1p-126 - 0x1.000002p0 i)":
+float: 1
+ifloat: 1
+Test "Real part of: catanh (-0x1p-13 + 0x1.000002p0 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: catanh (-0x1p-13 + 0x1.000002p0 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: catanh (-0x1p-13 + 1.0 i)":
+float: 1
+ifloat: 1
+Test "Real part of: catanh (-0x1p-13 - 0x1.000002p0 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: catanh (-0x1p-13 - 0x1.000002p0 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: catanh (-0x1p-13 - 1.0 i)":
+float: 1
+ifloat: 1
+Test "Real part of: catanh (-0x1p-27 + 0x1.0000000000001p0 i)":
+double: 1
+idouble: 1
+Test "Real part of: catanh (-0x1p-27 - 0x1.0000000000001p0 i)":
+double: 1
+idouble: 1
+Test "Real part of: catanh (-1.0 + 0x1p-1020 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: catanh (-1.0 + 0x1p-13 i)":
+float: 1
+ifloat: 1
+Test "Real part of: catanh (-1.0 + 0x1p-54 i)":
+float: 1
+ifloat: 1
+Test "Real part of: catanh (-1.0 + 0x1p-57 i)":
+float: 1
+ifloat: 1
+Test "Real part of: catanh (-1.0 - 0x1p-1020 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: catanh (-1.0 - 0x1p-13 i)":
+float: 1
+ifloat: 1
+Test "Real part of: catanh (-1.0 - 0x1p-54 i)":
+float: 1
+ifloat: 1
+Test "Real part of: catanh (-1.0 - 0x1p-57 i)":
+float: 1
+ifloat: 1
Test "Real part of: catanh (-2 - 3 i)":
-double: 4
-idouble: 4
-Test "Real part of: catanh (0.75 + 1.25 i)":
double: 1
idouble: 1
+Test "Imaginary part of: catanh (0x1.000002p0 + 0x1p-13 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: catanh (0x1.000002p0 - 0x1p-13 i)":
+float: 1
+ifloat: 1
+Test "Real part of: catanh (0x1.fp1023 + 0x1.fp1023 i)":
+double: 1
+idouble: 1
+Test "Real part of: catanh (0x1.fp1023 - 0x1.fp1023 i)":
+double: 1
+idouble: 1
+Test "Real part of: catanh (0x1.fp127 + 0x1.fp127 i)":
+double: 1
+idouble: 1
+Test "Real part of: catanh (0x1.fp127 - 0x1.fp127 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: catanh (0x1p-126 + 0x1.000002p0 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: catanh (0x1p-126 - 0x1.000002p0 i)":
+float: 1
+ifloat: 1
+Test "Real part of: catanh (0x1p-13 + 0x0.ffffffp0 i)":
+double: 1
+float: 1
+idouble: 1
+ifloat: 1
+Test "Imaginary part of: catanh (0x1p-13 + 0x1.000002p0 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: catanh (0x1p-13 + 1.0 i)":
+float: 1
+ifloat: 1
+Test "Real part of: catanh (0x1p-13 - 0x0.ffffffp0 i)":
+double: 1
+float: 1
+idouble: 1
+ifloat: 1
+Test "Imaginary part of: catanh (0x1p-13 - 0x1.000002p0 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: catanh (0x1p-13 - 1.0 i)":
+float: 1
+ifloat: 1
+Test "Real part of: catanh (0x1p-27 + 0x0.fffffffffffff8p0 i)":
+double: 1
+idouble: 1
+Test "Real part of: catanh (0x1p-27 - 0x0.fffffffffffff8p0 i)":
+double: 1
+idouble: 1
+Test "Real part of: catanh (1.0 + 0x1p-1020 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: catanh (1.0 + 0x1p-13 i)":
+float: 1
+ifloat: 1
+Test "Real part of: catanh (1.0 + 0x1p-54 i)":
+float: 1
+ifloat: 1
+Test "Real part of: catanh (1.0 + 0x1p-57 i)":
+float: 1
+ifloat: 1
+Test "Real part of: catanh (1.0 - 0x1p-1020 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: catanh (1.0 - 0x1p-13 i)":
+float: 1
+ifloat: 1
+Test "Real part of: catanh (1.0 - 0x1p-54 i)":
+float: 1
+ifloat: 1
+Test "Real part of: catanh (1.0 - 0x1p-57 i)":
+float: 1
+ifloat: 1
# cbrt
-Test "cbrt (-27.0)":
+Test "cbrt (-0x1.bp+4)":
double: 1
idouble: 1
-Test "cbrt (0.75)":
+Test "cbrt (-0x4.18937p-12)":
+float: 1
+ifloat: 1
+Test "cbrt (0xcp-4)":
double: 1
idouble: 1
-Test "cbrt (0.9921875)":
+Test "cbrt (0xf.ep-4)":
double: 1
idouble: 1
# ccos
-Test "Imaginary part of: ccos (-0.75 + 710.5 i)":
+Test "Imaginary part of: ccos (-0x2p+0 - 0x3p+0 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: ccos (-0xcp-4 + 0x2.c68p+8 i)":
double: 1
idouble: 1
-Test "Imaginary part of: ccos (-0.75 + 89.5 i)":
+Test "Imaginary part of: ccos (-0xcp-4 + 0x5.98p+4 i)":
float: 1
ifloat: 1
-Test "Imaginary part of: ccos (-0.75 - 710.5 i)":
+Test "Imaginary part of: ccos (-0xcp-4 - 0x2.c68p+8 i)":
double: 1
idouble: 1
-Test "Imaginary part of: ccos (-0.75 - 89.5 i)":
+Test "Imaginary part of: ccos (-0xcp-4 - 0x5.98p+4 i)":
float: 1
ifloat: 1
-Test "Imaginary part of: ccos (-2 - 3 i)":
+Test "Imaginary part of: ccos (0x4p-1076 + 0x5.ap+8 i)":
+double: 1
+idouble: 1
+Test "Real part of: ccos (0xcp-4 + 0x1.4p+0 i)":
+double: 1
+float: 1
+idouble: 1
+ifloat: 1
+Test "Imaginary part of: ccos (0xcp-4 + 0x1.4p+0 i)":
float: 1
ifloat: 1
-Test "Real part of: ccos (0.75 + 1.25 i)":
+Test "Imaginary part of: ccos (0xcp-4 + 0x2.c68p+8 i)":
double: 1
+idouble: 1
+Test "Imaginary part of: ccos (0xcp-4 + 0x5.98p+4 i)":
float: 1
+ifloat: 1
+Test "Imaginary part of: ccos (0xcp-4 - 0x2.c68p+8 i)":
+double: 1
idouble: 1
+Test "Imaginary part of: ccos (0xcp-4 - 0x5.98p+4 i)":
+float: 1
ifloat: 1
-Test "Imaginary part of: ccos (0.75 + 1.25 i)":
+
+# ccosh
+Test "Imaginary part of: ccosh (-0x2.c68p+8 + 0xcp-4 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: ccosh (-0x2.c68p+8 - 0xcp-4 i)":
+double: 1
+idouble: 1
+Test "Real part of: ccosh (-0x2p+0 - 0x3p+0 i)":
float: 1
ifloat: 1
-Test "Imaginary part of: ccos (0.75 + 710.5 i)":
+Test "Imaginary part of: ccosh (-0x2p+0 - 0x3p+0 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: ccosh (-0x5.98p+4 + 0xcp-4 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: ccosh (-0x5.98p+4 - 0xcp-4 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: ccosh (0x2.c68p+8 + 0xcp-4 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: ccosh (0x2.c68p+8 - 0xcp-4 i)":
double: 1
idouble: 1
-Test "Imaginary part of: ccos (0.75 + 89.5 i)":
+Test "Imaginary part of: ccosh (0x5.98p+4 + 0xcp-4 i)":
float: 1
ifloat: 1
-Test "Imaginary part of: ccos (0.75 - 710.5 i)":
+Test "Imaginary part of: ccosh (0x5.98p+4 - 0xcp-4 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: ccosh (0x5.ap+8 + 0x4p-1076 i)":
+double: 1
+idouble: 1
+Test "Real part of: ccosh (0xcp-4 + 0x1.4p+0 i)":
double: 1
+float: 1
idouble: 1
-Test "Imaginary part of: ccos (0.75 - 89.5 i)":
+ifloat: 1
+Test "Imaginary part of: ccosh (0xcp-4 + 0x1.4p+0 i)":
float: 1
ifloat: 1
-Test "Imaginary part of: ccos (0x1p-1074 + 1440 i)":
+
+# cexp
+Test "Imaginary part of: cexp (-0x2p+0 - 0x3p+0 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cexp (-0x5.fp+4 + 0xcp-4 i)":
double: 1
idouble: 1
+Test "Real part of: cexp (0x1.f4p+8 + 0x8p+1020 i)":
+double: 1
+idouble: 1
+Test "Real part of: cexp (0x2.c5dp+8 + 0xcp-4 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: cexp (0x2.c5dp+8 + 0xcp-4 i)":
+double: 1
+idouble: 1
+Test "Real part of: cexp (0x3.2p+4 + 0x8p+124 i)":
+double: 2
+float: 1
+idouble: 2
+ifloat: 1
+Test "Imaginary part of: cexp (0x3.2p+4 + 0x8p+124 i)":
+double: 1
+idouble: 1
+Test "Real part of: cexp (0x5.8cp+4 + 0xcp-4 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: cexp (0x5.8cp+4 + 0xcp-4 i)":
+float: 2
+ifloat: 2
+Test "Imaginary part of: cexp (0x5.ap+8 + 0x4p-1076 i)":
+double: 1
+idouble: 1
+Test "Real part of: cexp (0xcp-4 + 0x1.4p+0 i)":
+float: 1
+ifloat: 1
-# ccosh
-Test "Real part of: ccosh (-2 - 3 i)":
+# clog
+Test "Real part of: clog (+0 + 0x4p-1076 i)":
+double: 1
+idouble: 1
+Test "Real part of: clog (-0x1.0000000123456p+0 + +0 i)":
+double: 1
+idouble: 1
+Test "Real part of: clog (-0x1.0000000123456p+0 + 0x1.2345678p-1000 i)":
+double: 1
+idouble: 1
+Test "Real part of: clog (-0x1.0000000123456p+0 + 0x4.8d1598p-32 i)":
+double: 1
+idouble: 1
+Test "Real part of: clog (-0x1.0000000123456p+0 + 0x4.8d159ep-32 i)":
+double: 1
+idouble: 1
+Test "Real part of: clog (-0x1.0000000123456p+0 + 0x8p-152 i)":
+double: 1
+idouble: 1
+Test "Real part of: clog (-0x1.000002p+0 + +0 i)":
+float: 1
+ifloat: 1
+Test "Real part of: clog (-0x1.000002p+0 + 0x4.8d1598p-32 i)":
+double: 1
+float: 1
+idouble: 1
+ifloat: 1
+Test "Real part of: clog (-0x1.000002p+0 + 0x4.8d159ep-32 i)":
+double: 1
+idouble: 1
+Test "Real part of: clog (-0x1.000002p+0 + 0x4.8d15ap-32 i)":
+double: 1
+float: 1
+idouble: 1
+ifloat: 1
+Test "Real part of: clog (-0x1.000002p+0 + 0x8p-152 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: clog (-0x1.234566p-40 - 0x1p+0 i)":
+float: 1
+ifloat: 1
+Test "Real part of: clog (-0x8p-152 + 0xf.8p+124 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: clog (-0x8p-152 + 0xf.8p+124 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: clog (-0x8p-152 + 0xf.fffffp+124 i)":
float: 1
ifloat: 1
-Test "Imaginary part of: ccosh (-2 - 3 i)":
+Test "Real part of: clog (-0x8p-152 - 0xf.8p+124 i)":
float: 1
ifloat: 1
-Test "Imaginary part of: ccosh (-710.5 + 0.75 i)":
+Test "Imaginary part of: clog (-0x8p-152 - 0xf.8p+124 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: clog (-0x8p-152 - 0xf.fffffp+124 i)":
+float: 1
+ifloat: 1
+Test "Real part of: clog (-0xf.8p+124 + 0x8p-152 i)":
+float: 1
+ifloat: 1
+Test "Real part of: clog (-0xf.8p+124 - 0x8p-152 i)":
+float: 1
+ifloat: 1
+Test "Real part of: clog (0x1.0000000000001p+0 + +0 i)":
+double: 1
+idouble: 1
+Test "Real part of: clog (0x1.0000000000001p+0 + 0x1.234566p-60 i)":
+double: 1
+idouble: 1
+Test "Real part of: clog (0x1.0000000000001p+0 + 0x1.23456789p-1000 i)":
+double: 1
+idouble: 1
+Test "Real part of: clog (0x1.0000000000001p+0 + 0x1.23456789p-60 i)":
double: 1
idouble: 1
-Test "Imaginary part of: ccosh (-710.5 - 0.75 i)":
+Test "Real part of: clog (0x1.0000000000001p+0 + 0x1.234568p-60 i)":
double: 1
idouble: 1
-Test "Imaginary part of: ccosh (-89.5 + 0.75 i)":
+Test "Real part of: clog (0x1.0000000000001p+0 + 0x8p-152 i)":
+double: 1
+idouble: 1
+Test "Real part of: clog (0x1.000002p+0 + +0 i)":
+float: 1
+ifloat: 1
+Test "Real part of: clog (0x1.000002p+0 + 0x1.234566p-60 i)":
+float: 1
+ifloat: 1
+Test "Real part of: clog (0x1.000002p+0 + 0x1.234568p-60 i)":
float: 1
ifloat: 1
-Test "Imaginary part of: ccosh (-89.5 - 0.75 i)":
+Test "Real part of: clog (0x1.000002p+0 + 0x8p-152 i)":
float: 1
ifloat: 1
-Test "Real part of: ccosh (0.75 + 1.25 i)":
+Test "Real part of: clog (0x1.000566p+0 + 0x4.8dp-12 i)":
+float: 1
+ifloat: 1
+Test "Real part of: clog (0x1.48e45e3268d8p-4 + 0xf.f2c64p-4 i)":
double: 1
+idouble: 1
+Test "Real part of: clog (0x1.48e45ep-4 + 0xf.f2c63p-4 i)":
+float: 1
+ifloat: 1
+Test "Real part of: clog (0x1.48e45ep-4 + 0xf.f2c64p-4 i)":
float: 1
+ifloat: 1
+Test "Real part of: clog (0x1.8907bc3694fd4p-4 + 0xf.ed1990460bdf8p-4 i)":
+double: 1
+idouble: 1
+Test "Real part of: clog (0x1.8907bc3694fd5p-4 + 0xf.ed1990460bdf8p-4 i)":
+double: 1
+idouble: 1
+Test "Real part of: clog (0x1.c67eccp-4 + 0xf.e6b4d1d7a6e08p-4 i)":
+double: 1
idouble: 1
+Test "Real part of: clog (0x1.c67eccp-4 + 0xf.e6b4d1d7a6e1p-4 i)":
+double: 1
+idouble: 1
+Test "Real part of: clog (0x1.c67eccp-4 + 0xf.e6b4ep-4 i)":
+float: 1
ifloat: 1
-Test "Imaginary part of: ccosh (0.75 + 1.25 i)":
+Test "Real part of: clog (0x1.c67ecd92a8594p-4 + 0xf.e6b4dp-4 i)":
+double: 1
+idouble: 1
+Test "Real part of: clog (0x1.c67ecd92a8594p-4 + 0xf.e6b4ep-4 i)":
+double: 1
+idouble: 1
+Test "Real part of: clog (0x1.c67ecep-4 + 0xf.e6b4d1d7a6e1p-4 i)":
+double: 1
+idouble: 1
+Test "Real part of: clog (0x1p+0 + 0x4.8d1598p-12 i)":
float: 1
ifloat: 1
-Test "Imaginary part of: ccosh (1440 + 0x1p-1074 i)":
+Test "Real part of: clog (0x2.0ce7ba1e4902p-4 + 0xf.de3a3p-4 i)":
double: 1
idouble: 1
-Test "Imaginary part of: ccosh (710.5 + 0.75 i)":
+Test "Real part of: clog (0x2.82b794p-4 + 0xf.cd42a15bf9a38p-4 i)":
double: 1
idouble: 1
-Test "Imaginary part of: ccosh (710.5 - 0.75 i)":
+Test "Real part of: clog (0x2.82b795e420b28p-4 + 0xf.cd42a15bf9a3p-4 i)":
double: 1
idouble: 1
-Test "Imaginary part of: ccosh (89.5 + 0.75 i)":
+Test "Real part of: clog (0x2p-148 + 0x2p-148 i)":
float: 1
ifloat: 1
-Test "Imaginary part of: ccosh (89.5 - 0.75 i)":
+Test "Real part of: clog (0x3.3b8f94p-4 + 0xf.ab873p-4 i)":
float: 1
ifloat: 1
-
-# cexp
-Test "Imaginary part of: cexp (-2.0 - 3.0 i)":
+Test "Real part of: clog (0x3.6e17119fb8aacp-4 + 0xf.a0c58p-4 i)":
+double: 1
+idouble: 1
+Test "Real part of: clog (0x3.6e1714p-4 + 0xf.a0c58a83e57cp-4 i)":
+double: 1
+idouble: 1
+Test "Real part of: clog (0x3.6e1714p-4 + 0xf.a0c58p-4 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: clog (0x3.6e1714p-4 + 0xf.a0c58p-4 i)":
+float: 1
+ifloat: 1
+Test "Real part of: clog (0x3.6e1714p-4 + 0xf.a0c59p-4 i)":
float: 1
ifloat: 1
-Test "Imaginary part of: cexp (-95 + 0.75 i)":
+Test "Imaginary part of: clog (0x3.6e1714p-4 + 0xf.a0c59p-4 i)":
+float: 1
+ifloat: 1
+Test "Real part of: clog (0x3.bea2bcp-4 + 0xf.8e3d619a8d118p-4 i)":
double: 1
idouble: 1
-Test "Real part of: cexp (0.75 + 1.25 i)":
+Test "Real part of: clog (0x3.bea2bd62e35p-4 + 0xf.8e3d6p-4 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: clog (0x3.bea2cp-4 + 0xf.8e3d6p-4 i)":
+float: 1
+ifloat: 1
+Test "Real part of: clog (0x3.bea2cp-4 + 0xf.8e3d7p-4 i)":
float: 1
ifloat: 1
-Test "Imaginary part of: cexp (1440 + 0x1p-1074 i)":
+Test "Real part of: clog (0x3.e1d0a105ac4eap-4 + 0xf.859b3d1b06d08p-4 i)":
double: 1
idouble: 1
-Test "Real part of: cexp (50 + 0x1p127 i)":
-double: 2
+Test "Real part of: clog (0x3.e1d0ap-4 + 0xf.859b3d1b06d08p-4 i)":
+double: 1
+idouble: 1
+Test "Real part of: clog (0x3.e1d0ap-4 + 0xf.859b3p-4 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: clog (0x3.e1d0ap-4 + 0xf.859b4p-4 i)":
float: 1
-idouble: 2
ifloat: 1
-Test "Imaginary part of: cexp (50 + 0x1p127 i)":
+Test "Real part of: clog (0x4.0dbf7d40fe1acp-4 + 0xf.7a5c1af8e3ce8p-4 i)":
double: 1
idouble: 1
-Test "Real part of: cexp (500 + 0x1p1023 i)":
+Test "Real part of: clog (0x4.0dbf7d40fe1acp-4 + 0xf.7a5c1p-4 i)":
double: 1
idouble: 1
-Test "Real part of: cexp (709.8125 + 0.75 i)":
+Test "Real part of: clog (0x4.7017a2e36807cp-4 + 0xf.5f4a550c9d758p-4 i)":
double: 1
idouble: 1
-Test "Imaginary part of: cexp (709.8125 + 0.75 i)":
+Test "Real part of: clog (0x4.7017a8p-4 + 0xf.5f4a550c9d76p-4 i)":
double: 1
idouble: 1
-Test "Real part of: cexp (88.75 + 0.75 i)":
+Test "Real part of: clog (0x4.7017a8p-4 + 0xf.5f4a6p-4 i)":
float: 1
ifloat: 1
-Test "Imaginary part of: cexp (88.75 + 0.75 i)":
-float: 2
-ifloat: 2
-
-# clog
-Test "Real part of: clog (-0x1.0000000123456p0 + 0x1.2345678p-1000 i)":
+Test "Real part of: clog (0x4.d9e8c8p-4 + 0xf.3f303p-4 i)":
+float: 1
+ifloat: 1
+Test "Real part of: clog (0x4.d9e8cp-4 + 0xf.3f30281507d8p-4 i)":
+double: 1
+idouble: 1
+Test "Real part of: clog (0x4p-1076 + +0 i)":
+double: 1
+idouble: 1
+Test "Real part of: clog (0x4p-1076 + 0x4p-1076 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: clog (0x5.03p-4 + 0xf.31ep-4 i)":
+float: 1
+ifloat: 1
+Test "Real part of: clog (0x5.318c596a8cb1p-4 + 0xf.22364p-4 i)":
+double: 1
+idouble: 1
+Test "Real part of: clog (0x5.b06b68p-4 + 0xe.f452b965da9fp-4 i)":
+double: 1
+idouble: 1
+Test "Real part of: clog (0x5.b06b68p-4 + 0xe.f452bp-4 i)":
+float: 1
+ifloat: 1
+Test "Real part of: clog (0x5.b06b7p-4 + 0xe.f452b965da9fp-4 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: clog (0x5.b06b7p-4 + 0xe.f452bp-4 i)":
+float: 1
+ifloat: 1
+Test "Real part of: clog (0x6.02fd5037c479p-4 + 0xe.d3e21p-4 i)":
+double: 1
+idouble: 1
+Test "Real part of: clog (0x6.02fd5037c479p-4 + 0xe.d3e2p-4 i)":
+double: 1
+idouble: 1
+Test "Real part of: clog (0x6.02fd58p-4 + 0xe.d3e2086dcca8p-4 i)":
+double: 1
+idouble: 1
+Test "Real part of: clog (0x6.02fd58p-4 + 0xe.d3e21p-4 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: clog (0x6.02fd5p-4 + 0xe.d3e21p-4 i)":
+float: 1
+ifloat: 1
+Test "Real part of: clog (0x6.1c643068cd128p-4 + 0xe.c97c2p-4 i)":
+double: 1
+idouble: 1
+Test "Real part of: clog (0x6.1c6438p-4 + 0xe.c97c2018b4288p-4 i)":
+double: 1
+idouble: 1
+Test "Real part of: clog (0x6.1c6438p-4 + 0xe.c97c2018b428p-4 i)":
+double: 1
+idouble: 1
+Test "Real part of: clog (0x6.1c6438p-4 + 0xe.c97c3p-4 i)":
+float: 1
+ifloat: 1
+Test "Real part of: clog (0x6.2aff83ae6467cp-4 + 0xe.c36a6p-4 i)":
+double: 1
+idouble: 1
+Test "Real part of: clog (0x6.2aff83ae6468p-4 + 0xe.c36a599a86ba8p-4 i)":
+double: 1
+idouble: 1
+Test "Real part of: clog (0x6.2aff83ae6468p-4 + 0xe.c36a5p-4 i)":
+double: 1
+idouble: 1
+Test "Real part of: clog (0x6.2aff88p-4 + 0xe.c36a599a86ba8p-4 i)":
+double: 1
+idouble: 1
+Test "Real part of: clog (0x6.b10b48p-4 + 0xe.8893cbb44925p-4 i)":
+double: 1
+idouble: 1
+Test "Real part of: clog (0x6.b10b4f3520218p-4 + 0xe.8893dp-4 i)":
+double: 1
+idouble: 1
+Test "Real part of: clog (0x6.b10b5p-4 + 0xe.8893cbb449258p-4 i)":
+double: 1
+idouble: 1
+Test "Real part of: clog (0x6.b10b5p-4 + 0xe.8893cbb44925p-4 i)":
+double: 1
+idouble: 1
+Test "Real part of: clog (0x7.eca921b40e028p-4 + 0xd.e655fp-4 i)":
+double: 1
+idouble: 1
+Test "Real part of: clog (0x7.eca928p-4 + 0xd.e655e694e5108p-4 i)":
+double: 1
+idouble: 1
+Test "Real part of: clog (0x7.eca928p-4 + 0xd.e655fp-4 i)":
+float: 1
+ifloat: 1
+Test "Real part of: clog (0x7.f2c8d20a1eca4p-4 + 0xd.e2d66p-4 i)":
+double: 1
+idouble: 1
+Test "Real part of: clog (0x7.f2c8d20a1ecap-4 + 0xd.e2d65p-4 i)":
+double: 1
+idouble: 1
+Test "Real part of: clog (0x7.f2c8d8p-4 + 0xd.e2d65939160b8p-4 i)":
+double: 1
+idouble: 1
+Test "Real part of: clog (0x7.f2c8dp-4 + 0xd.e2d65939160bp-4 i)":
double: 1
idouble: 1
-Test "Real part of: clog (-0x1.0000000123456p0 + 0x1.2345678p-30 i)":
+Test "Real part of: clog (0x7.f4b088p-4 + 0xd.e1bf04f3688p-4 i)":
double: 1
idouble: 1
-Test "Imaginary part of: clog (-0x1.234566p-40 - 1.0 i)":
+Test "Real part of: clog (0x8.88faep-4 + 0xd.888bdp-4 i)":
float: 1
ifloat: 1
-Test "Real part of: clog (-0x1.fp+127 + 0x1p-149 i)":
+Test "Imaginary part of: clog (0x8.88faep-4 + 0xd.888bdp-4 i)":
float: 1
ifloat: 1
-Test "Real part of: clog (-0x1.fp+127 - 0x1p-149 i)":
+Test "Real part of: clog (0x8.88fafp-4 + 0xd.888bdp-4 i)":
float: 1
ifloat: 1
-Test "Real part of: clog (-0x1p-149 + 0x1.fp+127 i)":
+Test "Real part of: clog (0x8.ecbf810c4ae6p-4 + 0xd.47946p-4 i)":
+double: 1
+idouble: 1
+Test "Real part of: clog (0x8.ecbf8p-4 + 0xd.479468b09a37p-4 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: clog (0x8.ecbf8p-4 + 0xd.47946p-4 i)":
float: 1
ifloat: 1
-Test "Imaginary part of: clog (-0x1p-149 + 0x1.fp+127 i)":
+Test "Real part of: clog (0x8.ecbf9p-4 + 0xd.479468b09a37p-4 i)":
+double: 1
+idouble: 1
+Test "Real part of: clog (0x8p-152 + 0xf.8p+124 i)":
float: 1
ifloat: 1
-Test "Real part of: clog (-0x1p-149 - 0x1.fp+127 i)":
+Test "Real part of: clog (0x8p-152 - 0xf.8p+124 i)":
float: 1
ifloat: 1
-Test "Imaginary part of: clog (-0x1p-149 - 0x1.fp+127 i)":
+Test "Real part of: clog (0x9.b386fp-4 + 0xc.b9317p-4 i)":
float: 1
ifloat: 1
-Test "Real part of: clog (0x0.ffffffp0 + 0x0.ffffffp-100 i)":
+Test "Real part of: clog (0x9.c1b6ac509a248p-4 + 0xc.ae53de1d5a7dp-4 i)":
+double: 1
+idouble: 1
+Test "Real part of: clog (0x9.c1b6ac509a248p-4 + 0xc.ae53ep-4 i)":
+double: 1
+idouble: 1
+Test "Real part of: clog (0x9.c1b6ac509a24p-4 + 0xc.ae53dp-4 i)":
+double: 1
+idouble: 1
+Test "Real part of: clog (0x9.c1b6ac509a24p-4 + 0xc.ae53ep-4 i)":
+double: 1
+idouble: 1
+Test "Real part of: clog (0x9.c1b6ap-4 + 0xc.ae53de1d5a7dp-4 i)":
+double: 1
+idouble: 1
+Test "Real part of: clog (0x9.c1b6ap-4 + 0xc.ae53dp-4 i)":
float: 1
ifloat: 1
-Test "Real part of: clog (0x1.000566p0 + 0x1.234p-10 i)":
+Test "Imaginary part of: clog (0x9.c1b6ap-4 + 0xc.ae53ep-4 i)":
float: 1
ifloat: 1
-Test "Real part of: clog (0x1.fp+127 + 0x1p-149 i)":
+Test "Real part of: clog (0xa.47c0c65bd4928p-4 + 0xc.42a51p-4 i)":
+double: 1
+idouble: 1
+Test "Real part of: clog (0xa.47c0cp-4 + 0xc.42a51p-4 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: clog (0xa.47c0cp-4 + 0xc.42a51p-4 i)":
+float: 1
+ifloat: 1
+Test "Real part of: clog (0xa.afc57p-4 + 0xb.e867932966df8p-4 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: clog (0xa.afc58p-4 + 0xb.e867ap-4 i)":
+float: 1
+ifloat: 1
+Test "Real part of: clog (0xa.b96da19075eap-8 + 0xf.fc679p-4 i)":
+double: 1
+idouble: 1
+Test "Real part of: clog (0xa.b96dap-8 + 0xf.fc67818f89d2p-4 i)":
+double: 1
+idouble: 1
+Test "Real part of: clog (0xa.b96dap-8 + 0xf.fc678p-4 i)":
float: 1
ifloat: 1
-Test "Real part of: clog (0x1.fp+127 - 0x1p-149 i)":
+Test "Real part of: clog (0xa.b96dap-8 + 0xf.fc679p-4 i)":
float: 1
ifloat: 1
-Test "Real part of: clog (0x1p-1074 + 0x1p-1074 i)":
+Test "Real part of: clog (0xa.e7de8cc868ff8p-4 + 0xb.b51cbp-4 i)":
double: 1
idouble: 1
-Test "Real part of: clog (0x1p-147 + 0x1p-147 i)":
+Test "Real part of: clog (0xa.e7de8p-4 + 0xb.b51cbp-4 i)":
float: 1
ifloat: 1
-Test "Real part of: clog (0x1p-149 + 0x1.fp+127 i)":
+Test "Real part of: clog (0xa.e7de9p-4 + 0xb.b51cb9f04d4dp-4 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: clog (0xa.e7de9p-4 + 0xb.b51cbp-4 i)":
float: 1
ifloat: 1
-Test "Real part of: clog (0x1p-149 - 0x1.fp+127 i)":
+Test "Real part of: clog (0xa.ec55b7682e528p-4 + 0xb.b0f24p-4 i)":
+double: 1
+idouble: 1
+Test "Real part of: clog (0xa.ec55cp-4 + 0xb.b0f2405504a68p-4 i)":
+double: 1
+idouble: 1
+Test "Real part of: clog (0xa.ec55cp-4 + 0xb.b0f25p-4 i)":
float: 1
ifloat: 1
-Test "Imaginary part of: clog (0x2818p-15 + 0x798fp-15 i)":
+Test "Real part of: clog (0xb.263a77543bp-4 + 0xb.79c9ap-4 i)":
+double: 1
+idouble: 1
+Test "Real part of: clog (0xb.263a8p-4 + 0xb.79c9bp-4 i)":
float: 1
ifloat: 1
-Test "Real part of: clog (1.0 + 0x1.234566p-10 i)":
+Test "Real part of: clog (0xf.8p+124 + 0x8p-152 i)":
+float: 1
+ifloat: 1
+Test "Real part of: clog (0xf.8p+124 - 0x8p-152 i)":
+float: 1
+ifloat: 1
+Test "Real part of: clog (0xf.fffffp+124 + 0x8p+1020 i)":
+double: 1
+idouble: 1
+Test "Real part of: clog (0xf.fffffp-4 + +0 i)":
+float: 1
+ifloat: 1
+Test "Real part of: clog (0xf.fffffp-4 + 0x8p-152 i)":
+float: 1
+ifloat: 1
+Test "Real part of: clog (0xf.fffffp-4 + 0xf.fffffp-104 i)":
float: 1
ifloat: 1
# clog10
Test "Imaginary part of: clog10 (-0 + inf i)":
+double: 1
float: 1
+idouble: 1
ifloat: 1
Test "Imaginary part of: clog10 (-0 - inf i)":
+double: 1
float: 1
+idouble: 1
ifloat: 1
Test "Real part of: clog10 (-0x1.0000000123456p0 + 0x1.2345678p-1000 i)":
double: 2
@@ -529,28 +3256,47 @@ Test "Imaginary part of: clog10 (-2 - 3 i)":
double: 1
idouble: 1
Test "Imaginary part of: clog10 (-3 + inf i)":
+double: 1
float: 1
+idouble: 1
ifloat: 1
Test "Imaginary part of: clog10 (-3 - inf i)":
+double: 1
float: 1
+idouble: 1
ifloat: 1
Test "Imaginary part of: clog10 (-inf + 0 i)":
+double: 1
float: 1
+idouble: 1
ifloat: 1
Test "Imaginary part of: clog10 (-inf + 1 i)":
+double: 1
float: 1
+idouble: 1
ifloat: 1
+Test "Imaginary part of: clog10 (-inf + inf i)":
+double: 1
+idouble: 1
Test "Imaginary part of: clog10 (-inf - 0 i)":
+double: 1
float: 1
+idouble: 1
ifloat: 1
Test "Imaginary part of: clog10 (-inf - 1 i)":
+double: 1
float: 1
+idouble: 1
ifloat: 1
Test "Imaginary part of: clog10 (0 + inf i)":
+double: 1
float: 1
+idouble: 1
ifloat: 1
Test "Imaginary part of: clog10 (0 - inf i)":
+double: 1
float: 1
+idouble: 1
ifloat: 1
Test "Real part of: clog10 (0x0.fffffffffffff8p0 + 0x0.fffffffffffff8p-1000 i)":
double: 1
@@ -581,11 +3327,16 @@ float: 1
idouble: 1
ifloat: 1
Test "Imaginary part of: clog10 (0x1.fffffep+127 + 0x1.fffffep+127 i)":
+double: 1
float: 1
+idouble: 1
ifloat: 1
Test "Real part of: clog10 (0x1.fffffep+127 + 1.0 i)":
float: 1
ifloat: 1
+Test "Imaginary part of: clog10 (0x1.fffffffffffffp+1023 + 0x1.fffffffffffffp+1023 i)":
+double: 1
+idouble: 1
Test "Real part of: clog10 (0x10673dd0f2481p-51 + 0x7ef1d17cefbd2p-51 i)":
double: 1
idouble: 1
@@ -601,17 +3352,25 @@ idouble: 1
Test "Imaginary part of: clog10 (0x1a6p-10 + 0x3a5p-10 i)":
double: 1
idouble: 1
+Test "Imaginary part of: clog10 (0x1p-1073 + 0x1p-1073 i)":
+double: 1
+idouble: 1
Test "Imaginary part of: clog10 (0x1p-1074 + 0x1.fp+1023 i)":
double: 1
idouble: 1
Test "Real part of: clog10 (0x1p-1074 + 0x1p-1074 i)":
double: 1
idouble: 1
+Test "Imaginary part of: clog10 (0x1p-1074 + 0x1p-1074 i)":
+double: 1
+idouble: 1
Test "Imaginary part of: clog10 (0x1p-1074 - 0x1.fp+1023 i)":
double: 1
idouble: 1
Test "Imaginary part of: clog10 (0x1p-147 + 0x1p-147 i)":
+double: 1
float: 1
+idouble: 1
ifloat: 1
Test "Imaginary part of: clog10 (0x1p-149 + 0x1.fp+127 i)":
double: 1
@@ -619,7 +3378,9 @@ float: 1
idouble: 1
ifloat: 1
Test "Imaginary part of: clog10 (0x1p-149 + 0x1p-149 i)":
+double: 1
float: 1
+idouble: 1
ifloat: 1
Test "Imaginary part of: clog10 (0x1p-149 - 0x1.fp+127 i)":
double: 1
@@ -689,66 +3450,110 @@ Test "Imaginary part of: clog10 (1.0 + 0x1.234566p-10 i)":
double: 1
idouble: 1
Test "Imaginary part of: clog10 (3 + inf i)":
+double: 1
float: 1
+idouble: 1
ifloat: 1
Test "Imaginary part of: clog10 (3 - inf i)":
+double: 1
float: 1
+idouble: 1
ifloat: 1
Test "Imaginary part of: clog10 (inf + inf i)":
+double: 1
float: 1
+idouble: 1
ifloat: 1
Test "Imaginary part of: clog10 (inf - inf i)":
+double: 1
float: 1
+idouble: 1
ifloat: 1
# cos
Test "cos (0x1p+120)":
float: 1
ifloat: 1
-Test "cos (0x1p+127)":
+Test "cos (0x7p+0)":
float: 1
ifloat: 1
-Test "cos (M_PI_6l * 2.0)":
-double: 1
-idouble: 1
-Test "cos (M_PI_6l * 4.0)":
-double: 2
+Test "cos (0x8p+124)":
+float: 1
+ifloat: 1
+Test "cos (0xc.d4967p-4)":
float: 1
-idouble: 2
ifloat: 1
# cos_tonearest
-Test "cos_tonearest (7)":
+Test "cos_tonearest (0x1p+120)":
+float: 1
+ifloat: 1
+Test "cos_tonearest (0x7p+0)":
+float: 1
+ifloat: 1
+Test "cos_tonearest (0x8p+124)":
+float: 1
+ifloat: 1
+Test "cos_tonearest (0xc.d4967p-4)":
float: 1
ifloat: 1
-# cpow
-Test "Real part of: cpow (0.75 + 1.25 i, 0.0 + 1.0 i)":
+# cosh
+Test "cosh (-0x1p+0)":
+float: 1
+ifloat: 1
+Test "cosh (-0x2.c5e3acp+8)":
+double: 1
+idouble: 1
+Test "cosh (-0x2.c679dp+8)":
+double: 1
+idouble: 1
+Test "cosh (0x2.c5e3acp+8)":
+double: 1
+idouble: 1
+Test "cosh (0x2.c679dp+8)":
+double: 1
+idouble: 1
+
+# cosh_tonearest
+Test "cosh_tonearest (-0x1p+0)":
float: 1
ifloat: 1
-Test "Real part of: cpow (0.75 + 1.25 i, 0.75 + 1.25 i)":
+Test "cosh_tonearest (-0x2.c5e3acp+8)":
+double: 1
+idouble: 1
+Test "cosh_tonearest (-0x2.c679dp+8)":
+double: 1
+idouble: 1
+Test "cosh_tonearest (0x2.c5e3acp+8)":
+double: 1
+idouble: 1
+Test "cosh_tonearest (0x2.c679dp+8)":
+double: 1
+idouble: 1
+
+# cpow
+Test "Real part of: cpow (0x2p+0 + 0x3p+0 i, 0x4p+0 + +0 i)":
double: 1
float: 4
idouble: 1
ifloat: 4
-Test "Real part of: cpow (0.75 + 1.25 i, 1.0 + 1.0 i)":
+Test "Imaginary part of: cpow (0x2p+0 + 0x3p+0 i, 0x4p+0 + +0 i)":
+float: 2
+ifloat: 2
+Test "Real part of: cpow (0xcp-4 + 0x1.4p+0 i, +0 + 0x1p+0 i)":
+float: 1
+ifloat: 1
+Test "Real part of: cpow (0xcp-4 + 0x1.4p+0 i, 0x1p+0 + 0x1p+0 i)":
double: 2
float: 3
idouble: 2
ifloat: 3
-Test "Real part of: cpow (2 + 3 i, 4 + 0 i)":
+Test "Real part of: cpow (0xcp-4 + 0x1.4p+0 i, 0xcp-4 + 0x1.4p+0 i)":
double: 1
float: 4
idouble: 1
ifloat: 4
-Test "Imaginary part of: cpow (2 + 3 i, 4 + 0 i)":
-float: 2
-ifloat: 2
-Test "Imaginary part of: cpow (e + 0 i, 0 + 2 * M_PIl i)":
-double: 2
-float: 2
-idouble: 2
-ifloat: 2
# csin
Test "Real part of: csin (-0.75 + 710.5 i)":
@@ -818,591 +3623,1468 @@ float: 1
ifloat: 1
# csqrt
-Test "Real part of: csqrt (-0x1.000002p-126 - 0x1.000002p-126 i)":
+Test "Real part of: csqrt (-0x2p+0 + 0x3p+0 i)":
+float: 1
+ifloat: 1
+Test "Real part of: csqrt (-0x2p+0 - 0x3p+0 i)":
+float: 1
+ifloat: 1
+Test "Real part of: csqrt (-0x4.000008p-128 - 0x4.000008p-128 i)":
+double: 1
+idouble: 1
+Test "Real part of: csqrt (-0x8p-152 - 0x4p-1076 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: csqrt (0x4.000008p-128 + 0x4.000008p-128 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: csqrt (0x4p-1076 + 0xf.fffffp+124 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: csqrt (0x8p+1020 + 0x8p-152 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: csqrt (0x8p+124 + 0x8p-152 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: csqrt (0x8p-152 + 0x4p-1076 i)":
double: 1
idouble: 1
-Test "Real part of: csqrt (-2 + 3 i)":
+Test "Imaginary part of: csqrt (0x8p-152 + 0x8p-1076 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: csqrt (0x8p-152 + 0xf.fffffp+124 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: csqrt (0xf.ffffffffffff8p+1020 + 0x8p+1020 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: csqrt (0xf.ffffffffffff8p+1020 + 0x8p-152 i)":
+double: 1
+idouble: 1
+Test "Real part of: csqrt (0xf.ffffffffffff8p+1020 + 0xf.ffffffffffff8p+1020 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: csqrt (0xf.ffffffffffff8p+1020 + 0xf.ffffffffffff8p+1020 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: csqrt (0xf.ffffffffffff8p+1020 + 0xf.fffffp+124 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: csqrt (0xf.fffffp+124 + 0x1p+0 i)":
float: 1
ifloat: 1
-Test "Real part of: csqrt (-2 - 3 i)":
+
+# ctan
+Test "Real part of: ctan (-0x2p+0 - 0x3p+0 i)":
float: 1
ifloat: 1
-Test "Imaginary part of: csqrt (0x1.000002p-126 + 0x1.000002p-126 i)":
+Test "Imaginary part of: ctan (-0x2p+0 - 0x3p+0 i)":
double: 1
idouble: 1
-Test "Imaginary part of: csqrt (0x1.fffffep+127 + 1.0 i)":
+Test "Real part of: ctan (0x1.921fb4p+0 + +0 i)":
+double: 1
float: 1
+idouble: 1
ifloat: 1
-Test "Real part of: csqrt (0x1.fffffffffffffp+1023 + 0x1.fffffffffffffp+1023 i)":
+Test "Real part of: ctan (0x1.921fb4p+0 + 0x4p-1076 i)":
double: 1
idouble: 1
-Test "Imaginary part of: csqrt (0x1.fffffffffffffp+1023 + 0x1.fffffffffffffp+1023 i)":
+Test "Imaginary part of: ctan (0x1.921fb4p+0 + 0x4p-1076 i)":
double: 1
idouble: 1
-Test "Imaginary part of: csqrt (0x1.fffffffffffffp+1023 + 0x1p+1023 i)":
+Test "Real part of: ctan (0x1.921fb4p+0 + 0x8p-152 i)":
double: 1
+float: 1
idouble: 1
-
-# ctan
-Test "Real part of: ctan (-2 - 3 i)":
+ifloat: 1
+Test "Imaginary part of: ctan (0x1.921fb4p+0 + 0x8p-152 i)":
+double: 1
+idouble: 1
+Test "Real part of: ctan (0x1.921fb54442d19p+0 + +0 i)":
+double: 1
+idouble: 1
+Test "Real part of: ctan (0x1.921fb54442d19p+0 + 0x4p-1076 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: ctan (0x1.921fb54442d19p+0 + 0x4p-1076 i)":
+double: 2
+idouble: 2
+Test "Real part of: ctan (0x1.921fb54442d19p+0 + 0x8p-152 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: ctan (0x1.921fb54442d19p+0 + 0x8p-152 i)":
+double: 2
+idouble: 2
+Test "Real part of: ctan (0x1.921fb6p+0 + +0 i)":
+float: 1
+ifloat: 1
+Test "Real part of: ctan (0x1.921fb6p+0 + 0x8p-152 i)":
float: 1
ifloat: 1
-Test "Imaginary part of: ctan (-2 - 3 i)":
+Test "Imaginary part of: ctan (0x1.921fb6p+0 + 0x8p-152 i)":
+float: 1
+ifloat: 1
+Test "Real part of: ctan (0x8p+1020 + 0x1p+0 i)":
double: 1
idouble: 1
-Test "Imaginary part of: ctan (0.75 + 1.25 i)":
+Test "Imaginary part of: ctan (0x8p+124 + 0x1p+0 i)":
double: 1
idouble: 1
-Test "Real part of: ctan (0x1p1023 + 1 i)":
+Test "Imaginary part of: ctan (0xcp-4 + 0x1.4p+0 i)":
double: 1
idouble: 1
-Test "Imaginary part of: ctan (0x1p127 + 1 i)":
+Test "Real part of: ctan (0xf.ffffffffffff8p+1020 + 0x1p+0 i)":
double: 1
idouble: 1
-Test "Real part of: ctan (0x3.243f6cp-1 + 0 i)":
+Test "Real part of: ctan (0xf.fffffp+124 + 0x1p+0 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: ctan (0xf.fffffp+124 + 0x1p+0 i)":
+double: 1
float: 1
+idouble: 1
ifloat: 1
# ctan_tonearest
-Test "Real part of: ctan_tonearest (0x1.921fb6p+0 + 0x1p-149 i)":
+Test "Real part of: ctan_tonearest (-0x2p+0 - 0x3p+0 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: ctan_tonearest (-0x2p+0 - 0x3p+0 i)":
+double: 1
+idouble: 1
+Test "Real part of: ctan_tonearest (0x1.921fb4p+0 + +0 i)":
+double: 1
+float: 1
+idouble: 1
+ifloat: 1
+Test "Real part of: ctan_tonearest (0x1.921fb4p+0 + 0x4p-1076 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: ctan_tonearest (0x1.921fb4p+0 + 0x4p-1076 i)":
+double: 1
+idouble: 1
+Test "Real part of: ctan_tonearest (0x1.921fb4p+0 + 0x8p-152 i)":
+double: 1
+float: 1
+idouble: 1
+ifloat: 1
+Test "Imaginary part of: ctan_tonearest (0x1.921fb4p+0 + 0x8p-152 i)":
+double: 1
+idouble: 1
+Test "Real part of: ctan_tonearest (0x1.921fb54442d19p+0 + +0 i)":
+double: 1
+idouble: 1
+Test "Real part of: ctan_tonearest (0x1.921fb54442d19p+0 + 0x4p-1076 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: ctan_tonearest (0x1.921fb54442d19p+0 + 0x4p-1076 i)":
+double: 2
+idouble: 2
+Test "Real part of: ctan_tonearest (0x1.921fb54442d19p+0 + 0x8p-152 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: ctan_tonearest (0x1.921fb54442d19p+0 + 0x8p-152 i)":
+double: 2
+idouble: 2
+Test "Real part of: ctan_tonearest (0x1.921fb6p+0 + +0 i)":
+float: 1
+ifloat: 1
+Test "Real part of: ctan_tonearest (0x1.921fb6p+0 + 0x8p-152 i)":
float: 1
ifloat: 1
-Test "Imaginary part of: ctan_tonearest (0x1.921fb6p+0 + 0x1p-149 i)":
+Test "Imaginary part of: ctan_tonearest (0x1.921fb6p+0 + 0x8p-152 i)":
float: 1
ifloat: 1
+Test "Real part of: ctan_tonearest (0x8p+1020 + 0x1p+0 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: ctan_tonearest (0x8p+124 + 0x1p+0 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: ctan_tonearest (0xcp-4 + 0x1.4p+0 i)":
+double: 1
+idouble: 1
+Test "Real part of: ctan_tonearest (0xf.ffffffffffff8p+1020 + 0x1p+0 i)":
+double: 1
+idouble: 1
+Test "Real part of: ctan_tonearest (0xf.fffffp+124 + 0x1p+0 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: ctan_tonearest (0xf.fffffp+124 + 0x1p+0 i)":
+double: 1
+float: 1
+idouble: 1
+ifloat: 1
# ctanh
-Test "Real part of: ctanh (-2 - 3 i)":
+Test "Imaginary part of: ctanh (+0 + 0x1.921fb4p+0 i)":
double: 1
float: 1
idouble: 1
ifloat: 1
-Test "Imaginary part of: ctanh (-2 - 3 i)":
+Test "Imaginary part of: ctanh (+0 + 0x1.921fb54442d19p+0 i)":
double: 1
+idouble: 1
+Test "Imaginary part of: ctanh (+0 + 0x1.921fb6p+0 i)":
float: 1
+ifloat: 1
+Test "Imaginary part of: ctanh (+0 + 0xc.90fdaa22168cp-4 i)":
+double: 1
idouble: 1
+Test "Imaginary part of: ctanh (+0 + 0xc.90fdap-4 i)":
+double: 2
+float: 1
+idouble: 2
ifloat: 1
-Test "Imaginary part of: ctanh (0 + 0x3.243f6cp-1 i)":
+Test "Imaginary part of: ctanh (+0 + 0xc.90fdbp-4 i)":
float: 1
ifloat: 1
-Test "Imaginary part of: ctanh (0 + pi/4 i)":
+Test "Real part of: ctanh (-0x2p+0 - 0x3p+0 i)":
double: 1
float: 1
idouble: 1
ifloat: 1
-Test "Real part of: ctanh (0.75 + 1.25 i)":
+Test "Imaginary part of: ctanh (-0x2p+0 - 0x3p+0 i)":
double: 1
float: 1
idouble: 1
ifloat: 1
-Test "Imaginary part of: ctanh (0.75 + 1.25 i)":
-float: 2
-ifloat: 2
-Test "Imaginary part of: ctanh (1 + 0x1p1023 i)":
+Test "Imaginary part of: ctanh (0x1p+0 + 0x8p+1020 i)":
double: 1
idouble: 1
-Test "Real part of: ctanh (1 + 0x1p127 i)":
+Test "Real part of: ctanh (0x1p+0 + 0x8p+124 i)":
double: 1
idouble: 1
-
-# ctanh_tonearest
-Test "Real part of: ctanh_tonearest (0x1p-149 + 0x1.921fb6p+0 i)":
-float: 1
-ifloat: 1
-Test "Imaginary part of: ctanh_tonearest (0x1p-149 + 0x1.921fb6p+0 i)":
+Test "Imaginary part of: ctanh (0x1p+0 + 0xf.ffffffffffff8p+1020 i)":
+double: 1
+idouble: 1
+Test "Real part of: ctanh (0x1p+0 + 0xf.fffffp+124 i)":
+double: 1
float: 1
+idouble: 1
ifloat: 1
-
-# erf
-Test "erf (1.25)":
+Test "Imaginary part of: ctanh (0x1p+0 + 0xf.fffffp+124 i)":
double: 1
idouble: 1
-
-# erfc
-Test "erfc (0x1.f7303cp+1)":
+Test "Real part of: ctanh (0x4p-1076 + 0x1.921fb4p+0 i)":
double: 1
idouble: 1
-Test "erfc (0x1.ffa002p+2)":
+Test "Imaginary part of: ctanh (0x4p-1076 + 0x1.921fb4p+0 i)":
+double: 1
+idouble: 1
+Test "Real part of: ctanh (0x4p-1076 + 0x1.921fb54442d19p+0 i)":
+double: 2
+idouble: 2
+Test "Imaginary part of: ctanh (0x4p-1076 + 0x1.921fb54442d19p+0 i)":
+double: 1
+idouble: 1
+Test "Real part of: ctanh (0x8p-152 + 0x1.921fb4p+0 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: ctanh (0x8p-152 + 0x1.921fb4p+0 i)":
+double: 1
float: 1
+idouble: 1
ifloat: 1
-Test "erfc (2.0)":
+Test "Real part of: ctanh (0x8p-152 + 0x1.921fb54442d19p+0 i)":
+double: 2
+idouble: 2
+Test "Imaginary part of: ctanh (0x8p-152 + 0x1.921fb54442d19p+0 i)":
double: 1
idouble: 1
-Test "erfc (4.125)":
+Test "Real part of: ctanh (0x8p-152 + 0x1.921fb6p+0 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: ctanh (0x8p-152 + 0x1.921fb6p+0 i)":
+float: 1
+ifloat: 1
+Test "Real part of: ctanh (0xcp-4 + 0x1.4p+0 i)":
double: 1
+float: 1
idouble: 1
+ifloat: 1
+Test "Imaginary part of: ctanh (0xcp-4 + 0x1.4p+0 i)":
+float: 2
+ifloat: 2
-# exp10
-Test "exp10 (-1)":
+# ctanh_tonearest
+Test "Imaginary part of: ctanh_tonearest (+0 + 0x1.921fb4p+0 i)":
+double: 1
+float: 1
+idouble: 1
+ifloat: 1
+Test "Imaginary part of: ctanh_tonearest (+0 + 0x1.921fb54442d19p+0 i)":
+double: 1
+idouble: 1
+Test "Imaginary part of: ctanh_tonearest (+0 + 0x1.921fb6p+0 i)":
+float: 1
+ifloat: 1
+Test "Imaginary part of: ctanh_tonearest (+0 + 0xc.90fdaa22168cp-4 i)":
double: 1
idouble: 1
-Test "exp10 (-305)":
+Test "Imaginary part of: ctanh_tonearest (+0 + 0xc.90fdap-4 i)":
+double: 2
+float: 1
+idouble: 2
+ifloat: 1
+Test "Imaginary part of: ctanh_tonearest (+0 + 0xc.90fdbp-4 i)":
+float: 1
+ifloat: 1
+Test "Real part of: ctanh_tonearest (-0x2p+0 - 0x3p+0 i)":
double: 1
+float: 1
idouble: 1
-Test "exp10 (-36)":
+ifloat: 1
+Test "Imaginary part of: ctanh_tonearest (-0x2p+0 - 0x3p+0 i)":
double: 1
+float: 1
idouble: 1
-Test "exp10 (3)":
+ifloat: 1
+Test "Imaginary part of: ctanh_tonearest (0x1p+0 + 0x8p+1020 i)":
double: 1
idouble: 1
-Test "exp10 (36)":
+Test "Real part of: ctanh_tonearest (0x1p+0 + 0x8p+124 i)":
double: 1
idouble: 1
-
-# expm1
-Test "expm1 (0.75)":
+Test "Imaginary part of: ctanh_tonearest (0x1p+0 + 0xf.ffffffffffff8p+1020 i)":
double: 1
idouble: 1
-Test "expm1 (1)":
+Test "Real part of: ctanh_tonearest (0x1p+0 + 0xf.fffffp+124 i)":
+double: 1
float: 1
+idouble: 1
ifloat: 1
-Test "expm1 (500.0)":
+Test "Imaginary part of: ctanh_tonearest (0x1p+0 + 0xf.fffffp+124 i)":
double: 1
idouble: 1
-
-# fma
-Test "fma (-0x1.fffffffffffffp-711, 0x1.fffffffffffffp-275, 0x1.fffffe00007ffp-983)":
+Test "Real part of: ctanh_tonearest (0x4p-1076 + 0x1.921fb4p+0 i)":
double: 1
idouble: 1
-Test "fma (0x1.0000002p+0, 0x1.ffffffcp-1, -0x1p-300)":
+Test "Imaginary part of: ctanh_tonearest (0x4p-1076 + 0x1.921fb4p+0 i)":
double: 1
idouble: 1
-Test "fma (0x1.153d650bb9f06p-907, 0x1.2d01230d48407p-125, -0x0.b278d5acfc3cp-1022)":
+Test "Real part of: ctanh_tonearest (0x4p-1076 + 0x1.921fb54442d19p+0 i)":
+double: 2
+idouble: 2
+Test "Imaginary part of: ctanh_tonearest (0x4p-1076 + 0x1.921fb54442d19p+0 i)":
double: 1
idouble: 1
-Test "fma (0x1.4000004p-967, 0x1p-106, 0x0.000001p-1022)":
+Test "Real part of: ctanh_tonearest (0x8p-152 + 0x1.921fb4p+0 i)":
double: 1
idouble: 1
-Test "fma (0x1.7ff8p+13, 0x1.000002p+0, 0x1.ffffp-24)":
+Test "Imaginary part of: ctanh_tonearest (0x8p-152 + 0x1.921fb4p+0 i)":
+double: 1
float: 1
+idouble: 1
ifloat: 1
-Test "fma (0x1.7fffff8p-968, 0x1p-106, 0x0.000001p-1022)":
+Test "Real part of: ctanh_tonearest (0x8p-152 + 0x1.921fb54442d19p+0 i)":
+double: 2
+idouble: 2
+Test "Imaginary part of: ctanh_tonearest (0x8p-152 + 0x1.921fb54442d19p+0 i)":
double: 1
idouble: 1
-
-# hypot
-Test "hypot (-0.7, -12.4)":
+Test "Real part of: ctanh_tonearest (0x8p-152 + 0x1.921fb6p+0 i)":
float: 1
ifloat: 1
-Test "hypot (-0.7, 12.4)":
+Test "Imaginary part of: ctanh_tonearest (0x8p-152 + 0x1.921fb6p+0 i)":
float: 1
ifloat: 1
-Test "hypot (-12.4, -0.7)":
+Test "Real part of: ctanh_tonearest (0xcp-4 + 0x1.4p+0 i)":
+double: 1
float: 1
+idouble: 1
ifloat: 1
-Test "hypot (-12.4, 0.7)":
+Test "Imaginary part of: ctanh_tonearest (0xcp-4 + 0x1.4p+0 i)":
+float: 2
+ifloat: 2
+
+# erf
+Test "erf (0x1.4p+0)":
+double: 1
+idouble: 1
+
+# erfc
+Test "erfc (-0x8p-4)":
float: 1
ifloat: 1
-Test "hypot (0.7, -12.4)":
+Test "erfc (0x2p+0)":
+double: 1
+idouble: 1
+Test "erfc (0x3.ee6078p+0)":
+double: 1
+idouble: 1
+Test "erfc (0x4.2p+0)":
+double: 1
+idouble: 1
+Test "erfc (0x7.fe8008p+0)":
float: 1
ifloat: 1
-Test "hypot (0.7, 12.4)":
+Test "erfc (0x7.fffd6p+0)":
float: 1
ifloat: 1
-Test "hypot (12.4, -0.7)":
+
+# exp10
+Test "exp10 (-0x1.31p+8)":
+double: 1
+idouble: 1
+Test "exp10 (-0x1p+0)":
+double: 1
+idouble: 1
+Test "exp10 (-0x2.4p+4)":
+double: 1
+idouble: 1
+Test "exp10 (0x2.4p+4)":
+double: 1
+idouble: 1
+Test "exp10 (0x3p+0)":
+double: 1
+idouble: 1
+
+# exp10_tonearest
+Test "exp10_tonearest (-0x1.31p+8)":
+double: 1
+idouble: 1
+Test "exp10_tonearest (-0x1p+0)":
+double: 1
+idouble: 1
+Test "exp10_tonearest (-0x2.4p+4)":
+double: 1
+idouble: 1
+Test "exp10_tonearest (0x2.4p+4)":
+double: 1
+idouble: 1
+Test "exp10_tonearest (0x3p+0)":
+double: 1
+idouble: 1
+
+# expm1
+Test "expm1 (0x1.f4p+8)":
+double: 1
+idouble: 1
+Test "expm1 (0x1p+0)":
+double: 1
float: 1
+idouble: 1
ifloat: 1
-Test "hypot (12.4, 0.7)":
+Test "expm1 (0xcp-4)":
+double: 1
+idouble: 1
+
+# expm1_tonearest
+Test "expm1_tonearest (0x1.f4p+8)":
+double: 1
+idouble: 1
+Test "expm1_tonearest (0x1p+0)":
+double: 1
float: 1
+idouble: 1
ifloat: 1
+Test "expm1_tonearest (0xcp-4)":
+double: 1
+idouble: 1
-# j0
-Test "j0 (-4.0)":
+# gamma
+Test "gamma (-0x1p-20)":
+double: 1
+idouble: 1
+Test "gamma (-0x2p-16)":
double: 1
float: 1
idouble: 1
ifloat: 1
-Test "j0 (0.75)":
+Test "gamma (-0x4p-12)":
+double: 1
+idouble: 1
+Test "gamma (-0x8p-8)":
+double: 1
+idouble: 1
+Test "gamma (0x4p-12)":
float: 1
ifloat: 1
-Test "j0 (0x1.d7ce3ap+107)":
-float: 2
-ifloat: 2
-Test "j0 (10.0)":
-double: 2
+Test "gamma (0x4p-32)":
+double: 1
+idouble: 1
+Test "gamma (0xb.333333333333p-4)":
+double: 1
+idouble: 1
+Test "gamma (0xb.33333p-4)":
+double: 1
+idouble: 1
+
+# hypot
+Test "hypot (-0xb.33334p-4, -0xc.6666666666668p+0)":
+double: 1
+idouble: 1
+Test "hypot (-0xb.33334p-4, 0xc.6666666666668p+0)":
+double: 1
+idouble: 1
+Test "hypot (-0xc.6666666666668p+0, -0xb.33334p-4)":
+double: 1
+idouble: 1
+Test "hypot (-0xc.6666666666668p+0, 0xb.33334p-4)":
+double: 1
+idouble: 1
+Test "hypot (0xb.33334p-4, -0xc.6666666666668p+0)":
+double: 1
+idouble: 1
+Test "hypot (0xb.33334p-4, 0xc.6666666666668p+0)":
+double: 1
+idouble: 1
+Test "hypot (0xc.6666666666668p+0, -0xb.33334p-4)":
+double: 1
+idouble: 1
+Test "hypot (0xc.6666666666668p+0, 0xb.33334p-4)":
+double: 1
+idouble: 1
+
+# j0
+Test "j0 (-0x4p+0)":
+double: 1
float: 1
-idouble: 2
+idouble: 1
ifloat: 1
-Test "j0 (2.0)":
+Test "j0 (-0xf.fffffp+124)":
+double: 2
+float: 2
+idouble: 2
+ifloat: 2
+Test "j0 (0x2p+0)":
float: 2
ifloat: 2
-Test "j0 (4.0)":
+Test "j0 (0x4p+0)":
double: 1
float: 1
idouble: 1
ifloat: 1
-Test "j0 (8.0)":
+Test "j0 (0x8p+0)":
float: 1
ifloat: 1
+Test "j0 (0xap+0)":
+double: 2
+float: 1
+idouble: 2
+ifloat: 1
+Test "j0 (0xcp-4)":
+float: 1
+ifloat: 1
+Test "j0 (0xe.be71dp+104)":
+float: 2
+ifloat: 2
+Test "j0 (0xf.fffffp+124)":
+double: 2
+float: 2
+idouble: 2
+ifloat: 2
# j1
-Test "j1 (0x1.3ffp+74)":
+Test "j1 (0x1.ff00000000002p+840)":
double: 1
idouble: 1
-Test "j1 (0x1.ff00000000002p+840)":
+Test "j1 (0x2p+0)":
+double: 1
+idouble: 1
+Test "j1 (0x4.ffcp+72)":
+double: 1
+idouble: 1
+Test "j1 (0x8p+0)":
double: 1
idouble: 1
-Test "j1 (10.0)":
+Test "j1 (0xap+0)":
float: 2
ifloat: 2
-Test "j1 (2.0)":
+Test "j1 (0xf.ffffffffffff8p+1020)":
double: 1
idouble: 1
-Test "j1 (8.0)":
+Test "j1 (0xf.fffffp+124)":
double: 1
+float: 1
idouble: 1
+ifloat: 1
# jn
-Test "jn (0, -4.0)":
+Test "jn (0, -0x4p+0)":
double: 1
float: 1
idouble: 1
ifloat: 1
-Test "jn (0, 0.75)":
-float: 1
-ifloat: 1
-Test "jn (0, 10.0)":
-double: 2
-float: 1
-idouble: 2
-ifloat: 1
-Test "jn (0, 2.0)":
+Test "jn (0, 0x2p+0)":
float: 2
ifloat: 2
-Test "jn (0, 4.0)":
+Test "jn (0, 0x4p+0)":
double: 1
float: 1
idouble: 1
ifloat: 1
-Test "jn (0, 8.0)":
+Test "jn (0, 0x8p+0)":
float: 1
ifloat: 1
-Test "jn (1, 10.0)":
-float: 2
-ifloat: 2
-Test "jn (1, 2.0)":
+Test "jn (0, 0xap+0)":
+double: 2
+float: 1
+idouble: 2
+ifloat: 1
+Test "jn (0, 0xcp-4)":
+float: 1
+ifloat: 1
+Test "jn (1, 0x2p+0)":
double: 1
idouble: 1
-Test "jn (1, 8.0)":
+Test "jn (1, 0x8p+0)":
double: 1
idouble: 1
-Test "jn (10, 0.125)":
+Test "jn (1, 0xap+0)":
+float: 2
+ifloat: 2
+Test "jn (10, 0x2p+0)":
+double: 1
+float: 2
+idouble: 1
+ifloat: 2
+Test "jn (10, 0x2p-4)":
double: 1
float: 1
idouble: 1
ifloat: 1
-Test "jn (10, 0.75)":
+Test "jn (10, 0xap+0)":
+double: 4
+float: 2
+idouble: 4
+ifloat: 2
+Test "jn (10, 0xcp-4)":
double: 1
float: 1
idouble: 1
ifloat: 1
-Test "jn (10, 10.0)":
-double: 4
+Test "jn (2, 0x2.67a2a4p+0)":
+float: 1
+ifloat: 1
+Test "jn (2, 0x2.67a2a5d2e3682p+0)":
+double: 1
+idouble: 1
+Test "jn (2, 0x2.67a2a5d2e368p+0)":
+double: 2
+idouble: 2
+Test "jn (2, 0x2.67a2a8p+0)":
+double: 1
float: 3
-idouble: 4
+idouble: 1
ifloat: 3
-Test "jn (10, 2.0)":
+Test "jn (2, 0x8p+124)":
double: 1
-float: 2
idouble: 1
-ifloat: 2
-Test "jn (2, 0x1.ffff62p+99)":
+Test "jn (2, 0xf.fffb1p+96)":
double: 2
float: 2
idouble: 2
ifloat: 2
-Test "jn (2, 2.4048255576957729)":
+Test "jn (2, 0xf.fffffp+124)":
double: 2
-float: 1
+float: 2
idouble: 2
+ifloat: 2
+Test "jn (3, 0x2.67a2a4p+0)":
+double: 1
+float: 2
+idouble: 1
+ifloat: 2
+Test "jn (3, 0x2.67a2a5d2e3682p+0)":
+double: 1
+idouble: 1
+Test "jn (3, 0x2.67a2a5d2e368p+0)":
+double: 3
+idouble: 3
+Test "jn (3, 0x2.67a2a8p+0)":
+double: 1
+float: 3
+idouble: 1
+ifloat: 3
+Test "jn (3, 0x2p+0)":
+float: 1
ifloat: 1
-Test "jn (3, 0.125)":
+Test "jn (3, 0x2p-4)":
double: 1
float: 1
idouble: 1
ifloat: 1
-Test "jn (3, 0.75)":
+Test "jn (3, 0xap+0)":
+double: 3
+idouble: 3
+Test "jn (3, 0xcp-4)":
double: 1
float: 1
idouble: 1
ifloat: 1
-Test "jn (3, 10.0)":
-double: 3
+Test "jn (4, 0x2.67a2a4p+0)":
float: 1
-idouble: 3
ifloat: 1
-Test "jn (3, 2.0)":
+Test "jn (4, 0x2.67a2a5d2e3682p+0)":
+double: 1
+idouble: 1
+Test "jn (4, 0x2.67a2a5d2e368p+0)":
+double: 1
+idouble: 1
+Test "jn (4, 0x2.67a2a8p+0)":
float: 1
ifloat: 1
-Test "jn (3, 2.4048255576957729)":
-double: 3
-idouble: 3
-Test "jn (4, 2.4048255576957729)":
+Test "jn (5, 0x2.67a2a4p+0)":
double: 1
+float: 1
idouble: 1
-Test "jn (5, 2.4048255576957729)":
-double: 3
+ifloat: 1
+Test "jn (5, 0x2.67a2a5d2e3682p+0)":
+double: 1
+idouble: 1
+Test "jn (5, 0x2.67a2a5d2e368p+0)":
+double: 2
+idouble: 2
+Test "jn (5, 0x2.67a2a8p+0)":
+float: 2
+ifloat: 2
+Test "jn (6, 0x2.67a2a4p+0)":
+double: 2
float: 1
-idouble: 3
+idouble: 2
ifloat: 1
-Test "jn (6, 2.4048255576957729)":
+Test "jn (6, 0x2.67a2a5d2e3682p+0)":
+double: 2
+idouble: 2
+Test "jn (6, 0x2.67a2a5d2e368p+0)":
double: 4
-float: 3
idouble: 4
+Test "jn (6, 0x2.67a2a8p+0)":
+double: 2
+float: 3
+idouble: 2
ifloat: 3
-Test "jn (7, 2.4048255576957729)":
+Test "jn (7, 0x2.67a2a4p+0)":
+double: 2
+float: 1
+idouble: 2
+ifloat: 1
+Test "jn (7, 0x2.67a2a5d2e368p+0)":
double: 3
-float: 5
idouble: 3
-ifloat: 5
-Test "jn (8, 2.4048255576957729)":
-double: 3
+Test "jn (7, 0x2.67a2a8p+0)":
+double: 2
+float: 3
+idouble: 2
+ifloat: 3
+Test "jn (8, 0x2.67a2a4p+0)":
+double: 2
float: 2
-idouble: 3
+idouble: 2
ifloat: 2
-Test "jn (9, 2.4048255576957729)":
+Test "jn (8, 0x2.67a2a5d2e3682p+0)":
double: 1
-float: 2
idouble: 1
-ifloat: 2
+Test "jn (8, 0x2.67a2a5d2e368p+0)":
+double: 3
+idouble: 3
+Test "jn (8, 0x2.67a2a8p+0)":
+double: 2
+float: 4
+idouble: 2
+ifloat: 4
+Test "jn (9, 0x2.67a2a4p+0)":
+double: 3
+float: 3
+idouble: 3
+ifloat: 3
+Test "jn (9, 0x2.67a2a5d2e3682p+0)":
+double: 4
+idouble: 4
+Test "jn (9, 0x2.67a2a5d2e368p+0)":
+double: 1
+idouble: 1
+Test "jn (9, 0x2.67a2a8p+0)":
+double: 3
+float: 3
+idouble: 3
+ifloat: 3
# lgamma
-Test "lgamma (0.7)":
+Test "lgamma (-0x1p-20)":
+double: 1
+idouble: 1
+Test "lgamma (-0x2p-16)":
double: 1
float: 1
idouble: 1
ifloat: 1
-Test "lgamma (1.2)":
+Test "lgamma (-0x4p-12)":
double: 1
-float: 2
idouble: 1
-ifloat: 2
+Test "lgamma (-0x8p-8)":
+double: 1
+idouble: 1
+Test "lgamma (0x4p-12)":
+float: 1
+ifloat: 1
+Test "lgamma (0x4p-32)":
+double: 1
+idouble: 1
+Test "lgamma (0xb.333333333333p-4)":
+double: 1
+idouble: 1
+Test "lgamma (0xb.33333p-4)":
+double: 1
+idouble: 1
+
+# log
+Test "log (0x2.b7e15p+0)":
+float: 1
+ifloat: 1
# log10
-Test "log10 (0.75)":
+Test "log10 (0x2.b7e154p+0)":
+float: 1
+ifloat: 1
+Test "log10 (0xcp-4)":
double: 1
float: 2
idouble: 1
ifloat: 2
-Test "log10 (e)":
-float: 1
-ifloat: 1
# log1p
-Test "log1p (-0.25)":
+Test "log1p (-0x4p-4)":
+float: 1
+ifloat: 1
+Test "log1p (0x1.b7e15p+0)":
float: 1
ifloat: 1
# pow
-Test "pow (0x0.ffffffp0, -0x1p24)":
+Test "pow (0x1.000002p+0, 0x1p+24)":
+float: 1
+ifloat: 1
+Test "pow (0xf.fffffp-4, -0x1p+24)":
+float: 1
+ifloat: 1
+Test "pow (0xf.fffffp-4, 0x1p+24)":
+float: 1
+ifloat: 1
+
+# pow10
+Test "pow10 (-0x1.31p+8)":
+double: 1
+idouble: 1
+Test "pow10 (-0x1p+0)":
+double: 1
+idouble: 1
+Test "pow10 (-0x2.4p+4)":
+double: 1
+idouble: 1
+Test "pow10 (0x2.4p+4)":
+double: 1
+idouble: 1
+Test "pow10 (0x3p+0)":
+double: 1
+idouble: 1
+
+# pow_tonearest
+Test "pow_tonearest (0x1.000002p+0, 0x1p+24)":
float: 1
ifloat: 1
-Test "pow (0x0.ffffffp0, 0x1p24)":
+Test "pow_tonearest (0xf.fffffp-4, -0x1p+24)":
float: 1
ifloat: 1
-Test "pow (0x1.000002p0, 0x1p24)":
+Test "pow_tonearest (0xf.fffffp-4, 0x1p+24)":
+float: 1
+ifloat: 1
+
+# sin
+Test "sin (0x1p+0)":
float: 1
ifloat: 1
# sin_tonearest
-Test "sin_tonearest (1)":
+Test "sin_tonearest (0x1p+0)":
float: 1
ifloat: 1
# sincos
+Test "sincos (0x1.0c1522p+0) extra output 1":
+float: 1
+ifloat: 1
Test "sincos (0x1p+120) extra output 2":
float: 1
ifloat: 1
-Test "sincos (0x1p+127) extra output 2":
+Test "sincos (0x8.60a92p-4) extra output 2":
float: 1
ifloat: 1
-Test "sincos (M_PI_6l*2.0) extra output 1":
-double: 1
+Test "sincos (0x8p+124) extra output 2":
float: 1
-idouble: 1
ifloat: 1
-Test "sincos (M_PI_6l*2.0) extra output 2":
-double: 1
-idouble: 1
-Test "sincos (pi/6) extra output 2":
+Test "sincos (0xc.d4967p-4) extra output 2":
float: 1
ifloat: 1
# tgamma
-Test "tgamma (-0.5)":
+Test "tgamma (-0x1.000002p+0)":
+double: 2
+idouble: 2
+Test "tgamma (-0x1.3ffffep+4)":
+float: 2
+ifloat: 2
+Test "tgamma (-0x1.4000000000001p+4)":
double: 1
-float: 1
idouble: 1
+Test "tgamma (-0x1.400002p+4)":
+float: 1
ifloat: 1
-Test "tgamma (0.5)":
+Test "tgamma (-0x1.dffffep+4)":
+double: 1
float: 1
+idouble: 1
ifloat: 1
-Test "tgamma (0.7)":
+Test "tgamma (-0x1.e000000000001p+4)":
+double: 3
+idouble: 3
+Test "tgamma (-0x1.e00002p+4)":
double: 1
float: 1
idouble: 1
ifloat: 1
-
-# y0
-Test "y0 (0x1.3ffp+74)":
+Test "tgamma (-0x2.0000000000002p+0)":
double: 1
idouble: 1
-Test "y0 (0x1.ff00000000002p+840)":
+Test "tgamma (-0x2.000004p+0)":
+double: 2
+float: 1
+idouble: 2
+ifloat: 1
+Test "tgamma (-0x2.146544p+4)":
+float: 2
+ifloat: 2
+Test "tgamma (-0x2.7fffffffffffep+4)":
double: 1
idouble: 1
-Test "y0 (0x1p-10)":
+Test "tgamma (-0x2.8000000000002p+4)":
double: 1
idouble: 1
-Test "y0 (0x1p-110)":
+Test "tgamma (-0x2.800004p+4)":
+double: 2
+idouble: 2
+Test "tgamma (-0x2.8p+0)":
double: 1
+float: 2
idouble: 1
-Test "y0 (0x1p-20)":
+ifloat: 2
+Test "tgamma (-0x2.900004p+4)":
+double: 1
+idouble: 1
+Test "tgamma (-0x2.9ffffcp+4)":
+double: 1
+idouble: 1
+Test "tgamma (-0x2.fffffcp+0)":
+double: 1
float: 1
+idouble: 1
ifloat: 1
-Test "y0 (0x1p-30)":
+Test "tgamma (-0x3.000004p+0)":
+double: 2
float: 1
+idouble: 2
ifloat: 1
-Test "y0 (0x1p-40)":
+Test "tgamma (-0x3.1ffffcp+4)":
+double: 1
+idouble: 1
+Test "tgamma (-0x3.1fffffffffffep+4)":
+double: 3
+idouble: 3
+Test "tgamma (-0x3.8p+0)":
+double: 1
+float: 1
+idouble: 1
+ifloat: 1
+Test "tgamma (-0x3.fffffcp+0)":
double: 1
float: 1
idouble: 1
ifloat: 1
-Test "y0 (0x1p-50)":
+Test "tgamma (-0x3.ffffffffffffep+0)":
+double: 2
+idouble: 2
+Test "tgamma (-0x4.000008p+0)":
float: 1
ifloat: 1
-Test "y0 (0x1p-70)":
+Test "tgamma (-0x4.8p+0)":
double: 1
+float: 1
idouble: 1
-Test "y0 (0x1p-80)":
+ifloat: 1
+Test "tgamma (-0x4.fffff8p+0)":
+double: 1
+idouble: 1
+Test "tgamma (-0x4.ffffffffffffcp+0)":
+double: 1
+idouble: 1
+Test "tgamma (-0x5.000008p+0)":
double: 1
float: 1
idouble: 1
ifloat: 1
-Test "y0 (1.0)":
+Test "tgamma (-0x5.8p+0)":
+double: 1
+idouble: 1
+Test "tgamma (-0x5.ffffffffffffcp+0)":
+double: 1
+idouble: 1
+Test "tgamma (-0x6.000008p+0)":
+float: 2
+ifloat: 2
+Test "tgamma (-0x6.3fffffffffffcp+4)":
+double: 2
+idouble: 2
+Test "tgamma (-0x6.4000000000004p+4)":
+double: 1
+idouble: 1
+Test "tgamma (-0x6.400008p+4)":
+double: 1
+idouble: 1
+Test "tgamma (-0x6.8p+0)":
+float: 1
+ifloat: 1
+Test "tgamma (-0x6.fffff8p+0)":
double: 2
float: 1
idouble: 2
ifloat: 1
-Test "y0 (1.5)":
+Test "tgamma (-0x6.ffffffffffffcp+0)":
+double: 4
+idouble: 4
+Test "tgamma (-0x7.0000000000004p+0)":
+double: 3
+idouble: 3
+Test "tgamma (-0x7.000008p+0)":
+double: 1
+float: 1
+idouble: 1
+ifloat: 1
+Test "tgamma (-0x7.8p+0)":
double: 2
float: 1
idouble: 2
ifloat: 1
-Test "y0 (10.0)":
+Test "tgamma (-0x7.fffff8p+0)":
+double: 3
float: 1
+idouble: 3
ifloat: 1
-Test "y0 (8.0)":
+Test "tgamma (-0x7.ffffffffffffcp+0)":
+double: 3
+idouble: 3
+Test "tgamma (-0x8.00001p+0)":
+double: 2
+idouble: 2
+Test "tgamma (-0x8.8p+0)":
double: 1
float: 1
idouble: 1
ifloat: 1
-
-# y1
-Test "y1 (0.125)":
+Test "tgamma (-0x8p-4)":
double: 1
+float: 1
idouble: 1
-Test "y1 (0x1.27e204p+99)":
+ifloat: 1
+Test "tgamma (-0x9.6000000000008p+4)":
double: 1
idouble: 1
-Test "y1 (0x1p-10)":
+Test "tgamma (-0x9.60001p+4)":
double: 1
idouble: 1
-Test "y1 (1.5)":
+Test "tgamma (-0x9.8p+0)":
+double: 1
float: 1
+idouble: 1
ifloat: 1
-Test "y1 (10.0)":
-double: 3
+Test "tgamma (-0x9.ffffffffffff8p+0)":
+double: 1
+idouble: 1
+Test "tgamma (-0x9.fffffp+0)":
float: 1
-idouble: 3
ifloat: 1
-Test "y1 (2.0)":
+Test "tgamma (-0xa.00001p+0)":
+double: 1
+idouble: 1
+Test "tgamma (-0xa.c0001p+4)":
+double: 1
+idouble: 1
+Test "tgamma (-0xf.ffffffffffff8p-4)":
+double: 1
+idouble: 1
+Test "tgamma (-0xf.fffffp-4)":
+float: 1
+ifloat: 1
+Test "tgamma (0x1.28p+4)":
double: 1
float: 1
idouble: 1
ifloat: 1
-Test "y1 (8.0)":
+Test "tgamma (0x1.38p+4)":
+double: 2
+idouble: 2
+Test "tgamma (0x1.78p+4)":
+double: 1
+float: 1
+idouble: 1
+ifloat: 1
+Test "tgamma (0x1.d8p+4)":
+double: 1
+float: 1
+idouble: 1
+ifloat: 1
+Test "tgamma (0x1.e8p+4)":
+float: 1
+ifloat: 1
+Test "tgamma (0x1.fffffep+0)":
+float: 1
+ifloat: 1
+Test "tgamma (0x1.fffffffffffffp+0)":
+double: 1
+idouble: 1
+Test "tgamma (0x1p-24)":
+float: 1
+ifloat: 1
+Test "tgamma (0x2.18p+4)":
+float: 1
+ifloat: 1
+Test "tgamma (0x2.28p+4)":
double: 1
float: 2
idouble: 1
ifloat: 2
+Test "tgamma (0x2.30a43cp+4)":
+double: 1
+float: 2
+idouble: 1
+ifloat: 2
+Test "tgamma (0x2.8p+0)":
+float: 2
+ifloat: 2
+Test "tgamma (0x2.fffffcp+0)":
+float: 3
+ifloat: 3
+Test "tgamma (0x3.8p+0)":
+float: 2
+ifloat: 2
+Test "tgamma (0x3.fffffcp+0)":
+float: 1
+ifloat: 1
+Test "tgamma (0x3.ffffffffffffep+0)":
+double: 1
+idouble: 1
+Test "tgamma (0x3p+0)":
+float: 1
+ifloat: 1
+Test "tgamma (0x4.0000000000004p+0)":
+double: 1
+idouble: 1
+Test "tgamma (0x4.8p+0)":
+double: 1
+float: 1
+idouble: 1
+ifloat: 1
+Test "tgamma (0x4.ffffffffffffcp+0)":
+double: 1
+idouble: 1
+Test "tgamma (0x4p+0)":
+float: 1
+ifloat: 1
+Test "tgamma (0x5.0000000000004p+0)":
+double: 1
+idouble: 1
+Test "tgamma (0x5.000008p+0)":
+float: 2
+ifloat: 2
+Test "tgamma (0x5.fffff8p+0)":
+double: 1
+float: 1
+idouble: 1
+ifloat: 1
+Test "tgamma (0x6.0000000000004p+0)":
+double: 1
+idouble: 1
+Test "tgamma (0x6.000008p+0)":
+float: 2
+ifloat: 2
+Test "tgamma (0x6.8p+0)":
+float: 1
+ifloat: 1
+Test "tgamma (0x6.fffff8p+0)":
+double: 1
+idouble: 1
+Test "tgamma (0x6.ffffffffffffcp+0)":
+double: 4
+idouble: 4
+Test "tgamma (0x6p+0)":
+float: 1
+ifloat: 1
+Test "tgamma (0x7.0000000000004p+0)":
+double: 4
+idouble: 4
+Test "tgamma (0x7.000008p+0)":
+double: 1
+float: 1
+idouble: 1
+ifloat: 1
+Test "tgamma (0x7.8p+0)":
+double: 2
+float: 1
+idouble: 2
+ifloat: 1
+Test "tgamma (0x7.fffff8p+0)":
+double: 2
+float: 1
+idouble: 2
+ifloat: 1
+Test "tgamma (0x7.ffffffffffffcp+0)":
+double: 2
+idouble: 2
+Test "tgamma (0x7p+0)":
+double: 1
+idouble: 1
+Test "tgamma (0x8.00001p+0)":
+double: 2
+idouble: 2
+Test "tgamma (0x8.8p+0)":
+double: 1
+float: 1
+idouble: 1
+ifloat: 1
+Test "tgamma (0x8p+0)":
+double: 1
+idouble: 1
+Test "tgamma (0x8p-4)":
+float: 1
+ifloat: 1
+Test "tgamma (0x8p-56)":
+double: 1
+idouble: 1
+Test "tgamma (0x9.8p+0)":
+double: 1
+idouble: 1
+Test "tgamma (0x9p+0)":
+double: 1
+idouble: 1
+Test "tgamma (0xa.b9fd72b0fb238p+4)":
+double: 1
+idouble: 1
+Test "tgamma (0xa.b9fd7p+4)":
+double: 2
+idouble: 2
+Test "tgamma (0xap+0)":
+double: 1
+float: 1
+idouble: 1
+ifloat: 1
-# yn
-Test "yn (0, 1.0)":
+# y0
+Test "y0 (0x1.8p+0)":
double: 2
float: 1
idouble: 2
ifloat: 1
-Test "yn (0, 1.5)":
+Test "y0 (0x1.ff00000000002p+840)":
+double: 1
+idouble: 1
+Test "y0 (0x1p+0)":
double: 2
float: 1
idouble: 2
ifloat: 1
-Test "yn (0, 10.0)":
+Test "y0 (0x1p-20)":
+float: 1
+ifloat: 1
+Test "y0 (0x1p-40)":
+double: 1
+float: 1
+idouble: 1
+ifloat: 1
+Test "y0 (0x1p-80)":
+double: 1
+float: 1
+idouble: 1
+ifloat: 1
+Test "y0 (0x4.ffcp+72)":
+double: 1
+idouble: 1
+Test "y0 (0x4p-112)":
+double: 1
+idouble: 1
+Test "y0 (0x4p-12)":
+double: 1
+idouble: 1
+Test "y0 (0x4p-32)":
+float: 1
+ifloat: 1
+Test "y0 (0x4p-52)":
float: 1
ifloat: 1
-Test "yn (0, 8.0)":
+Test "y0 (0x4p-72)":
+double: 1
+idouble: 1
+Test "y0 (0x8p+0)":
double: 1
float: 1
idouble: 1
ifloat: 1
-Test "yn (1, 0.125)":
+Test "y0 (0xap+0)":
+float: 1
+ifloat: 1
+Test "y0 (0xf.ffffffffffff8p+1020)":
double: 1
idouble: 1
-Test "yn (1, 1.5)":
+Test "y0 (0xf.fffffp+124)":
+double: 1
+float: 1
+idouble: 1
+ifloat: 1
+
+# y1
+Test "y1 (0x1.8p+0)":
+float: 1
+ifloat: 1
+Test "y1 (0x2p+0)":
+double: 1
float: 1
+idouble: 1
ifloat: 1
-Test "yn (1, 10.0)":
+Test "y1 (0x2p-4)":
+double: 1
+idouble: 1
+Test "y1 (0x4p-12)":
+double: 1
+idouble: 1
+Test "y1 (0x8p+0)":
+double: 1
+float: 2
+idouble: 1
+ifloat: 2
+Test "y1 (0x9.3f102p+96)":
+double: 1
+idouble: 1
+Test "y1 (0xap+0)":
double: 3
float: 1
idouble: 3
ifloat: 1
-Test "yn (1, 2.0)":
+Test "y1 (0xf.fffffp+124)":
+double: 2
+float: 2
+idouble: 2
+ifloat: 2
+
+# yn
+Test "yn (-10, 0x1p+0)":
+double: 1
+float: 2
+idouble: 1
+ifloat: 2
+Test "yn (0, 0x1.8p+0)":
+double: 2
+float: 1
+idouble: 2
+ifloat: 1
+Test "yn (0, 0x1p+0)":
+double: 2
+float: 1
+idouble: 2
+ifloat: 1
+Test "yn (0, 0x8p+0)":
double: 1
float: 1
idouble: 1
ifloat: 1
-Test "yn (1, 8.0)":
+Test "yn (0, 0xap+0)":
+float: 1
+ifloat: 1
+Test "yn (1, 0x1.8p+0)":
+float: 1
+ifloat: 1
+Test "yn (1, 0x2p+0)":
+double: 1
+float: 1
+idouble: 1
+ifloat: 1
+Test "yn (1, 0x2p-4)":
+double: 1
+idouble: 1
+Test "yn (1, 0x8p+0)":
+double: 1
+float: 2
+idouble: 1
+ifloat: 2
+Test "yn (1, 0xap+0)":
+double: 3
+float: 1
+idouble: 3
+ifloat: 1
+Test "yn (10, 0x1p+0)":
double: 1
float: 2
idouble: 1
ifloat: 2
-Test "yn (10, 0.125)":
+Test "yn (10, 0x2p+0)":
+double: 2
+float: 1
+idouble: 2
+ifloat: 1
+Test "yn (10, 0x2p-4)":
double: 1
idouble: 1
-Test "yn (10, 0.75)":
+Test "yn (10, 0xap+0)":
double: 1
float: 1
idouble: 1
ifloat: 1
-Test "yn (10, 1.0)":
+Test "yn (10, 0xcp-4)":
double: 1
+float: 1
idouble: 1
-Test "yn (10, 10.0)":
+ifloat: 1
+Test "yn (2, 0x8p+124)":
double: 1
float: 1
idouble: 1
ifloat: 1
-Test "yn (10, 2.0)":
-double: 2
-idouble: 2
-Test "yn (3, 0.125)":
+Test "yn (2, 0xf.fffb1p+96)":
+double: 1
+idouble: 1
+Test "yn (2, 0xf.ffffffffffff8p+1020)":
double: 1
idouble: 1
-Test "yn (3, 0.75)":
+Test "yn (2, 0xf.fffffp+124)":
double: 1
float: 1
idouble: 1
ifloat: 1
-Test "yn (3, 10.0)":
+Test "yn (3, 0x2p+0)":
+double: 1
+idouble: 1
+Test "yn (3, 0x2p-4)":
+double: 1
+idouble: 1
+Test "yn (3, 0xap+0)":
double: 1
float: 1
idouble: 1
ifloat: 1
-Test "yn (3, 2.0)":
+Test "yn (3, 0xcp-4)":
double: 1
idouble: 1
# Maximal error of functions:
+Function: "acosh":
+double: 1
+idouble: 1
+
+Function: "asinh":
+double: 1
+float: 1
+ifloat: 1
+
Function: "atan2":
float: 1
ifloat: 1
@@ -1413,27 +5095,27 @@ ifloat: 1
Function: Real part of "cacos":
double: 1
-float: 1
+float: 2
idouble: 1
-ifloat: 1
+ifloat: 2
Function: Imaginary part of "cacos":
double: 1
-float: 1
+float: 2
idouble: 1
-ifloat: 1
+ifloat: 2
Function: Real part of "cacosh":
double: 1
-float: 1
+float: 2
idouble: 1
-ifloat: 1
+ifloat: 2
Function: Imaginary part of "cacosh":
double: 1
-float: 1
+float: 2
idouble: 1
-ifloat: 1
+ifloat: 2
Function: Real part of "casin":
double: 1
@@ -1443,15 +5125,15 @@ ifloat: 1
Function: Imaginary part of "casin":
double: 1
-float: 1
+float: 2
idouble: 1
-ifloat: 1
+ifloat: 2
Function: Real part of "casinh":
double: 1
-float: 1
+float: 2
idouble: 1
-ifloat: 1
+ifloat: 2
Function: Imaginary part of "casinh":
double: 1
@@ -1459,6 +5141,10 @@ float: 1
idouble: 1
ifloat: 1
+Function: Real part of "catan":
+float: 1
+ifloat: 1
+
Function: Imaginary part of "catan":
double: 1
float: 1
@@ -1466,12 +5152,20 @@ idouble: 1
ifloat: 1
Function: Real part of "catanh":
-double: 4
-idouble: 4
+double: 1
+float: 1
+idouble: 1
+ifloat: 1
+
+Function: Imaginary part of "catanh":
+float: 1
+ifloat: 1
Function: "cbrt":
double: 1
+float: 1
idouble: 1
+ifloat: 1
Function: Real part of "ccos":
double: 1
@@ -1532,15 +5226,25 @@ idouble: 1
ifloat: 1
Function: "cos":
-double: 2
float: 1
-idouble: 2
ifloat: 1
Function: "cos_tonearest":
float: 1
ifloat: 1
+Function: "cosh":
+double: 1
+float: 1
+idouble: 1
+ifloat: 1
+
+Function: "cosh_tonearest":
+double: 1
+float: 1
+idouble: 1
+ifloat: 1
+
Function: Real part of "cpow":
double: 2
float: 4
@@ -1548,9 +5252,7 @@ idouble: 2
ifloat: 4
Function: Imaginary part of "cpow":
-double: 2
float: 2
-idouble: 2
ifloat: 2
Function: Real part of "csin":
@@ -1588,36 +5290,46 @@ idouble: 1
ifloat: 1
Function: Imaginary part of "ctan":
-double: 1
-idouble: 1
+double: 2
+float: 1
+idouble: 2
+ifloat: 1
Function: Real part of "ctan_tonearest":
+double: 1
float: 1
+idouble: 1
ifloat: 1
Function: Imaginary part of "ctan_tonearest":
+double: 2
float: 1
+idouble: 2
ifloat: 1
Function: Real part of "ctanh":
-double: 1
+double: 2
float: 1
-idouble: 1
+idouble: 2
ifloat: 1
Function: Imaginary part of "ctanh":
-double: 1
+double: 2
float: 2
-idouble: 1
+idouble: 2
ifloat: 2
Function: Real part of "ctanh_tonearest":
+double: 2
float: 1
+idouble: 2
ifloat: 1
Function: Imaginary part of "ctanh_tonearest":
-float: 1
-ifloat: 1
+double: 2
+float: 2
+idouble: 2
+ifloat: 2
Function: "erf":
double: 1
@@ -1633,22 +5345,32 @@ Function: "exp10":
double: 1
idouble: 1
+Function: "exp10_tonearest":
+double: 1
+idouble: 1
+
Function: "expm1":
double: 1
float: 1
idouble: 1
ifloat: 1
-Function: "fma":
+Function: "expm1_tonearest":
double: 1
float: 1
idouble: 1
ifloat: 1
-Function: "hypot":
+Function: "gamma":
+double: 1
float: 1
+idouble: 1
ifloat: 1
+Function: "hypot":
+double: 1
+idouble: 1
+
Function: "j0":
double: 2
float: 2
@@ -1663,15 +5385,19 @@ ifloat: 2
Function: "jn":
double: 4
-float: 5
+float: 4
idouble: 4
-ifloat: 5
+ifloat: 4
Function: "lgamma":
double: 1
-float: 2
+float: 1
idouble: 1
-ifloat: 2
+ifloat: 1
+
+Function: "log":
+float: 1
+ifloat: 1
Function: "log10":
double: 1
@@ -1687,26 +5413,32 @@ Function: "pow":
float: 1
ifloat: 1
-Function: "sin_tonearest":
+Function: "pow10":
+double: 1
+idouble: 1
+
+Function: "pow_tonearest":
float: 1
ifloat: 1
-Function: "sincos":
-double: 1
+Function: "sin":
float: 1
-idouble: 1
ifloat: 1
-Function: "tan":
-double: 1
-idouble: 1
+Function: "sin_tonearest":
+float: 1
+ifloat: 1
-Function: "tgamma":
-double: 1
+Function: "sincos":
float: 1
-idouble: 1
ifloat: 1
+Function: "tgamma":
+double: 4
+float: 3
+idouble: 4
+ifloat: 3
+
Function: "y0":
double: 2
float: 1
diff --git a/ports/sysdeps/microblaze/libm-test-ulps_new b/ports/sysdeps/microblaze/libm-test-ulps_new
deleted file mode 100644
index 2f33c07..0000000
--- a/ports/sysdeps/microblaze/libm-test-ulps_new
+++ /dev/null
@@ -1,3032 +0,0 @@
-# Begin of automatic generation
-
-# atan2
-Test "atan2 (-0.75, -1.0) == -2.49809154479650885165983415456218025":
-float: 1
-ifloat: 1
-Test "atan2 (-max_value, -min_value) == -pi/2":
-float: 1
-ifloat: 1
-Test "atan2 (0.75, -1.0) == 2.49809154479650885165983415456218025":
-float: 1
-ifloat: 1
-Test "atan2 (1.390625, 0.9296875) == 0.981498387184244311516296577615519772":
-float: 1
-ifloat: 1
-
-# atanh
-Test "atanh (0.75) == 0.972955074527656652552676371721589865":
-float: 1
-ifloat: 1
-
-# cacos
-Test "Imaginary part of: cacos (+0 + 0.5 i) == pi/2 - 0.4812118250596034474977589134243684231352 i":
-float: 1
-ifloat: 1
-Test "Imaginary part of: cacos (+0 + 1.0 i) == pi/2 - 0.8813735870195430252326093249797923090282 i":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-Test "Imaginary part of: cacos (+0 + 1.5 i) == pi/2 - 1.194763217287109304111930828519090523536 i":
-double: 1
-idouble: 1
-Test "Imaginary part of: cacos (+0 - 0.5 i) == pi/2 + 0.4812118250596034474977589134243684231352 i":
-float: 1
-ifloat: 1
-Test "Imaginary part of: cacos (+0 - 1.0 i) == pi/2 + 0.8813735870195430252326093249797923090282 i":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-Test "Imaginary part of: cacos (+0 - 1.5 i) == pi/2 + 1.194763217287109304111930828519090523536 i":
-double: 1
-idouble: 1
-Test "Imaginary part of: cacos (-0 + 0.5 i) == pi/2 - 0.4812118250596034474977589134243684231352 i":
-float: 1
-ifloat: 1
-Test "Imaginary part of: cacos (-0 + 1.0 i) == pi/2 - 0.8813735870195430252326093249797923090282 i":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-Test "Imaginary part of: cacos (-0 + 1.5 i) == pi/2 - 1.194763217287109304111930828519090523536 i":
-double: 1
-idouble: 1
-Test "Imaginary part of: cacos (-0 - 0.5 i) == pi/2 + 0.4812118250596034474977589134243684231352 i":
-float: 1
-ifloat: 1
-Test "Imaginary part of: cacos (-0 - 1.0 i) == pi/2 + 0.8813735870195430252326093249797923090282 i":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-Test "Imaginary part of: cacos (-0 - 1.5 i) == pi/2 + 1.194763217287109304111930828519090523536 i":
-double: 1
-idouble: 1
-Test "Real part of: cacos (-0.25 + 1.0 i) == 1.747098759571863549650000258275841544745 - 8.924633639033482359562124741744951972772e-1 i":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-Test "Imaginary part of: cacos (-0.25 + 1.0 i) == 1.747098759571863549650000258275841544745 - 8.924633639033482359562124741744951972772e-1 i":
-float: 1
-ifloat: 1
-Test "Real part of: cacos (-0.25 - 1.0 i) == 1.747098759571863549650000258275841544745 + 8.924633639033482359562124741744951972772e-1 i":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-Test "Imaginary part of: cacos (-0.25 - 1.0 i) == 1.747098759571863549650000258275841544745 + 8.924633639033482359562124741744951972772e-1 i":
-float: 1
-ifloat: 1
-Test "Real part of: cacos (-0.5 + 1.0 i) == 1.920235389652109912858733517715121394831 - 9.261330313501824245501244453057873152694e-1 i":
-float: 1
-ifloat: 1
-Test "Imaginary part of: cacos (-0.5 + 1.0 i) == 1.920235389652109912858733517715121394831 - 9.261330313501824245501244453057873152694e-1 i":
-double: 1
-idouble: 1
-Test "Real part of: cacos (-0.5 - 1.0 i) == 1.920235389652109912858733517715121394831 + 9.261330313501824245501244453057873152694e-1 i":
-float: 1
-ifloat: 1
-Test "Imaginary part of: cacos (-0.5 - 1.0 i) == 1.920235389652109912858733517715121394831 + 9.261330313501824245501244453057873152694e-1 i":
-double: 1
-idouble: 1
-Test "Imaginary part of: cacos (-0x1.0000000000001p0 + 0.0 i) == 3.141592653589793238462643383279502884197 - 2.107342425544701550354780375182800088393e-8 i":
-double: 25216052
-idouble: 25216052
-Test "Imaginary part of: cacos (-0x1.0000000000001p0 + 0x1.fp-1025 i) == 3.141592653589793238462643383279502884197 - 2.107342425544701550354780375182800088393e-8 i":
-double: 25216052
-idouble: 25216052
-Test "Imaginary part of: cacos (-0x1.0000000000001p0 + 0x1p-52 i) == 3.141592643999491532482601997450598791535 - 2.315303644582684770975188768022139415020e-8 i":
-double: 20798466
-idouble: 20798466
-Test "Imaginary part of: cacos (-0x1.0000000000001p0 - 0.0 i) == 3.141592653589793238462643383279502884197 + 2.107342425544701550354780375182800088393e-8 i":
-double: 25216052
-idouble: 25216052
-Test "Imaginary part of: cacos (-0x1.0000000000001p0 - 0x1.fp-1025 i) == 3.141592653589793238462643383279502884197 + 2.107342425544701550354780375182800088393e-8 i":
-double: 25216052
-idouble: 25216052
-Test "Imaginary part of: cacos (-0x1.0000000000001p0 - 0x1p-52 i) == 3.141592643999491532482601997450598791535 + 2.315303644582684770975188768022139415020e-8 i":
-double: 20798466
-idouble: 20798466
-Test "Imaginary part of: cacos (-0x1.000002p0 + 0.0 i) == 3.141592653589793238462643383279502884197 - 4.882812451493617206486388134172712975070e-4 i":
-double: 4
-float: 2
-idouble: 4
-ifloat: 2
-Test "Imaginary part of: cacos (-0x1.000002p0 + 0x1.fp-129 i) == 3.141592653589793238462643383279502878367 - 4.882812451493617206486388134172712975070e-4 i":
-double: 4
-float: 2
-idouble: 4
-ifloat: 2
-Test "Imaginary part of: cacos (-0x1.000002p0 + 0x1p-23 i) == 3.141370441751352383825802745874586120521 - 5.364668491573609633134147164031476452679e-4 i":
-double: 327
-float: 431
-idouble: 327
-ifloat: 431
-Test "Imaginary part of: cacos (-0x1.000002p0 - 0.0 i) == 3.141592653589793238462643383279502884197 + 4.882812451493617206486388134172712975070e-4 i":
-double: 4
-float: 2
-idouble: 4
-ifloat: 2
-Test "Imaginary part of: cacos (-0x1.000002p0 - 0x1.fp-129 i) == 3.141592653589793238462643383279502878367 + 4.882812451493617206486388134172712975070e-4 i":
-double: 4
-float: 2
-idouble: 4
-ifloat: 2
-Test "Imaginary part of: cacos (-0x1.000002p0 - 0x1p-23 i) == 3.141370441751352383825802745874586120521 + 5.364668491573609633134147164031476452679e-4 i":
-double: 327
-float: 431
-idouble: 327
-ifloat: 431
-Test "Imaginary part of: cacos (-0x1.fp-10 + 1.0 i) == 1.572134236154454360143880041170803681211 - 8.813742198809567991336704287826445879025e-1 i":
-double: 1
-idouble: 1
-Test "Imaginary part of: cacos (-0x1.fp-10 - 1.0 i) == 1.572134236154454360143880041170803681211 + 8.813742198809567991336704287826445879025e-1 i":
-double: 1
-idouble: 1
-Test "Real part of: cacos (-0x1.fp-100 + 1.0 i) == 1.570796326794896619231321691640832196834 - 8.813735870195430252326093249797923090282e-1 i":
-float: 1
-ifloat: 1
-Test "Imaginary part of: cacos (-0x1.fp-100 + 1.0 i) == 1.570796326794896619231321691640832196834 - 8.813735870195430252326093249797923090282e-1 i":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-Test "Real part of: cacos (-0x1.fp-100 - 1.0 i) == 1.570796326794896619231321691640832196834 + 8.813735870195430252326093249797923090282e-1 i":
-float: 1
-ifloat: 1
-Test "Imaginary part of: cacos (-0x1.fp-100 - 1.0 i) == 1.570796326794896619231321691640832196834 + 8.813735870195430252326093249797923090282e-1 i":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-Test "Imaginary part of: cacos (-0x1.fp-1000 + 1.0 i) == 1.570796326794896619231321691639751442099 - 8.813735870195430252326093249797923090282e-1 i":
-double: 1
-idouble: 1
-Test "Imaginary part of: cacos (-0x1.fp-1000 - 1.0 i) == 1.570796326794896619231321691639751442099 + 8.813735870195430252326093249797923090282e-1 i":
-double: 1
-idouble: 1
-Test "Imaginary part of: cacos (-0x1.fp-1025 + 1.0 i) == 1.570796326794896619231321691639751442099 - 8.813735870195430252326093249797923090282e-1 i":
-double: 1
-idouble: 1
-Test "Imaginary part of: cacos (-0x1.fp-1025 + 1.5 i) == 1.570796326794896619231321691639751442099 - 1.194763217287109304111930828519090523536 i":
-double: 1
-idouble: 1
-Test "Imaginary part of: cacos (-0x1.fp-1025 - 1.0 i) == 1.570796326794896619231321691639751442099 + 8.813735870195430252326093249797923090282e-1 i":
-double: 1
-idouble: 1
-Test "Imaginary part of: cacos (-0x1.fp-1025 - 1.5 i) == 1.570796326794896619231321691639751442099 + 1.194763217287109304111930828519090523536 i":
-double: 1
-idouble: 1
-Test "Real part of: cacos (-0x1.fp-129 + 0x1.000002p0 i) == 1.570796326794896619231321691639751442101 - 8.813736713132375348727889167749389235161e-1 i":
-float: 1
-ifloat: 1
-Test "Real part of: cacos (-0x1.fp-129 + 1.0 i) == 1.570796326794896619231321691639751442101 - 8.813735870195430252326093249797923090282e-1 i":
-float: 1
-ifloat: 1
-Test "Imaginary part of: cacos (-0x1.fp-129 + 1.0 i) == 1.570796326794896619231321691639751442101 - 8.813735870195430252326093249797923090282e-1 i":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-Test "Real part of: cacos (-0x1.fp-129 + 1.5 i) == 1.570796326794896619231321691639751442100 - 1.194763217287109304111930828519090523536 i":
-float: 1
-ifloat: 1
-Test "Imaginary part of: cacos (-0x1.fp-129 + 1.5 i) == 1.570796326794896619231321691639751442100 - 1.194763217287109304111930828519090523536 i":
-double: 1
-idouble: 1
-Test "Real part of: cacos (-0x1.fp-129 - 0x1.000002p0 i) == 1.570796326794896619231321691639751442101 + 8.813736713132375348727889167749389235161e-1 i":
-float: 1
-ifloat: 1
-Test "Real part of: cacos (-0x1.fp-129 - 1.0 i) == 1.570796326794896619231321691639751442101 + 8.813735870195430252326093249797923090282e-1 i":
-float: 1
-ifloat: 1
-Test "Imaginary part of: cacos (-0x1.fp-129 - 1.0 i) == 1.570796326794896619231321691639751442101 + 8.813735870195430252326093249797923090282e-1 i":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-Test "Real part of: cacos (-0x1.fp-129 - 1.5 i) == 1.570796326794896619231321691639751442100 + 1.194763217287109304111930828519090523536 i":
-float: 1
-ifloat: 1
-Test "Imaginary part of: cacos (-0x1.fp-129 - 1.5 i) == 1.570796326794896619231321691639751442100 + 1.194763217287109304111930828519090523536 i":
-double: 1
-idouble: 1
-Test "Real part of: cacos (-0x1.fp-30 + 1.0 i) == 1.570796328070826603447840231892468927106 - 8.813735870195430258081932989769495326854e-1 i":
-float: 1
-ifloat: 1
-Test "Imaginary part of: cacos (-0x1.fp-30 + 1.0 i) == 1.570796328070826603447840231892468927106 - 8.813735870195430258081932989769495326854e-1 i":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-Test "Real part of: cacos (-0x1.fp-30 - 1.0 i) == 1.570796328070826603447840231892468927106 + 8.813735870195430258081932989769495326854e-1 i":
-float: 1
-ifloat: 1
-Test "Imaginary part of: cacos (-0x1.fp-30 - 1.0 i) == 1.570796328070826603447840231892468927106 + 8.813735870195430258081932989769495326854e-1 i":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-Test "Imaginary part of: cacos (-1.0 + 0.5 i) == 2.466703808003786858297978415967328452322 - 7.328576759736452608886724437653071523305e-1 i":
-float: 1
-ifloat: 1
-Test "Imaginary part of: cacos (-1.0 + 0x1.fp-10 i) == 3.098101355958774410750062883737683164607 - 4.350501469856803800217957402220976497152e-2 i":
-double: 6
-float: 17
-idouble: 6
-ifloat: 17
-Test "Imaginary part of: cacos (-1.0 + 0x1.fp-100 i) == 3.141592653589792002170605123018614219682 - 1.236292038260260888664514866457202186027e-15 i":
-double: 486654063623740
-float: 11676448
-idouble: 486654063623740
-ifloat: 11676448
-Test "Imaginary part of: cacos (-1.0 + 0x1.fp-1000 i) == 3.141592653589793238462643383279502884197 - 4.252291453851660175550490409247739011867e-151 i":
-double: 6268745377432003
-idouble: 6268745377432003
-Test "Imaginary part of: cacos (-1.0 + 0x1.fp-1025 i) == 3.141592653589793238462643383279502884197 - 7.340879205566679497036857179189356754017e-155 i":
-double: 8865344731827986
-idouble: 8865344731827986
-Test "Imaginary part of: cacos (-1.0 + 0x1.fp-129 i) == 3.141592653589793238409287030509680549213 - 5.335635276982233498398987585285818977933e-20 i":
-double: 8865344731827986
-float: 16512991
-idouble: 8865344731827986
-ifloat: 16512991
-Test "Real part of: cacos (-1.0 + 0x1.fp-30 i) == 3.141550174918818561961484385371624132331 - 4.247867098745151888768727039216644758847e-5 i":
-double: 43
-idouble: 43
-Test "Imaginary part of: cacos (-1.0 + 0x1.fp-30 i) == 3.141550174918818561961484385371624132331 - 4.247867098745151888768727039216644758847e-5 i":
-double: 2843582
-float: 11039
-idouble: 2843582
-ifloat: 11039
-Test "Real part of: cacos (-1.0 + 0x1p50 i) == 1.570796326794897507409741391764983781004 - 3.535050620855721078027883819436759661753e1 i":
-float: 1
-ifloat: 1
-Test "Imaginary part of: cacos (-1.0 - 0.5 i) == 2.466703808003786858297978415967328452322 + 7.328576759736452608886724437653071523305e-1 i":
-float: 1
-ifloat: 1
-Test "Imaginary part of: cacos (-1.0 - 0x1.fp-10 i) == 3.098101355958774410750062883737683164607 + 4.350501469856803800217957402220976497152e-2 i":
-double: 6
-float: 17
-idouble: 6
-ifloat: 17
-Test "Imaginary part of: cacos (-1.0 - 0x1.fp-100 i) == 3.141592653589792002170605123018614219682 + 1.236292038260260888664514866457202186027e-15 i":
-double: 486654063623740
-float: 11676448
-idouble: 486654063623740
-ifloat: 11676448
-Test "Imaginary part of: cacos (-1.0 - 0x1.fp-1000 i) == 3.141592653589793238462643383279502884197 + 4.252291453851660175550490409247739011867e-151 i":
-double: 6268745377432003
-idouble: 6268745377432003
-Test "Imaginary part of: cacos (-1.0 - 0x1.fp-1025 i) == 3.141592653589793238462643383279502884197 + 7.340879205566679497036857179189356754017e-155 i":
-double: 8865344731827986
-idouble: 8865344731827986
-Test "Imaginary part of: cacos (-1.0 - 0x1.fp-129 i) == 3.141592653589793238409287030509680549213 + 5.335635276982233498398987585285818977933e-20 i":
-double: 8865344731827986
-float: 16512991
-idouble: 8865344731827986
-ifloat: 16512991
-Test "Real part of: cacos (-1.0 - 0x1.fp-30 i) == 3.141550174918818561961484385371624132331 + 4.247867098745151888768727039216644758847e-5 i":
-double: 43
-idouble: 43
-Test "Imaginary part of: cacos (-1.0 - 0x1.fp-30 i) == 3.141550174918818561961484385371624132331 + 4.247867098745151888768727039216644758847e-5 i":
-double: 2843582
-float: 11039
-idouble: 2843582
-ifloat: 11039
-Test "Real part of: cacos (-1.0 - 0x1p50 i) == 1.570796326794897507409741391764983781004 + 3.535050620855721078027883819436759661753e1 i":
-float: 1
-ifloat: 1
-Test "Real part of: cacos (-2 - 3 i) == 2.1414491111159960199416055713254211 + 1.9833870299165354323470769028940395 i":
-float: 1
-ifloat: 1
-Test "Imaginary part of: cacos (0.25 + 1.0 i) == 1.394493894017929688812643125003661339452 - 8.924633639033482359562124741744951972772e-1 i":
-float: 1
-ifloat: 1
-Test "Imaginary part of: cacos (0.25 - 1.0 i) == 1.394493894017929688812643125003661339452 + 8.924633639033482359562124741744951972772e-1 i":
-float: 1
-ifloat: 1
-Test "Real part of: cacos (0.5 + +0 i) == 1.047197551196597746154214461093167628066 - 0 i":
-double: 1
-idouble: 1
-Test "Real part of: cacos (0.5 + 1.0 i) == 1.221357263937683325603909865564381489366 - 9.261330313501824245501244453057873152694e-1 i":
-float: 1
-ifloat: 1
-Test "Imaginary part of: cacos (0.5 + 1.0 i) == 1.221357263937683325603909865564381489366 - 9.261330313501824245501244453057873152694e-1 i":
-double: 1
-idouble: 1
-Test "Real part of: cacos (0.5 - 0 i) == 1.047197551196597746154214461093167628066 + +0 i":
-double: 1
-idouble: 1
-Test "Real part of: cacos (0.5 - 1.0 i) == 1.221357263937683325603909865564381489366 + 9.261330313501824245501244453057873152694e-1 i":
-float: 1
-ifloat: 1
-Test "Imaginary part of: cacos (0.5 - 1.0 i) == 1.221357263937683325603909865564381489366 + 9.261330313501824245501244453057873152694e-1 i":
-double: 1
-idouble: 1
-Test "Imaginary part of: cacos (0x1.0000000000001p0 + 0.0 i) == 0.0 - 2.107342425544701550354780375182800088393e-8 i":
-double: 25216052
-idouble: 25216052
-Test "Real part of: cacos (0x1.0000000000001p0 + 0x1.fp-1025 i) == 2.557178503953494342609835913586108008322e-301 - 2.107342425544701550354780375182800088393e-8 i":
-double: 2
-idouble: 2
-Test "Imaginary part of: cacos (0x1.0000000000001p0 + 0x1.fp-1025 i) == 2.557178503953494342609835913586108008322e-301 - 2.107342425544701550354780375182800088393e-8 i":
-double: 25216052
-idouble: 25216052
-Test "Imaginary part of: cacos (0x1.0000000000001p0 + 0x1p-52 i) == 9.590301705980041385828904092662391018164e-9 - 2.315303644582684770975188768022139415020e-8 i":
-double: 20798466
-idouble: 20798466
-Test "Imaginary part of: cacos (0x1.0000000000001p0 - 0.0 i) == 0.0 + 2.107342425544701550354780375182800088393e-8 i":
-double: 25216052
-idouble: 25216052
-Test "Real part of: cacos (0x1.0000000000001p0 - 0x1.fp-1025 i) == 2.557178503953494342609835913586108008322e-301 + 2.107342425544701550354780375182800088393e-8 i":
-double: 2
-idouble: 2
-Test "Imaginary part of: cacos (0x1.0000000000001p0 - 0x1.fp-1025 i) == 2.557178503953494342609835913586108008322e-301 + 2.107342425544701550354780375182800088393e-8 i":
-double: 25216052
-idouble: 25216052
-Test "Imaginary part of: cacos (0x1.0000000000001p0 - 0x1p-52 i) == 9.590301705980041385828904092662391018164e-9 + 2.315303644582684770975188768022139415020e-8 i":
-double: 20798466
-idouble: 20798466
-Test "Imaginary part of: cacos (0x1.000002p0 + 0.0 i) == 0.0 - 4.882812451493617206486388134172712975070e-4 i":
-double: 4
-float: 2
-idouble: 4
-ifloat: 2
-Test "Real part of: cacos (0x1.000002p0 + 0x1.fp-129 i) == 5.830451806317544230969669308596361881467e-36 - 4.882812451493617206486388134172712975070e-4 i":
-float: 2
-ifloat: 2
-Test "Imaginary part of: cacos (0x1.000002p0 + 0x1.fp-129 i) == 5.830451806317544230969669308596361881467e-36 - 4.882812451493617206486388134172712975070e-4 i":
-double: 4
-float: 2
-idouble: 4
-ifloat: 2
-Test "Real part of: cacos (0x1.000002p0 + 0x1p-23 i) == 2.222118384408546368406374049167636760903e-4 - 5.364668491573609633134147164031476452679e-4 i":
-float: 1
-ifloat: 1
-Test "Imaginary part of: cacos (0x1.000002p0 + 0x1p-23 i) == 2.222118384408546368406374049167636760903e-4 - 5.364668491573609633134147164031476452679e-4 i":
-double: 327
-float: 431
-idouble: 327
-ifloat: 431
-Test "Imaginary part of: cacos (0x1.000002p0 - 0.0 i) == 0.0 + 4.882812451493617206486388134172712975070e-4 i":
-double: 4
-float: 2
-idouble: 4
-ifloat: 2
-Test "Real part of: cacos (0x1.000002p0 - 0x1.fp-129 i) == 5.830451806317544230969669308596361881467e-36 + 4.882812451493617206486388134172712975070e-4 i":
-float: 2
-ifloat: 2
-Test "Imaginary part of: cacos (0x1.000002p0 - 0x1.fp-129 i) == 5.830451806317544230969669308596361881467e-36 + 4.882812451493617206486388134172712975070e-4 i":
-double: 4
-float: 2
-idouble: 4
-ifloat: 2
-Test "Real part of: cacos (0x1.000002p0 - 0x1p-23 i) == 2.222118384408546368406374049167636760903e-4 + 5.364668491573609633134147164031476452679e-4 i":
-float: 1
-ifloat: 1
-Test "Imaginary part of: cacos (0x1.000002p0 - 0x1p-23 i) == 2.222118384408546368406374049167636760903e-4 + 5.364668491573609633134147164031476452679e-4 i":
-double: 327
-float: 431
-idouble: 327
-ifloat: 431
-Test "Imaginary part of: cacos (0x1.fp-10 + 1.0 i) == 1.569458417435338878318763342108699202986 - 8.813742198809567991336704287826445879025e-1 i":
-double: 1
-idouble: 1
-Test "Imaginary part of: cacos (0x1.fp-10 - 1.0 i) == 1.569458417435338878318763342108699202986 + 8.813742198809567991336704287826445879025e-1 i":
-double: 1
-idouble: 1
-Test "Imaginary part of: cacos (0x1.fp-100 + 1.0 i) == 1.570796326794896619231321691638670687364 - 8.813735870195430252326093249797923090282e-1 i":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-Test "Imaginary part of: cacos (0x1.fp-100 - 1.0 i) == 1.570796326794896619231321691638670687364 + 8.813735870195430252326093249797923090282e-1 i":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-Test "Imaginary part of: cacos (0x1.fp-1000 + 1.0 i) == 1.570796326794896619231321691639751442099 - 8.813735870195430252326093249797923090282e-1 i":
-double: 1
-idouble: 1
-Test "Imaginary part of: cacos (0x1.fp-1000 - 1.0 i) == 1.570796326794896619231321691639751442099 + 8.813735870195430252326093249797923090282e-1 i":
-double: 1
-idouble: 1
-Test "Imaginary part of: cacos (0x1.fp-1025 + 1.0 i) == 1.570796326794896619231321691639751442099 - 8.813735870195430252326093249797923090282e-1 i":
-double: 1
-idouble: 1
-Test "Imaginary part of: cacos (0x1.fp-1025 + 1.5 i) == 1.570796326794896619231321691639751442099 - 1.194763217287109304111930828519090523536 i":
-double: 1
-idouble: 1
-Test "Imaginary part of: cacos (0x1.fp-1025 - 1.0 i) == 1.570796326794896619231321691639751442099 + 8.813735870195430252326093249797923090282e-1 i":
-double: 1
-idouble: 1
-Test "Imaginary part of: cacos (0x1.fp-1025 - 1.5 i) == 1.570796326794896619231321691639751442099 + 1.194763217287109304111930828519090523536 i":
-double: 1
-idouble: 1
-Test "Imaginary part of: cacos (0x1.fp-129 + 1.0 i) == 1.570796326794896619231321691639751442097 - 8.813735870195430252326093249797923090282e-1 i":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-Test "Imaginary part of: cacos (0x1.fp-129 + 1.5 i) == 1.570796326794896619231321691639751442097 - 1.194763217287109304111930828519090523536 i":
-double: 1
-idouble: 1
-Test "Imaginary part of: cacos (0x1.fp-129 - 1.0 i) == 1.570796326794896619231321691639751442097 + 8.813735870195430252326093249797923090282e-1 i":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-Test "Imaginary part of: cacos (0x1.fp-129 - 1.5 i) == 1.570796326794896619231321691639751442097 + 1.194763217287109304111930828519090523536 i":
-double: 1
-idouble: 1
-Test "Imaginary part of: cacos (0x1.fp-30 + 1.0 i) == 1.570796325518966635014803151387033957091 - 8.813735870195430258081932989769495326854e-1 i":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-Test "Imaginary part of: cacos (0x1.fp-30 - 1.0 i) == 1.570796325518966635014803151387033957091 + 8.813735870195430258081932989769495326854e-1 i":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-Test "Imaginary part of: cacos (0x1.fp1023 + 0x1.fp1023 i) == 7.853981633974483096156608458198757210493e-1 - 7.107906849659093345062145442726115449315e2 i":
-double: 1
-idouble: 1
-Test "Imaginary part of: cacos (0x1.fp127 + 0x1.fp127 i) == 7.853981633974483096156608458198757210493e-1 - 8.973081118419833726837456344608533993585e1 i":
-double: 1
-idouble: 1
-Test "Real part of: cacos (1.0 + 0.25 i) == 4.890443302710802929202843732146540079124e-1 - 5.097911466811016354623559941115413499164e-1 i":
-double: 1
-idouble: 1
-Test "Real part of: cacos (1.0 + 0.5 i) == 6.748888455860063801646649673121744318756e-1 - 7.328576759736452608886724437653071523305e-1 i":
-float: 1
-ifloat: 1
-Test "Imaginary part of: cacos (1.0 + 0.5 i) == 6.748888455860063801646649673121744318756e-1 - 7.328576759736452608886724437653071523305e-1 i":
-float: 1
-ifloat: 1
-Test "Real part of: cacos (1.0 + 0x1.fp-10 i) == 4.349129763101882771258049954181971959031e-2 - 4.350501469856803800217957402220976497152e-2 i":
-float: 6
-ifloat: 6
-Test "Imaginary part of: cacos (1.0 + 0x1.fp-10 i) == 4.349129763101882771258049954181971959031e-2 - 4.350501469856803800217957402220976497152e-2 i":
-double: 6
-float: 17
-idouble: 6
-ifloat: 17
-Test "Imaginary part of: cacos (1.0 + 0x1.fp-100 i) == 1.236292038260260888664514866456887257525e-15 - 1.236292038260260888664514866457202186027e-15 i":
-double: 486654063623740
-float: 11676448
-idouble: 486654063623740
-ifloat: 11676448
-Test "Imaginary part of: cacos (1.0 + 0x1.fp-1000 i) == 4.252291453851660175550490409247739011867e-151 - 4.252291453851660175550490409247739011867e-151 i":
-double: 6268745377432003
-idouble: 6268745377432003
-Test "Imaginary part of: cacos (1.0 + 0x1.fp-1025 i) == 7.340879205566679497036857179189356754017e-155 - 7.340879205566679497036857179189356754017e-155 i":
-double: 8865344731827986
-idouble: 8865344731827986
-Test "Imaginary part of: cacos (1.0 + 0x1.fp-129 i) == 5.335635276982233498398987585285818977930e-20 - 5.335635276982233498398987585285818977933e-20 i":
-double: 8865344731827986
-float: 16512991
-idouble: 8865344731827986
-ifloat: 16512991
-Test "Real part of: cacos (1.0 + 0x1.fp-30 i) == 4.247867097467650115899790787875186617316e-5 - 4.247867098745151888768727039216644758847e-5 i":
-double: 2827891
-idouble: 2827891
-Test "Imaginary part of: cacos (1.0 + 0x1.fp-30 i) == 4.247867097467650115899790787875186617316e-5 - 4.247867098745151888768727039216644758847e-5 i":
-double: 2843582
-float: 11039
-idouble: 2843582
-ifloat: 11039
-Test "Real part of: cacos (1.0 - 0.25 i) == 4.890443302710802929202843732146540079124e-1 + 5.097911466811016354623559941115413499164e-1 i":
-double: 1
-idouble: 1
-Test "Real part of: cacos (1.0 - 0.5 i) == 6.748888455860063801646649673121744318756e-1 + 7.328576759736452608886724437653071523305e-1 i":
-float: 1
-ifloat: 1
-Test "Imaginary part of: cacos (1.0 - 0.5 i) == 6.748888455860063801646649673121744318756e-1 + 7.328576759736452608886724437653071523305e-1 i":
-float: 1
-ifloat: 1
-Test "Real part of: cacos (1.0 - 0x1.fp-10 i) == 4.349129763101882771258049954181971959031e-2 + 4.350501469856803800217957402220976497152e-2 i":
-float: 6
-ifloat: 6
-Test "Imaginary part of: cacos (1.0 - 0x1.fp-10 i) == 4.349129763101882771258049954181971959031e-2 + 4.350501469856803800217957402220976497152e-2 i":
-double: 6
-float: 17
-idouble: 6
-ifloat: 17
-Test "Imaginary part of: cacos (1.0 - 0x1.fp-100 i) == 1.236292038260260888664514866456887257525e-15 + 1.236292038260260888664514866457202186027e-15 i":
-double: 486654063623740
-float: 11676448
-idouble: 486654063623740
-ifloat: 11676448
-Test "Imaginary part of: cacos (1.0 - 0x1.fp-1000 i) == 4.252291453851660175550490409247739011867e-151 + 4.252291453851660175550490409247739011867e-151 i":
-double: 6268745377432003
-idouble: 6268745377432003
-Test "Imaginary part of: cacos (1.0 - 0x1.fp-1025 i) == 7.340879205566679497036857179189356754017e-155 + 7.340879205566679497036857179189356754017e-155 i":
-double: 8865344731827986
-idouble: 8865344731827986
-Test "Imaginary part of: cacos (1.0 - 0x1.fp-129 i) == 5.335635276982233498398987585285818977930e-20 + 5.335635276982233498398987585285818977933e-20 i":
-double: 8865344731827986
-float: 16512991
-idouble: 8865344731827986
-ifloat: 16512991
-Test "Real part of: cacos (1.0 - 0x1.fp-30 i) == 4.247867097467650115899790787875186617316e-5 + 4.247867098745151888768727039216644758847e-5 i":
-double: 2827891
-idouble: 2827891
-Test "Imaginary part of: cacos (1.0 - 0x1.fp-30 i) == 4.247867097467650115899790787875186617316e-5 + 4.247867098745151888768727039216644758847e-5 i":
-double: 2843582
-float: 11039
-idouble: 2843582
-ifloat: 11039
-
-# cacosh
-Test "Real part of: cacosh (+0 + 0.5 i) == 0.4812118250596034474977589134243684231352 + pi/2 i":
-float: 1
-ifloat: 1
-Test "Real part of: cacosh (+0 + 1.0 i) == 0.8813735870195430252326093249797923090282 + pi/2 i":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-Test "Real part of: cacosh (+0 + 1.5 i) == 1.194763217287109304111930828519090523536 + pi/2 i":
-double: 1
-idouble: 1
-Test "Real part of: cacosh (+0 - 0.5 i) == 0.4812118250596034474977589134243684231352 - pi/2 i":
-float: 1
-ifloat: 1
-Test "Real part of: cacosh (+0 - 1.0 i) == 0.8813735870195430252326093249797923090282 - pi/2 i":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-Test "Real part of: cacosh (+0 - 1.5 i) == 1.194763217287109304111930828519090523536 - pi/2 i":
-double: 1
-idouble: 1
-Test "Real part of: cacosh (-0 + 0.5 i) == 0.4812118250596034474977589134243684231352 + pi/2 i":
-float: 1
-ifloat: 1
-Test "Real part of: cacosh (-0 + 1.0 i) == 0.8813735870195430252326093249797923090282 + pi/2 i":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-Test "Real part of: cacosh (-0 + 1.5 i) == 1.194763217287109304111930828519090523536 + pi/2 i":
-double: 1
-idouble: 1
-Test "Real part of: cacosh (-0 - 0.5 i) == 0.4812118250596034474977589134243684231352 - pi/2 i":
-float: 1
-ifloat: 1
-Test "Real part of: cacosh (-0 - 1.0 i) == 0.8813735870195430252326093249797923090282 - pi/2 i":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-Test "Real part of: cacosh (-0 - 1.5 i) == 1.194763217287109304111930828519090523536 - pi/2 i":
-double: 1
-idouble: 1
-Test "Imaginary part of: cacosh (-0.5 + +0 i) == +0 + 2.094395102393195492308428922186335256131 i":
-double: 1
-idouble: 1
-Test "Imaginary part of: cacosh (-0.5 - 0 i) == +0 - 2.094395102393195492308428922186335256131 i":
-double: 1
-idouble: 1
-Test "Real part of: cacosh (-1.5 + +0 i) == 0.9624236501192068949955178268487368462704 + pi i":
-float: 1
-ifloat: 1
-Test "Real part of: cacosh (-1.5 - 0 i) == 0.9624236501192068949955178268487368462704 - pi i":
-float: 1
-ifloat: 1
-Test "Imaginary part of: cacosh (-2 - 3 i) == 1.9833870299165354323470769028940395 - 2.1414491111159960199416055713254211 i":
-float: 1
-ifloat: 1
-Test "Real part of: cacosh (1.5 + +0 i) == 0.9624236501192068949955178268487368462704 + +0 i":
-float: 1
-ifloat: 1
-Test "Real part of: cacosh (1.5 - 0 i) == 0.9624236501192068949955178268487368462704 - 0 i":
-float: 1
-ifloat: 1
-
-# casin
-Test "Imaginary part of: casin (+0 + 0.5 i) == +0 + 0.4812118250596034474977589134243684231352 i":
-float: 1
-ifloat: 1
-Test "Imaginary part of: casin (+0 + 1.0 i) == +0 + 0.8813735870195430252326093249797923090282 i":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-Test "Imaginary part of: casin (+0 + 1.5 i) == +0 + 1.194763217287109304111930828519090523536 i":
-double: 1
-idouble: 1
-Test "Imaginary part of: casin (+0 - 0.5 i) == +0 - 0.4812118250596034474977589134243684231352 i":
-float: 1
-ifloat: 1
-Test "Imaginary part of: casin (+0 - 1.0 i) == +0 - 0.8813735870195430252326093249797923090282 i":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-Test "Imaginary part of: casin (+0 - 1.5 i) == +0 - 1.194763217287109304111930828519090523536 i":
-double: 1
-idouble: 1
-Test "Imaginary part of: casin (-0 + 0.5 i) == -0 + 0.4812118250596034474977589134243684231352 i":
-float: 1
-ifloat: 1
-Test "Imaginary part of: casin (-0 + 1.0 i) == -0 + 0.8813735870195430252326093249797923090282 i":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-Test "Imaginary part of: casin (-0 + 1.5 i) == -0 + 1.194763217287109304111930828519090523536 i":
-double: 1
-idouble: 1
-Test "Imaginary part of: casin (-0 - 0.5 i) == -0 - 0.4812118250596034474977589134243684231352 i":
-float: 1
-ifloat: 1
-Test "Imaginary part of: casin (-0 - 1.0 i) == -0 - 0.8813735870195430252326093249797923090282 i":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-Test "Imaginary part of: casin (-0 - 1.5 i) == -0 - 1.194763217287109304111930828519090523536 i":
-double: 1
-idouble: 1
-Test "Imaginary part of: casin (-0.25 + 1.0 i) == -1.763024327769669304186785666360901026468e-1 + 8.924633639033482359562124741744951972772e-1 i":
-float: 1
-ifloat: 1
-Test "Imaginary part of: casin (-0.25 - 1.0 i) == -1.763024327769669304186785666360901026468e-1 - 8.924633639033482359562124741744951972772e-1 i":
-float: 1
-ifloat: 1
-Test "Imaginary part of: casin (-0.5 + 1.0 i) == -3.494390628572132936274118260753699527325e-1 + 9.261330313501824245501244453057873152694e-1 i":
-double: 1
-idouble: 1
-Test "Imaginary part of: casin (-0.5 - 1.0 i) == -3.494390628572132936274118260753699527325e-1 - 9.261330313501824245501244453057873152694e-1 i":
-double: 1
-idouble: 1
-Test "Imaginary part of: casin (-0x1.0000000000001p0 + 0.0 i) == -1.570796326794896619231321691639751442099 + 2.107342425544701550354780375182800088393e-8 i":
-double: 25216052
-idouble: 25216052
-Test "Imaginary part of: casin (-0x1.0000000000001p0 + 0x1.fp-1025 i) == -1.570796326794896619231321691639751442099 + 2.107342425544701550354780375182800088393e-8 i":
-double: 25216052
-idouble: 25216052
-Test "Imaginary part of: casin (-0x1.0000000000001p0 + 0x1p-52 i) == -1.570796317204594913251280305810847349436 + 2.315303644582684770975188768022139415020e-8 i":
-double: 20798466
-idouble: 20798466
-Test "Imaginary part of: casin (-0x1.0000000000001p0 - 0.0 i) == -1.570796326794896619231321691639751442099 - 2.107342425544701550354780375182800088393e-8 i":
-double: 25216052
-idouble: 25216052
-Test "Imaginary part of: casin (-0x1.0000000000001p0 - 0x1.fp-1025 i) == -1.570796326794896619231321691639751442099 - 2.107342425544701550354780375182800088393e-8 i":
-double: 25216052
-idouble: 25216052
-Test "Imaginary part of: casin (-0x1.0000000000001p0 - 0x1p-52 i) == -1.570796317204594913251280305810847349436 - 2.315303644582684770975188768022139415020e-8 i":
-double: 20798466
-idouble: 20798466
-Test "Imaginary part of: casin (-0x1.000002p0 + 0.0 i) == -1.570796326794896619231321691639751442099 + 4.882812451493617206486388134172712975070e-4 i":
-double: 4
-float: 2
-idouble: 4
-ifloat: 2
-Test "Imaginary part of: casin (-0x1.000002p0 + 0x1.fp-129 i) == -1.570796326794896619231321691639751436268 + 4.882812451493617206486388134172712975070e-4 i":
-double: 4
-float: 2
-idouble: 4
-ifloat: 2
-Test "Imaginary part of: casin (-0x1.000002p0 + 0x1p-23 i) == -1.570574114956455764594481054234834678422 + 5.364668491573609633134147164031476452679e-4 i":
-double: 327
-float: 431
-idouble: 327
-ifloat: 431
-Test "Imaginary part of: casin (-0x1.000002p0 - 0.0 i) == -1.570796326794896619231321691639751442099 - 4.882812451493617206486388134172712975070e-4 i":
-double: 4
-float: 2
-idouble: 4
-ifloat: 2
-Test "Imaginary part of: casin (-0x1.000002p0 - 0x1.fp-129 i) == -1.570796326794896619231321691639751436268 - 4.882812451493617206486388134172712975070e-4 i":
-double: 4
-float: 2
-idouble: 4
-ifloat: 2
-Test "Imaginary part of: casin (-0x1.000002p0 - 0x1p-23 i) == -1.570574114956455764594481054234834678422 - 5.364668491573609633134147164031476452679e-4 i":
-double: 327
-float: 431
-idouble: 327
-ifloat: 431
-Test "Real part of: casin (-0x1.fp-10 + 1.0 i) == -1.337909359557740912558349531052239112857e-3 + 8.813742198809567991336704287826445879025e-1 i":
-float: 1
-ifloat: 1
-Test "Imaginary part of: casin (-0x1.fp-10 + 1.0 i) == -1.337909359557740912558349531052239112857e-3 + 8.813742198809567991336704287826445879025e-1 i":
-double: 1
-idouble: 1
-Test "Real part of: casin (-0x1.fp-10 - 1.0 i) == -1.337909359557740912558349531052239112857e-3 - 8.813742198809567991336704287826445879025e-1 i":
-float: 1
-ifloat: 1
-Test "Imaginary part of: casin (-0x1.fp-10 - 1.0 i) == -1.337909359557740912558349531052239112857e-3 - 8.813742198809567991336704287826445879025e-1 i":
-double: 1
-idouble: 1
-Test "Imaginary part of: casin (-0x1.fp-100 + 1.0 i) == -1.080754735021050612990719608916167354321e-30 + 8.813735870195430252326093249797923090282e-1 i":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-Test "Imaginary part of: casin (-0x1.fp-100 - 1.0 i) == -1.080754735021050612990719608916167354321e-30 - 8.813735870195430252326093249797923090282e-1 i":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-Test "Imaginary part of: casin (-0x1.fp-1000 + 1.0 i) == -1.278589251976747242280879285935084814093e-301 + 8.813735870195430252326093249797923090282e-1 i":
-double: 1
-idouble: 1
-Test "Imaginary part of: casin (-0x1.fp-1000 - 1.0 i) == -1.278589251976747242280879285935084814093e-301 - 8.813735870195430252326093249797923090282e-1 i":
-double: 1
-idouble: 1
-Test "Imaginary part of: casin (-0x1.fp-1025 + 1.0 i) == -3.810492908885321743133304375216617626230e-309 + 8.813735870195430252326093249797923090282e-1 i":
-double: 1
-idouble: 1
-Test "Imaginary part of: casin (-0x1.fp-1025 + 1.5 i) == -2.989196569048182929051881765490354365918e-309 + 1.194763217287109304111930828519090523536 i":
-double: 1
-idouble: 1
-Test "Imaginary part of: casin (-0x1.fp-1025 - 1.0 i) == -3.810492908885321743133304375216617626230e-309 - 8.813735870195430252326093249797923090282e-1 i":
-double: 1
-idouble: 1
-Test "Imaginary part of: casin (-0x1.fp-1025 - 1.5 i) == -2.989196569048182929051881765490354365918e-309 - 1.194763217287109304111930828519090523536 i":
-double: 1
-idouble: 1
-Test "Imaginary part of: casin (-0x1.fp-129 + 1.0 i) == -2.013062564695348242280482517399205554874e-39 + 8.813735870195430252326093249797923090282e-1 i":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-Test "Imaginary part of: casin (-0x1.fp-129 + 1.5 i) == -1.579176199917649005841160751101628985741e-39 + 1.194763217287109304111930828519090523536 i":
-double: 1
-idouble: 1
-Test "Imaginary part of: casin (-0x1.fp-129 - 1.0 i) == -2.013062564695348242280482517399205554874e-39 - 8.813735870195430252326093249797923090282e-1 i":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-Test "Imaginary part of: casin (-0x1.fp-129 - 1.5 i) == -1.579176199917649005841160751101628985741e-39 - 1.194763217287109304111930828519090523536 i":
-double: 1
-idouble: 1
-Test "Imaginary part of: casin (-0x1.fp-30 + 1.0 i) == -1.275929984216518540252717485007112529021e-9 + 8.813735870195430258081932989769495326854e-1 i":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-Test "Imaginary part of: casin (-0x1.fp-30 - 1.0 i) == -1.275929984216518540252717485007112529021e-9 - 8.813735870195430258081932989769495326854e-1 i":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-Test "Real part of: casin (-0x1p-23 + 0x1.000002p0 i) == -8.429369199749229560964789467980644296420e-8 + 8.813736713132400470205730751186547909968e-1 i":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-Test "Real part of: casin (-0x1p-23 - 0x1.000002p0 i) == -8.429369199749229560964789467980644296420e-8 - 8.813736713132400470205730751186547909968e-1 i":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-Test "Real part of: casin (-1.0 + 0.25 i) == -1.081751996523816326311037318425097434186 + 5.097911466811016354623559941115413499164e-1 i":
-double: 1
-idouble: 1
-Test "Real part of: casin (-1.0 + 0.5 i) == -8.959074812088902390666567243275770102229e-1 + 7.328576759736452608886724437653071523305e-1 i":
-float: 1
-ifloat: 1
-Test "Imaginary part of: casin (-1.0 + 0.5 i) == -8.959074812088902390666567243275770102229e-1 + 7.328576759736452608886724437653071523305e-1 i":
-float: 1
-ifloat: 1
-Test "Imaginary part of: casin (-1.0 + 0x1.fp-10 i) == -1.527305029163877791518741192097931722508 + 4.350501469856803800217957402220976497152e-2 i":
-double: 6
-float: 17
-idouble: 6
-ifloat: 17
-Test "Imaginary part of: casin (-1.0 + 0x1.fp-100 i) == -1.570796326794895382939283431378862777584 + 1.236292038260260888664514866457202186027e-15 i":
-double: 486654063623740
-float: 11676448
-idouble: 486654063623740
-ifloat: 11676448
-Test "Imaginary part of: casin (-1.0 + 0x1.fp-1000 i) == -1.570796326794896619231321691639751442099 + 4.252291453851660175550490409247739011867e-151 i":
-double: 6268745377432003
-idouble: 6268745377432003
-Test "Imaginary part of: casin (-1.0 + 0x1.fp-1025 i) == -1.570796326794896619231321691639751442099 + 7.340879205566679497036857179189356754017e-155 i":
-double: 8865344731827986
-idouble: 8865344731827986
-Test "Imaginary part of: casin (-1.0 + 0x1.fp-129 i) == -1.570796326794896619177965338869929107115 + 5.335635276982233498398987585285818977933e-20 i":
-double: 8865344731827986
-float: 16512991
-idouble: 8865344731827986
-ifloat: 16512991
-Test "Real part of: casin (-1.0 + 0x1.fp-30 i) == -1.570753848123921942730162693731872690232 + 4.247867098745151888768727039216644758847e-5 i":
-double: 86
-idouble: 86
-Test "Imaginary part of: casin (-1.0 + 0x1.fp-30 i) == -1.570753848123921942730162693731872690232 + 4.247867098745151888768727039216644758847e-5 i":
-double: 2843582
-float: 11039
-idouble: 2843582
-ifloat: 11039
-Test "Real part of: casin (-1.0 - 0.25 i) == -1.081751996523816326311037318425097434186 - 5.097911466811016354623559941115413499164e-1 i":
-double: 1
-idouble: 1
-Test "Real part of: casin (-1.0 - 0.5 i) == -8.959074812088902390666567243275770102229e-1 - 7.328576759736452608886724437653071523305e-1 i":
-float: 1
-ifloat: 1
-Test "Imaginary part of: casin (-1.0 - 0.5 i) == -8.959074812088902390666567243275770102229e-1 - 7.328576759736452608886724437653071523305e-1 i":
-float: 1
-ifloat: 1
-Test "Imaginary part of: casin (-1.0 - 0x1.fp-10 i) == -1.527305029163877791518741192097931722508 - 4.350501469856803800217957402220976497152e-2 i":
-double: 6
-float: 17
-idouble: 6
-ifloat: 17
-Test "Imaginary part of: casin (-1.0 - 0x1.fp-100 i) == -1.570796326794895382939283431378862777584 - 1.236292038260260888664514866457202186027e-15 i":
-double: 486654063623740
-float: 11676448
-idouble: 486654063623740
-ifloat: 11676448
-Test "Imaginary part of: casin (-1.0 - 0x1.fp-1000 i) == -1.570796326794896619231321691639751442099 - 4.252291453851660175550490409247739011867e-151 i":
-double: 6268745377432003
-idouble: 6268745377432003
-Test "Imaginary part of: casin (-1.0 - 0x1.fp-1025 i) == -1.570796326794896619231321691639751442099 - 7.340879205566679497036857179189356754017e-155 i":
-double: 8865344731827986
-idouble: 8865344731827986
-Test "Imaginary part of: casin (-1.0 - 0x1.fp-129 i) == -1.570796326794896619177965338869929107115 - 5.335635276982233498398987585285818977933e-20 i":
-double: 8865344731827986
-float: 16512991
-idouble: 8865344731827986
-ifloat: 16512991
-Test "Real part of: casin (-1.0 - 0x1.fp-30 i) == -1.570753848123921942730162693731872690232 - 4.247867098745151888768727039216644758847e-5 i":
-double: 86
-idouble: 86
-Test "Imaginary part of: casin (-1.0 - 0x1.fp-30 i) == -1.570753848123921942730162693731872690232 - 4.247867098745151888768727039216644758847e-5 i":
-double: 2843582
-float: 11039
-idouble: 2843582
-ifloat: 11039
-Test "Imaginary part of: casin (0.25 + 1.0 i) == 1.763024327769669304186785666360901026468e-1 + 8.924633639033482359562124741744951972772e-1 i":
-float: 1
-ifloat: 1
-Test "Imaginary part of: casin (0.25 - 1.0 i) == 1.763024327769669304186785666360901026468e-1 - 8.924633639033482359562124741744951972772e-1 i":
-float: 1
-ifloat: 1
-Test "Imaginary part of: casin (0.5 + 1.0 i) == 3.494390628572132936274118260753699527325e-1 + 9.261330313501824245501244453057873152694e-1 i":
-double: 1
-idouble: 1
-Test "Imaginary part of: casin (0.5 - 1.0 i) == 3.494390628572132936274118260753699527325e-1 - 9.261330313501824245501244453057873152694e-1 i":
-double: 1
-idouble: 1
-Test "Real part of: casin (0.75 + 1.25 i) == 0.453276177638793913448921196101971749 + 1.13239363160530819522266333696834467 i":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-Test "Imaginary part of: casin (0x1.0000000000001p0 + 0.0 i) == 1.570796326794896619231321691639751442099 + 2.107342425544701550354780375182800088393e-8 i":
-double: 25216052
-idouble: 25216052
-Test "Imaginary part of: casin (0x1.0000000000001p0 + 0x1.fp-1025 i) == 1.570796326794896619231321691639751442099 + 2.107342425544701550354780375182800088393e-8 i":
-double: 25216052
-idouble: 25216052
-Test "Imaginary part of: casin (0x1.0000000000001p0 + 0x1p-52 i) == 1.570796317204594913251280305810847349436 + 2.315303644582684770975188768022139415020e-8 i":
-double: 20798466
-idouble: 20798466
-Test "Imaginary part of: casin (0x1.0000000000001p0 - 0.0 i) == 1.570796326794896619231321691639751442099 - 2.107342425544701550354780375182800088393e-8 i":
-double: 25216052
-idouble: 25216052
-Test "Imaginary part of: casin (0x1.0000000000001p0 - 0x1.fp-1025 i) == 1.570796326794896619231321691639751442099 - 2.107342425544701550354780375182800088393e-8 i":
-double: 25216052
-idouble: 25216052
-Test "Imaginary part of: casin (0x1.0000000000001p0 - 0x1p-52 i) == 1.570796317204594913251280305810847349436 - 2.315303644582684770975188768022139415020e-8 i":
-double: 20798466
-idouble: 20798466
-Test "Imaginary part of: casin (0x1.000002p0 + 0.0 i) == 1.570796326794896619231321691639751442099 + 4.882812451493617206486388134172712975070e-4 i":
-double: 4
-float: 2
-idouble: 4
-ifloat: 2
-Test "Imaginary part of: casin (0x1.000002p0 + 0x1.fp-129 i) == 1.570796326794896619231321691639751436268 + 4.882812451493617206486388134172712975070e-4 i":
-double: 4
-float: 2
-idouble: 4
-ifloat: 2
-Test "Imaginary part of: casin (0x1.000002p0 + 0x1p-23 i) == 1.570574114956455764594481054234834678422 + 5.364668491573609633134147164031476452679e-4 i":
-double: 327
-float: 431
-idouble: 327
-ifloat: 431
-Test "Imaginary part of: casin (0x1.000002p0 - 0.0 i) == 1.570796326794896619231321691639751442099 - 4.882812451493617206486388134172712975070e-4 i":
-double: 4
-float: 2
-idouble: 4
-ifloat: 2
-Test "Imaginary part of: casin (0x1.000002p0 - 0x1.fp-129 i) == 1.570796326794896619231321691639751436268 - 4.882812451493617206486388134172712975070e-4 i":
-double: 4
-float: 2
-idouble: 4
-ifloat: 2
-Test "Imaginary part of: casin (0x1.000002p0 - 0x1p-23 i) == 1.570574114956455764594481054234834678422 - 5.364668491573609633134147164031476452679e-4 i":
-double: 327
-float: 431
-idouble: 327
-ifloat: 431
-Test "Real part of: casin (0x1.fp-10 + 1.0 i) == 1.337909359557740912558349531052239112857e-3 + 8.813742198809567991336704287826445879025e-1 i":
-float: 1
-ifloat: 1
-Test "Imaginary part of: casin (0x1.fp-10 + 1.0 i) == 1.337909359557740912558349531052239112857e-3 + 8.813742198809567991336704287826445879025e-1 i":
-double: 1
-idouble: 1
-Test "Real part of: casin (0x1.fp-10 - 1.0 i) == 1.337909359557740912558349531052239112857e-3 - 8.813742198809567991336704287826445879025e-1 i":
-float: 1
-ifloat: 1
-Test "Imaginary part of: casin (0x1.fp-10 - 1.0 i) == 1.337909359557740912558349531052239112857e-3 - 8.813742198809567991336704287826445879025e-1 i":
-double: 1
-idouble: 1
-Test "Imaginary part of: casin (0x1.fp-100 + 1.0 i) == 1.080754735021050612990719608916167354321e-30 + 8.813735870195430252326093249797923090282e-1 i":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-Test "Imaginary part of: casin (0x1.fp-100 - 1.0 i) == 1.080754735021050612990719608916167354321e-30 - 8.813735870195430252326093249797923090282e-1 i":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-Test "Imaginary part of: casin (0x1.fp-1000 + 1.0 i) == 1.278589251976747242280879285935084814093e-301 + 8.813735870195430252326093249797923090282e-1 i":
-double: 1
-idouble: 1
-Test "Imaginary part of: casin (0x1.fp-1000 - 1.0 i) == 1.278589251976747242280879285935084814093e-301 - 8.813735870195430252326093249797923090282e-1 i":
-double: 1
-idouble: 1
-Test "Imaginary part of: casin (0x1.fp-1025 + 1.0 i) == 3.810492908885321743133304375216617626230e-309 + 8.813735870195430252326093249797923090282e-1 i":
-double: 1
-idouble: 1
-Test "Imaginary part of: casin (0x1.fp-1025 + 1.5 i) == 2.989196569048182929051881765490354365918e-309 + 1.194763217287109304111930828519090523536 i":
-double: 1
-idouble: 1
-Test "Imaginary part of: casin (0x1.fp-1025 - 1.0 i) == 3.810492908885321743133304375216617626230e-309 - 8.813735870195430252326093249797923090282e-1 i":
-double: 1
-idouble: 1
-Test "Imaginary part of: casin (0x1.fp-1025 - 1.5 i) == 2.989196569048182929051881765490354365918e-309 - 1.194763217287109304111930828519090523536 i":
-double: 1
-idouble: 1
-Test "Imaginary part of: casin (0x1.fp-129 + 1.0 i) == 2.013062564695348242280482517399205554874e-39 + 8.813735870195430252326093249797923090282e-1 i":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-Test "Imaginary part of: casin (0x1.fp-129 + 1.5 i) == 1.579176199917649005841160751101628985741e-39 + 1.194763217287109304111930828519090523536 i":
-double: 1
-idouble: 1
-Test "Imaginary part of: casin (0x1.fp-129 - 1.0 i) == 2.013062564695348242280482517399205554874e-39 - 8.813735870195430252326093249797923090282e-1 i":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-Test "Imaginary part of: casin (0x1.fp-129 - 1.5 i) == 1.579176199917649005841160751101628985741e-39 - 1.194763217287109304111930828519090523536 i":
-double: 1
-idouble: 1
-Test "Imaginary part of: casin (0x1.fp-30 + 1.0 i) == 1.275929984216518540252717485007112529021e-9 + 8.813735870195430258081932989769495326854e-1 i":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-Test "Imaginary part of: casin (0x1.fp-30 - 1.0 i) == 1.275929984216518540252717485007112529021e-9 - 8.813735870195430258081932989769495326854e-1 i":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-Test "Imaginary part of: casin (0x1.fp1023 + 0x1.fp1023 i) == 7.853981633974483096156608458198757210493e-1 + 7.107906849659093345062145442726115449315e2 i":
-double: 1
-idouble: 1
-Test "Imaginary part of: casin (0x1.fp127 + 0x1.fp127 i) == 7.853981633974483096156608458198757210493e-1 + 8.973081118419833726837456344608533993585e1 i":
-double: 1
-idouble: 1
-Test "Real part of: casin (0x1p-23 + 0x1.000002p0 i) == 8.429369199749229560964789467980644296420e-8 + 8.813736713132400470205730751186547909968e-1 i":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-Test "Real part of: casin (0x1p-23 - 0x1.000002p0 i) == 8.429369199749229560964789467980644296420e-8 - 8.813736713132400470205730751186547909968e-1 i":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-Test "Real part of: casin (1.0 + 0.25 i) == 1.081751996523816326311037318425097434186 + 5.097911466811016354623559941115413499164e-1 i":
-double: 1
-idouble: 1
-Test "Real part of: casin (1.0 + 0.5 i) == 8.959074812088902390666567243275770102229e-1 + 7.328576759736452608886724437653071523305e-1 i":
-float: 1
-ifloat: 1
-Test "Imaginary part of: casin (1.0 + 0.5 i) == 8.959074812088902390666567243275770102229e-1 + 7.328576759736452608886724437653071523305e-1 i":
-float: 1
-ifloat: 1
-Test "Imaginary part of: casin (1.0 + 0x1.fp-10 i) == 1.527305029163877791518741192097931722508 + 4.350501469856803800217957402220976497152e-2 i":
-double: 6
-float: 17
-idouble: 6
-ifloat: 17
-Test "Imaginary part of: casin (1.0 + 0x1.fp-100 i) == 1.570796326794895382939283431378862777584 + 1.236292038260260888664514866457202186027e-15 i":
-double: 486654063623740
-float: 11676448
-idouble: 486654063623740
-ifloat: 11676448
-Test "Imaginary part of: casin (1.0 + 0x1.fp-1000 i) == 1.570796326794896619231321691639751442099 + 4.252291453851660175550490409247739011867e-151 i":
-double: 6268745377432003
-idouble: 6268745377432003
-Test "Imaginary part of: casin (1.0 + 0x1.fp-1025 i) == 1.570796326794896619231321691639751442099 + 7.340879205566679497036857179189356754017e-155 i":
-double: 8865344731827986
-idouble: 8865344731827986
-Test "Imaginary part of: casin (1.0 + 0x1.fp-129 i) == 1.570796326794896619177965338869929107115 + 5.335635276982233498398987585285818977933e-20 i":
-double: 8865344731827986
-float: 16512991
-idouble: 8865344731827986
-ifloat: 16512991
-Test "Real part of: casin (1.0 + 0x1.fp-30 i) == 1.570753848123921942730162693731872690232 + 4.247867098745151888768727039216644758847e-5 i":
-double: 86
-idouble: 86
-Test "Imaginary part of: casin (1.0 + 0x1.fp-30 i) == 1.570753848123921942730162693731872690232 + 4.247867098745151888768727039216644758847e-5 i":
-double: 2843582
-float: 11039
-idouble: 2843582
-ifloat: 11039
-Test "Real part of: casin (1.0 - 0.25 i) == 1.081751996523816326311037318425097434186 - 5.097911466811016354623559941115413499164e-1 i":
-double: 1
-idouble: 1
-Test "Real part of: casin (1.0 - 0.5 i) == 8.959074812088902390666567243275770102229e-1 - 7.328576759736452608886724437653071523305e-1 i":
-float: 1
-ifloat: 1
-Test "Imaginary part of: casin (1.0 - 0.5 i) == 8.959074812088902390666567243275770102229e-1 - 7.328576759736452608886724437653071523305e-1 i":
-float: 1
-ifloat: 1
-Test "Imaginary part of: casin (1.0 - 0x1.fp-10 i) == 1.527305029163877791518741192097931722508 - 4.350501469856803800217957402220976497152e-2 i":
-double: 6
-float: 17
-idouble: 6
-ifloat: 17
-Test "Imaginary part of: casin (1.0 - 0x1.fp-100 i) == 1.570796326794895382939283431378862777584 - 1.236292038260260888664514866457202186027e-15 i":
-double: 486654063623740
-float: 11676448
-idouble: 486654063623740
-ifloat: 11676448
-Test "Imaginary part of: casin (1.0 - 0x1.fp-1000 i) == 1.570796326794896619231321691639751442099 - 4.252291453851660175550490409247739011867e-151 i":
-double: 6268745377432003
-idouble: 6268745377432003
-Test "Imaginary part of: casin (1.0 - 0x1.fp-1025 i) == 1.570796326794896619231321691639751442099 - 7.340879205566679497036857179189356754017e-155 i":
-double: 8865344731827986
-idouble: 8865344731827986
-Test "Imaginary part of: casin (1.0 - 0x1.fp-129 i) == 1.570796326794896619177965338869929107115 - 5.335635276982233498398987585285818977933e-20 i":
-double: 8865344731827986
-float: 16512991
-idouble: 8865344731827986
-ifloat: 16512991
-Test "Real part of: casin (1.0 - 0x1.fp-30 i) == 1.570753848123921942730162693731872690232 - 4.247867098745151888768727039216644758847e-5 i":
-double: 86
-idouble: 86
-Test "Imaginary part of: casin (1.0 - 0x1.fp-30 i) == 1.570753848123921942730162693731872690232 - 4.247867098745151888768727039216644758847e-5 i":
-double: 2843582
-float: 11039
-idouble: 2843582
-ifloat: 11039
-
-# casinh
-Test "Real part of: casinh (-0.0 + 0x1.0000000000001p0 i) == -2.107342425544701550354780375182800088393e-8 + 1.570796326794896619231321691639751442099 i":
-double: 25216052
-idouble: 25216052
-Test "Real part of: casinh (-0.0 + 0x1.000002p0 i) == -4.882812451493617206486388134172712975070e-4 + 1.570796326794896619231321691639751442099 i":
-double: 4
-float: 2
-idouble: 4
-ifloat: 2
-Test "Real part of: casinh (-0.0 - 0x1.0000000000001p0 i) == -2.107342425544701550354780375182800088393e-8 - 1.570796326794896619231321691639751442099 i":
-double: 25216052
-idouble: 25216052
-Test "Real part of: casinh (-0.0 - 0x1.000002p0 i) == -4.882812451493617206486388134172712975070e-4 - 1.570796326794896619231321691639751442099 i":
-double: 4
-float: 2
-idouble: 4
-ifloat: 2
-Test "Imaginary part of: casinh (-0.25 + 1.0 i) == -5.097911466811016354623559941115413499164e-1 + 1.081751996523816326311037318425097434186 i":
-double: 1
-idouble: 1
-Test "Imaginary part of: casinh (-0.25 - 1.0 i) == -5.097911466811016354623559941115413499164e-1 - 1.081751996523816326311037318425097434186 i":
-double: 1
-idouble: 1
-Test "Real part of: casinh (-0.5 + +0 i) == -0.4812118250596034474977589134243684231352 + +0 i":
-float: 1
-ifloat: 1
-Test "Real part of: casinh (-0.5 + 1.0 i) == -7.328576759736452608886724437653071523305e-1 + 8.959074812088902390666567243275770102229e-1 i":
-float: 1
-ifloat: 1
-Test "Imaginary part of: casinh (-0.5 + 1.0 i) == -7.328576759736452608886724437653071523305e-1 + 8.959074812088902390666567243275770102229e-1 i":
-float: 1
-ifloat: 1
-Test "Real part of: casinh (-0.5 - 0 i) == -0.4812118250596034474977589134243684231352 - 0 i":
-float: 1
-ifloat: 1
-Test "Real part of: casinh (-0.5 - 1.0 i) == -7.328576759736452608886724437653071523305e-1 - 8.959074812088902390666567243275770102229e-1 i":
-float: 1
-ifloat: 1
-Test "Imaginary part of: casinh (-0.5 - 1.0 i) == -7.328576759736452608886724437653071523305e-1 - 8.959074812088902390666567243275770102229e-1 i":
-float: 1
-ifloat: 1
-Test "Imaginary part of: casinh (-0x1.000002p0 + 0x1p-23 i) == -8.813736713132400470205730751186547909968e-1 + 8.429369199749229560964789467980644296420e-8 i":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-Test "Imaginary part of: casinh (-0x1.000002p0 - 0x1p-23 i) == -8.813736713132400470205730751186547909968e-1 - 8.429369199749229560964789467980644296420e-8 i":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-Test "Real part of: casinh (-0x1.fp-10 + 1.0 i) == -4.350501469856803800217957402220976497152e-2 + 1.527305029163877791518741192097931722508 i":
-double: 6
-float: 17
-idouble: 6
-ifloat: 17
-Test "Real part of: casinh (-0x1.fp-10 - 1.0 i) == -4.350501469856803800217957402220976497152e-2 - 1.527305029163877791518741192097931722508 i":
-double: 6
-float: 17
-idouble: 6
-ifloat: 17
-Test "Real part of: casinh (-0x1.fp-100 + 1.0 i) == -1.236292038260260888664514866457202186027e-15 + 1.570796326794895382939283431378862777584 i":
-double: 486654063623740
-float: 11676448
-idouble: 486654063623740
-ifloat: 11676448
-Test "Real part of: casinh (-0x1.fp-100 - 1.0 i) == -1.236292038260260888664514866457202186027e-15 - 1.570796326794895382939283431378862777584 i":
-double: 486654063623740
-float: 11676448
-idouble: 486654063623740
-ifloat: 11676448
-Test "Real part of: casinh (-0x1.fp-1000 + 1.0 i) == -4.252291453851660175550490409247739011867e-151 + 1.570796326794896619231321691639751442099 i":
-double: 6268745377432003
-idouble: 6268745377432003
-Test "Real part of: casinh (-0x1.fp-1000 - 1.0 i) == -4.252291453851660175550490409247739011867e-151 - 1.570796326794896619231321691639751442099 i":
-double: 6268745377432003
-idouble: 6268745377432003
-Test "Real part of: casinh (-0x1.fp-1025 + 0x1.0000000000001p0 i) == -2.107342425544701550354780375182800088393e-8 + 1.570796326794896619231321691639751442099 i":
-double: 25216052
-idouble: 25216052
-Test "Real part of: casinh (-0x1.fp-1025 + 1.0 i) == -7.340879205566679497036857179189356754017e-155 + 1.570796326794896619231321691639751442099 i":
-double: 8865344731827986
-idouble: 8865344731827986
-Test "Real part of: casinh (-0x1.fp-1025 - 0x1.0000000000001p0 i) == -2.107342425544701550354780375182800088393e-8 - 1.570796326794896619231321691639751442099 i":
-double: 25216052
-idouble: 25216052
-Test "Real part of: casinh (-0x1.fp-1025 - 1.0 i) == -7.340879205566679497036857179189356754017e-155 - 1.570796326794896619231321691639751442099 i":
-double: 8865344731827986
-idouble: 8865344731827986
-Test "Real part of: casinh (-0x1.fp-129 + 0x1.000002p0 i) == -4.882812451493617206486388134172712975070e-4 + 1.570796326794896619231321691639751436268 i":
-double: 4
-float: 2
-idouble: 4
-ifloat: 2
-Test "Real part of: casinh (-0x1.fp-129 + 1.0 i) == -5.335635276982233498398987585285818977933e-20 + 1.570796326794896619177965338869929107115 i":
-double: 8865344731827986
-float: 16512991
-idouble: 8865344731827986
-ifloat: 16512991
-Test "Real part of: casinh (-0x1.fp-129 - 0x1.000002p0 i) == -4.882812451493617206486388134172712975070e-4 - 1.570796326794896619231321691639751436268 i":
-double: 4
-float: 2
-idouble: 4
-ifloat: 2
-Test "Real part of: casinh (-0x1.fp-129 - 1.0 i) == -5.335635276982233498398987585285818977933e-20 - 1.570796326794896619177965338869929107115 i":
-double: 8865344731827986
-float: 16512991
-idouble: 8865344731827986
-ifloat: 16512991
-Test "Real part of: casinh (-0x1.fp-30 + 1.0 i) == -4.247867098745151888768727039216644758847e-5 + 1.570753848123921942730162693731872690232 i":
-double: 2843582
-float: 11039
-idouble: 2843582
-ifloat: 11039
-Test "Imaginary part of: casinh (-0x1.fp-30 + 1.0 i) == -4.247867098745151888768727039216644758847e-5 + 1.570753848123921942730162693731872690232 i":
-double: 86
-idouble: 86
-Test "Real part of: casinh (-0x1.fp-30 - 1.0 i) == -4.247867098745151888768727039216644758847e-5 - 1.570753848123921942730162693731872690232 i":
-double: 2843582
-float: 11039
-idouble: 2843582
-ifloat: 11039
-Test "Imaginary part of: casinh (-0x1.fp-30 - 1.0 i) == -4.247867098745151888768727039216644758847e-5 - 1.570753848123921942730162693731872690232 i":
-double: 86
-idouble: 86
-Test "Real part of: casinh (-0x1p-23 + 0x1.000002p0 i) == -5.364668491573609633134147164031476452679e-4 + 1.570574114956455764594481054234834678422 i":
-double: 327
-float: 431
-idouble: 327
-ifloat: 431
-Test "Real part of: casinh (-0x1p-23 - 0x1.000002p0 i) == -5.364668491573609633134147164031476452679e-4 - 1.570574114956455764594481054234834678422 i":
-double: 327
-float: 431
-idouble: 327
-ifloat: 431
-Test "Real part of: casinh (-0x1p-52 + 0x1.0000000000001p0 i) == -2.315303644582684770975188768022139415020e-8 + 1.570796317204594913251280305810847349436 i":
-double: 20798466
-idouble: 20798466
-Test "Real part of: casinh (-0x1p-52 - 0x1.0000000000001p0 i) == -2.315303644582684770975188768022139415020e-8 - 1.570796317204594913251280305810847349436 i":
-double: 20798466
-idouble: 20798466
-Test "Real part of: casinh (-1.0 + +0 i) == -0.8813735870195430252326093249797923090282 + +0 i":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-Test "Real part of: casinh (-1.0 + 0.25 i) == -8.924633639033482359562124741744951972772e-1 + 1.763024327769669304186785666360901026468e-1 i":
-float: 1
-ifloat: 1
-Test "Real part of: casinh (-1.0 + 0.5 i) == -9.261330313501824245501244453057873152694e-1 + 3.494390628572132936274118260753699527325e-1 i":
-double: 1
-idouble: 1
-Test "Real part of: casinh (-1.0 + 0x1.fp-10 i) == -8.813742198809567991336704287826445879025e-1 + 1.337909359557740912558349531052239112857e-3 i":
-double: 1
-idouble: 1
-Test "Imaginary part of: casinh (-1.0 + 0x1.fp-10 i) == -8.813742198809567991336704287826445879025e-1 + 1.337909359557740912558349531052239112857e-3 i":
-float: 1
-ifloat: 1
-Test "Real part of: casinh (-1.0 + 0x1.fp-100 i) == -8.813735870195430252326093249797923090282e-1 + 1.080754735021050612990719608916167354321e-30 i":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-Test "Real part of: casinh (-1.0 + 0x1.fp-1000 i) == -8.813735870195430252326093249797923090282e-1 + 1.278589251976747242280879285935084814093e-301 i":
-double: 1
-idouble: 1
-Test "Real part of: casinh (-1.0 + 0x1.fp-1025 i) == -8.813735870195430252326093249797923090282e-1 + 3.810492908885321743133304375216617626230e-309 i":
-double: 1
-idouble: 1
-Test "Real part of: casinh (-1.0 + 0x1.fp-129 i) == -8.813735870195430252326093249797923090282e-1 + 2.013062564695348242280482517399205554874e-39 i":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-Test "Real part of: casinh (-1.0 + 0x1.fp-30 i) == -8.813735870195430258081932989769495326854e-1 + 1.275929984216518540252717485007112529021e-9 i":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-Test "Real part of: casinh (-1.0 - 0 i) == -0.8813735870195430252326093249797923090282 - 0 i":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-Test "Real part of: casinh (-1.0 - 0.25 i) == -8.924633639033482359562124741744951972772e-1 - 1.763024327769669304186785666360901026468e-1 i":
-float: 1
-ifloat: 1
-Test "Real part of: casinh (-1.0 - 0.5 i) == -9.261330313501824245501244453057873152694e-1 - 3.494390628572132936274118260753699527325e-1 i":
-double: 1
-idouble: 1
-Test "Real part of: casinh (-1.0 - 0x1.fp-10 i) == -8.813742198809567991336704287826445879025e-1 - 1.337909359557740912558349531052239112857e-3 i":
-double: 1
-idouble: 1
-Test "Imaginary part of: casinh (-1.0 - 0x1.fp-10 i) == -8.813742198809567991336704287826445879025e-1 - 1.337909359557740912558349531052239112857e-3 i":
-float: 1
-ifloat: 1
-Test "Real part of: casinh (-1.0 - 0x1.fp-100 i) == -8.813735870195430252326093249797923090282e-1 - 1.080754735021050612990719608916167354321e-30 i":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-Test "Real part of: casinh (-1.0 - 0x1.fp-1000 i) == -8.813735870195430252326093249797923090282e-1 - 1.278589251976747242280879285935084814093e-301 i":
-double: 1
-idouble: 1
-Test "Real part of: casinh (-1.0 - 0x1.fp-1025 i) == -8.813735870195430252326093249797923090282e-1 - 3.810492908885321743133304375216617626230e-309 i":
-double: 1
-idouble: 1
-Test "Real part of: casinh (-1.0 - 0x1.fp-129 i) == -8.813735870195430252326093249797923090282e-1 - 2.013062564695348242280482517399205554874e-39 i":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-Test "Real part of: casinh (-1.0 - 0x1.fp-30 i) == -8.813735870195430258081932989769495326854e-1 - 1.275929984216518540252717485007112529021e-9 i":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-Test "Real part of: casinh (-1.5 + +0 i) == -1.194763217287109304111930828519090523536 + +0 i":
-double: 1
-idouble: 1
-Test "Real part of: casinh (-1.5 + 0x1.fp-1025 i) == -1.194763217287109304111930828519090523536 + 2.989196569048182929051881765490354365918e-309 i":
-double: 1
-idouble: 1
-Test "Real part of: casinh (-1.5 + 0x1.fp-129 i) == -1.194763217287109304111930828519090523536 + 1.579176199917649005841160751101628985741e-39 i":
-double: 1
-idouble: 1
-Test "Real part of: casinh (-1.5 - 0 i) == -1.194763217287109304111930828519090523536 - 0 i":
-double: 1
-idouble: 1
-Test "Real part of: casinh (-1.5 - 0x1.fp-1025 i) == -1.194763217287109304111930828519090523536 - 2.989196569048182929051881765490354365918e-309 i":
-double: 1
-idouble: 1
-Test "Real part of: casinh (-1.5 - 0x1.fp-129 i) == -1.194763217287109304111930828519090523536 - 1.579176199917649005841160751101628985741e-39 i":
-double: 1
-idouble: 1
-Test "Real part of: casinh (0.0 + 0x1.0000000000001p0 i) == 2.107342425544701550354780375182800088393e-8 + 1.570796326794896619231321691639751442099 i":
-double: 25216052
-idouble: 25216052
-Test "Real part of: casinh (0.0 + 0x1.000002p0 i) == 4.882812451493617206486388134172712975070e-4 + 1.570796326794896619231321691639751442099 i":
-double: 4
-float: 2
-idouble: 4
-ifloat: 2
-Test "Real part of: casinh (0.0 - 0x1.0000000000001p0 i) == 2.107342425544701550354780375182800088393e-8 - 1.570796326794896619231321691639751442099 i":
-double: 25216052
-idouble: 25216052
-Test "Real part of: casinh (0.0 - 0x1.000002p0 i) == 4.882812451493617206486388134172712975070e-4 - 1.570796326794896619231321691639751442099 i":
-double: 4
-float: 2
-idouble: 4
-ifloat: 2
-Test "Imaginary part of: casinh (0.25 + 1.0 i) == 5.097911466811016354623559941115413499164e-1 + 1.081751996523816326311037318425097434186 i":
-double: 1
-idouble: 1
-Test "Imaginary part of: casinh (0.25 - 1.0 i) == 5.097911466811016354623559941115413499164e-1 - 1.081751996523816326311037318425097434186 i":
-double: 1
-idouble: 1
-Test "Real part of: casinh (0.5 + +0 i) == 0.4812118250596034474977589134243684231352 + +0 i":
-float: 1
-ifloat: 1
-Test "Real part of: casinh (0.5 + 1.0 i) == 7.328576759736452608886724437653071523305e-1 + 8.959074812088902390666567243275770102229e-1 i":
-float: 1
-ifloat: 1
-Test "Imaginary part of: casinh (0.5 + 1.0 i) == 7.328576759736452608886724437653071523305e-1 + 8.959074812088902390666567243275770102229e-1 i":
-float: 1
-ifloat: 1
-Test "Real part of: casinh (0.5 - 0 i) == 0.4812118250596034474977589134243684231352 - 0 i":
-float: 1
-ifloat: 1
-Test "Real part of: casinh (0.5 - 1.0 i) == 7.328576759736452608886724437653071523305e-1 - 8.959074812088902390666567243275770102229e-1 i":
-float: 1
-ifloat: 1
-Test "Imaginary part of: casinh (0.5 - 1.0 i) == 7.328576759736452608886724437653071523305e-1 - 8.959074812088902390666567243275770102229e-1 i":
-float: 1
-ifloat: 1
-Test "Real part of: casinh (0.75 + 1.25 i) == 1.03171853444778027336364058631006594 + 0.911738290968487636358489564316731207 i":
-float: 1
-ifloat: 1
-Test "Imaginary part of: casinh (0.75 + 1.25 i) == 1.03171853444778027336364058631006594 + 0.911738290968487636358489564316731207 i":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-Test "Imaginary part of: casinh (0x1.000002p0 + 0x1p-23 i) == 8.813736713132400470205730751186547909968e-1 + 8.429369199749229560964789467980644296420e-8 i":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-Test "Imaginary part of: casinh (0x1.000002p0 - 0x1p-23 i) == 8.813736713132400470205730751186547909968e-1 - 8.429369199749229560964789467980644296420e-8 i":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-Test "Real part of: casinh (0x1.fp-10 + 1.0 i) == 4.350501469856803800217957402220976497152e-2 + 1.527305029163877791518741192097931722508 i":
-double: 6
-float: 17
-idouble: 6
-ifloat: 17
-Test "Real part of: casinh (0x1.fp-10 - 1.0 i) == 4.350501469856803800217957402220976497152e-2 - 1.527305029163877791518741192097931722508 i":
-double: 6
-float: 17
-idouble: 6
-ifloat: 17
-Test "Real part of: casinh (0x1.fp-100 + 1.0 i) == 1.236292038260260888664514866457202186027e-15 + 1.570796326794895382939283431378862777584 i":
-double: 486654063623740
-float: 11676448
-idouble: 486654063623740
-ifloat: 11676448
-Test "Real part of: casinh (0x1.fp-100 - 1.0 i) == 1.236292038260260888664514866457202186027e-15 - 1.570796326794895382939283431378862777584 i":
-double: 486654063623740
-float: 11676448
-idouble: 486654063623740
-ifloat: 11676448
-Test "Real part of: casinh (0x1.fp-1000 + 1.0 i) == 4.252291453851660175550490409247739011867e-151 + 1.570796326794896619231321691639751442099 i":
-double: 6268745377432003
-idouble: 6268745377432003
-Test "Real part of: casinh (0x1.fp-1000 - 1.0 i) == 4.252291453851660175550490409247739011867e-151 - 1.570796326794896619231321691639751442099 i":
-double: 6268745377432003
-idouble: 6268745377432003
-Test "Real part of: casinh (0x1.fp-1025 + 0x1.0000000000001p0 i) == 2.107342425544701550354780375182800088393e-8 + 1.570796326794896619231321691639751442099 i":
-double: 25216052
-idouble: 25216052
-Test "Real part of: casinh (0x1.fp-1025 + 1.0 i) == 7.340879205566679497036857179189356754017e-155 + 1.570796326794896619231321691639751442099 i":
-double: 8865344731827986
-idouble: 8865344731827986
-Test "Real part of: casinh (0x1.fp-1025 - 0x1.0000000000001p0 i) == 2.107342425544701550354780375182800088393e-8 - 1.570796326794896619231321691639751442099 i":
-double: 25216052
-idouble: 25216052
-Test "Real part of: casinh (0x1.fp-1025 - 1.0 i) == 7.340879205566679497036857179189356754017e-155 - 1.570796326794896619231321691639751442099 i":
-double: 8865344731827986
-idouble: 8865344731827986
-Test "Real part of: casinh (0x1.fp-129 + 0x1.000002p0 i) == 4.882812451493617206486388134172712975070e-4 + 1.570796326794896619231321691639751436268 i":
-double: 4
-float: 2
-idouble: 4
-ifloat: 2
-Test "Real part of: casinh (0x1.fp-129 + 1.0 i) == 5.335635276982233498398987585285818977933e-20 + 1.570796326794896619177965338869929107115 i":
-double: 8865344731827986
-float: 16512991
-idouble: 8865344731827986
-ifloat: 16512991
-Test "Real part of: casinh (0x1.fp-129 - 0x1.000002p0 i) == 4.882812451493617206486388134172712975070e-4 - 1.570796326794896619231321691639751436268 i":
-double: 4
-float: 2
-idouble: 4
-ifloat: 2
-Test "Real part of: casinh (0x1.fp-129 - 1.0 i) == 5.335635276982233498398987585285818977933e-20 - 1.570796326794896619177965338869929107115 i":
-double: 8865344731827986
-float: 16512991
-idouble: 8865344731827986
-ifloat: 16512991
-Test "Real part of: casinh (0x1.fp-30 + 1.0 i) == 4.247867098745151888768727039216644758847e-5 + 1.570753848123921942730162693731872690232 i":
-double: 2843582
-float: 11039
-idouble: 2843582
-ifloat: 11039
-Test "Imaginary part of: casinh (0x1.fp-30 + 1.0 i) == 4.247867098745151888768727039216644758847e-5 + 1.570753848123921942730162693731872690232 i":
-double: 86
-idouble: 86
-Test "Real part of: casinh (0x1.fp-30 - 1.0 i) == 4.247867098745151888768727039216644758847e-5 - 1.570753848123921942730162693731872690232 i":
-double: 2843582
-float: 11039
-idouble: 2843582
-ifloat: 11039
-Test "Imaginary part of: casinh (0x1.fp-30 - 1.0 i) == 4.247867098745151888768727039216644758847e-5 - 1.570753848123921942730162693731872690232 i":
-double: 86
-idouble: 86
-Test "Real part of: casinh (0x1.fp1023 + 0x1.fp1023 i) == 7.107906849659093345062145442726115449315e2 + 7.853981633974483096156608458198757210493e-1 i":
-double: 1
-idouble: 1
-Test "Real part of: casinh (0x1.fp127 + 0x1.fp127 i) == 8.973081118419833726837456344608533993585e1 + 7.853981633974483096156608458198757210493e-1 i":
-double: 1
-idouble: 1
-Test "Real part of: casinh (0x1p-23 + 0x1.000002p0 i) == 5.364668491573609633134147164031476452679e-4 + 1.570574114956455764594481054234834678422 i":
-double: 327
-float: 431
-idouble: 327
-ifloat: 431
-Test "Real part of: casinh (0x1p-23 - 0x1.000002p0 i) == 5.364668491573609633134147164031476452679e-4 - 1.570574114956455764594481054234834678422 i":
-double: 327
-float: 431
-idouble: 327
-ifloat: 431
-Test "Real part of: casinh (0x1p-52 + 0x1.0000000000001p0 i) == 2.315303644582684770975188768022139415020e-8 + 1.570796317204594913251280305810847349436 i":
-double: 20798466
-idouble: 20798466
-Test "Real part of: casinh (0x1p-52 - 0x1.0000000000001p0 i) == 2.315303644582684770975188768022139415020e-8 - 1.570796317204594913251280305810847349436 i":
-double: 20798466
-idouble: 20798466
-Test "Real part of: casinh (1.0 + +0 i) == 0.8813735870195430252326093249797923090282 + +0 i":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-Test "Real part of: casinh (1.0 + 0.25 i) == 8.924633639033482359562124741744951972772e-1 + 1.763024327769669304186785666360901026468e-1 i":
-float: 1
-ifloat: 1
-Test "Real part of: casinh (1.0 + 0.5 i) == 9.261330313501824245501244453057873152694e-1 + 3.494390628572132936274118260753699527325e-1 i":
-double: 1
-idouble: 1
-Test "Real part of: casinh (1.0 + 0x1.fp-10 i) == 8.813742198809567991336704287826445879025e-1 + 1.337909359557740912558349531052239112857e-3 i":
-double: 1
-idouble: 1
-Test "Imaginary part of: casinh (1.0 + 0x1.fp-10 i) == 8.813742198809567991336704287826445879025e-1 + 1.337909359557740912558349531052239112857e-3 i":
-float: 1
-ifloat: 1
-Test "Real part of: casinh (1.0 + 0x1.fp-100 i) == 8.813735870195430252326093249797923090282e-1 + 1.080754735021050612990719608916167354321e-30 i":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-Test "Real part of: casinh (1.0 + 0x1.fp-1000 i) == 8.813735870195430252326093249797923090282e-1 + 1.278589251976747242280879285935084814093e-301 i":
-double: 1
-idouble: 1
-Test "Real part of: casinh (1.0 + 0x1.fp-1025 i) == 8.813735870195430252326093249797923090282e-1 + 3.810492908885321743133304375216617626230e-309 i":
-double: 1
-idouble: 1
-Test "Real part of: casinh (1.0 + 0x1.fp-129 i) == 8.813735870195430252326093249797923090282e-1 + 2.013062564695348242280482517399205554874e-39 i":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-Test "Real part of: casinh (1.0 + 0x1.fp-30 i) == 8.813735870195430258081932989769495326854e-1 + 1.275929984216518540252717485007112529021e-9 i":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-Test "Real part of: casinh (1.0 - 0 i) == 0.8813735870195430252326093249797923090282 - 0 i":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-Test "Real part of: casinh (1.0 - 0.25 i) == 8.924633639033482359562124741744951972772e-1 - 1.763024327769669304186785666360901026468e-1 i":
-float: 1
-ifloat: 1
-Test "Real part of: casinh (1.0 - 0.5 i) == 9.261330313501824245501244453057873152694e-1 - 3.494390628572132936274118260753699527325e-1 i":
-double: 1
-idouble: 1
-Test "Real part of: casinh (1.0 - 0x1.fp-10 i) == 8.813742198809567991336704287826445879025e-1 - 1.337909359557740912558349531052239112857e-3 i":
-double: 1
-idouble: 1
-Test "Imaginary part of: casinh (1.0 - 0x1.fp-10 i) == 8.813742198809567991336704287826445879025e-1 - 1.337909359557740912558349531052239112857e-3 i":
-float: 1
-ifloat: 1
-Test "Real part of: casinh (1.0 - 0x1.fp-100 i) == 8.813735870195430252326093249797923090282e-1 - 1.080754735021050612990719608916167354321e-30 i":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-Test "Real part of: casinh (1.0 - 0x1.fp-1000 i) == 8.813735870195430252326093249797923090282e-1 - 1.278589251976747242280879285935084814093e-301 i":
-double: 1
-idouble: 1
-Test "Real part of: casinh (1.0 - 0x1.fp-1025 i) == 8.813735870195430252326093249797923090282e-1 - 3.810492908885321743133304375216617626230e-309 i":
-double: 1
-idouble: 1
-Test "Real part of: casinh (1.0 - 0x1.fp-129 i) == 8.813735870195430252326093249797923090282e-1 - 2.013062564695348242280482517399205554874e-39 i":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-Test "Real part of: casinh (1.0 - 0x1.fp-30 i) == 8.813735870195430258081932989769495326854e-1 - 1.275929984216518540252717485007112529021e-9 i":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-Test "Real part of: casinh (1.5 + +0 i) == 1.194763217287109304111930828519090523536 + +0 i":
-double: 1
-idouble: 1
-Test "Real part of: casinh (1.5 + 0x1.fp-1025 i) == 1.194763217287109304111930828519090523536 + 2.989196569048182929051881765490354365918e-309 i":
-double: 1
-idouble: 1
-Test "Real part of: casinh (1.5 + 0x1.fp-129 i) == 1.194763217287109304111930828519090523536 + 1.579176199917649005841160751101628985741e-39 i":
-double: 1
-idouble: 1
-Test "Real part of: casinh (1.5 - 0 i) == 1.194763217287109304111930828519090523536 - 0 i":
-double: 1
-idouble: 1
-Test "Real part of: casinh (1.5 - 0x1.fp-1025 i) == 1.194763217287109304111930828519090523536 - 2.989196569048182929051881765490354365918e-309 i":
-double: 1
-idouble: 1
-Test "Real part of: casinh (1.5 - 0x1.fp-129 i) == 1.194763217287109304111930828519090523536 - 1.579176199917649005841160751101628985741e-39 i":
-double: 1
-idouble: 1
-
-# catan
-Test "Imaginary part of: catan (-2 - 3 i) == -1.4099210495965755225306193844604208 - 0.22907268296853876629588180294200276 i":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-
-# catanh
-Test "Real part of: catanh (-2 - 3 i) == -0.14694666622552975204743278515471595 - 1.3389725222944935611241935759091443 i":
-double: 4
-idouble: 4
-Test "Real part of: catanh (0.75 + 1.25 i) == 0.261492138795671927078652057366532140 + 0.996825126463918666098902241310446708 i":
-double: 1
-idouble: 1
-
-# cbrt
-Test "cbrt (-27.0) == -3.0":
-double: 1
-idouble: 1
-Test "cbrt (0.75) == 0.908560296416069829445605878163630251":
-double: 1
-idouble: 1
-Test "cbrt (0.9921875) == 0.997389022060725270579075195353955217":
-double: 1
-idouble: 1
-
-# ccos
-Test "Imaginary part of: ccos (-0.75 + 710.5 i) == 1.347490911916428129246890157395342279438e308 + 1.255317763348154410745082950806112487736e308 i":
-double: 1
-idouble: 1
-Test "Imaginary part of: ccos (-0.75 + 89.5 i) == 2.708024460708609732016532185663087200560e38 + 2.522786001038096774676288412995370563339e38 i":
-float: 1
-ifloat: 1
-Test "Imaginary part of: ccos (-0.75 - 710.5 i) == 1.347490911916428129246890157395342279438e308 - 1.255317763348154410745082950806112487736e308 i":
-double: 1
-idouble: 1
-Test "Imaginary part of: ccos (-0.75 - 89.5 i) == 2.708024460708609732016532185663087200560e38 - 2.522786001038096774676288412995370563339e38 i":
-float: 1
-ifloat: 1
-Test "Imaginary part of: ccos (-2 - 3 i) == -4.18962569096880723013255501961597373 - 9.10922789375533659797919726277886212 i":
-float: 1
-ifloat: 1
-Test "Real part of: ccos (0.75 + 1.25 i) == 1.38173873063425888530729933139078645 - 1.09193013555397466170919531722024128 i":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-Test "Imaginary part of: ccos (0.75 + 1.25 i) == 1.38173873063425888530729933139078645 - 1.09193013555397466170919531722024128 i":
-float: 1
-ifloat: 1
-Test "Imaginary part of: ccos (0.75 + 710.5 i) == 1.347490911916428129246890157395342279438e308 - 1.255317763348154410745082950806112487736e308 i":
-double: 1
-idouble: 1
-Test "Imaginary part of: ccos (0.75 + 89.5 i) == 2.708024460708609732016532185663087200560e38 - 2.522786001038096774676288412995370563339e38 i":
-float: 1
-ifloat: 1
-Test "Imaginary part of: ccos (0.75 - 710.5 i) == 1.347490911916428129246890157395342279438e308 + 1.255317763348154410745082950806112487736e308 i":
-double: 1
-idouble: 1
-Test "Imaginary part of: ccos (0.75 - 89.5 i) == 2.708024460708609732016532185663087200560e38 + 2.522786001038096774676288412995370563339e38 i":
-float: 1
-ifloat: 1
-Test "Imaginary part of: ccos (0x1p-1074 + 1440 i) == inf - 5.981479269486130556466515778180916082415e301 i":
-double: 1
-idouble: 1
-
-# ccosh
-Test "Real part of: ccosh (-2 - 3 i) == -3.72454550491532256547397070325597253 + 0.511822569987384608834463849801875634 i":
-float: 1
-ifloat: 1
-Test "Imaginary part of: ccosh (-2 - 3 i) == -3.72454550491532256547397070325597253 + 0.511822569987384608834463849801875634 i":
-float: 1
-ifloat: 1
-Test "Imaginary part of: ccosh (-710.5 + 0.75 i) == 1.347490911916428129246890157395342279438e308 - 1.255317763348154410745082950806112487736e308 i":
-double: 1
-idouble: 1
-Test "Imaginary part of: ccosh (-710.5 - 0.75 i) == 1.347490911916428129246890157395342279438e308 + 1.255317763348154410745082950806112487736e308 i":
-double: 1
-idouble: 1
-Test "Imaginary part of: ccosh (-89.5 + 0.75 i) == 2.708024460708609732016532185663087200560e38 - 2.522786001038096774676288412995370563339e38 i":
-float: 1
-ifloat: 1
-Test "Imaginary part of: ccosh (-89.5 - 0.75 i) == 2.708024460708609732016532185663087200560e38 + 2.522786001038096774676288412995370563339e38 i":
-float: 1
-ifloat: 1
-Test "Real part of: ccosh (0.75 + 1.25 i) == 0.408242591877968807788852146397499084 + 0.780365930845853240391326216300863152 i":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-Test "Imaginary part of: ccosh (0.75 + 1.25 i) == 0.408242591877968807788852146397499084 + 0.780365930845853240391326216300863152 i":
-float: 1
-ifloat: 1
-Test "Imaginary part of: ccosh (1440 + 0x1p-1074 i) == inf + 5.981479269486130556466515778180916082415e301 i":
-double: 1
-idouble: 1
-Test "Imaginary part of: ccosh (710.5 + 0.75 i) == 1.347490911916428129246890157395342279438e308 + 1.255317763348154410745082950806112487736e308 i":
-double: 1
-idouble: 1
-Test "Imaginary part of: ccosh (710.5 - 0.75 i) == 1.347490911916428129246890157395342279438e308 - 1.255317763348154410745082950806112487736e308 i":
-double: 1
-idouble: 1
-Test "Imaginary part of: ccosh (89.5 + 0.75 i) == 2.708024460708609732016532185663087200560e38 + 2.522786001038096774676288412995370563339e38 i":
-float: 1
-ifloat: 1
-Test "Imaginary part of: ccosh (89.5 - 0.75 i) == 2.708024460708609732016532185663087200560e38 - 2.522786001038096774676288412995370563339e38 i":
-float: 1
-ifloat: 1
-
-# cexp
-Test "Imaginary part of: cexp (-2.0 - 3.0 i) == -0.13398091492954261346140525546115575 - 0.019098516261135196432576240858800925 i":
-float: 1
-ifloat: 1
-Test "Imaginary part of: cexp (-95 + 0.75 i) == 4.039714446238306526889476684000081624047e-42 + 3.763383677300535390271646960780570275931e-42 i":
-double: 1
-idouble: 1
-Test "Real part of: cexp (0.75 + 1.25 i) == 0.667537446429131586942201977015932112 + 2.00900045494094876258347228145863909 i":
-float: 1
-ifloat: 1
-Test "Imaginary part of: cexp (1440 + 0x1p-1074 i) == inf + 1.196295853897226111293303155636183216483e302 i":
-double: 1
-idouble: 1
-Test "Real part of: cexp (50 + 0x1p127 i) == 4.053997150228616856622417636046265337193e21 + 3.232070315463388524466674772633810238819e21 i":
-double: 2
-float: 1
-idouble: 2
-ifloat: 1
-Test "Imaginary part of: cexp (50 + 0x1p127 i) == 4.053997150228616856622417636046265337193e21 + 3.232070315463388524466674772633810238819e21 i":
-double: 1
-idouble: 1
-Test "Real part of: cexp (500 + 0x1p1023 i) == -1.159886268932754433233243794561351783426e217 + 7.904017694554466595359379965081774849708e216 i":
-double: 1
-idouble: 1
-Test "Real part of: cexp (709.8125 + 0.75 i) == 1.355121963080879535248452862759108365762e308 + 1.262426823598609432507811340856186873507e308 i":
-double: 1
-idouble: 1
-Test "Imaginary part of: cexp (709.8125 + 0.75 i) == 1.355121963080879535248452862759108365762e308 + 1.262426823598609432507811340856186873507e308 i":
-double: 1
-idouble: 1
-Test "Real part of: cexp (88.75 + 0.75 i) == 2.558360358486542817001900410314204322891e38 + 2.383359453227311447654736314679677655100e38 i":
-float: 1
-ifloat: 1
-Test "Imaginary part of: cexp (88.75 + 0.75 i) == 2.558360358486542817001900410314204322891e38 + 2.383359453227311447654736314679677655100e38 i":
-float: 2
-ifloat: 2
-
-# clog
-Test "Real part of: clog (-0x1.0000000123456p0 + 0x1.2345678p-1000 i) == 2.649094276923003995420209214900915462737e-10 + 3.141592653589793238462643383279502884197 i":
-double: 1
-idouble: 1
-Test "Real part of: clog (-0x1.0000000123456p0 + 0x1.2345678p-30 i) == 2.649094282537168795982991778475646793277e-10 + 3.141592652530155111500161671113150737892 i":
-double: 1
-idouble: 1
-Test "Imaginary part of: clog (-0x1.234566p-40 - 1.0 i) == 5.354083939753840089583620652120903838944e-25 - 1.570796326795931422008642456283782656359 i":
-float: 1
-ifloat: 1
-Test "Real part of: clog (-0x1.fp+127 + 0x1p-149 i) == 88.69109041335841930424871526389807508374 + pi i":
-float: 1
-ifloat: 1
-Test "Real part of: clog (-0x1.fp+127 - 0x1p-149 i) == 88.69109041335841930424871526389807508374 - pi i":
-float: 1
-ifloat: 1
-Test "Real part of: clog (-0x1p-149 + 0x1.fp+127 i) == 88.69109041335841930424871526389807508374 + pi/2 i":
-float: 1
-ifloat: 1
-Test "Imaginary part of: clog (-0x1p-149 + 0x1.fp+127 i) == 88.69109041335841930424871526389807508374 + pi/2 i":
-float: 1
-ifloat: 1
-Test "Real part of: clog (-0x1p-149 - 0x1.fp+127 i) == 88.69109041335841930424871526389807508374 - pi/2 i":
-float: 1
-ifloat: 1
-Test "Imaginary part of: clog (-0x1p-149 - 0x1.fp+127 i) == 88.69109041335841930424871526389807508374 - pi/2 i":
-float: 1
-ifloat: 1
-Test "Real part of: clog (0x0.ffffffp0 + 0x0.ffffffp-100 i) == -5.960464655174753498633255797994360530379e-8 + 7.888609052210118054117285652827862296732e-31 i":
-float: 1
-ifloat: 1
-Test "Real part of: clog (0x1.000566p0 + 0x1.234p-10 i) == 8.298731898331237038231468223024422855654e-5 + 1.110938609507128729312743251313024793990e-3 i":
-float: 1
-ifloat: 1
-Test "Real part of: clog (0x1.fp+127 + 0x1p-149 i) == 88.69109041335841930424871526389807508374 + +0 i":
-float: 1
-ifloat: 1
-Test "Real part of: clog (0x1.fp+127 - 0x1p-149 i) == 88.69109041335841930424871526389807508374 - 0 i":
-float: 1
-ifloat: 1
-Test "Real part of: clog (0x1p-1074 + 0x1p-1074 i) == -744.0934983311012896593986823853525458290 + pi/4 i":
-double: 1
-idouble: 1
-Test "Real part of: clog (0x1p-147 + 0x1p-147 i) == -101.5460619520319878296245057936228672231 + pi/4 i":
-float: 1
-ifloat: 1
-Test "Real part of: clog (0x1p-149 + 0x1.fp+127 i) == 88.69109041335841930424871526389807508374 + pi/2 i":
-float: 1
-ifloat: 1
-Test "Real part of: clog (0x1p-149 - 0x1.fp+127 i) == 88.69109041335841930424871526389807508374 - pi/2 i":
-float: 1
-ifloat: 1
-Test "Imaginary part of: clog (0x2818p-15 + 0x798fp-15 i) == 1.5366822245016167178749091974664853785194e-08 + 1.2522014929038946066987318471922169174157 i":
-float: 1
-ifloat: 1
-Test "Real part of: clog (1.0 + 0x1.234566p-10 i) == 6.172834701221959432440126967147726538097e-7 + 1.111110564353742042376451655136933182201e-3 i":
-float: 1
-ifloat: 1
-
-# clog10
-Test "Imaginary part of: clog10 (-0 + inf i) == inf + pi/2*log10(e) i":
-float: 1
-ifloat: 1
-Test "Imaginary part of: clog10 (-0 - inf i) == inf - pi/2*log10(e) i":
-float: 1
-ifloat: 1
-Test "Real part of: clog10 (-0x1.0000000123456p0 + 0x1.2345678p-1000 i) == 1.150487026509145544402795327729455391948e-10 + 1.364376353841841347485783625431355770210 i":
-double: 2
-idouble: 2
-Test "Imaginary part of: clog10 (-0x1.0000000123456p0 + 0x1.2345678p-1000 i) == 1.150487026509145544402795327729455391948e-10 + 1.364376353841841347485783625431355770210 i":
-double: 1
-idouble: 1
-Test "Real part of: clog10 (-0x1.0000000123456p0 + 0x1.2345678p-30 i) == 1.150487028947346337782682105935961875822e-10 + 1.364376353381646356131680448946397884147 i":
-double: 2
-idouble: 2
-Test "Imaginary part of: clog10 (-0x1.0000000123456p0 + 0x1.2345678p-30 i) == 1.150487028947346337782682105935961875822e-10 + 1.364376353381646356131680448946397884147 i":
-double: 1
-idouble: 1
-Test "Imaginary part of: clog10 (-0x1.fp+1023 + 0x1p-1074 i) == 308.2409272754311106024666378243768099991 + 1.364376353841841347485783625431355770210 i":
-double: 1
-idouble: 1
-Test "Imaginary part of: clog10 (-0x1.fp+1023 - 0x1p-1074 i) == 308.2409272754311106024666378243768099991 - 1.364376353841841347485783625431355770210 i":
-double: 1
-idouble: 1
-Test "Imaginary part of: clog10 (-0x1.fp+127 + 0x1p-149 i) == 38.51805116050395969095658815123105801479 + 1.364376353841841347485783625431355770210 i":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-Test "Imaginary part of: clog10 (-0x1.fp+127 - 0x1p-149 i) == 38.51805116050395969095658815123105801479 - 1.364376353841841347485783625431355770210 i":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-Test "Imaginary part of: clog10 (-0x1p-1074 + 0x1.fp+1023 i) == 308.2409272754311106024666378243768099991 + 0.6821881769209206737428918127156778851051 i":
-double: 1
-idouble: 1
-Test "Imaginary part of: clog10 (-0x1p-1074 - 0x1.fp+1023 i) == 308.2409272754311106024666378243768099991 - 0.6821881769209206737428918127156778851051 i":
-double: 1
-idouble: 1
-Test "Imaginary part of: clog10 (-0x1p-149 + 0x1.fp+127 i) == 38.51805116050395969095658815123105801479 + 0.6821881769209206737428918127156778851051 i":
-double: 1
-idouble: 1
-Test "Imaginary part of: clog10 (-0x1p-149 - 0x1.fp+127 i) == 38.51805116050395969095658815123105801479 - 0.6821881769209206737428918127156778851051 i":
-double: 1
-idouble: 1
-Test "Imaginary part of: clog10 (-1.0 + 0x1.234566p-20 i) == 2.556638434669064077889576526006849923281e-13 + 1.364375882602207106407956770293808181427 i":
-double: 1
-idouble: 1
-Test "Imaginary part of: clog10 (-2 - 3 i) == 0.556971676153418384603252578971164214 - 0.937554462986374708541507952140189646 i":
-double: 1
-idouble: 1
-Test "Imaginary part of: clog10 (-3 + inf i) == inf + pi/2*log10(e) i":
-float: 1
-ifloat: 1
-Test "Imaginary part of: clog10 (-3 - inf i) == inf - pi/2*log10(e) i":
-float: 1
-ifloat: 1
-Test "Imaginary part of: clog10 (-inf + 0 i) == inf + pi*log10(e) i":
-float: 1
-ifloat: 1
-Test "Imaginary part of: clog10 (-inf + 1 i) == inf + pi*log10(e) i":
-float: 1
-ifloat: 1
-Test "Imaginary part of: clog10 (-inf - 0 i) == inf - pi*log10(e) i":
-float: 1
-ifloat: 1
-Test "Imaginary part of: clog10 (-inf - 1 i) == inf - pi*log10(e) i":
-float: 1
-ifloat: 1
-Test "Imaginary part of: clog10 (0 + inf i) == inf + pi/2*log10(e) i":
-float: 1
-ifloat: 1
-Test "Imaginary part of: clog10 (0 - inf i) == inf - pi/2*log10(e) i":
-float: 1
-ifloat: 1
-Test "Real part of: clog10 (0x0.fffffffffffff8p0 + 0x0.fffffffffffff8p-1000 i) == -4.821637332766435821255375046554377090472e-17 + 4.053112396770095089737411317782466262176e-302 i":
-double: 1
-idouble: 1
-Test "Real part of: clog10 (0x0.ffffffp0 + 0x0.ffffffp-100 i) == -2.588596909321764128428416045209904492216e-8 + 3.425979381266895667295625489912064603415e-31 i":
-double: 1
-float: 2
-idouble: 1
-ifloat: 2
-Test "Real part of: clog10 (0x1.000566p0 + 0x1.234p-10 i) == 3.604093470239754109961125085078190708674e-5 + 4.824745078422174667425851670822596859720e-4 i":
-float: 1
-ifloat: 1
-Test "Imaginary part of: clog10 (0x1.000566p0 + 0x1.234p-10 i) == 3.604093470239754109961125085078190708674e-5 + 4.824745078422174667425851670822596859720e-4 i":
-double: 1
-idouble: 1
-Test "Real part of: clog10 (0x1.000566p0 + 0x1.234p-100 i) == 3.577293486783822178310971763308187385546e-5 + 3.897399639875661463735636919790792140598e-31 i":
-float: 1
-ifloat: 1
-Test "Imaginary part of: clog10 (0x1.234566p-30 + 1.0 i) == 2.438200411482400072282924063740535840474e-19 + 6.821881764607257184291586401763604544928e-1 i":
-float: 1
-ifloat: 1
-Test "Imaginary part of: clog10 (0x1.234566p-50 + 1.0 i) == 2.217530356103816369479108963807448194409e-31 + 6.821881769209202348667823902864283966959e-1 i":
-float: 1
-ifloat: 1
-Test "Imaginary part of: clog10 (0x1.234566p-60 + 1.0 i) == 2.114801746467415208319767917450504756866e-37 + 6.821881769209206733143018621078368211515e-1 i":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-Test "Imaginary part of: clog10 (0x1.fffffep+127 + 0x1.fffffep+127 i) == 38.68235441693561449174780668781319348761 + pi/4*log10(e) i":
-float: 1
-ifloat: 1
-Test "Real part of: clog10 (0x1.fffffep+127 + 1.0 i) == 38.53183941910362389414093724045094697423 + 1.276276851248440096917018665609900318458e-39 i":
-float: 1
-ifloat: 1
-Test "Real part of: clog10 (0x10673dd0f2481p-51 + 0x7ef1d17cefbd2p-51 i) == 1.3918041236396763648388478552321724382899e-29 + 0.6263795733790237053262025311642907438291 i":
-double: 1
-idouble: 1
-Test "Real part of: clog10 (0x1367a310575591p-54 + 0x3cfcc0a0541f60p-54 i) == 2.2081507730821788480616336165447731164865e-32 + 0.5484039935757001196548030312819898864760 i":
-double: 1
-idouble: 1
-Test "Imaginary part of: clog10 (0x1367a310575591p-54 + 0x3cfcc0a0541f60p-54 i) == 2.2081507730821788480616336165447731164865e-32 + 0.5484039935757001196548030312819898864760 i":
-double: 1
-idouble: 1
-Test "Imaginary part of: clog10 (0x164c74eea876p-45 + 0x16f393482f77p-45 i) == -1.3155760824064879362415202279780039150764e-26 + 0.3473590599762514228227328130640352044313 i":
-double: 1
-idouble: 1
-Test "Imaginary part of: clog10 (0x1a6p-10 + 0x3a5p-10 i) == -6.2126412844802358329771948751248003038444e-07 + 0.4977135139537443711784513409096950995985 i":
-double: 1
-idouble: 1
-Test "Imaginary part of: clog10 (0x1p-1074 + 0x1.fp+1023 i) == 308.2409272754311106024666378243768099991 + 0.6821881769209206737428918127156778851051 i":
-double: 1
-idouble: 1
-Test "Real part of: clog10 (0x1p-1074 + 0x1p-1074 i) == -323.1557003452838130619487034867432642357 + pi/4*log10(e) i":
-double: 1
-idouble: 1
-Test "Imaginary part of: clog10 (0x1p-1074 - 0x1.fp+1023 i) == 308.2409272754311106024666378243768099991 - 0.6821881769209206737428918127156778851051 i":
-double: 1
-idouble: 1
-Test "Imaginary part of: clog10 (0x1p-147 + 0x1p-147 i) == -44.10089436477324509881274807713822842154 + pi/4*log10(e) i":
-float: 1
-ifloat: 1
-Test "Imaginary part of: clog10 (0x1p-149 + 0x1.fp+127 i) == 38.51805116050395969095658815123105801479 + 0.6821881769209206737428918127156778851051 i":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-Test "Imaginary part of: clog10 (0x1p-149 + 0x1p-149 i) == -44.70295435610120748924022586658721447508 + pi/4*log10(e) i":
-float: 1
-ifloat: 1
-Test "Imaginary part of: clog10 (0x1p-149 - 0x1.fp+127 i) == 38.51805116050395969095658815123105801479 - 0.6821881769209206737428918127156778851051 i":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-Test "Imaginary part of: clog10 (0x1p-509 + 1.0 i) == 7.730698388614835910296270976605350994446e-308 + 6.821881769209206737428918127156778851051e-1 i":
-double: 1
-idouble: 1
-Test "Imaginary part of: clog10 (0x1p-510 + 1.0 i) == 1.932674597153708977574067744151337748612e-308 + 6.821881769209206737428918127156778851051e-1 i":
-double: 1
-idouble: 1
-Test "Imaginary part of: clog10 (0x1p-511 + 1.0 i) == 4.831686492884272443935169360378344371529e-309 + 6.821881769209206737428918127156778851051e-1 i":
-double: 1
-idouble: 1
-Test "Imaginary part of: clog10 (0x1p-61 + 1.0 i) == 4.084085680564517578238994467153626207224e-38 + 6.821881769209206735545466044044889962925e-1 i":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-Test "Imaginary part of: clog10 (0x1p-62 + 1.0 i) == 1.021021420141129394559748616788406551878e-38 + 6.821881769209206736487192085600834406988e-1 i":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-Test "Imaginary part of: clog10 (0x1p-63 + 1.0 i) == 2.552553550352823486399371541971016379740e-39 + 6.821881769209206736958055106378806629019e-1 i":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-Test "Real part of: clog10 (0x2818p-15 + 0x798fp-15 i) == 6.6737261053986614395049481326819059203910e-09 + 0.5438241985991753781478398141908629586460 i":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-Test "Imaginary part of: clog10 (0x2818p-15 + 0x798fp-15 i) == 6.6737261053986614395049481326819059203910e-09 + 0.5438241985991753781478398141908629586460 i":
-float: 1
-ifloat: 1
-Test "Real part of: clog10 (0x2dd46725bp-35 + 0x7783a1284p-35 i) == 1.9312741086596516918394613098872836703188e-20 + 0.5231613813514771042838490538484014771862 i":
-double: 1
-idouble: 1
-Test "Real part of: clog10 (0x2ede88p-23 + 0x771c3fp-23 i) == -1.9440841725722970687903291200493082253766e-13 + 0.5193774116724956222518530053006822210323 i":
-float: 1
-ifloat: 1
-Test "Imaginary part of: clog10 (0x2ede88p-23 + 0x771c3fp-23 i) == -1.9440841725722970687903291200493082253766e-13 + 0.5193774116724956222518530053006822210323 i":
-double: 1
-idouble: 1
-Test "Real part of: clog10 (0x4447d7175p-35 + 0x6c445e00ap-35 i) == -6.4375803621988389731799033530075237868110e-21 + 0.4378257977686804492768642780897650927167 i":
-double: 1
-idouble: 1
-Test "Imaginary part of: clog10 (0x5b06b680ea2ccp-52 + 0xef452b965da9fp-52 i) == 3.6079845358966994996207055940336690133424e-30 + 0.5243112258263349992771652393178033846555 i":
-double: 1
-idouble: 1
-Test "Imaginary part of: clog10 (0x9b57bp-20 + 0xcb7b4p-20 i) == -1.7182001068739620267773842120965071561416e-11 + 0.3990121149225253562859800593935899629087 i":
-double: 1
-idouble: 1
-Test "Real part of: clog10 (0xf2p-10 + 0x3e3p-10 i) == 2.6921240173351112953324592659528481616879e-06 + 0.5785726025799636431142862788413361783862 i":
-double: 1
-idouble: 1
-Test "Imaginary part of: clog10 (0xf2p-10 + 0x3e3p-10 i) == 2.6921240173351112953324592659528481616879e-06 + 0.5785726025799636431142862788413361783862 i":
-double: 1
-idouble: 1
-Test "Imaginary part of: clog10 (0xfe961079616p-45 + 0x1bc37e09e6d1p-45 i) == 2.3329549194675052736016290082882121135546e-26 + 0.4561756099441139182878993697611751382976 i":
-double: 1
-idouble: 1
-Test "Imaginary part of: clog10 (1.0 + 0x1.234566p-10 i) == 2.680828048441605163181684680300513080769e-7 + 4.825491868832381486767558728169977751564e-4 i":
-double: 1
-idouble: 1
-Test "Imaginary part of: clog10 (3 + inf i) == inf + pi/2*log10(e) i":
-float: 1
-ifloat: 1
-Test "Imaginary part of: clog10 (3 - inf i) == inf - pi/2*log10(e) i":
-float: 1
-ifloat: 1
-Test "Imaginary part of: clog10 (inf + inf i) == inf + pi/4*log10(e) i":
-float: 1
-ifloat: 1
-Test "Imaginary part of: clog10 (inf - inf i) == inf - pi/4*log10(e) i":
-float: 1
-ifloat: 1
-
-# cos
-Test "cos (0x1p+120) == -9.25879022854837867303861764107414946730833e-01":
-float: 1
-ifloat: 1
-Test "cos (0x1p+127) == 7.81914638714960072263910298466369236613162e-01":
-float: 1
-ifloat: 1
-Test "cos (M_PI_6l * 2.0) == 0.5":
-double: 1
-idouble: 1
-Test "cos (M_PI_6l * 4.0) == -0.5":
-double: 2
-float: 1
-idouble: 2
-ifloat: 1
-
-# cos_tonearest
-Test "cos_tonearest (7) == 0.7539022543433046381411975217191820122183":
-float: 1
-ifloat: 1
-
-# cpow
-Test "Real part of: cpow (0.75 + 1.25 i, 0.0 + 1.0 i) == 0.331825439177608832276067945276730566 + 0.131338600281188544930936345230903032 i":
-float: 1
-ifloat: 1
-Test "Real part of: cpow (0.75 + 1.25 i, 0.75 + 1.25 i) == 0.117506293914473555420279832210420483 + 0.346552747708338676483025352060418001 i":
-double: 1
-float: 4
-idouble: 1
-ifloat: 4
-Test "Real part of: cpow (0.75 + 1.25 i, 1.0 + 1.0 i) == 0.0846958290317209430433805274189191353 + 0.513285749182902449043287190519090481 i":
-double: 2
-float: 3
-idouble: 2
-ifloat: 3
-Test "Real part of: cpow (2 + 3 i, 4 + 0 i) == -119.0 - 120.0 i":
-double: 1
-float: 4
-idouble: 1
-ifloat: 4
-Test "Imaginary part of: cpow (2 + 3 i, 4 + 0 i) == -119.0 - 120.0 i":
-float: 2
-ifloat: 2
-Test "Imaginary part of: cpow (e + 0 i, 0 + 2 * M_PIl i) == 1.0 + 0.0 i":
-double: 2
-float: 2
-idouble: 2
-ifloat: 2
-
-# csin
-Test "Real part of: csin (-0.75 + 710.5 i) == -1.255317763348154410745082950806112487736e308 + 1.347490911916428129246890157395342279438e308 i":
-double: 1
-idouble: 1
-Test "Real part of: csin (-0.75 + 89.5 i) == -2.522786001038096774676288412995370563339e38 + 2.708024460708609732016532185663087200560e38 i":
-float: 1
-ifloat: 1
-Test "Real part of: csin (-0.75 - 710.5 i) == -1.255317763348154410745082950806112487736e308 - 1.347490911916428129246890157395342279438e308 i":
-double: 1
-idouble: 1
-Test "Real part of: csin (-0.75 - 89.5 i) == -2.522786001038096774676288412995370563339e38 - 2.708024460708609732016532185663087200560e38 i":
-float: 1
-ifloat: 1
-Test "Real part of: csin (0.75 + 710.5 i) == 1.255317763348154410745082950806112487736e308 + 1.347490911916428129246890157395342279438e308 i":
-double: 1
-idouble: 1
-Test "Real part of: csin (0.75 + 89.5 i) == 2.522786001038096774676288412995370563339e38 + 2.708024460708609732016532185663087200560e38 i":
-float: 1
-ifloat: 1
-Test "Real part of: csin (0.75 - 710.5 i) == 1.255317763348154410745082950806112487736e308 - 1.347490911916428129246890157395342279438e308 i":
-double: 1
-idouble: 1
-Test "Real part of: csin (0.75 - 89.5 i) == 2.522786001038096774676288412995370563339e38 - 2.708024460708609732016532185663087200560e38 i":
-float: 1
-ifloat: 1
-Test "Real part of: csin (0x1p-1074 + 1440 i) == 5.981479269486130556466515778180916082415e301 + inf i":
-double: 1
-idouble: 1
-
-# csinh
-Test "Imaginary part of: csinh (-2 - 3 i) == 3.59056458998577995201256544779481679 - 0.530921086248519805267040090660676560 i":
-double: 1
-idouble: 1
-Test "Imaginary part of: csinh (-710.5 + 0.75 i) == -1.347490911916428129246890157395342279438e308 + 1.255317763348154410745082950806112487736e308 i":
-double: 1
-idouble: 1
-Test "Imaginary part of: csinh (-710.5 - 0.75 i) == -1.347490911916428129246890157395342279438e308 - 1.255317763348154410745082950806112487736e308 i":
-double: 1
-idouble: 1
-Test "Imaginary part of: csinh (-89.5 + 0.75 i) == -2.708024460708609732016532185663087200560e38 + 2.522786001038096774676288412995370563339e38 i":
-float: 1
-ifloat: 1
-Test "Imaginary part of: csinh (-89.5 - 0.75 i) == -2.708024460708609732016532185663087200560e38 - 2.522786001038096774676288412995370563339e38 i":
-float: 1
-ifloat: 1
-Test "Real part of: csinh (0.75 + 1.25 i) == 0.259294854551162779153349830618433028 + 1.22863452409509552219214606515777594 i":
-float: 1
-ifloat: 1
-Test "Imaginary part of: csinh (0.75 + 1.25 i) == 0.259294854551162779153349830618433028 + 1.22863452409509552219214606515777594 i":
-float: 1
-ifloat: 1
-Test "Imaginary part of: csinh (1440 + 0x1p-1074 i) == inf + 5.981479269486130556466515778180916082415e301 i":
-double: 1
-idouble: 1
-Test "Imaginary part of: csinh (710.5 + 0.75 i) == 1.347490911916428129246890157395342279438e308 + 1.255317763348154410745082950806112487736e308 i":
-double: 1
-idouble: 1
-Test "Imaginary part of: csinh (710.5 - 0.75 i) == 1.347490911916428129246890157395342279438e308 - 1.255317763348154410745082950806112487736e308 i":
-double: 1
-idouble: 1
-Test "Imaginary part of: csinh (89.5 + 0.75 i) == 2.708024460708609732016532185663087200560e38 + 2.522786001038096774676288412995370563339e38 i":
-float: 1
-ifloat: 1
-Test "Imaginary part of: csinh (89.5 - 0.75 i) == 2.708024460708609732016532185663087200560e38 - 2.522786001038096774676288412995370563339e38 i":
-float: 1
-ifloat: 1
-
-# csqrt
-Test "Real part of: csqrt (-0x1.000002p-126 - 0x1.000002p-126 i) == 4.934094449071842328766868579214125217132e-20 - 1.191195773697904627170323731331667740087e-19 i":
-double: 1
-idouble: 1
-Test "Real part of: csqrt (-2 + 3 i) == 0.89597747612983812471573375529004348 + 1.6741492280355400404480393008490519 i":
-float: 1
-ifloat: 1
-Test "Real part of: csqrt (-2 - 3 i) == 0.89597747612983812471573375529004348 - 1.6741492280355400404480393008490519 i":
-float: 1
-ifloat: 1
-Test "Imaginary part of: csqrt (0x1.000002p-126 + 0x1.000002p-126 i) == 1.191195773697904627170323731331667740087e-19 + 4.934094449071842328766868579214125217132e-20 i":
-double: 1
-idouble: 1
-Test "Imaginary part of: csqrt (0x1.fffffep+127 + 1.0 i) == 1.844674352395372953599975585936590505260e+19 + 2.710505511993121390769065968615872097053e-20 i":
-float: 1
-ifloat: 1
-Test "Real part of: csqrt (0x1.fffffffffffffp+1023 + 0x1.fffffffffffffp+1023 i) == 1.473094556905565378990473658199034571917e+154 + 6.101757441282702188537080005372547713595e+153 i":
-double: 1
-idouble: 1
-Test "Imaginary part of: csqrt (0x1.fffffffffffffp+1023 + 0x1.fffffffffffffp+1023 i) == 1.473094556905565378990473658199034571917e+154 + 6.101757441282702188537080005372547713595e+153 i":
-double: 1
-idouble: 1
-Test "Imaginary part of: csqrt (0x1.fffffffffffffp+1023 + 0x1p+1023 i) == 1.379778091031440685006200821918878702861e+154 + 3.257214233483129514781233066898042490248e+153 i":
-double: 1
-idouble: 1
-
-# ctan
-Test "Real part of: ctan (-2 - 3 i) == 0.376402564150424829275122113032269084e-2 - 1.00323862735360980144635859782192726 i":
-float: 1
-ifloat: 1
-Test "Imaginary part of: ctan (-2 - 3 i) == 0.376402564150424829275122113032269084e-2 - 1.00323862735360980144635859782192726 i":
-double: 1
-idouble: 1
-Test "Imaginary part of: ctan (0.75 + 1.25 i) == 0.160807785916206426725166058173438663 + 0.975363285031235646193581759755216379 i":
-double: 1
-idouble: 1
-Test "Real part of: ctan (0x1p1023 + 1 i) == -0.2254627924997545057926782581695274244229 + 0.8786063118883068695462540226219865087189 i":
-double: 1
-idouble: 1
-Test "Imaginary part of: ctan (0x1p127 + 1 i) == 0.2446359391192790896381501310437708987204 + 0.9101334047676183761532873794426475906201 i":
-double: 1
-idouble: 1
-Test "Real part of: ctan (0x3.243f6cp-1 + 0 i) == -2.287733242885645987394874673945769518150e7 + 0.0 i":
-float: 1
-ifloat: 1
-
-# ctan_tonearest
-Test "Real part of: ctan_tonearest (0x1.921fb6p+0 + 0x1p-149 i) == -2.287733242885645987394874673945769518150e7 + 7.334008549954377778731880988481078535821e-31 i":
-float: 1
-ifloat: 1
-Test "Imaginary part of: ctan_tonearest (0x1.921fb6p+0 + 0x1p-149 i) == -2.287733242885645987394874673945769518150e7 + 7.334008549954377778731880988481078535821e-31 i":
-float: 1
-ifloat: 1
-
-# ctanh
-Test "Real part of: ctanh (-2 - 3 i) == -0.965385879022133124278480269394560686 + 0.988437503832249372031403430350121098e-2 i":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-Test "Imaginary part of: ctanh (-2 - 3 i) == -0.965385879022133124278480269394560686 + 0.988437503832249372031403430350121098e-2 i":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-Test "Imaginary part of: ctanh (0 + 0x3.243f6cp-1 i) == 0.0 - 2.287733242885645987394874673945769518150e7 i":
-float: 1
-ifloat: 1
-Test "Imaginary part of: ctanh (0 + pi/4 i) == 0.0 + 1.0 i":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-Test "Real part of: ctanh (0.75 + 1.25 i) == 1.37260757053378320258048606571226857 + 0.385795952609750664177596760720790220 i":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-Test "Imaginary part of: ctanh (0.75 + 1.25 i) == 1.37260757053378320258048606571226857 + 0.385795952609750664177596760720790220 i":
-float: 2
-ifloat: 2
-Test "Imaginary part of: ctanh (1 + 0x1p1023 i) == 0.8786063118883068695462540226219865087189 - 0.2254627924997545057926782581695274244229 i":
-double: 1
-idouble: 1
-Test "Real part of: ctanh (1 + 0x1p127 i) == 0.9101334047676183761532873794426475906201 + 0.2446359391192790896381501310437708987204 i":
-double: 1
-idouble: 1
-
-# ctanh_tonearest
-Test "Real part of: ctanh_tonearest (0x1p-149 + 0x1.921fb6p+0 i) == 7.334008549954377778731880988481078535821e-31 - 2.287733242885645987394874673945769518150e7 i":
-float: 1
-ifloat: 1
-Test "Imaginary part of: ctanh_tonearest (0x1p-149 + 0x1.921fb6p+0 i) == 7.334008549954377778731880988481078535821e-31 - 2.287733242885645987394874673945769518150e7 i":
-float: 1
-ifloat: 1
-
-# erf
-Test "erf (1.25) == 0.922900128256458230136523481197281140":
-double: 1
-idouble: 1
-
-# erfc
-Test "erfc (0x1.f7303cp+1) == 2.705500297238986897105236321218861842255e-8":
-double: 1
-idouble: 1
-Test "erfc (0x1.ffa002p+2) == 1.233585992097580296336099501489175967033e-29":
-float: 1
-ifloat: 1
-Test "erfc (2.0) == 0.00467773498104726583793074363274707139":
-double: 1
-idouble: 1
-Test "erfc (4.125) == 0.542340079956506600531223408575531062e-8":
-double: 1
-idouble: 1
-
-# exp10
-Test "exp10 (-1) == 0.1":
-double: 1
-idouble: 1
-Test "exp10 (-305) == 1.0e-305":
-double: 1
-idouble: 1
-Test "exp10 (-36) == 1.0e-36":
-double: 1
-idouble: 1
-Test "exp10 (3) == 1000":
-double: 1
-idouble: 1
-Test "exp10 (36) == 1.0e36":
-double: 1
-idouble: 1
-
-# expm1
-Test "expm1 (0.75) == 1.11700001661267466854536981983709561":
-double: 1
-idouble: 1
-Test "expm1 (1) == M_El - 1.0":
-float: 1
-ifloat: 1
-Test "expm1 (500.0) == 1.4035922178528374107397703328409120821806e+217":
-double: 1
-idouble: 1
-
-# fma
-Test "fma (-0x1.fffffffffffffp-711, 0x1.fffffffffffffp-275, 0x1.fffffe00007ffp-983) == 0x1.7ffffe00007ffp-983":
-double: 1
-idouble: 1
-Test "fma (0x1.0000002p+0, 0x1.ffffffcp-1, -0x1p-300) == 0x1.fffffffffffffp-1":
-double: 1
-idouble: 1
-Test "fma (0x1.153d650bb9f06p-907, 0x1.2d01230d48407p-125, -0x0.b278d5acfc3cp-1022) == -0x0.b22757123bbe9p-1022":
-double: 1
-idouble: 1
-Test "fma (0x1.4000004p-967, 0x1p-106, 0x0.000001p-1022) == 0x0.0000010000003p-1022":
-double: 1
-idouble: 1
-Test "fma (0x1.7ff8p+13, 0x1.000002p+0, 0x1.ffffp-24) == 0x1.7ff802p+13":
-float: 1
-ifloat: 1
-Test "fma (0x1.7fffff8p-968, 0x1p-106, 0x0.000001p-1022) == 0x0.0000010000001p-1022":
-double: 1
-idouble: 1
-
-# hypot
-Test "hypot (-0.7, -12.4) == 12.419742348374220601176836866763271":
-float: 1
-ifloat: 1
-Test "hypot (-0.7, 12.4) == 12.419742348374220601176836866763271":
-float: 1
-ifloat: 1
-Test "hypot (-12.4, -0.7) == 12.419742348374220601176836866763271":
-float: 1
-ifloat: 1
-Test "hypot (-12.4, 0.7) == 12.419742348374220601176836866763271":
-float: 1
-ifloat: 1
-Test "hypot (0.7, -12.4) == 12.419742348374220601176836866763271":
-float: 1
-ifloat: 1
-Test "hypot (0.7, 12.4) == 12.419742348374220601176836866763271":
-float: 1
-ifloat: 1
-Test "hypot (12.4, -0.7) == 12.419742348374220601176836866763271":
-float: 1
-ifloat: 1
-Test "hypot (12.4, 0.7) == 12.419742348374220601176836866763271":
-float: 1
-ifloat: 1
-
-# j0
-Test "j0 (-4.0) == -3.9714980986384737228659076845169804197562E-1":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-Test "j0 (0.75) == 0.864242275166648623555731103820923211":
-float: 1
-ifloat: 1
-Test "j0 (0x1.d7ce3ap+107) == 2.775523647291230802651040996274861694514e-17":
-float: 2
-ifloat: 2
-Test "j0 (10.0) == -0.245935764451348335197760862485328754":
-double: 2
-float: 1
-idouble: 2
-ifloat: 1
-Test "j0 (2.0) == 0.223890779141235668051827454649948626":
-float: 2
-ifloat: 2
-Test "j0 (4.0) == -3.9714980986384737228659076845169804197562E-1":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-Test "j0 (8.0) == 0.171650807137553906090869407851972001":
-float: 1
-ifloat: 1
-
-# j1
-Test "j1 (0x1.3ffp+74) == 1.818984347516051243459364437186082741567e-12":
-double: 1
-idouble: 1
-Test "j1 (0x1.ff00000000002p+840) == 1.846591691699331493194965158699937660696e-127":
-double: 1
-idouble: 1
-Test "j1 (10.0) == 0.0434727461688614366697487680258592883":
-float: 2
-ifloat: 2
-Test "j1 (2.0) == 0.576724807756873387202448242269137087":
-double: 1
-idouble: 1
-Test "j1 (8.0) == 0.234636346853914624381276651590454612":
-double: 1
-idouble: 1
-
-# jn
-Test "jn (0, -4.0) == -3.9714980986384737228659076845169804197562E-1":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-Test "jn (0, 0.75) == 0.864242275166648623555731103820923211":
-float: 1
-ifloat: 1
-Test "jn (0, 10.0) == -0.245935764451348335197760862485328754":
-double: 2
-float: 1
-idouble: 2
-ifloat: 1
-Test "jn (0, 2.0) == 0.223890779141235668051827454649948626":
-float: 2
-ifloat: 2
-Test "jn (0, 4.0) == -3.9714980986384737228659076845169804197562E-1":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-Test "jn (0, 8.0) == 0.171650807137553906090869407851972001":
-float: 1
-ifloat: 1
-Test "jn (1, 10.0) == 0.0434727461688614366697487680258592883":
-float: 2
-ifloat: 2
-Test "jn (1, 2.0) == 0.576724807756873387202448242269137087":
-double: 1
-idouble: 1
-Test "jn (1, 8.0) == 0.234636346853914624381276651590454612":
-double: 1
-idouble: 1
-Test "jn (10, 0.125) == 0.250543369809369890173993791865771547e-18":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-Test "jn (10, 0.75) == 0.149621713117596814698712483621682835e-10":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-Test "jn (10, 10.0) == 0.207486106633358857697278723518753428":
-double: 4
-float: 3
-idouble: 4
-ifloat: 3
-Test "jn (10, 2.0) == 0.251538628271673670963516093751820639e-6":
-double: 1
-float: 2
-idouble: 1
-ifloat: 2
-Test "jn (2, 0x1.ffff62p+99) == -4.43860668048170034334926693188979974489e-16":
-double: 2
-float: 2
-idouble: 2
-ifloat: 2
-Test "jn (2, 2.4048255576957729) == 0.43175480701968038399746111312430703":
-double: 2
-float: 1
-idouble: 2
-ifloat: 1
-Test "jn (3, 0.125) == 0.406503832554912875023029337653442868e-4":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-Test "jn (3, 0.75) == 0.848438342327410884392755236884386804e-2":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-Test "jn (3, 10.0) == 0.0583793793051868123429354784103409563":
-double: 3
-float: 1
-idouble: 3
-ifloat: 1
-Test "jn (3, 2.0) == 0.128943249474402051098793332969239835":
-float: 1
-ifloat: 1
-Test "jn (3, 2.4048255576957729) == 0.19899990535769083404042146764530813":
-double: 3
-idouble: 3
-Test "jn (4, 2.4048255576957729) == 0.647466661641779720084932282551219891E-1":
-double: 1
-idouble: 1
-Test "jn (5, 2.4048255576957729) == 0.163892432048058525099230549946147698E-1":
-double: 3
-float: 1
-idouble: 3
-ifloat: 1
-Test "jn (6, 2.4048255576957729) == 0.34048184720278336646673682895929161E-2":
-double: 4
-float: 3
-idouble: 4
-ifloat: 3
-Test "jn (7, 2.4048255576957729) == 0.60068836573295394221291569249883076E-3":
-double: 3
-float: 5
-idouble: 3
-ifloat: 5
-Test "jn (8, 2.4048255576957729) == 0.92165786705344923232879022467054148E-4":
-double: 3
-float: 2
-idouble: 3
-ifloat: 2
-Test "jn (9, 2.4048255576957729) == 0.12517270977961513005428966643852564E-4":
-double: 1
-float: 2
-idouble: 1
-ifloat: 2
-
-# lgamma
-Test "lgamma (0.7) == 0.260867246531666514385732417016759578":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-Test "lgamma (1.2) == -0.853740900033158497197028392998854470e-1":
-double: 1
-float: 2
-idouble: 1
-ifloat: 2
-
-# log10
-Test "log10 (0.75) == -0.124938736608299953132449886193870744":
-double: 1
-float: 2
-idouble: 1
-ifloat: 2
-Test "log10 (e) == log10(e)":
-float: 1
-ifloat: 1
-
-# log1p
-Test "log1p (-0.25) == -0.287682072451780927439219005993827432":
-float: 1
-ifloat: 1
-
-# pow
-Test "pow (0x0.ffffffp0, -0x1p24) == 2.7182819094701610539628664526874952929416":
-float: 1
-ifloat: 1
-Test "pow (0x0.ffffffp0, 0x1p24) == 0.3678794302077803437135155590023422899744":
-float: 1
-ifloat: 1
-Test "pow (0x1.000002p0, 0x1p24) == 7.3890552180866447284268641248075832310141":
-float: 1
-ifloat: 1
-
-# sin_tonearest
-Test "sin_tonearest (1) == 0.8414709848078965066525023216302989996226":
-float: 1
-ifloat: 1
-
-# sincos
-Test "sincos (0x1p+120, &sin_res, &cos_res) puts -9.25879022854837867303861764107414946730833e-01 in cos_res":
-float: 1
-ifloat: 1
-Test "sincos (0x1p+127, &sin_res, &cos_res) puts 7.81914638714960072263910298466369236613162e-01 in cos_res":
-float: 1
-ifloat: 1
-Test "sincos (M_PI_6l*2.0, &sin_res, &cos_res) puts 0.5 in cos_res":
-double: 1
-idouble: 1
-Test "sincos (M_PI_6l*2.0, &sin_res, &cos_res) puts 0.86602540378443864676372317075293616 in sin_res":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-Test "sincos (pi/6, &sin_res, &cos_res) puts 0.86602540378443864676372317075293616 in cos_res":
-float: 1
-ifloat: 1
-
-# tgamma
-Test "tgamma (-0.5) == -2 sqrt (pi)":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-Test "tgamma (0.5) == sqrt (pi)":
-float: 1
-ifloat: 1
-Test "tgamma (0.7) == 1.29805533264755778568117117915281162":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-
-# y0
-Test "y0 (0x1.3ffp+74) == 1.818984347516051243459467456433028748678e-12":
-double: 1
-idouble: 1
-Test "y0 (0x1.ff00000000002p+840) == 1.846591691699331493194965158699937660696e-127":
-double: 1
-idouble: 1
-Test "y0 (0x1p-10) == -4.4865150767109739412411806297168793661098":
-double: 1
-idouble: 1
-Test "y0 (0x1p-110) == -4.861363632869203777249475899390797503250e+1":
-double: 1
-idouble: 1
-Test "y0 (0x1p-20) == -8.8992283012125827603076426611387876938160":
-float: 1
-ifloat: 1
-Test "y0 (0x1p-30) == -1.3311940304267782826037118027401817264906e+1":
-float: 1
-ifloat: 1
-Test "y0 (0x1p-40) == -1.7724652307320814696990854700366226762563e+1":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-Test "y0 (0x1p-50) == -2.2137364310373846564919987139743760738155e+1":
-float: 1
-ifloat: 1
-Test "y0 (0x1p-70) == -3.0962788316479910300778244424468159753887e+1":
-double: 1
-idouble: 1
-Test "y0 (0x1p-80) == -3.5375500319532942168707373066828113573541e+1":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-Test "y0 (1.0) == 0.0882569642156769579829267660235151628":
-double: 2
-float: 1
-idouble: 2
-ifloat: 1
-Test "y0 (1.5) == 0.382448923797758843955068554978089862":
-double: 2
-float: 1
-idouble: 2
-ifloat: 1
-Test "y0 (10.0) == 0.0556711672835993914244598774101900481":
-float: 1
-ifloat: 1
-Test "y0 (8.0) == 0.223521489387566220527323400498620359":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-
-# y1
-Test "y1 (0.125) == -5.19993611253477499595928744876579921":
-double: 1
-idouble: 1
-Test "y1 (0x1.27e204p+99) == -8.881610148467797208469612080785210013461e-16":
-double: 1
-idouble: 1
-Test "y1 (0x1p-10) == -6.5190099301063115047395187618929589514382e+02":
-double: 1
-idouble: 1
-Test "y1 (1.5) == -0.412308626973911295952829820633445323":
-float: 1
-ifloat: 1
-Test "y1 (10.0) == 0.249015424206953883923283474663222803":
-double: 3
-float: 1
-idouble: 3
-ifloat: 1
-Test "y1 (2.0) == -0.107032431540937546888370772277476637":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-Test "y1 (8.0) == -0.158060461731247494255555266187483550":
-double: 1
-float: 2
-idouble: 1
-ifloat: 2
-
-# yn
-Test "yn (0, 1.0) == 0.0882569642156769579829267660235151628":
-double: 2
-float: 1
-idouble: 2
-ifloat: 1
-Test "yn (0, 1.5) == 0.382448923797758843955068554978089862":
-double: 2
-float: 1
-idouble: 2
-ifloat: 1
-Test "yn (0, 10.0) == 0.0556711672835993914244598774101900481":
-float: 1
-ifloat: 1
-Test "yn (0, 8.0) == 0.223521489387566220527323400498620359":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-Test "yn (1, 0.125) == -5.19993611253477499595928744876579921":
-double: 1
-idouble: 1
-Test "yn (1, 1.5) == -0.412308626973911295952829820633445323":
-float: 1
-ifloat: 1
-Test "yn (1, 10.0) == 0.249015424206953883923283474663222803":
-double: 3
-float: 1
-idouble: 3
-ifloat: 1
-Test "yn (1, 2.0) == -0.107032431540937546888370772277476637":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-Test "yn (1, 8.0) == -0.158060461731247494255555266187483550":
-double: 1
-float: 2
-idouble: 1
-ifloat: 2
-Test "yn (10, 0.125) == -127057845771019398.252538486899753195":
-double: 1
-idouble: 1
-Test "yn (10, 0.75) == -2133501638.90573424452445412893839236":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-Test "yn (10, 1.0) == -121618014.278689189288130426667971145":
-double: 1
-idouble: 1
-Test "yn (10, 10.0) == -0.359814152183402722051986577343560609":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-Test "yn (10, 2.0) == -129184.542208039282635913145923304214":
-double: 2
-idouble: 2
-Test "yn (3, 0.125) == -2612.69757350066712600220955744091741":
-double: 1
-idouble: 1
-Test "yn (3, 0.75) == -12.9877176234475433186319774484809207":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-Test "yn (3, 10.0) == -0.251362657183837329779204747654240998":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-Test "yn (3, 2.0) == -1.12778377684042778608158395773179238":
-double: 1
-idouble: 1
-
-# Maximal error of functions:
-Function: "atan2":
-float: 1
-ifloat: 1
-
-Function: "atanh":
-float: 1
-ifloat: 1
-
-Function: Real part of "cacos":
-double: 2827891
-float: 6
-idouble: 2827891
-ifloat: 6
-
-Function: Imaginary part of "cacos":
-double: 8865344731827986
-float: 16512991
-idouble: 8865344731827986
-ifloat: 16512991
-
-Function: Real part of "cacosh":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-
-Function: Imaginary part of "cacosh":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-
-Function: Real part of "casin":
-double: 86
-float: 1
-idouble: 86
-ifloat: 1
-
-Function: Imaginary part of "casin":
-double: 8865344731827986
-float: 16512991
-idouble: 8865344731827986
-ifloat: 16512991
-
-Function: Real part of "casinh":
-double: 8865344731827986
-float: 16512991
-idouble: 8865344731827986
-ifloat: 16512991
-
-Function: Imaginary part of "casinh":
-double: 86
-float: 1
-idouble: 86
-ifloat: 1
-
-Function: Imaginary part of "catan":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-
-Function: Real part of "catanh":
-double: 4
-idouble: 4
-
-Function: "cbrt":
-double: 1
-idouble: 1
-
-Function: Real part of "ccos":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-
-Function: Imaginary part of "ccos":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-
-Function: Real part of "ccosh":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-
-Function: Imaginary part of "ccosh":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-
-Function: Real part of "cexp":
-double: 2
-float: 1
-idouble: 2
-ifloat: 1
-
-Function: Imaginary part of "cexp":
-double: 1
-float: 2
-idouble: 1
-ifloat: 2
-
-Function: Real part of "clog":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-
-Function: Imaginary part of "clog":
-float: 1
-ifloat: 1
-
-Function: Real part of "clog10":
-double: 2
-float: 2
-idouble: 2
-ifloat: 2
-
-Function: Imaginary part of "clog10":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-
-Function: "cos":
-double: 2
-float: 1
-idouble: 2
-ifloat: 1
-
-Function: "cos_tonearest":
-float: 1
-ifloat: 1
-
-Function: Real part of "cpow":
-double: 2
-float: 4
-idouble: 2
-ifloat: 4
-
-Function: Imaginary part of "cpow":
-double: 2
-float: 2
-idouble: 2
-ifloat: 2
-
-Function: Real part of "csin":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-
-Function: Real part of "csinh":
-float: 1
-ifloat: 1
-
-Function: Imaginary part of "csinh":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-
-Function: Real part of "csqrt":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-
-Function: Imaginary part of "csqrt":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-
-Function: Real part of "ctan":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-
-Function: Imaginary part of "ctan":
-double: 1
-idouble: 1
-
-Function: Real part of "ctan_tonearest":
-float: 1
-ifloat: 1
-
-Function: Imaginary part of "ctan_tonearest":
-float: 1
-ifloat: 1
-
-Function: Real part of "ctanh":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-
-Function: Imaginary part of "ctanh":
-double: 1
-float: 2
-idouble: 1
-ifloat: 2
-
-Function: Real part of "ctanh_tonearest":
-float: 1
-ifloat: 1
-
-Function: Imaginary part of "ctanh_tonearest":
-float: 1
-ifloat: 1
-
-Function: "erf":
-double: 1
-idouble: 1
-
-Function: "erfc":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-
-Function: "exp10":
-double: 1
-idouble: 1
-
-Function: "expm1":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-
-Function: "fma":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-
-Function: "hypot":
-float: 1
-ifloat: 1
-
-Function: "j0":
-double: 2
-float: 2
-idouble: 2
-ifloat: 2
-
-Function: "j1":
-double: 1
-float: 2
-idouble: 1
-ifloat: 2
-
-Function: "jn":
-double: 4
-float: 5
-idouble: 4
-ifloat: 5
-
-Function: "lgamma":
-double: 1
-float: 2
-idouble: 1
-ifloat: 2
-
-Function: "log10":
-double: 1
-float: 2
-idouble: 1
-ifloat: 2
-
-Function: "log1p":
-float: 1
-ifloat: 1
-
-Function: "pow":
-float: 1
-ifloat: 1
-
-Function: "sin_tonearest":
-float: 1
-ifloat: 1
-
-Function: "sincos":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-
-Function: "tan":
-double: 1
-idouble: 1
-
-Function: "tgamma":
-double: 1
-float: 1
-idouble: 1
-ifloat: 1
-
-Function: "y0":
-double: 2
-float: 1
-idouble: 2
-ifloat: 1
-
-Function: "y1":
-double: 3
-float: 2
-idouble: 3
-ifloat: 2
-
-Function: "yn":
-double: 3
-float: 2
-idouble: 3
-ifloat: 2
-
-# end of automatic generation
http://sourceware.org/git/gitweb.cgi?p=glibc.git;a=commitdiff;h=22af99fa7227e7a60ae1ec792260bf868a8cdd3e
commit 22af99fa7227e7a60ae1ec792260bf868a8cdd3e
Author: David Holsgrove <david.holsgrove@xilinx.com>
Date: Tue Feb 4 09:26:15 2014 +1000
microblaze BZ #15705: Define MMAP2_PAGE_SHIFT
Define MMAP2_PAGE_SHIFT to -1 for microblaze so the correct shift
for the syscall is determined dynamically using getpagesize
ports/ChangeLog.microblaze
2014-02-04 David Holsgrove <david.holsgrove@xilinx.com>
* sysdeps/unix/sysv/linux/microblaze/mmap64.c: New file.
Signed-off-by: David Holsgrove <david.holsgrove@xilinx.com>
diff --git a/NEWS b/NEWS
index 2c8f4f9..c0d981e 100644
--- a/NEWS
+++ b/NEWS
@@ -15,18 +15,18 @@ Version 2.19
14699, 14752, 14782, 14876, 14910, 15004, 15048, 15073, 15089, 15128,
15218, 15268, 15277, 15308, 15362, 15374, 15400, 15425, 15427, 15483,
15522, 15531, 15532, 15593, 15601, 15608, 15609, 15610, 15632, 15640,
- 15670, 15672, 15680, 15681, 15723, 15734, 15735, 15736, 15748, 15749,
- 15754, 15760, 15763, 15764, 15797, 15799, 15825, 15843, 15844, 15846,
- 15847, 15849, 15850, 15855, 15856, 15857, 15859, 15867, 15886, 15887,
- 15890, 15892, 15893, 15895, 15897, 15901, 15905, 15909, 15915, 15917,
- 15919, 15921, 15923, 15939, 15941, 15948, 15963, 15966, 15985, 15988,
- 15997, 16032, 16034, 16036, 16037, 16038, 16041, 16046, 16055, 16071,
- 16072, 16074, 16077, 16078, 16103, 16112, 16133, 16143, 16144, 16146,
- 16150, 16151, 16153, 16167, 16169, 16172, 16195, 16214, 16245, 16271,
- 16274, 16283, 16289, 16293, 16314, 16316, 16330, 16337, 16338, 16356,
- 16365, 16366, 16369, 16372, 16375, 16379, 16384, 16385, 16386, 16387,
- 16390, 16394, 16398, 16400, 16407, 16408, 16414, 16430, 16431, 16453,
- 16474, 16506, 16510
+ 15670, 15672, 15680, 15681, 15705, 15723, 15734, 15735, 15736, 15748,
+ 15749, 15754, 15760, 15763, 15764, 15797, 15799, 15825, 15843, 15844,
+ 15846, 15847, 15849, 15850, 15855, 15856, 15857, 15859, 15867, 15886,
+ 15887, 15890, 15892, 15893, 15895, 15897, 15901, 15905, 15909, 15915,
+ 15917, 15919, 15921, 15923, 15939, 15941, 15948, 15963, 15966, 15985,
+ 15988, 15997, 16032, 16034, 16036, 16037, 16038, 16041, 16046, 16055,
+ 16071, 16072, 16074, 16077, 16078, 16103, 16112, 16133, 16143, 16144,
+ 16146, 16150, 16151, 16153, 16167, 16169, 16172, 16195, 16214, 16245,
+ 16271, 16274, 16283, 16289, 16293, 16314, 16316, 16330, 16337, 16338,
+ 16356, 16365, 16366, 16369, 16372, 16375, 16379, 16384, 16385, 16386,
+ 16387, 16390, 16394, 16398, 16400, 16407, 16408, 16414, 16430, 16431,
+ 16453, 16474, 16506, 16510
* Slovenian translations for glibc messages have been contributed by the
Translation Project's Slovenian team of translators.
diff --git a/ports/ChangeLog.microblaze b/ports/ChangeLog.microblaze
index df1518e..93c311e 100644
--- a/ports/ChangeLog.microblaze
+++ b/ports/ChangeLog.microblaze
@@ -1,5 +1,10 @@
2014-02-04 David Holsgrove <david.holsgrove@xilinx.com>
+ [BZ #15705]
+ * sysdeps/unix/sysv/linux/microblaze/mmap64.c: New file.
+
+2014-02-04 David Holsgrove <david.holsgrove@xilinx.com>
+
* sysdeps/microblaze/fegetround.c: Delete redundant file.
* sysdeps/microblaze/fesetround.c: Likewise.
diff --git a/ports/sysdeps/unix/sysv/linux/microblaze/mmap64.c b/ports/sysdeps/unix/sysv/linux/microblaze/mmap64.c
new file mode 100644
index 0000000..11a6bd8
--- /dev/null
+++ b/ports/sysdeps/unix/sysv/linux/microblaze/mmap64.c
@@ -0,0 +1,4 @@
+/* Microblaze kernel has PAGE_SHIFT set to 12.
+ Determine the shift dynamically with getpagesize. */
+#define MMAP2_PAGE_SHIFT -1
+#include <sysdeps/unix/sysv/linux/mmap64.c>
http://sourceware.org/git/gitweb.cgi?p=glibc.git;a=commitdiff;h=9e4dfbefc63fc67fee2f9a74163dcc0bd0aa66ef
commit 9e4dfbefc63fc67fee2f9a74163dcc0bd0aa66ef
Author: David Holsgrove <david.holsgrove@xilinx.com>
Date: Tue Feb 4 09:22:42 2014 +1000
microblaze: Use <fenv.h> fallback functions
Delete redundant fegetround.c and fesetround.c for microblaze
and use the fallback functions instead.
ports/ChangeLog.microblaze
2014-02-04 David Holsgrove <david.holsgrove@xilinx.com>
* sysdeps/microblaze/fegetround.c: Delete redundant file.
* sysdeps/microblaze/fesetround.c: Likewise.
Signed-off-by: David Holsgrove <david.holsgrove@xilinx.com>
diff --git a/ports/ChangeLog.microblaze b/ports/ChangeLog.microblaze
index 7d47e04..df1518e 100644
--- a/ports/ChangeLog.microblaze
+++ b/ports/ChangeLog.microblaze
@@ -1,3 +1,8 @@
+2014-02-04 David Holsgrove <david.holsgrove@xilinx.com>
+
+ * sysdeps/microblaze/fegetround.c: Delete redundant file.
+ * sysdeps/microblaze/fesetround.c: Likewise.
+
2013-11-28 Joseph Myers <joseph@codesourcery.com>
* sysdeps/microblaze/fegetround.c (fegetround): Use
diff --git a/ports/sysdeps/microblaze/fegetround.c b/ports/sysdeps/microblaze/fegetround.c
deleted file mode 100644
index a2e57eb..0000000
--- a/ports/sysdeps/microblaze/fegetround.c
+++ /dev/null
@@ -1,25 +0,0 @@
-/* Copyright (C) 2011-2014 Free Software Foundation, Inc.
- This file is part of the GNU C Library.
-
- The GNU C Library is free software; you can redistribute it and/or
- modify it under the terms of the GNU Lesser General Public
- License as published by the Free Software Foundation; either
- version 2.1 of the License, or (at your option) any later version.
-
- The GNU C Library is distributed in the hope that it will be useful,
- but WITHOUT ANY WARRANTY; without even the implied warranty of
- MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
- Lesser General Public License for more details.
-
- You should have received a copy of the GNU Lesser General Public
- License along with the GNU C Library. If not, see
- <http://www.gnu.org/licenses/>. */
-
-#include <fenv.h>
-
-int
-fegetround (void)
-{
- return FE_TONEAREST;
-}
-libm_hidden_def (fegetround)
diff --git a/ports/sysdeps/microblaze/fesetround.c b/ports/sysdeps/microblaze/fesetround.c
deleted file mode 100644
index 16e2bf2..0000000
--- a/ports/sysdeps/microblaze/fesetround.c
+++ /dev/null
@@ -1,25 +0,0 @@
-/* Copyright (C) 2011-2014 Free Software Foundation, Inc.
- This file is part of the GNU C Library.
-
- The GNU C Library is free software; you can redistribute it and/or
- modify it under the terms of the GNU Lesser General Public
- License as published by the Free Software Foundation; either
- version 2.1 of the License, or (at your option) any later version.
-
- The GNU C Library is distributed in the hope that it will be useful,
- but WITHOUT ANY WARRANTY; without even the implied warranty of
- MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
- Lesser General Public License for more details.
-
- You should have received a copy of the GNU Lesser General Public
- License along with the GNU C Library. If not, see
- <http://www.gnu.org/licenses/>. */
-
-#include <fenv.h>
-
-int
-fesetround (int round)
-{
- return (round == FE_TONEAREST) ? 0 : 1;
-}
-libm_hidden_def (fesetround)
http://sourceware.org/git/gitweb.cgi?p=glibc.git;a=commitdiff;h=be6406a872b0e7e142cb326db07fb8e4c795ceb9
commit be6406a872b0e7e142cb326db07fb8e4c795ceb9
Author: Siddhesh Poyarekar <siddhesh@redhat.com>
Date: Wed Feb 5 12:50:22 2014 +0530
Update NEWS for #16398
diff --git a/NEWS b/NEWS
index 7998c75..2c8f4f9 100644
--- a/NEWS
+++ b/NEWS
@@ -25,8 +25,8 @@ Version 2.19
16150, 16151, 16153, 16167, 16169, 16172, 16195, 16214, 16245, 16271,
16274, 16283, 16289, 16293, 16314, 16316, 16330, 16337, 16338, 16356,
16365, 16366, 16369, 16372, 16375, 16379, 16384, 16385, 16386, 16387,
- 16390, 16394, 16400, 16407, 16408, 16414, 16430, 16431, 16453, 16474,
- 16506, 16510
+ 16390, 16394, 16398, 16400, 16407, 16408, 16414, 16430, 16431, 16453,
+ 16474, 16506, 16510
* Slovenian translations for glibc messages have been contributed by the
Translation Project's Slovenian team of translators.
http://sourceware.org/git/gitweb.cgi?p=glibc.git;a=commitdiff;h=cf015393a0a8e137fef06c3bc18f76c11cff3c6a
commit cf015393a0a8e137fef06c3bc18f76c11cff3c6a
Author: Siddhesh Poyarekar <siddhesh@redhat.com>
Date: Wed Feb 5 12:49:00 2014 +0530
Fix infinite loop in ftell when writing wide char data (BZ #16398)
ftell tries to avoid flushing the buffer when it is in write mode by
converting the wide char data and placing it into the binary buffer.
If the output buffer space is full and there is data to write, the
code reverts to flushing the buffer. This breaks when there is space
in the buffer but it is not enough to convert the next character in
the wide data buffer, due to which __codecvt_do_out returns a
__codecvt_partial status. In this case, ftell keeps running in an
infinite loop.
The fix here is to detect the __codecvt_partial status in addition to
checking if the buffer is full. I have also added a test case that
demonstrates the infinite loop.
diff --git a/libio/Makefile b/libio/Makefile
index 05432f4..747a779 100644
--- a/libio/Makefile
+++ b/libio/Makefile
@@ -60,7 +60,7 @@ tests = tst_swprintf tst_wprintf tst_swscanf tst_wscanf tst_getwc tst_putwc \
tst-wmemstream1 tst-wmemstream2 \
bug-memstream1 bug-wmemstream1 \
tst-setvbuf1 tst-popen1 tst-fgetwc bug-wsetpos tst-fseek \
- tst-fwrite-error
+ tst-fwrite-error tst-ftell-partial-wide
ifeq (yes,$(build-shared))
# Add test-fopenloc only if shared library is enabled since it depends on
# shared localedata objects.
diff --git a/libio/tst-ftell-partial-wide.c b/libio/tst-ftell-partial-wide.c
new file mode 100644
index 0000000..3734e77
--- /dev/null
+++ b/libio/tst-ftell-partial-wide.c
@@ -0,0 +1,107 @@
+/* Verify that ftell does not go into an infinite loop when a conversion fails
+ due to insufficient space in the buffer.
+ Copyright (C) 2014 Free Software Foundation, Inc.
+ This file is part of the GNU C Library.
+
+ The GNU C Library is free software; you can redistribute it and/or
+ modify it under the terms of the GNU Lesser General Public
+ License as published by the Free Software Foundation; either
+ version 2.1 of the License, or (at your option) any later version.
+
+ The GNU C Library is distributed in the hope that it will be useful,
+ but WITHOUT ANY WARRANTY; without even the implied warranty of
+ MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
+ Lesser General Public License for more details.
+
+ You should have received a copy of the GNU Lesser General Public
+ License along with the GNU C Library; if not, see
+ <http://www.gnu.org/licenses/>. */
+
+#include <wchar.h>
+#include <stdio.h>
+#include <stdlib.h>
+#include <string.h>
+#include <locale.h>
+#include <errno.h>
+#include <unistd.h>
+
+static int do_test (void);
+#define TEST_FUNCTION do_test ()
+#include "../test-skeleton.c"
+
+/* Arbitrary number large enough so that the target buffer during conversion is
+ not large enough. */
+#define STRING_SIZE (1400)
+#define NSTRINGS (2)
+
+static int
+do_test (void)
+{
+ FILE *fp = NULL;
+ wchar_t *inputs[NSTRINGS] = {NULL};
+ int ret = 1;
+
+ if (setlocale (LC_ALL, "en_US.UTF-8") == NULL)
+ {
+ printf ("Cannot set en_US.UTF-8 locale.\n");
+ goto out;
+ }
+
+
+ /* Generate input from one character, chosen because it has an odd number of
+ bytes in UTF-8, making it easier to reproduce the problem:
+
+ NAME Hiragana letter GO
+ CHAR ã??
+ UTF-8 E38194
+ UCS 3054
+ MARC-8 692434 */
+ wchar_t seed = L'ã??';
+ for (int i = 0; i < NSTRINGS; i++)
+ {
+ inputs[i] = malloc (STRING_SIZE * sizeof (wchar_t));
+ if (inputs[i] == NULL)
+ {
+ printf ("Failed to allocate memory for inputs: %m\n");
+ goto out;
+ }
+ wmemset (inputs[i], seed, STRING_SIZE - 1);
+ inputs[i][STRING_SIZE - 1] = L'\0';
+ }
+
+ char *filename;
+ int fd = create_temp_file ("tst-fseek-wide-partial.out", &filename);
+
+ if (fd == -1)
+ {
+ printf ("create_temp_file: %m\n");
+ goto out;
+ }
+
+ fp = fdopen (fd, "w+");
+ if (fp == NULL)
+ {
+ printf ("fopen: %m\n");
+ close (fd);
+ goto out;
+ }
+
+ for (int i = 0; i < NSTRINGS; i++)
+ {
+ printf ("offset: %ld\n", ftell (fp));
+ if (fputws (inputs[i], fp) == -1)
+ {
+ perror ("fputws");
+ goto out;
+ }
+ }
+ ret = 0;
+
+out:
+ if (fp != NULL)
+ fclose (fp);
+ for (int i = 0; i < NSTRINGS; i++)
+ free (inputs[i]);
+
+ return ret;
+}
diff --git a/libio/wfileops.c b/libio/wfileops.c
index 87d3cdc..877fc1f 100644
--- a/libio/wfileops.c
+++ b/libio/wfileops.c
@@ -715,7 +715,7 @@ _IO_wfile_seekoff (fp, offset, dir, mode)
- fp->_wide_data->_IO_write_base) / clen;
else
{
- enum __codecvt_result status;
+ enum __codecvt_result status = __codecvt_ok;
delta = (fp->_wide_data->_IO_write_ptr
- fp->_wide_data->_IO_write_base);
const wchar_t *write_base = fp->_wide_data->_IO_write_base;
@@ -728,9 +728,12 @@ _IO_wfile_seekoff (fp, offset, dir, mode)
flush buffers for every ftell. */
do
{
- /* Ugh, no point trying to avoid the flush. Just do it
- and go back to how it was with the read mode. */
- if (delta > 0 && new_write_ptr == fp->_IO_buf_end)
+ /* There is not enough space in the buffer to do the entire
+ conversion, so there is no point trying to avoid the
+ buffer flush. Just do it and go back to how it was with
+ the read mode. */
+ if (status == __codecvt_partial
+ || (delta > 0 && new_write_ptr == fp->_IO_buf_end))
{
if (_IO_switch_to_wget_mode (fp))
return WEOF;
http://sourceware.org/git/gitweb.cgi?p=glibc.git;a=commitdiff;h=3672eb9056332bf1b05a0275f85db70d7fbcfe4c
commit 3672eb9056332bf1b05a0275f85db70d7fbcfe4c
Author: Siddhesh Poyarekar <siddhesh@redhat.com>
Date: Wed Feb 5 12:22:58 2014 +0530
Update contrib.texi
This may not be a complete list of new contributors added to the list,
so I'd love it if more people look at contributions and suggest
additions.
diff --git a/ChangeLog b/ChangeLog
index 66e4049..9c0a003 100644
--- a/ChangeLog
+++ b/ChangeLog
@@ -1,3 +1,9 @@
+2014-02-05 Siddhesh Poyarekar <siddhesh@redhat.com>
+
+ * manual/contrib.texi: Update entry for Ondrej Bilka, Will
+ Newton and Alexandre Oliva. Add entries for Steve Ellcey, Chris
+ Leonard and Allan McRae.
+
2014-02-04 Adhemerval Zanella <azanella@linux.vnet.ibm.com>
* sysdeps/unix/sysv/linux/powerpc/powerpc64/nptl/ld-le.abilist: New
diff --git a/manual/contrib.texi b/manual/contrib.texi
index 8116367..286aa96 100644
--- a/manual/contrib.texi
+++ b/manual/contrib.texi
@@ -29,7 +29,8 @@ Stephen R. van den Berg for contributing a highly-optimized
@code{strstr} function.
@item
-Ondrej Bilka for contributing optimized string routines for x64.
+Ondrej Bilka for contributing optimized string routines for x64 and various
+fixes.
@item
Eric Blake for adding O(n) implementations of @code{memmem},
@@ -84,6 +85,9 @@ Paul Eggert for the @code{mktime} function and for his direction as
part of @theglibc{} steering committee.
@item
+Steve Ellcey for various fixes.
+
+@item
Tulio Magno Quites Machado Filho for adding a new class of installed
headers for low-level platform-specific functionality and one such for
PowerPC.
@@ -175,6 +179,9 @@ functions @code{malloc}, @code{realloc} and @code{free} and related
code.
@item
+Chris Leonard for various fixes and enhancements to localedata.
+
+@item
Hongjiu Lu for providing the support for a Linux 32-bit runtime
environment under x86-64 (x32), for porting to Linux on IA64, for
improved string functions, a framework for testing IFUNC
@@ -196,6 +203,9 @@ work on the Hurd port, his direction as part of @theglibc{} steering
committee, and for many bug fixes and reviewing of contributions.
@item
+Allan McRae for various fixes.
+
+@item
Jason Merrill for the port to the Sequent Symmetry running Dynix
version 3 (@code{i386-sequent-bsd}).
@@ -232,8 +242,8 @@ coverage of conformtest, and merging the ports/ subdirectory
into the @glibcadj{} main repository.
@item
-Will Newton for contributing an optimized memcpy for ARM NEON and
-VFP chips.
+Will Newton for contributing some optimized string functions and pointer
+encryption support for ARM and various fixes.
@item
Carlos O'Donell for his maintainership of the HPPA architecture and
@@ -242,7 +252,8 @@ maintaining @theglibc{} web pages.
@item
Alexandre Oliva for adding TLS descriptors for LD and GD on x86 and
x86-64, for the am33 port, for completing the MIPS n64/n32/o32 multilib
-port, and for various fixes.
+port, for thread-safety, async-signal safety and async-cancellation
+safety documentation in the manual and for various fixes.
@item
Paul Pluzhnikov for various fixes.
http://sourceware.org/git/gitweb.cgi?p=glibc.git;a=commitdiff;h=dc52d4171b01963c36bc80afb2d2e23fc096e0dc
commit dc52d4171b01963c36bc80afb2d2e23fc096e0dc
Author: David S. Miller <davem@davemloft.net>
Date: Tue Feb 4 20:54:58 2014 -0800
Adjust sparc ULPs.
* sysdeps/sparc/fpu/libm-test-ulps: Update for some 64-bit differences from
32-bit.
diff --git a/sysdeps/sparc/fpu/libm-test-ulps b/sysdeps/sparc/fpu/libm-test-ulps
index b22c08a..bf3cd45 100644
--- a/sysdeps/sparc/fpu/libm-test-ulps
+++ b/sysdeps/sparc/fpu/libm-test-ulps
@@ -16632,6 +16632,9 @@ double: 2
idouble: 2
ildouble: 2
ldouble: 2
+Test "tgamma (-0x2.8ffffcp+4)":
+ildouble: 2
+ldouble: 2
Test "tgamma (-0x2.8fffffffffffep+4)":
ildouble: 1
ldouble: 1
@@ -17057,6 +17060,8 @@ double: 1
float: 1
idouble: 1
ifloat: 1
+ildouble: 1
+ldouble: 1
Test "tgamma (-0x9.ffffffffffff8p+0)":
double: 1
idouble: 1
http://sourceware.org/git/gitweb.cgi?p=glibc.git;a=commitdiff;h=2fdda5919e204128906e53ad8619e874ee96f193
commit 2fdda5919e204128906e53ad8619e874ee96f193
Author: Adhemerval Zanella <azanella@linux.vnet.ibm.com>
Date: Tue Feb 4 09:49:34 2014 -0200
PowerPC: powerpc64le abilist for 2.17
This patch is the abifiles for powerpc64le based on GLIBC 2.17.
diff --git a/ChangeLog b/ChangeLog
index 627c7ab..66e4049 100644
--- a/ChangeLog
+++ b/ChangeLog
@@ -1,5 +1,34 @@
2014-02-04 Adhemerval Zanella <azanella@linux.vnet.ibm.com>
+ * sysdeps/unix/sysv/linux/powerpc/powerpc64/nptl/ld-le.abilist: New
+ file
+ * sysdeps/unix/sysv/linux/powerpc/powerpc64/nptl/libBrokenLocale-le.abilist:
+ New file
+ * sysdeps/unix/sysv/linux/powerpc/powerpc64/nptl/libanl-le.abilist: New
+ file.
+ * sysdeps/unix/sysv/linux/powerpc/powerpc64/nptl/libc-le.abilist: New
+ file.
+ * sysdeps/unix/sysv/linux/powerpc/powerpc64/nptl/libcrypt-le.abilist:
+ New file.
+ * sysdeps/unix/sysv/linux/powerpc/powerpc64/nptl/libdl-le.abilist: New
+ file.
+ * sysdeps/unix/sysv/linux/powerpc/powerpc64/nptl/libm-le.abilist: New
+ file.
+ * sysdeps/unix/sysv/linux/powerpc/powerpc64/nptl/libnsl-le.abilist:
+ New file.
+ * sysdeps/unix/sysv/linux/powerpc/powerpc64/nptl/libpthread-le.abilist:
+ New file.
+ * sysdeps/unix/sysv/linux/powerpc/powerpc64/nptl/libresolv-le.abilist:
+ New file.
+ * sysdeps/unix/sysv/linux/powerpc/powerpc64/nptl/librt-le.abilist:
+ New file.
+ * sysdeps/unix/sysv/linux/powerpc/powerpc64/nptl/libthread_db-le.abilist:
+ New file.
+ * sysdeps/unix/sysv/linux/powerpc/powerpc64/nptl/libutil-le.abilist:
+ New file.
+
+2014-02-01 Adhemerval Zanella <azanella@linux.vnet.ibm.com>
+
* nptl/shlib-versions: Change powerpc*le start to 2.17.
* shlib-versions: Likewise.
diff --git a/sysdeps/unix/sysv/linux/powerpc/powerpc64/nptl/ld-le.abilist b/sysdeps/unix/sysv/linux/powerpc/powerpc64/nptl/ld-le.abilist
new file mode 100644
index 0000000..3530fb4
--- /dev/null
+++ b/sysdeps/unix/sysv/linux/powerpc/powerpc64/nptl/ld-le.abilist
@@ -0,0 +1,11 @@
+GLIBC_2.17
+ GLIBC_2.17 A
+ __libc_memalign F
+ __libc_stack_end D 0x8
+ __tls_get_addr F
+ _dl_mcount F
+ _r_debug D 0x28
+ calloc F
+ free F
+ malloc F
+ realloc F
diff --git a/sysdeps/unix/sysv/linux/powerpc/powerpc64/nptl/libBrokenLocale-le.abilist b/sysdeps/unix/sysv/linux/powerpc/powerpc64/nptl/libBrokenLocale-le.abilist
new file mode 100644
index 0000000..92c43d9
--- /dev/null
+++ b/sysdeps/unix/sysv/linux/powerpc/powerpc64/nptl/libBrokenLocale-le.abilist
@@ -0,0 +1,3 @@
+GLIBC_2.17
+ GLIBC_2.17 A
+ __ctype_get_mb_cur_max F
diff --git a/sysdeps/unix/sysv/linux/powerpc/powerpc64/nptl/libanl-le.abilist b/sysdeps/unix/sysv/linux/powerpc/powerpc64/nptl/libanl-le.abilist
new file mode 100644
index 0000000..0d32f2e
--- /dev/null
+++ b/sysdeps/unix/sysv/linux/powerpc/powerpc64/nptl/libanl-le.abilist
@@ -0,0 +1,6 @@
+GLIBC_2.17
+ GLIBC_2.17 A
+ gai_cancel F
+ gai_error F
+ gai_suspend F
+ getaddrinfo_a F
diff --git a/sysdeps/unix/sysv/linux/powerpc/powerpc64/nptl/libc-le.abilist b/sysdeps/unix/sysv/linux/powerpc/powerpc64/nptl/libc-le.abilist
new file mode 100644
index 0000000..20eac4e
--- /dev/null
+++ b/sysdeps/unix/sysv/linux/powerpc/powerpc64/nptl/libc-le.abilist
@@ -0,0 +1,2171 @@
+GLIBC_2.17
+ GLIBC_2.17 A
+ _Exit F
+ _IO_2_1_stderr_ D 0xe0
+ _IO_2_1_stdin_ D 0xe0
+ _IO_2_1_stdout_ D 0xe0
+ _IO_adjust_column F
+ _IO_adjust_wcolumn F
+ _IO_default_doallocate F
+ _IO_default_finish F
+ _IO_default_pbackfail F
+ _IO_default_uflow F
+ _IO_default_xsgetn F
+ _IO_default_xsputn F
+ _IO_do_write F
+ _IO_doallocbuf F
+ _IO_fclose F
+ _IO_fdopen F
+ _IO_feof F
+ _IO_ferror F
+ _IO_fflush F
+ _IO_fgetpos F
+ _IO_fgetpos64 F
+ _IO_fgets F
+ _IO_file_attach F
+ _IO_file_close F
+ _IO_file_close_it F
+ _IO_file_doallocate F
+ _IO_file_finish F
+ _IO_file_fopen F
+ _IO_file_init F
+ _IO_file_jumps D 0xa8
+ _IO_file_open F
+ _IO_file_overflow F
+ _IO_file_read F
+ _IO_file_seek F
+ _IO_file_seekoff F
+ _IO_file_setbuf F
+ _IO_file_stat F
+ _IO_file_sync F
+ _IO_file_underflow F
+ _IO_file_write F
+ _IO_file_xsputn F
+ _IO_flockfile F
+ _IO_flush_all F
+ _IO_flush_all_linebuffered F
+ _IO_fopen F
+ _IO_fprintf F
+ _IO_fputs F
+ _IO_fread F
+ _IO_free_backup_area F
+ _IO_free_wbackup_area F
+ _IO_fsetpos F
+ _IO_fsetpos64 F
+ _IO_ftell F
+ _IO_ftrylockfile F
+ _IO_funlockfile F
+ _IO_fwrite F
+ _IO_getc F
+ _IO_getline F
+ _IO_getline_info F
+ _IO_gets F
+ _IO_init F
+ _IO_init_marker F
+ _IO_init_wmarker F
+ _IO_iter_begin F
+ _IO_iter_end F
+ _IO_iter_file F
+ _IO_iter_next F
+ _IO_least_wmarker F
+ _IO_link_in F
+ _IO_list_all D 0x8
+ _IO_list_lock F
+ _IO_list_resetlock F
+ _IO_list_unlock F
+ _IO_marker_delta F
+ _IO_marker_difference F
+ _IO_padn F
+ _IO_peekc_locked F
+ _IO_popen F
+ _IO_printf F
+ _IO_proc_close F
+ _IO_proc_open F
+ _IO_putc F
+ _IO_puts F
+ _IO_remove_marker F
+ _IO_seekmark F
+ _IO_seekoff F
+ _IO_seekpos F
+ _IO_seekwmark F
+ _IO_setb F
+ _IO_setbuffer F
+ _IO_setvbuf F
+ _IO_sgetn F
+ _IO_sprintf F
+ _IO_sputbackc F
+ _IO_sputbackwc F
+ _IO_sscanf F
+ _IO_str_init_readonly F
+ _IO_str_init_static F
+ _IO_str_overflow F
+ _IO_str_pbackfail F
+ _IO_str_seekoff F
+ _IO_str_underflow F
+ _IO_sungetc F
+ _IO_sungetwc F
+ _IO_switch_to_get_mode F
+ _IO_switch_to_main_wget_area F
+ _IO_switch_to_wbackup_area F
+ _IO_switch_to_wget_mode F
+ _IO_un_link F
+ _IO_ungetc F
+ _IO_unsave_markers F
+ _IO_unsave_wmarkers F
+ _IO_vfprintf F
+ _IO_vfscanf F
+ _IO_vsprintf F
+ _IO_wdefault_doallocate F
+ _IO_wdefault_finish F
+ _IO_wdefault_pbackfail F
+ _IO_wdefault_uflow F
+ _IO_wdefault_xsgetn F
+ _IO_wdefault_xsputn F
+ _IO_wdo_write F
+ _IO_wdoallocbuf F
+ _IO_wfile_jumps D 0xa8
+ _IO_wfile_overflow F
+ _IO_wfile_seekoff F
+ _IO_wfile_sync F
+ _IO_wfile_underflow F
+ _IO_wfile_xsputn F
+ _IO_wmarker_delta F
+ _IO_wsetb F
+ __adjtimex F
+ __after_morecore_hook D 0x8
+ __argz_count F
+ __argz_next F
+ __argz_stringify F
+ __asprintf F
+ __asprintf_chk F
+ __assert F
+ __assert_fail F
+ __assert_perror_fail F
+ __backtrace F
+ __backtrace_symbols F
+ __backtrace_symbols_fd F
+ __bsd_getpgrp F
+ __bzero F
+ __check_rhosts_file D 0x4
+ __chk_fail F
+ __clone F
+ __close F
+ __cmsg_nxthdr F
+ __confstr_chk F
+ __connect F
+ __ctype_b_loc F
+ __ctype_get_mb_cur_max F
+ __ctype_tolower_loc F
+ __ctype_toupper_loc F
+ __curbrk D 0x8
+ __cxa_at_quick_exit F
+ __cxa_atexit F
+ __cxa_finalize F
+ __cyg_profile_func_enter F
+ __cyg_profile_func_exit F
+ __daylight D 0x4
+ __dcgettext F
+ __default_morecore F
+ __dgettext F
+ __dprintf_chk F
+ __dup2 F
+ __duplocale F
+ __endmntent F
+ __environ D 0x8
+ __errno_location F
+ __fbufsize F
+ __fcntl F
+ __fdelt_chk F
+ __fdelt_warn F
+ __ffs F
+ __fgets_chk F
+ __fgets_unlocked_chk F
+ __fgetws_chk F
+ __fgetws_unlocked_chk F
+ __finite F
+ __finitef F
+ __finitel F
+ __flbf F
+ __fork F
+ __fpending F
+ __fprintf_chk F
+ __fpu_control D 0x4
+ __fpurge F
+ __fread_chk F
+ __fread_unlocked_chk F
+ __freadable F
+ __freading F
+ __free_hook D 0x8
+ __freelocale F
+ __fsetlocking F
+ __fwprintf_chk F
+ __fwritable F
+ __fwriting F
+ __fxstat F
+ __fxstat64 F
+ __fxstatat F
+ __fxstatat64 F
+ __getauxval F
+ __getcwd_chk F
+ __getdelim F
+ __getdomainname_chk F
+ __getgroups_chk F
+ __gethostname_chk F
+ __getlogin_r_chk F
+ __getmntent_r F
+ __getpagesize F
+ __getpgid F
+ __getpid F
+ __gets_chk F
+ __gettimeofday F
+ __getwd_chk F
+ __gmtime_r F
+ __h_errno_location F
+ __isalnum_l F
+ __isalpha_l F
+ __isascii_l F
+ __isblank_l F
+ __iscntrl_l F
+ __isctype F
+ __isdigit_l F
+ __isgraph_l F
+ __isinf F
+ __isinff F
+ __isinfl F
+ __islower_l F
+ __isnan F
+ __isnanf F
+ __isnanl F
+ __isoc99_fscanf F
+ __isoc99_fwscanf F
+ __isoc99_scanf F
+ __isoc99_sscanf F
+ __isoc99_swscanf F
+ __isoc99_vfscanf F
+ __isoc99_vfwscanf F
+ __isoc99_vscanf F
+ __isoc99_vsscanf F
+ __isoc99_vswscanf F
+ __isoc99_vwscanf F
+ __isoc99_wscanf F
+ __isprint_l F
+ __ispunct_l F
+ __isspace_l F
+ __isupper_l F
+ __iswalnum_l F
+ __iswalpha_l F
+ __iswblank_l F
+ __iswcntrl_l F
+ __iswctype F
+ __iswctype_l F
+ __iswdigit_l F
+ __iswgraph_l F
+ __iswlower_l F
+ __iswprint_l F
+ __iswpunct_l F
+ __iswspace_l F
+ __iswupper_l F
+ __iswxdigit_l F
+ __isxdigit_l F
+ __ivaliduser F
+ __key_decryptsession_pk_LOCAL D 0x8
+ __key_encryptsession_pk_LOCAL D 0x8
+ __key_gendes_LOCAL D 0x8
+ __libc_allocate_rtsig F
+ __libc_calloc F
+ __libc_current_sigrtmax F
+ __libc_current_sigrtmin F
+ __libc_free F
+ __libc_freeres F
+ __libc_init_first F
+ __libc_mallinfo F
+ __libc_malloc F
+ __libc_mallopt F
+ __libc_memalign F
+ __libc_pvalloc F
+ __libc_realloc F
+ __libc_sa_len F
+ __libc_start_main F
+ __libc_valloc F
+ __longjmp_chk F
+ __lseek F
+ __lxstat F
+ __lxstat64 F
+ __malloc_hook D 0x8
+ __malloc_initialize_hook D 0x8
+ __mbrlen F
+ __mbrtowc F
+ __mbsnrtowcs_chk F
+ __mbsrtowcs_chk F
+ __mbstowcs_chk F
+ __memalign_hook D 0x8
+ __memcpy_chk F
+ __memmove_chk F
+ __mempcpy F
+ __mempcpy_chk F
+ __mempcpy_small F
+ __memset_chk F
+ __monstartup F
+ __morecore D 0x8
+ __nanosleep F
+ __newlocale F
+ __nl_langinfo_l F
+ __nldbl__IO_fprintf F
+ __nldbl__IO_printf F
+ __nldbl__IO_sprintf F
+ __nldbl__IO_sscanf F
+ __nldbl__IO_vfprintf F
+ __nldbl__IO_vfscanf F
+ __nldbl__IO_vsprintf F
+ __nldbl___asprintf F
+ __nldbl___asprintf_chk F
+ __nldbl___dprintf_chk F
+ __nldbl___fprintf_chk F
+ __nldbl___fwprintf_chk F
+ __nldbl___isoc99_fscanf F
+ __nldbl___isoc99_fwscanf F
+ __nldbl___isoc99_scanf F
+ __nldbl___isoc99_sscanf F
+ __nldbl___isoc99_swscanf F
+ __nldbl___isoc99_vfscanf F
+ __nldbl___isoc99_vfwscanf F
+ __nldbl___isoc99_vscanf F
+ __nldbl___isoc99_vsscanf F
+ __nldbl___isoc99_vswscanf F
+ __nldbl___isoc99_vwscanf F
+ __nldbl___isoc99_wscanf F
+ __nldbl___obstack_printf_chk F
+ __nldbl___obstack_vprintf_chk F
+ __nldbl___printf_chk F
+ __nldbl___printf_fp F
+ __nldbl___snprintf_chk F
+ __nldbl___sprintf_chk F
+ __nldbl___strfmon_l F
+ __nldbl___swprintf_chk F
+ __nldbl___syslog_chk F
+ __nldbl___vasprintf_chk F
+ __nldbl___vdprintf_chk F
+ __nldbl___vfprintf_chk F
+ __nldbl___vfscanf F
+ __nldbl___vfwprintf_chk F
+ __nldbl___vprintf_chk F
+ __nldbl___vsnprintf F
+ __nldbl___vsnprintf_chk F
+ __nldbl___vsprintf_chk F
+ __nldbl___vsscanf F
+ __nldbl___vstrfmon F
+ __nldbl___vstrfmon_l F
+ __nldbl___vswprintf_chk F
+ __nldbl___vsyslog_chk F
+ __nldbl___vwprintf_chk F
+ __nldbl___wprintf_chk F
+ __nldbl_asprintf F
+ __nldbl_dprintf F
+ __nldbl_fprintf F
+ __nldbl_fscanf F
+ __nldbl_fwprintf F
+ __nldbl_fwscanf F
+ __nldbl_obstack_printf F
+ __nldbl_obstack_vprintf F
+ __nldbl_printf F
+ __nldbl_printf_size F
+ __nldbl_scanf F
+ __nldbl_snprintf F
+ __nldbl_sprintf F
+ __nldbl_sscanf F
+ __nldbl_strfmon F
+ __nldbl_strfmon_l F
+ __nldbl_swprintf F
+ __nldbl_swscanf F
+ __nldbl_syslog F
+ __nldbl_vasprintf F
+ __nldbl_vdprintf F
+ __nldbl_vfprintf F
+ __nldbl_vfscanf F
+ __nldbl_vfwprintf F
+ __nldbl_vfwscanf F
+ __nldbl_vprintf F
+ __nldbl_vscanf F
+ __nldbl_vsnprintf F
+ __nldbl_vsprintf F
+ __nldbl_vsscanf F
+ __nldbl_vswprintf F
+ __nldbl_vswscanf F
+ __nldbl_vsyslog F
+ __nldbl_vwprintf F
+ __nldbl_vwscanf F
+ __nldbl_wprintf F
+ __nldbl_wscanf F
+ __nss_configure_lookup F
+ __nss_database_lookup F
+ __nss_group_lookup F
+ __nss_hostname_digits_dots F
+ __nss_hosts_lookup F
+ __nss_next F
+ __nss_passwd_lookup F
+ __obstack_printf_chk F
+ __obstack_vprintf_chk F
+ __open F
+ __open64 F
+ __open64_2 F
+ __open_2 F
+ __openat64_2 F
+ __openat_2 F
+ __overflow F
+ __pipe F
+ __poll F
+ __poll_chk F
+ __posix_getopt F
+ __ppc_get_timebase_freq F
+ __ppoll_chk F
+ __pread64 F
+ __pread64_chk F
+ __pread_chk F
+ __printf_chk F
+ __printf_fp F
+ __profile_frequency F
+ __progname D 0x8
+ __progname_full D 0x8
+ __ptsname_r_chk F
+ __pwrite64 F
+ __rawmemchr F
+ __rcmd_errstr D 0x8
+ __read F
+ __read_chk F
+ __readlink_chk F
+ __readlinkat_chk F
+ __realloc_hook D 0x8
+ __realpath_chk F
+ __recv_chk F
+ __recvfrom_chk F
+ __register_atfork F
+ __res_init F
+ __res_nclose F
+ __res_ninit F
+ __res_randomid F
+ __res_state F
+ __rpc_thread_createerr F
+ __rpc_thread_svc_fdset F
+ __rpc_thread_svc_max_pollfd F
+ __rpc_thread_svc_pollfd F
+ __sbrk F
+ __sched_cpualloc F
+ __sched_cpucount F
+ __sched_cpufree F
+ __sched_get_priority_max F
+ __sched_get_priority_min F
+ __sched_getparam F
+ __sched_getscheduler F
+ __sched_setscheduler F
+ __sched_yield F
+ __select F
+ __send F
+ __setmntent F
+ __setpgid F
+ __sigaction F
+ __sigaddset F
+ __sigdelset F
+ __sigismember F
+ __signbit F
+ __signbitf F
+ __signbitl F
+ __sigpause F
+ __sigsetjmp F
+ __sigsuspend F
+ __snprintf_chk F
+ __sprintf_chk F
+ __stack_chk_fail F
+ __statfs F
+ __stpcpy F
+ __stpcpy_chk F
+ __stpcpy_small F
+ __stpncpy F
+ __stpncpy_chk F
+ __strcasecmp F
+ __strcasecmp_l F
+ __strcasestr F
+ __strcat_chk F
+ __strcoll_l F
+ __strcpy_chk F
+ __strcpy_small F
+ __strcspn_c1 F
+ __strcspn_c2 F
+ __strcspn_c3 F
+ __strdup F
+ __strerror_r F
+ __strfmon_l F
+ __strftime_l F
+ __strncasecmp_l F
+ __strncat_chk F
+ __strncpy_chk F
+ __strndup F
+ __strpbrk_c2 F
+ __strpbrk_c3 F
+ __strsep_1c F
+ __strsep_2c F
+ __strsep_3c F
+ __strsep_g F
+ __strspn_c1 F
+ __strspn_c2 F
+ __strspn_c3 F
+ __strtod_internal F
+ __strtod_l F
+ __strtof_internal F
+ __strtof_l F
+ __strtok_r F
+ __strtok_r_1c F
+ __strtol_internal F
+ __strtol_l F
+ __strtold_internal F
+ __strtold_l F
+ __strtoll_internal F
+ __strtoll_l F
+ __strtoul_internal F
+ __strtoul_l F
+ __strtoull_internal F
+ __strtoull_l F
+ __strverscmp F
+ __strxfrm_l F
+ __swprintf_chk F
+ __sysconf F
+ __sysctl F
+ __syslog_chk F
+ __sysv_signal F
+ __timezone D 0x8
+ __toascii_l F
+ __tolower_l F
+ __toupper_l F
+ __towctrans F
+ __towctrans_l F
+ __towlower_l F
+ __towupper_l F
+ __ttyname_r_chk F
+ __tzname D 0x10
+ __uflow F
+ __underflow F
+ __uselocale F
+ __vasprintf_chk F
+ __vdprintf_chk F
+ __vfork F
+ __vfprintf_chk F
+ __vfscanf F
+ __vfwprintf_chk F
+ __vprintf_chk F
+ __vsnprintf F
+ __vsnprintf_chk F
+ __vsprintf_chk F
+ __vsscanf F
+ __vswprintf_chk F
+ __vsyslog_chk F
+ __vwprintf_chk F
+ __wait F
+ __waitpid F
+ __wcpcpy_chk F
+ __wcpncpy_chk F
+ __wcrtomb_chk F
+ __wcscasecmp_l F
+ __wcscat_chk F
+ __wcscoll_l F
+ __wcscpy_chk F
+ __wcsftime_l F
+ __wcsncasecmp_l F
+ __wcsncat_chk F
+ __wcsncpy_chk F
+ __wcsnrtombs_chk F
+ __wcsrtombs_chk F
+ __wcstod_internal F
+ __wcstod_l F
+ __wcstof_internal F
+ __wcstof_l F
+ __wcstol_internal F
+ __wcstol_l F
+ __wcstold_internal F
+ __wcstold_l F
+ __wcstoll_internal F
+ __wcstoll_l F
+ __wcstombs_chk F
+ __wcstoul_internal F
+ __wcstoul_l F
+ __wcstoull_internal F
+ __wcstoull_l F
+ __wcsxfrm_l F
+ __wctomb_chk F
+ __wctrans_l F
+ __wctype_l F
+ __wmemcpy_chk F
+ __wmemmove_chk F
+ __wmempcpy_chk F
+ __wmemset_chk F
+ __woverflow F
+ __wprintf_chk F
+ __write F
+ __wuflow F
+ __wunderflow F
+ __xmknod F
+ __xmknodat F
+ __xpg_basename F
+ __xpg_sigpause F
+ __xpg_strerror_r F
+ __xstat F
+ __xstat64 F
+ _authenticate F
+ _dl_mcount_wrapper F
+ _dl_mcount_wrapper_check F
+ _environ D 0x8
+ _exit F
+ _flushlbf F
+ _libc_intl_domainname D 0x5
+ _longjmp F
+ _mcleanup F
+ _mcount F
+ _nl_default_dirname D 0x12
+ _nl_domain_bindings D 0x8
+ _nl_msg_cat_cntr D 0x4
+ _null_auth D 0x18
+ _obstack_allocated_p F
+ _obstack_begin F
+ _obstack_begin_1 F
+ _obstack_free F
+ _obstack_memory_used F
+ _obstack_newchunk F
+ _res D 0x238
+ _res_hconf D 0x48
+ _rpc_dtablesize F
+ _seterr_reply F
+ _setjmp F
+ _sys_errlist D 0x438
+ _sys_nerr D 0x4
+ _sys_siglist D 0x208
+ _tolower F
+ _toupper F
+ a64l F
+ abort F
+ abs F
+ accept F
+ accept4 F
+ access F
+ acct F
+ addmntent F
+ addseverity F
+ adjtime F
+ adjtimex F
+ advance F
+ alarm F
+ aligned_alloc F
+ alphasort F
+ alphasort64 F
+ argp_err_exit_status D 0x4
+ argp_error F
+ argp_failure F
+ argp_help F
+ argp_parse F
+ argp_program_bug_address D 0x8
+ argp_program_version D 0x8
+ argp_program_version_hook D 0x8
+ argp_state_help F
+ argp_usage F
+ argz_add F
+ argz_add_sep F
+ argz_append F
+ argz_count F
+ argz_create F
+ argz_create_sep F
+ argz_delete F
+ argz_extract F
+ argz_insert F
+ argz_next F
+ argz_replace F
+ argz_stringify F
+ asctime F
+ asctime_r F
+ asprintf F
+ atof F
+ atoi F
+ atol F
+ atoll F
+ authdes_create F
+ authdes_getucred F
+ authdes_pk_create F
+ authnone_create F
+ authunix_create F
+ authunix_create_default F
+ backtrace F
+ backtrace_symbols F
+ backtrace_symbols_fd F
+ basename F
+ bcmp F
+ bcopy F
+ bdflush F
+ bind F
+ bind_textdomain_codeset F
+ bindresvport F
+ bindtextdomain F
+ brk F
+ bsd_signal F
+ bsearch F
+ btowc F
+ bzero F
+ c16rtomb F
+ c32rtomb F
+ calloc F
+ callrpc F
+ canonicalize_file_name F
+ capget F
+ capset F
+ catclose F
+ catgets F
+ catopen F
+ cbc_crypt F
+ cfgetispeed F
+ cfgetospeed F
+ cfmakeraw F
+ cfree F
+ cfsetispeed F
+ cfsetospeed F
+ cfsetspeed F
+ chdir F
+ chflags F
+ chmod F
+ chown F
+ chroot F
+ clearenv F
+ clearerr F
+ clearerr_unlocked F
+ clnt_broadcast F
+ clnt_create F
+ clnt_pcreateerror F
+ clnt_perrno F
+ clnt_perror F
+ clnt_spcreateerror F
+ clnt_sperrno F
+ clnt_sperror F
+ clntraw_create F
+ clnttcp_create F
+ clntudp_bufcreate F
+ clntudp_create F
+ clntunix_create F
+ clock F
+ clock_adjtime F
+ clock_getcpuclockid F
+ clock_getres F
+ clock_gettime F
+ clock_nanosleep F
+ clock_settime F
+ clone F
+ close F
+ closedir F
+ closelog F
+ confstr F
+ connect F
+ copysign F
+ copysignf F
+ copysignl F
+ creat F
+ creat64 F
+ create_module F
+ ctermid F
+ ctime F
+ ctime_r F
+ cuserid F
+ daemon F
+ daylight D 0x4
+ dcgettext F
+ dcngettext F
+ delete_module F
+ des_setparity F
+ dgettext F
+ difftime F
+ dirfd F
+ dirname F
+ div F
+ dl_iterate_phdr F
+ dngettext F
+ dprintf F
+ drand48 F
+ drand48_r F
+ dup F
+ dup2 F
+ dup3 F
+ duplocale F
+ dysize F
+ eaccess F
+ ecb_crypt F
+ ecvt F
+ ecvt_r F
+ endaliasent F
+ endfsent F
+ endgrent F
+ endhostent F
+ endmntent F
+ endnetent F
+ endnetgrent F
+ endprotoent F
+ endpwent F
+ endrpcent F
+ endservent F
+ endsgent F
+ endspent F
+ endttyent F
+ endusershell F
+ endutent F
+ endutxent F
+ environ D 0x8
+ envz_add F
+ envz_entry F
+ envz_get F
+ envz_merge F
+ envz_remove F
+ envz_strip F
+ epoll_create F
+ epoll_create1 F
+ epoll_ctl F
+ epoll_pwait F
+ epoll_wait F
+ erand48 F
+ erand48_r F
+ err F
+ error F
+ error_at_line F
+ error_message_count D 0x4
+ error_one_per_line D 0x4
+ error_print_progname D 0x8
+ errx F
+ ether_aton F
+ ether_aton_r F
+ ether_hostton F
+ ether_line F
+ ether_ntoa F
+ ether_ntoa_r F
+ ether_ntohost F
+ euidaccess F
+ eventfd F
+ eventfd_read F
+ eventfd_write F
+ execl F
+ execle F
+ execlp F
+ execv F
+ execve F
+ execvp F
+ execvpe F
+ exit F
+ faccessat F
+ fallocate F
+ fallocate64 F
+ fanotify_init F
+ fanotify_mark F
+ fattach F
+ fchdir F
+ fchflags F
+ fchmod F
+ fchmodat F
+ fchown F
+ fchownat F
+ fclose F
+ fcloseall F
+ fcntl F
+ fcvt F
+ fcvt_r F
+ fdatasync F
+ fdetach F
+ fdopen F
+ fdopendir F
+ feof F
+ feof_unlocked F
+ ferror F
+ ferror_unlocked F
+ fexecve F
+ fflush F
+ fflush_unlocked F
+ ffs F
+ ffsl F
+ ffsll F
+ fgetc F
+ fgetc_unlocked F
+ fgetgrent F
+ fgetgrent_r F
+ fgetpos F
+ fgetpos64 F
+ fgetpwent F
+ fgetpwent_r F
+ fgets F
+ fgets_unlocked F
+ fgetsgent F
+ fgetsgent_r F
+ fgetspent F
+ fgetspent_r F
+ fgetwc F
+ fgetwc_unlocked F
+ fgetws F
+ fgetws_unlocked F
+ fgetxattr F
+ fileno F
+ fileno_unlocked F
+ finite F
+ finitef F
+ finitel F
+ flistxattr F
+ flock F
+ flockfile F
+ fmemopen F
+ fmtmsg F
+ fnmatch F
+ fopen F
+ fopen64 F
+ fopencookie F
+ fork F
+ fpathconf F
+ fprintf F
+ fputc F
+ fputc_unlocked F
+ fputs F
+ fputs_unlocked F
+ fputwc F
+ fputwc_unlocked F
+ fputws F
+ fputws_unlocked F
+ fread F
+ fread_unlocked F
+ free F
+ freeaddrinfo F
+ freeifaddrs F
+ freelocale F
+ fremovexattr F
+ freopen F
+ freopen64 F
+ frexp F
+ frexpf F
+ frexpl F
+ fscanf F
+ fseek F
+ fseeko F
+ fseeko64 F
+ fsetpos F
+ fsetpos64 F
+ fsetxattr F
+ fstatfs F
+ fstatfs64 F
+ fstatvfs F
+ fstatvfs64 F
+ fsync F
+ ftell F
+ ftello F
+ ftello64 F
+ ftime F
+ ftok F
+ ftruncate F
+ ftruncate64 F
+ ftrylockfile F
+ fts_children F
+ fts_close F
+ fts_open F
+ fts_read F
+ fts_set F
+ ftw F
+ ftw64 F
+ funlockfile F
+ futimens F
+ futimes F
+ futimesat F
+ fwide F
+ fwprintf F
+ fwrite F
+ fwrite_unlocked F
+ fwscanf F
+ gai_strerror F
+ gcvt F
+ get_avphys_pages F
+ get_current_dir_name F
+ get_kernel_syms F
+ get_myaddress F
+ get_nprocs F
+ get_nprocs_conf F
+ get_phys_pages F
+ getaddrinfo F
+ getaliasbyname F
+ getaliasbyname_r F
+ getaliasent F
+ getaliasent_r F
+ getauxval F
+ getc F
+ getc_unlocked F
+ getchar F
+ getchar_unlocked F
+ getcontext F
+ getcwd F
+ getdate F
+ getdate_err D 0x4
+ getdate_r F
+ getdelim F
+ getdirentries F
+ getdirentries64 F
+ getdomainname F
+ getdtablesize F
+ getegid F
+ getenv F
+ geteuid F
+ getfsent F
+ getfsfile F
+ getfsspec F
+ getgid F
+ getgrent F
+ getgrent_r F
+ getgrgid F
+ getgrgid_r F
+ getgrnam F
+ getgrnam_r F
+ getgrouplist F
+ getgroups F
+ gethostbyaddr F
+ gethostbyaddr_r F
+ gethostbyname F
+ gethostbyname2 F
+ gethostbyname2_r F
+ gethostbyname_r F
+ gethostent F
+ gethostent_r F
+ gethostid F
+ gethostname F
+ getifaddrs F
+ getipv4sourcefilter F
+ getitimer F
+ getline F
+ getloadavg F
+ getlogin F
+ getlogin_r F
+ getmntent F
+ getmntent_r F
+ getmsg F
+ getnameinfo F
+ getnetbyaddr F
+ getnetbyaddr_r F
+ getnetbyname F
+ getnetbyname_r F
+ getnetent F
+ getnetent_r F
+ getnetgrent F
+ getnetgrent_r F
+ getnetname F
+ getopt F
+ getopt_long F
+ getopt_long_only F
+ getpagesize F
+ getpass F
+ getpeername F
+ getpgid F
+ getpgrp F
+ getpid F
+ getpmsg F
+ getppid F
+ getpriority F
+ getprotobyname F
+ getprotobyname_r F
+ getprotobynumber F
+ getprotobynumber_r F
+ getprotoent F
+ getprotoent_r F
+ getpt F
+ getpublickey F
+ getpw F
+ getpwent F
+ getpwent_r F
+ getpwnam F
+ getpwnam_r F
+ getpwuid F
+ getpwuid_r F
+ getresgid F
+ getresuid F
+ getrlimit F
+ getrlimit64 F
+ getrpcbyname F
+ getrpcbyname_r F
+ getrpcbynumber F
+ getrpcbynumber_r F
+ getrpcent F
+ getrpcent_r F
+ getrpcport F
+ getrusage F
+ gets F
+ getsecretkey F
+ getservbyname F
+ getservbyname_r F
+ getservbyport F
+ getservbyport_r F
+ getservent F
+ getservent_r F
+ getsgent F
+ getsgent_r F
+ getsgnam F
+ getsgnam_r F
+ getsid F
+ getsockname F
+ getsockopt F
+ getsourcefilter F
+ getspent F
+ getspent_r F
+ getspnam F
+ getspnam_r F
+ getsubopt F
+ gettext F
+ gettimeofday F
+ getttyent F
+ getttynam F
+ getuid F
+ getusershell F
+ getutent F
+ getutent_r F
+ getutid F
+ getutid_r F
+ getutline F
+ getutline_r F
+ getutmp F
+ getutmpx F
+ getutxent F
+ getutxid F
+ getutxline F
+ getw F
+ getwc F
+ getwc_unlocked F
+ getwchar F
+ getwchar_unlocked F
+ getwd F
+ getxattr F
+ glob F
+ glob64 F
+ glob_pattern_p F
+ globfree F
+ globfree64 F
+ gmtime F
+ gmtime_r F
+ gnu_dev_major F
+ gnu_dev_makedev F
+ gnu_dev_minor F
+ gnu_get_libc_release F
+ gnu_get_libc_version F
+ grantpt F
+ group_member F
+ gsignal F
+ gtty F
+ h_errlist D 0x28
+ h_nerr D 0x4
+ hasmntopt F
+ hcreate F
+ hcreate_r F
+ hdestroy F
+ hdestroy_r F
+ herror F
+ host2netname F
+ hsearch F
+ hsearch_r F
+ hstrerror F
+ htonl F
+ htons F
+ iconv F
+ iconv_close F
+ iconv_open F
+ if_freenameindex F
+ if_indextoname F
+ if_nameindex F
+ if_nametoindex F
+ imaxabs F
+ imaxdiv F
+ in6addr_any D 0x10
+ in6addr_loopback D 0x10
+ index F
+ inet6_opt_append F
+ inet6_opt_find F
+ inet6_opt_finish F
+ inet6_opt_get_val F
+ inet6_opt_init F
+ inet6_opt_next F
+ inet6_opt_set_val F
+ inet6_option_alloc F
+ inet6_option_append F
+ inet6_option_find F
+ inet6_option_init F
+ inet6_option_next F
+ inet6_option_space F
+ inet6_rth_add F
+ inet6_rth_getaddr F
+ inet6_rth_init F
+ inet6_rth_reverse F
+ inet6_rth_segments F
+ inet6_rth_space F
+ inet_addr F
+ inet_aton F
+ inet_lnaof F
+ inet_makeaddr F
+ inet_netof F
+ inet_network F
+ inet_nsap_addr F
+ inet_nsap_ntoa F
+ inet_ntoa F
+ inet_ntop F
+ inet_pton F
+ init_module F
+ initgroups F
+ initstate F
+ initstate_r F
+ innetgr F
+ inotify_add_watch F
+ inotify_init F
+ inotify_init1 F
+ inotify_rm_watch F
+ insque F
+ ioctl F
+ iruserok F
+ iruserok_af F
+ isalnum F
+ isalnum_l F
+ isalpha F
+ isalpha_l F
+ isascii F
+ isastream F
+ isatty F
+ isblank F
+ isblank_l F
+ iscntrl F
+ iscntrl_l F
+ isctype F
+ isdigit F
+ isdigit_l F
+ isfdtype F
+ isgraph F
+ isgraph_l F
+ isinf F
+ isinff F
+ isinfl F
+ islower F
+ islower_l F
+ isnan F
+ isnanf F
+ isnanl F
+ isprint F
+ isprint_l F
+ ispunct F
+ ispunct_l F
+ isspace F
+ isspace_l F
+ isupper F
+ isupper_l F
+ iswalnum F
+ iswalnum_l F
+ iswalpha F
+ iswalpha_l F
+ iswblank F
+ iswblank_l F
+ iswcntrl F
+ iswcntrl_l F
+ iswctype F
+ iswctype_l F
+ iswdigit F
+ iswdigit_l F
+ iswgraph F
+ iswgraph_l F
+ iswlower F
+ iswlower_l F
+ iswprint F
+ iswprint_l F
+ iswpunct F
+ iswpunct_l F
+ iswspace F
+ iswspace_l F
+ iswupper F
+ iswupper_l F
+ iswxdigit F
+ iswxdigit_l F
+ isxdigit F
+ isxdigit_l F
+ jrand48 F
+ jrand48_r F
+ key_decryptsession F
+ key_decryptsession_pk F
+ key_encryptsession F
+ key_encryptsession_pk F
+ key_gendes F
+ key_get_conv F
+ key_secretkey_is_set F
+ key_setnet F
+ key_setsecret F
+ kill F
+ killpg F
+ klogctl F
+ l64a F
+ labs F
+ lchmod F
+ lchown F
+ lckpwdf F
+ lcong48 F
+ lcong48_r F
+ ldexp F
+ ldexpf F
+ ldexpl F
+ ldiv F
+ lfind F
+ lgetxattr F
+ link F
+ linkat F
+ listen F
+ listxattr F
+ llabs F
+ lldiv F
+ llistxattr F
+ llseek F
+ loc1 D 0x8
+ loc2 D 0x8
+ localeconv F
+ localtime F
+ localtime_r F
+ lockf F
+ lockf64 F
+ locs D 0x8
+ longjmp F
+ lrand48 F
+ lrand48_r F
+ lremovexattr F
+ lsearch F
+ lseek F
+ lseek64 F
+ lsetxattr F
+ lutimes F
+ madvise F
+ makecontext F
+ mallinfo F
+ malloc F
+ malloc_get_state F
+ malloc_info F
+ malloc_set_state F
+ malloc_stats F
+ malloc_trim F
+ malloc_usable_size F
+ mallopt F
+ mallwatch D 0x8
+ mblen F
+ mbrlen F
+ mbrtoc16 F
+ mbrtoc32 F
+ mbrtowc F
+ mbsinit F
+ mbsnrtowcs F
+ mbsrtowcs F
+ mbstowcs F
+ mbtowc F
+ mcheck F
+ mcheck_check_all F
+ mcheck_pedantic F
+ memalign F
+ memccpy F
+ memchr F
+ memcmp F
+ memcpy F
+ memfrob F
+ memmem F
+ memmove F
+ mempcpy F
+ memrchr F
+ memset F
+ mincore F
+ mkdir F
+ mkdirat F
+ mkdtemp F
+ mkfifo F
+ mkfifoat F
+ mkostemp F
+ mkostemp64 F
+ mkostemps F
+ mkostemps64 F
+ mkstemp F
+ mkstemp64 F
+ mkstemps F
+ mkstemps64 F
+ mktemp F
+ mktime F
+ mlock F
+ mlockall F
+ mmap F
+ mmap64 F
+ modf F
+ modff F
+ modfl F
+ moncontrol F
+ monstartup F
+ mount F
+ mprobe F
+ mprotect F
+ mrand48 F
+ mrand48_r F
+ mremap F
+ msgctl F
+ msgget F
+ msgrcv F
+ msgsnd F
+ msync F
+ mtrace F
+ munlock F
+ munlockall F
+ munmap F
+ muntrace F
+ name_to_handle_at F
+ nanosleep F
+ netname2host F
+ netname2user F
+ newlocale F
+ nfsservctl F
+ nftw F
+ nftw64 F
+ ngettext F
+ nice F
+ nl_langinfo F
+ nl_langinfo_l F
+ nrand48 F
+ nrand48_r F
+ ntohl F
+ ntohs F
+ ntp_adjtime F
+ ntp_gettime F
+ ntp_gettimex F
+ obstack_alloc_failed_handler D 0x8
+ obstack_exit_failure D 0x4
+ obstack_free F
+ obstack_printf F
+ obstack_vprintf F
+ on_exit F
+ open F
+ open64 F
+ open_by_handle_at F
+ open_memstream F
+ open_wmemstream F
+ openat F
+ openat64 F
+ opendir F
+ openlog F
+ optarg D 0x8
+ opterr D 0x4
+ optind D 0x4
+ optopt D 0x4
+ parse_printf_format F
+ passwd2des F
+ pathconf F
+ pause F
+ pclose F
+ perror F
+ personality F
+ pipe F
+ pipe2 F
+ pivot_root F
+ pmap_getmaps F
+ pmap_getport F
+ pmap_rmtcall F
+ pmap_set F
+ pmap_unset F
+ poll F
+ popen F
+ posix_fadvise F
+ posix_fadvise64 F
+ posix_fallocate F
+ posix_fallocate64 F
+ posix_madvise F
+ posix_memalign F
+ posix_openpt F
+ posix_spawn F
+ posix_spawn_file_actions_addclose F
+ posix_spawn_file_actions_adddup2 F
+ posix_spawn_file_actions_addopen F
+ posix_spawn_file_actions_destroy F
+ posix_spawn_file_actions_init F
+ posix_spawnattr_destroy F
+ posix_spawnattr_getflags F
+ posix_spawnattr_getpgroup F
+ posix_spawnattr_getschedparam F
+ posix_spawnattr_getschedpolicy F
+ posix_spawnattr_getsigdefault F
+ posix_spawnattr_getsigmask F
+ posix_spawnattr_init F
+ posix_spawnattr_setflags F
+ posix_spawnattr_setpgroup F
+ posix_spawnattr_setschedparam F
+ posix_spawnattr_setschedpolicy F
+ posix_spawnattr_setsigdefault F
+ posix_spawnattr_setsigmask F
+ posix_spawnp F
+ ppoll F
+ prctl F
+ pread F
+ pread64 F
+ preadv F
+ preadv64 F
+ printf F
+ printf_size F
+ printf_size_info F
+ prlimit F
+ prlimit64 F
+ process_vm_readv F
+ process_vm_writev F
+ profil F
+ program_invocation_name D 0x8
+ program_invocation_short_name D 0x8
+ pselect F
+ psiginfo F
+ psignal F
+ pthread_attr_destroy F
+ pthread_attr_getdetachstate F
+ pthread_attr_getinheritsched F
+ pthread_attr_getschedparam F
+ pthread_attr_getschedpolicy F
+ pthread_attr_getscope F
+ pthread_attr_init F
+ pthread_attr_setdetachstate F
+ pthread_attr_setinheritsched F
+ pthread_attr_setschedparam F
+ pthread_attr_setschedpolicy F
+ pthread_attr_setscope F
+ pthread_cond_broadcast F
+ pthread_cond_destroy F
+ pthread_cond_init F
+ pthread_cond_signal F
+ pthread_cond_timedwait F
+ pthread_cond_wait F
+ pthread_condattr_destroy F
+ pthread_condattr_init F
+ pthread_equal F
+ pthread_exit F
+ pthread_getschedparam F
+ pthread_mutex_destroy F
+ pthread_mutex_init F
+ pthread_mutex_lock F
+ pthread_mutex_unlock F
+ pthread_self F
+ pthread_setcancelstate F
+ pthread_setcanceltype F
+ pthread_setschedparam F
+ ptrace F
+ ptsname F
+ ptsname_r F
+ putc F
+ putc_unlocked F
+ putchar F
+ putchar_unlocked F
+ putenv F
+ putgrent F
+ putmsg F
+ putpmsg F
+ putpwent F
+ puts F
+ putsgent F
+ putspent F
+ pututline F
+ pututxline F
+ putw F
+ putwc F
+ putwc_unlocked F
+ putwchar F
+ putwchar_unlocked F
+ pvalloc F
+ pwrite F
+ pwrite64 F
+ pwritev F
+ pwritev64 F
+ qecvt F
+ qecvt_r F
+ qfcvt F
+ qfcvt_r F
+ qgcvt F
+ qsort F
+ qsort_r F
+ query_module F
+ quick_exit F
+ quotactl F
+ raise F
+ rand F
+ rand_r F
+ random F
+ random_r F
+ rawmemchr F
+ rcmd F
+ rcmd_af F
+ re_comp F
+ re_compile_fastmap F
+ re_compile_pattern F
+ re_exec F
+ re_match F
+ re_match_2 F
+ re_search F
+ re_search_2 F
+ re_set_registers F
+ re_set_syntax F
+ re_syntax_options D 0x8
+ read F
+ readahead F
+ readdir F
+ readdir64 F
+ readdir64_r F
+ readdir_r F
+ readlink F
+ readlinkat F
+ readv F
+ realloc F
+ realpath F
+ reboot F
+ recv F
+ recvfrom F
+ recvmmsg F
+ recvmsg F
+ regcomp F
+ regerror F
+ regexec F
+ regfree F
+ register_printf_function F
+ register_printf_modifier F
+ register_printf_specifier F
+ register_printf_type F
+ registerrpc F
+ remap_file_pages F
+ remove F
+ removexattr F
+ remque F
+ rename F
+ renameat F
+ revoke F
+ rewind F
+ rewinddir F
+ rexec F
+ rexec_af F
+ rexecoptions D 0x4
+ rindex F
+ rmdir F
+ rpc_createerr D 0x20
+ rpmatch F
+ rresvport F
+ rresvport_af F
+ rtime F
+ ruserok F
+ ruserok_af F
+ ruserpass F
+ sbrk F
+ scalbn F
+ scalbnf F
+ scalbnl F
+ scandir F
+ scandir64 F
+ scandirat F
+ scandirat64 F
+ scanf F
+ sched_get_priority_max F
+ sched_get_priority_min F
+ sched_getaffinity F
+ sched_getcpu F
+ sched_getparam F
+ sched_getscheduler F
+ sched_rr_get_interval F
+ sched_setaffinity F
+ sched_setparam F
+ sched_setscheduler F
+ sched_yield F
+ secure_getenv F
+ seed48 F
+ seed48_r F
+ seekdir F
+ select F
+ semctl F
+ semget F
+ semop F
+ semtimedop F
+ send F
+ sendfile F
+ sendfile64 F
+ sendmmsg F
+ sendmsg F
+ sendto F
+ setaliasent F
+ setbuf F
+ setbuffer F
+ setcontext F
+ setdomainname F
+ setegid F
+ setenv F
+ seteuid F
+ setfsent F
+ setfsgid F
+ setfsuid F
+ setgid F
+ setgrent F
+ setgroups F
+ sethostent F
+ sethostid F
+ sethostname F
+ setipv4sourcefilter F
+ setitimer F
+ setjmp F
+ setlinebuf F
+ setlocale F
+ setlogin F
+ setlogmask F
+ setmntent F
+ setnetent F
+ setnetgrent F
+ setns F
+ setpgid F
+ setpgrp F
+ setpriority F
+ setprotoent F
+ setpwent F
+ setregid F
+ setresgid F
+ setresuid F
+ setreuid F
+ setrlimit F
+ setrlimit64 F
+ setrpcent F
+ setservent F
+ setsgent F
+ setsid F
+ setsockopt F
+ setsourcefilter F
+ setspent F
+ setstate F
+ setstate_r F
+ settimeofday F
+ setttyent F
+ setuid F
+ setusershell F
+ setutent F
+ setutxent F
+ setvbuf F
+ setxattr F
+ sgetsgent F
+ sgetsgent_r F
+ sgetspent F
+ sgetspent_r F
+ shmat F
+ shmctl F
+ shmdt F
+ shmget F
+ shutdown F
+ sigaction F
+ sigaddset F
+ sigaltstack F
+ sigandset F
+ sigblock F
+ sigdelset F
+ sigemptyset F
+ sigfillset F
+ siggetmask F
+ sighold F
+ sigignore F
+ siginterrupt F
+ sigisemptyset F
+ sigismember F
+ siglongjmp F
+ signal F
+ signalfd F
+ sigorset F
+ sigpause F
+ sigpending F
+ sigprocmask F
+ sigqueue F
+ sigrelse F
+ sigreturn F
+ sigset F
+ sigsetmask F
+ sigstack F
+ sigsuspend F
+ sigtimedwait F
+ sigvec F
+ sigwait F
+ sigwaitinfo F
+ sleep F
+ snprintf F
+ sockatmark F
+ socket F
+ socketpair F
+ splice F
+ sprintf F
+ sprofil F
+ srand F
+ srand48 F
+ srand48_r F
+ srandom F
+ srandom_r F
+ sscanf F
+ ssignal F
+ sstk F
+ statfs F
+ statfs64 F
+ statvfs F
+ statvfs64 F
+ stderr D 0x8
+ stdin D 0x8
+ stdout D 0x8
+ step F
+ stime F
+ stpcpy F
+ stpncpy F
+ strcasecmp F
+ strcasecmp_l F
+ strcasestr F
+ strcat F
+ strchr F
+ strchrnul F
+ strcmp F
+ strcoll F
+ strcoll_l F
+ strcpy F
+ strcspn F
+ strdup F
+ strerror F
+ strerror_l F
+ strerror_r F
+ strfmon F
+ strfmon_l F
+ strfry F
+ strftime F
+ strftime_l F
+ strlen F
+ strncasecmp F
+ strncasecmp_l F
+ strncat F
+ strncmp F
+ strncpy F
+ strndup F
+ strnlen F
+ strpbrk F
+ strptime F
+ strptime_l F
+ strrchr F
+ strsep F
+ strsignal F
+ strspn F
+ strstr F
+ strtod F
+ strtod_l F
+ strtof F
+ strtof_l F
+ strtoimax F
+ strtok F
+ strtok_r F
+ strtol F
+ strtol_l F
+ strtold F
+ strtold_l F
+ strtoll F
+ strtoll_l F
+ strtoq F
+ strtoul F
+ strtoul_l F
+ strtoull F
+ strtoull_l F
+ strtoumax F
+ strtouq F
+ strverscmp F
+ strxfrm F
+ strxfrm_l F
+ stty F
+ svc_exit F
+ svc_fdset D 0x80
+ svc_getreq F
+ svc_getreq_common F
+ svc_getreq_poll F
+ svc_getreqset F
+ svc_max_pollfd D 0x4
+ svc_pollfd D 0x8
+ svc_register F
+ svc_run F
+ svc_sendreply F
+ svc_unregister F
+ svcauthdes_stats D 0x18
+ svcerr_auth F
+ svcerr_decode F
+ svcerr_noproc F
+ svcerr_noprog F
+ svcerr_progvers F
+ svcerr_systemerr F
+ svcerr_weakauth F
+ svcfd_create F
+ svcraw_create F
+ svctcp_create F
+ svcudp_bufcreate F
+ svcudp_create F
+ svcudp_enablecache F
+ svcunix_create F
+ svcunixfd_create F
+ swab F
+ swapcontext F
+ swapoff F
+ swapon F
+ swprintf F
+ swscanf F
+ symlink F
+ symlinkat F
+ sync F
+ sync_file_range F
+ syncfs F
+ sys_errlist D 0x438
+ sys_nerr D 0x4
+ sys_sigabbrev D 0x208
+ sys_siglist D 0x208
+ syscall F
+ sysconf F
+ sysctl F
+ sysinfo F
+ syslog F
+ system F
+ sysv_signal F
+ tcdrain F
+ tcflow F
+ tcflush F
+ tcgetattr F
+ tcgetpgrp F
+ tcgetsid F
+ tcsendbreak F
+ tcsetattr F
+ tcsetpgrp F
+ tdelete F
+ tdestroy F
+ tee F
+ telldir F
+ tempnam F
+ textdomain F
+ tfind F
+ time F
+ timegm F
+ timelocal F
+ timerfd_create F
+ timerfd_gettime F
+ timerfd_settime F
+ times F
+ timespec_get F
+ timezone D 0x8
+ tmpfile F
+ tmpfile64 F
+ tmpnam F
+ tmpnam_r F
+ toascii F
+ tolower F
+ tolower_l F
+ toupper F
+ toupper_l F
+ towctrans F
+ towctrans_l F
+ towlower F
+ towlower_l F
+ towupper F
+ towupper_l F
+ tr_break F
+ truncate F
+ truncate64 F
+ tsearch F
+ ttyname F
+ ttyname_r F
+ ttyslot F
+ twalk F
+ tzname D 0x10
+ tzset F
+ ualarm F
+ ulckpwdf F
+ ulimit F
+ umask F
+ umount F
+ umount2 F
+ uname F
+ ungetc F
+ ungetwc F
+ unlink F
+ unlinkat F
+ unlockpt F
+ unsetenv F
+ unshare F
+ updwtmp F
+ updwtmpx F
+ uselib F
+ uselocale F
+ user2netname F
+ usleep F
+ ustat F
+ utime F
+ utimensat F
+ utimes F
+ utmpname F
+ utmpxname F
+ valloc F
+ vasprintf F
+ vdprintf F
+ verr F
+ verrx F
+ versionsort F
+ versionsort64 F
+ vfork F
+ vfprintf F
+ vfscanf F
+ vfwprintf F
+ vfwscanf F
+ vhangup F
+ vlimit F
+ vmsplice F
+ vprintf F
+ vscanf F
+ vsnprintf F
+ vsprintf F
+ vsscanf F
+ vswprintf F
+ vswscanf F
+ vsyslog F
+ vtimes F
+ vwarn F
+ vwarnx F
+ vwprintf F
+ vwscanf F
+ wait F
+ wait3 F
+ wait4 F
+ waitid F
+ waitpid F
+ warn F
+ warnx F
+ wcpcpy F
+ wcpncpy F
+ wcrtomb F
+ wcscasecmp F
+ wcscasecmp_l F
+ wcscat F
+ wcschr F
+ wcschrnul F
+ wcscmp F
+ wcscoll F
+ wcscoll_l F
+ wcscpy F
+ wcscspn F
+ wcsdup F
+ wcsftime F
+ wcsftime_l F
+ wcslen F
+ wcsncasecmp F
+ wcsncasecmp_l F
+ wcsncat F
+ wcsncmp F
+ wcsncpy F
+ wcsnlen F
+ wcsnrtombs F
+ wcspbrk F
+ wcsrchr F
+ wcsrtombs F
+ wcsspn F
+ wcsstr F
+ wcstod F
+ wcstod_l F
+ wcstof F
+ wcstof_l F
+ wcstoimax F
+ wcstok F
+ wcstol F
+ wcstol_l F
+ wcstold F
+ wcstold_l F
+ wcstoll F
+ wcstoll_l F
+ wcstombs F
+ wcstoq F
+ wcstoul F
+ wcstoul_l F
+ wcstoull F
+ wcstoull_l F
+ wcstoumax F
+ wcstouq F
+ wcswcs F
+ wcswidth F
+ wcsxfrm F
+ wcsxfrm_l F
+ wctob F
+ wctomb F
+ wctrans F
+ wctrans_l F
+ wctype F
+ wctype_l F
+ wcwidth F
+ wmemchr F
+ wmemcmp F
+ wmemcpy F
+ wmemmove F
+ wmempcpy F
+ wmemset F
+ wordexp F
+ wordfree F
+ wprintf F
+ write F
+ writev F
+ wscanf F
+ xdecrypt F
+ xdr_accepted_reply F
+ xdr_array F
+ xdr_authdes_cred F
+ xdr_authdes_verf F
+ xdr_authunix_parms F
+ xdr_bool F
+ xdr_bytes F
+ xdr_callhdr F
+ xdr_callmsg F
+ xdr_char F
+ xdr_cryptkeyarg F
+ xdr_cryptkeyarg2 F
+ xdr_cryptkeyres F
+ xdr_des_block F
+ xdr_double F
+ xdr_enum F
+ xdr_float F
+ xdr_free F
+ xdr_getcredres F
+ xdr_hyper F
+ xdr_int F
+ xdr_int16_t F
+ xdr_int32_t F
+ xdr_int64_t F
+ xdr_int8_t F
+ xdr_key_netstarg F
+ xdr_key_netstres F
+ xdr_keybuf F
+ xdr_keystatus F
+ xdr_long F
+ xdr_longlong_t F
+ xdr_netnamestr F
+ xdr_netobj F
+ xdr_opaque F
+ xdr_opaque_auth F
+ xdr_pmap F
+ xdr_pmaplist F
+ xdr_pointer F
+ xdr_quad_t F
+ xdr_reference F
+ xdr_rejected_reply F
+ xdr_replymsg F
+ xdr_rmtcall_args F
+ xdr_rmtcallres F
+ xdr_short F
+ xdr_sizeof F
+ xdr_string F
+ xdr_u_char F
+ xdr_u_hyper F
+ xdr_u_int F
+ xdr_u_long F
+ xdr_u_longlong_t F
+ xdr_u_quad_t F
+ xdr_u_short F
+ xdr_uint16_t F
+ xdr_uint32_t F
+ xdr_uint64_t F
+ xdr_uint8_t F
+ xdr_union F
+ xdr_unixcred F
+ xdr_vector F
+ xdr_void F
+ xdr_wrapstring F
+ xdrmem_create F
+ xdrrec_create F
+ xdrrec_endofrecord F
+ xdrrec_eof F
+ xdrrec_skiprecord F
+ xdrstdio_create F
+ xencrypt F
+ xprt_register F
+ xprt_unregister F
+GLIBC_2.18
+ GLIBC_2.18 A
+ __cxa_thread_atexit_impl F
diff --git a/sysdeps/unix/sysv/linux/powerpc/powerpc64/nptl/libcrypt-le.abilist b/sysdeps/unix/sysv/linux/powerpc/powerpc64/nptl/libcrypt-le.abilist
new file mode 100644
index 0000000..177c536
--- /dev/null
+++ b/sysdeps/unix/sysv/linux/powerpc/powerpc64/nptl/libcrypt-le.abilist
@@ -0,0 +1,9 @@
+GLIBC_2.17
+ GLIBC_2.17 A
+ crypt F
+ crypt_r F
+ encrypt F
+ encrypt_r F
+ fcrypt F
+ setkey F
+ setkey_r F
diff --git a/sysdeps/unix/sysv/linux/powerpc/powerpc64/nptl/libdl-le.abilist b/sysdeps/unix/sysv/linux/powerpc/powerpc64/nptl/libdl-le.abilist
new file mode 100644
index 0000000..6caff88
--- /dev/null
+++ b/sysdeps/unix/sysv/linux/powerpc/powerpc64/nptl/libdl-le.abilist
@@ -0,0 +1,11 @@
+GLIBC_2.17
+ GLIBC_2.17 A
+ dladdr F
+ dladdr1 F
+ dlclose F
+ dlerror F
+ dlinfo F
+ dlmopen F
+ dlopen F
+ dlsym F
+ dlvsym F
diff --git a/sysdeps/unix/sysv/linux/powerpc/powerpc64/nptl/libm-le.abilist b/sysdeps/unix/sysv/linux/powerpc/powerpc64/nptl/libm-le.abilist
new file mode 100644
index 0000000..a820074
--- /dev/null
+++ b/sysdeps/unix/sysv/linux/powerpc/powerpc64/nptl/libm-le.abilist
@@ -0,0 +1,407 @@
+GLIBC_2.17
+ GLIBC_2.17 A
+ _LIB_VERSION D 0x4
+ __acos_finite F
+ __acosf_finite F
+ __acosh_finite F
+ __acoshf_finite F
+ __acoshl_finite F
+ __acosl_finite F
+ __asin_finite F
+ __asinf_finite F
+ __asinl_finite F
+ __atan2_finite F
+ __atan2f_finite F
+ __atan2l_finite F
+ __atanh_finite F
+ __atanhf_finite F
+ __atanhl_finite F
+ __clog10 F
+ __clog10f F
+ __clog10l F
+ __cosh_finite F
+ __coshf_finite F
+ __coshl_finite F
+ __exp10_finite F
+ __exp10f_finite F
+ __exp10l_finite F
+ __exp2_finite F
+ __exp2f_finite F
+ __exp2l_finite F
+ __exp_finite F
+ __expf_finite F
+ __expl_finite F
+ __fe_dfl_env D 0x8
+ __fe_enabled_env D 0x8
+ __fe_nomask_env F
+ __fe_nonieee_env D 0x8
+ __finite F
+ __finitef F
+ __finitel F
+ __fmod_finite F
+ __fmodf_finite F
+ __fmodl_finite F
+ __fpclassify F
+ __fpclassifyf F
+ __fpclassifyl F
+ __gamma_r_finite F
+ __gammaf_r_finite F
+ __gammal_r_finite F
+ __hypot_finite F
+ __hypotf_finite F
+ __hypotl_finite F
+ __j0_finite F
+ __j0f_finite F
+ __j0l_finite F
+ __j1_finite F
+ __j1f_finite F
+ __j1l_finite F
+ __jn_finite F
+ __jnf_finite F
+ __jnl_finite F
+ __lgamma_r_finite F
+ __lgammaf_r_finite F
+ __lgammal_r_finite F
+ __log10_finite F
+ __log10f_finite F
+ __log10l_finite F
+ __log2_finite F
+ __log2f_finite F
+ __log2l_finite F
+ __log_finite F
+ __logf_finite F
+ __logl_finite F
+ __nldbl_nexttowardf F
+ __pow_finite F
+ __powf_finite F
+ __powl_finite F
+ __remainder_finite F
+ __remainderf_finite F
+ __remainderl_finite F
+ __scalb_finite F
+ __scalbf_finite F
+ __scalbl_finite F
+ __signbit F
+ __signbitf F
+ __signbitl F
+ __sinh_finite F
+ __sinhf_finite F
+ __sinhl_finite F
+ __sqrt_finite F
+ __sqrtf_finite F
+ __sqrtl_finite F
+ __y0_finite F
+ __y0f_finite F
+ __y0l_finite F
+ __y1_finite F
+ __y1f_finite F
+ __y1l_finite F
+ __yn_finite F
+ __ynf_finite F
+ __ynl_finite F
+ acos F
+ acosf F
+ acosh F
+ acoshf F
+ acoshl F
+ acosl F
+ asin F
+ asinf F
+ asinh F
+ asinhf F
+ asinhl F
+ asinl F
+ atan F
+ atan2 F
+ atan2f F
+ atan2l F
+ atanf F
+ atanh F
+ atanhf F
+ atanhl F
+ atanl F
+ cabs F
+ cabsf F
+ cabsl F
+ cacos F
+ cacosf F
+ cacosh F
+ cacoshf F
+ cacoshl F
+ cacosl F
+ carg F
+ cargf F
+ cargl F
+ casin F
+ casinf F
+ casinh F
+ casinhf F
+ casinhl F
+ casinl F
+ catan F
+ catanf F
+ catanh F
+ catanhf F
+ catanhl F
+ catanl F
+ cbrt F
+ cbrtf F
+ cbrtl F
+ ccos F
+ ccosf F
+ ccosh F
+ ccoshf F
+ ccoshl F
+ ccosl F
+ ceil F
+ ceilf F
+ ceill F
+ cexp F
+ cexpf F
+ cexpl F
+ cimag F
+ cimagf F
+ cimagl F
+ clog F
+ clog10 F
+ clog10f F
+ clog10l F
+ clogf F
+ clogl F
+ conj F
+ conjf F
+ conjl F
+ copysign F
+ copysignf F
+ copysignl F
+ cos F
+ cosf F
+ cosh F
+ coshf F
+ coshl F
+ cosl F
+ cpow F
+ cpowf F
+ cpowl F
+ cproj F
+ cprojf F
+ cprojl F
+ creal F
+ crealf F
+ creall F
+ csin F
+ csinf F
+ csinh F
+ csinhf F
+ csinhl F
+ csinl F
+ csqrt F
+ csqrtf F
+ csqrtl F
+ ctan F
+ ctanf F
+ ctanh F
+ ctanhf F
+ ctanhl F
+ ctanl F
+ drem F
+ dremf F
+ dreml F
+ erf F
+ erfc F
+ erfcf F
+ erfcl F
+ erff F
+ erfl F
+ exp F
+ exp10 F
+ exp10f F
+ exp10l F
+ exp2 F
+ exp2f F
+ exp2l F
+ expf F
+ expl F
+ expm1 F
+ expm1f F
+ expm1l F
+ fabs F
+ fabsf F
+ fabsl F
+ fdim F
+ fdimf F
+ fdiml F
+ feclearexcept F
+ fedisableexcept F
+ feenableexcept F
+ fegetenv F
+ fegetexcept F
+ fegetexceptflag F
+ fegetround F
+ feholdexcept F
+ feraiseexcept F
+ fesetenv F
+ fesetexceptflag F
+ fesetround F
+ fetestexcept F
+ feupdateenv F
+ finite F
+ finitef F
+ finitel F
+ floor F
+ floorf F
+ floorl F
+ fma F
+ fmaf F
+ fmal F
+ fmax F
+ fmaxf F
+ fmaxl F
+ fmin F
+ fminf F
+ fminl F
+ fmod F
+ fmodf F
+ fmodl F
+ frexp F
+ frexpf F
+ frexpl F
+ gamma F
+ gammaf F
+ gammal F
+ hypot F
+ hypotf F
+ hypotl F
+ ilogb F
+ ilogbf F
+ ilogbl F
+ j0 F
+ j0f F
+ j0l F
+ j1 F
+ j1f F
+ j1l F
+ jn F
+ jnf F
+ jnl F
+ ldexp F
+ ldexpf F
+ ldexpl F
+ lgamma F
+ lgamma_r F
+ lgammaf F
+ lgammaf_r F
+ lgammal F
+ lgammal_r F
+ llrint F
+ llrintf F
+ llrintl F
+ llround F
+ llroundf F
+ llroundl F
+ log F
+ log10 F
+ log10f F
+ log10l F
+ log1p F
+ log1pf F
+ log1pl F
+ log2 F
+ log2f F
+ log2l F
+ logb F
+ logbf F
+ logbl F
+ logf F
+ logl F
+ lrint F
+ lrintf F
+ lrintl F
+ lround F
+ lroundf F
+ lroundl F
+ matherr F
+ modf F
+ modff F
+ modfl F
+ nan F
+ nanf F
+ nanl F
+ nearbyint F
+ nearbyintf F
+ nearbyintl F
+ nextafter F
+ nextafterf F
+ nextafterl F
+ nexttoward F
+ nexttowardf F
+ nexttowardl F
+ pow F
+ pow10 F
+ pow10f F
+ pow10l F
+ powf F
+ powl F
+ remainder F
+ remainderf F
+ remainderl F
+ remquo F
+ remquof F
+ remquol F
+ rint F
+ rintf F
+ rintl F
+ round F
+ roundf F
+ roundl F
+ scalb F
+ scalbf F
+ scalbl F
+ scalbln F
+ scalblnf F
+ scalblnl F
+ scalbn F
+ scalbnf F
+ scalbnl F
+ signgam D 0x4
+ significand F
+ significandf F
+ significandl F
+ sin F
+ sincos F
+ sincosf F
+ sincosl F
+ sinf F
+ sinh F
+ sinhf F
+ sinhl F
+ sinl F
+ sqrt F
+ sqrtf F
+ sqrtl F
+ tan F
+ tanf F
+ tanh F
+ tanhf F
+ tanhl F
+ tanl F
+ tgamma F
+ tgammaf F
+ tgammal F
+ trunc F
+ truncf F
+ truncl F
+ y0 F
+ y0f F
+ y0l F
+ y1 F
+ y1f F
+ y1l F
+ yn F
+ ynf F
+ ynl F
+GLIBC_2.18
+ GLIBC_2.18 A
+ __issignaling F
+ __issignalingf F
+ __issignalingl F
diff --git a/sysdeps/unix/sysv/linux/powerpc/powerpc64/nptl/libnsl-le.abilist b/sysdeps/unix/sysv/linux/powerpc/powerpc64/nptl/libnsl-le.abilist
new file mode 100644
index 0000000..763b8dc
--- /dev/null
+++ b/sysdeps/unix/sysv/linux/powerpc/powerpc64/nptl/libnsl-le.abilist
@@ -0,0 +1,123 @@
+GLIBC_2.17
+ GLIBC_2.17 A
+ __free_fdresult F
+ __nis_default_access F
+ __nis_default_group F
+ __nis_default_owner F
+ __nis_default_ttl F
+ __nis_finddirectory F
+ __nis_hash F
+ __nisbind_connect F
+ __nisbind_create F
+ __nisbind_destroy F
+ __nisbind_next F
+ __yp_check F
+ nis_add F
+ nis_add_entry F
+ nis_addmember F
+ nis_checkpoint F
+ nis_clone_directory F
+ nis_clone_object F
+ nis_clone_result F
+ nis_creategroup F
+ nis_destroy_object F
+ nis_destroygroup F
+ nis_dir_cmp F
+ nis_domain_of F
+ nis_domain_of_r F
+ nis_first_entry F
+ nis_free_directory F
+ nis_free_object F
+ nis_free_request F
+ nis_freenames F
+ nis_freeresult F
+ nis_freeservlist F
+ nis_freetags F
+ nis_getnames F
+ nis_getservlist F
+ nis_ismember F
+ nis_leaf_of F
+ nis_leaf_of_r F
+ nis_lerror F
+ nis_list F
+ nis_local_directory F
+ nis_local_group F
+ nis_local_host F
+ nis_local_principal F
+ nis_lookup F
+ nis_mkdir F
+ nis_modify F
+ nis_modify_entry F
+ nis_name_of F
+ nis_name_of_r F
+ nis_next_entry F
+ nis_perror F
+ nis_ping F
+ nis_print_directory F
+ nis_print_entry F
+ nis_print_group F
+ nis_print_group_entry F
+ nis_print_link F
+ nis_print_object F
+ nis_print_result F
+ nis_print_rights F
+ nis_print_table F
+ nis_read_obj F
+ nis_remove F
+ nis_remove_entry F
+ nis_removemember F
+ nis_rmdir F
+ nis_servstate F
+ nis_sperrno F
+ nis_sperror F
+ nis_sperror_r F
+ nis_stats F
+ nis_verifygroup F
+ nis_write_obj F
+ readColdStartFile F
+ writeColdStartFile F
+ xdr_cback_data F
+ xdr_domainname F
+ xdr_keydat F
+ xdr_mapname F
+ xdr_obj_p F
+ xdr_peername F
+ xdr_valdat F
+ xdr_yp_buf F
+ xdr_ypall F
+ xdr_ypbind_binding F
+ xdr_ypbind_resp F
+ xdr_ypbind_resptype F
+ xdr_ypbind_setdom F
+ xdr_ypdelete_args F
+ xdr_ypmap_parms F
+ xdr_ypmaplist F
+ xdr_yppush_status F
+ xdr_yppushresp_xfr F
+ xdr_ypreq_key F
+ xdr_ypreq_nokey F
+ xdr_ypreq_xfr F
+ xdr_ypresp_all F
+ xdr_ypresp_key_val F
+ xdr_ypresp_maplist F
+ xdr_ypresp_master F
+ xdr_ypresp_order F
+ xdr_ypresp_val F
+ xdr_ypresp_xfr F
+ xdr_ypstat F
+ xdr_ypupdate_args F
+ xdr_ypxfrstat F
+ yp_all F
+ yp_bind F
+ yp_first F
+ yp_get_default_domain F
+ yp_maplist F
+ yp_master F
+ yp_match F
+ yp_next F
+ yp_order F
+ yp_unbind F
+ yp_update F
+ ypbinderr_string F
+ yperr_string F
+ ypprot_err F
diff --git a/sysdeps/unix/sysv/linux/powerpc/powerpc64/nptl/libpthread-le.abilist b/sysdeps/unix/sysv/linux/powerpc/powerpc64/nptl/libpthread-le.abilist
new file mode 100644
index 0000000..5520312
--- /dev/null
+++ b/sysdeps/unix/sysv/linux/powerpc/powerpc64/nptl/libpthread-le.abilist
@@ -0,0 +1,228 @@
+GLIBC_2.17
+ GLIBC_2.17 A
+ _IO_flockfile F
+ _IO_ftrylockfile F
+ _IO_funlockfile F
+ __close F
+ __connect F
+ __errno_location F
+ __fcntl F
+ __fork F
+ __h_errno_location F
+ __libc_allocate_rtsig F
+ __libc_current_sigrtmax F
+ __libc_current_sigrtmin F
+ __lseek F
+ __nanosleep F
+ __open F
+ __open64 F
+ __pread64 F
+ __pthread_cleanup_routine F
+ __pthread_getspecific F
+ __pthread_key_create F
+ __pthread_mutex_destroy F
+ __pthread_mutex_init F
+ __pthread_mutex_lock F
+ __pthread_mutex_trylock F
+ __pthread_mutex_unlock F
+ __pthread_mutexattr_destroy F
+ __pthread_mutexattr_init F
+ __pthread_mutexattr_settype F
+ __pthread_once F
+ __pthread_register_cancel F
+ __pthread_register_cancel_defer F
+ __pthread_rwlock_destroy F
+ __pthread_rwlock_init F
+ __pthread_rwlock_rdlock F
+ __pthread_rwlock_tryrdlock F
+ __pthread_rwlock_trywrlock F
+ __pthread_rwlock_unlock F
+ __pthread_rwlock_wrlock F
+ __pthread_setspecific F
+ __pthread_unregister_cancel F
+ __pthread_unregister_cancel_restore F
+ __pthread_unwind_next F
+ __pwrite64 F
+ __read F
+ __res_state F
+ __send F
+ __sigaction F
+ __vfork F
+ __wait F
+ __write F
+ _pthread_cleanup_pop F
+ _pthread_cleanup_pop_restore F
+ _pthread_cleanup_push F
+ _pthread_cleanup_push_defer F
+ accept F
+ close F
+ connect F
+ fcntl F
+ flockfile F
+ fork F
+ fsync F
+ ftrylockfile F
+ funlockfile F
+ longjmp F
+ lseek F
+ lseek64 F
+ msync F
+ nanosleep F
+ open F
+ open64 F
+ pause F
+ pread F
+ pread64 F
+ pthread_attr_destroy F
+ pthread_attr_getaffinity_np F
+ pthread_attr_getdetachstate F
+ pthread_attr_getguardsize F
+ pthread_attr_getinheritsched F
+ pthread_attr_getschedparam F
+ pthread_attr_getschedpolicy F
+ pthread_attr_getscope F
+ pthread_attr_getstack F
+ pthread_attr_getstackaddr F
+ pthread_attr_getstacksize F
+ pthread_attr_init F
+ pthread_attr_setaffinity_np F
+ pthread_attr_setdetachstate F
+ pthread_attr_setguardsize F
+ pthread_attr_setinheritsched F
+ pthread_attr_setschedparam F
+ pthread_attr_setschedpolicy F
+ pthread_attr_setscope F
+ pthread_attr_setstack F
+ pthread_attr_setstackaddr F
+ pthread_attr_setstacksize F
+ pthread_barrier_destroy F
+ pthread_barrier_init F
+ pthread_barrier_wait F
+ pthread_barrierattr_destroy F
+ pthread_barrierattr_getpshared F
+ pthread_barrierattr_init F
+ pthread_barrierattr_setpshared F
+ pthread_cancel F
+ pthread_cond_broadcast F
+ pthread_cond_destroy F
+ pthread_cond_init F
+ pthread_cond_signal F
+ pthread_cond_timedwait F
+ pthread_cond_wait F
+ pthread_condattr_destroy F
+ pthread_condattr_getclock F
+ pthread_condattr_getpshared F
+ pthread_condattr_init F
+ pthread_condattr_setclock F
+ pthread_condattr_setpshared F
+ pthread_create F
+ pthread_detach F
+ pthread_equal F
+ pthread_exit F
+ pthread_getaffinity_np F
+ pthread_getattr_np F
+ pthread_getconcurrency F
+ pthread_getcpuclockid F
+ pthread_getname_np F
+ pthread_getschedparam F
+ pthread_getspecific F
+ pthread_join F
+ pthread_key_create F
+ pthread_key_delete F
+ pthread_kill F
+ pthread_kill_other_threads_np F
+ pthread_mutex_consistent F
+ pthread_mutex_consistent_np F
+ pthread_mutex_destroy F
+ pthread_mutex_getprioceiling F
+ pthread_mutex_init F
+ pthread_mutex_lock F
+ pthread_mutex_setprioceiling F
+ pthread_mutex_timedlock F
+ pthread_mutex_trylock F
+ pthread_mutex_unlock F
+ pthread_mutexattr_destroy F
+ pthread_mutexattr_getkind_np F
+ pthread_mutexattr_getprioceiling F
+ pthread_mutexattr_getprotocol F
+ pthread_mutexattr_getpshared F
+ pthread_mutexattr_getrobust F
+ pthread_mutexattr_getrobust_np F
+ pthread_mutexattr_gettype F
+ pthread_mutexattr_init F
+ pthread_mutexattr_setkind_np F
+ pthread_mutexattr_setprioceiling F
+ pthread_mutexattr_setprotocol F
+ pthread_mutexattr_setpshared F
+ pthread_mutexattr_setrobust F
+ pthread_mutexattr_setrobust_np F
+ pthread_mutexattr_settype F
+ pthread_once F
+ pthread_rwlock_destroy F
+ pthread_rwlock_init F
+ pthread_rwlock_rdlock F
+ pthread_rwlock_timedrdlock F
+ pthread_rwlock_timedwrlock F
+ pthread_rwlock_tryrdlock F
+ pthread_rwlock_trywrlock F
+ pthread_rwlock_unlock F
+ pthread_rwlock_wrlock F
+ pthread_rwlockattr_destroy F
+ pthread_rwlockattr_getkind_np F
+ pthread_rwlockattr_getpshared F
+ pthread_rwlockattr_init F
+ pthread_rwlockattr_setkind_np F
+ pthread_rwlockattr_setpshared F
+ pthread_self F
+ pthread_setaffinity_np F
+ pthread_setcancelstate F
+ pthread_setcanceltype F
+ pthread_setconcurrency F
+ pthread_setname_np F
+ pthread_setschedparam F
+ pthread_setschedprio F
+ pthread_setspecific F
+ pthread_sigmask F
+ pthread_sigqueue F
+ pthread_spin_destroy F
+ pthread_spin_init F
+ pthread_spin_lock F
+ pthread_spin_trylock F
+ pthread_spin_unlock F
+ pthread_testcancel F
+ pthread_timedjoin_np F
+ pthread_tryjoin_np F
+ pthread_yield F
+ pwrite F
+ pwrite64 F
+ raise F
+ read F
+ recv F
+ recvfrom F
+ recvmsg F
+ sem_close F
+ sem_destroy F
+ sem_getvalue F
+ sem_init F
+ sem_open F
+ sem_post F
+ sem_timedwait F
+ sem_trywait F
+ sem_unlink F
+ sem_wait F
+ send F
+ sendmsg F
+ sendto F
+ sigaction F
+ siglongjmp F
+ sigwait F
+ system F
+ tcdrain F
+ vfork F
+ wait F
+ waitpid F
+ write F
+GLIBC_2.18
+ GLIBC_2.18 A
+ pthread_getattr_default_np F
+ pthread_setattr_default_np F
diff --git a/sysdeps/unix/sysv/linux/powerpc/powerpc64/nptl/libresolv-le.abilist b/sysdeps/unix/sysv/linux/powerpc/powerpc64/nptl/libresolv-le.abilist
new file mode 100644
index 0000000..ed312c0
--- /dev/null
+++ b/sysdeps/unix/sysv/linux/powerpc/powerpc64/nptl/libresolv-le.abilist
@@ -0,0 +1,93 @@
+GLIBC_2.17
+ GLIBC_2.17 A
+ __b64_ntop F
+ __b64_pton F
+ __dn_comp F
+ __dn_count_labels F
+ __dn_expand F
+ __dn_skipname F
+ __fp_nquery F
+ __fp_query F
+ __fp_resstat F
+ __hostalias F
+ __loc_aton F
+ __loc_ntoa F
+ __p_cdname F
+ __p_cdnname F
+ __p_class F
+ __p_class_syms D 0xa8
+ __p_fqname F
+ __p_fqnname F
+ __p_option F
+ __p_query F
+ __p_rcode F
+ __p_secstodate F
+ __p_time F
+ __p_type F
+ __p_type_syms D 0x450
+ __putlong F
+ __putshort F
+ __res_close F
+ __res_dnok F
+ __res_hnok F
+ __res_hostalias F
+ __res_isourserver F
+ __res_mailok F
+ __res_mkquery F
+ __res_nameinquery F
+ __res_nmkquery F
+ __res_nquery F
+ __res_nquerydomain F
+ __res_nsearch F
+ __res_nsend F
+ __res_ownok F
+ __res_queriesmatch F
+ __res_query F
+ __res_querydomain F
+ __res_search F
+ __res_send F
+ __sym_ntop F
+ __sym_ntos F
+ __sym_ston F
+ _gethtbyaddr F
+ _gethtbyname F
+ _gethtbyname2 F
+ _gethtent F
+ _getlong F
+ _getshort F
+ _res_opcodes D 0x80
+ _sethtent F
+ inet_net_ntop F
+ inet_net_pton F
+ inet_neta F
+ ns_datetosecs F
+ ns_format_ttl F
+ ns_get16 F
+ ns_get32 F
+ ns_initparse F
+ ns_makecanon F
+ ns_msg_getflag F
+ ns_name_compress F
+ ns_name_ntol F
+ ns_name_ntop F
+ ns_name_pack F
+ ns_name_pton F
+ ns_name_rollback F
+ ns_name_skip F
+ ns_name_uncompress F
+ ns_name_unpack F
+ ns_parse_ttl F
+ ns_parserr F
+ ns_put16 F
+ ns_put32 F
+ ns_samedomain F
+ ns_samename F
+ ns_skiprr F
+ ns_sprintrr F
+ ns_sprintrrf F
+ ns_subdomain F
+ res_gethostbyaddr F
+ res_gethostbyname F
+ res_gethostbyname2 F
+ res_send_setqhook F
+ res_send_setrhook F
diff --git a/sysdeps/unix/sysv/linux/powerpc/powerpc64/nptl/librt-le.abilist b/sysdeps/unix/sysv/linux/powerpc/powerpc64/nptl/librt-le.abilist
new file mode 100644
index 0000000..f89f83e
--- /dev/null
+++ b/sysdeps/unix/sysv/linux/powerpc/powerpc64/nptl/librt-le.abilist
@@ -0,0 +1,37 @@
+GLIBC_2.17
+ GLIBC_2.17 A
+ __mq_open_2 F
+ aio_cancel F
+ aio_cancel64 F
+ aio_error F
+ aio_error64 F
+ aio_fsync F
+ aio_fsync64 F
+ aio_init F
+ aio_read F
+ aio_read64 F
+ aio_return F
+ aio_return64 F
+ aio_suspend F
+ aio_suspend64 F
+ aio_write F
+ aio_write64 F
+ lio_listio F
+ lio_listio64 F
+ mq_close F
+ mq_getattr F
+ mq_notify F
+ mq_open F
+ mq_receive F
+ mq_send F
+ mq_setattr F
+ mq_timedreceive F
+ mq_timedsend F
+ mq_unlink F
+ shm_open F
+ shm_unlink F
+ timer_create F
+ timer_delete F
+ timer_getoverrun F
+ timer_gettime F
+ timer_settime F
diff --git a/sysdeps/unix/sysv/linux/powerpc/powerpc64/nptl/libthread_db-le.abilist b/sysdeps/unix/sysv/linux/powerpc/powerpc64/nptl/libthread_db-le.abilist
new file mode 100644
index 0000000..52f8d07
--- /dev/null
+++ b/sysdeps/unix/sysv/linux/powerpc/powerpc64/nptl/libthread_db-le.abilist
@@ -0,0 +1,42 @@
+GLIBC_2.17
+ GLIBC_2.17 A
+ td_init F
+ td_log F
+ td_symbol_list F
+ td_ta_clear_event F
+ td_ta_delete F
+ td_ta_enable_stats F
+ td_ta_event_addr F
+ td_ta_event_getmsg F
+ td_ta_get_nthreads F
+ td_ta_get_ph F
+ td_ta_get_stats F
+ td_ta_map_id2thr F
+ td_ta_map_lwp2thr F
+ td_ta_new F
+ td_ta_reset_stats F
+ td_ta_set_event F
+ td_ta_setconcurrency F
+ td_ta_thr_iter F
+ td_ta_tsd_iter F
+ td_thr_clear_event F
+ td_thr_dbresume F
+ td_thr_dbsuspend F
+ td_thr_event_enable F
+ td_thr_event_getmsg F
+ td_thr_get_info F
+ td_thr_getfpregs F
+ td_thr_getgregs F
+ td_thr_getxregs F
+ td_thr_getxregsize F
+ td_thr_set_event F
+ td_thr_setfpregs F
+ td_thr_setgregs F
+ td_thr_setprio F
+ td_thr_setsigpending F
+ td_thr_setxregs F
+ td_thr_sigsetmask F
+ td_thr_tls_get_addr F
+ td_thr_tlsbase F
+ td_thr_tsd F
+ td_thr_validate F
diff --git a/sysdeps/unix/sysv/linux/powerpc/powerpc64/nptl/libutil-le.abilist b/sysdeps/unix/sysv/linux/powerpc/powerpc64/nptl/libutil-le.abilist
new file mode 100644
index 0000000..7e75bb2
--- /dev/null
+++ b/sysdeps/unix/sysv/linux/powerpc/powerpc64/nptl/libutil-le.abilist
@@ -0,0 +1,8 @@
+GLIBC_2.17
+ GLIBC_2.17 A
+ forkpty F
+ login F
+ login_tty F
+ logout F
+ logwtmp F
+ openpty F
http://sourceware.org/git/gitweb.cgi?p=glibc.git;a=commitdiff;h=01dcbb8a166c2974c8c34a996a9d1513ea9b1431
commit 01dcbb8a166c2974c8c34a996a9d1513ea9b1431
Author: Adhemerval Zanella <azanella@linux.vnet.ibm.com>
Date: Tue Feb 4 09:49:08 2014 -0200
PowerPC: Change powerpc64le start ABI to 2.17.
diff --git a/ChangeLog b/ChangeLog
index d9fa673..627c7ab 100644
--- a/ChangeLog
+++ b/ChangeLog
@@ -1,3 +1,8 @@
+2014-02-04 Adhemerval Zanella <azanella@linux.vnet.ibm.com>
+
+ * nptl/shlib-versions: Change powerpc*le start to 2.17.
+ * shlib-versions: Likewise.
+
2014-02-04 Roland McGrath <roland@hack.frob.com>
Adhemerval Zanella <azanella@linux.vnet.ibm.com>
diff --git a/nptl/shlib-versions b/nptl/shlib-versions
index 495b240..f6b9b9a 100644
--- a/nptl/shlib-versions
+++ b/nptl/shlib-versions
@@ -2,5 +2,5 @@ sparc64.*-.*-linux.* libpthread=0 GLIBC_2.2
sh.*-.*-linux.* libpthread=0 GLIBC_2.2
s390x-.*-linux.* libpthread=0 GLIBC_2.2
powerpc64-.*-linux.* libpthread=0 GLIBC_2.3
-powerpc.*le-.*-linux.* libpthread=0 GLIBC_2.18
+powerpc.*le-.*-linux.* libpthread=0 GLIBC_2.17
.*-.*-linux.* libpthread=0
diff --git a/shlib-versions b/shlib-versions
index 51f5327..78b0ad7 100644
--- a/shlib-versions
+++ b/shlib-versions
@@ -23,7 +23,7 @@
s390x-.*-linux.* DEFAULT GLIBC_2.2
powerpc64-.*-linux.* DEFAULT GLIBC_2.3
-powerpc.*le-.*-linux.* DEFAULT GLIBC_2.18
+powerpc.*le-.*-linux.* DEFAULT GLIBC_2.17
.*-.*-gnu-gnu.* DEFAULT GLIBC_2.2.6
# Configuration ABI Identifier for ABI data files
http://sourceware.org/git/gitweb.cgi?p=glibc.git;a=commitdiff;h=b99620786823c57f54c9447af27e1191095386ec
commit b99620786823c57f54c9447af27e1191095386ec
Author: Adhemerval Zanella <azanella@linux.vnet.ibm.com>
Date: Tue Feb 4 09:48:47 2014 -0200
abilist-pattern configurability
This patch creates implicit rules to match the abifiles if
abilist-pattern is defined in the architecture Makefile. This allows
machine specific Makefiles to define different abifiles names
(for instance *-le.abilist for powerpc64le).
diff --git a/ChangeLog b/ChangeLog
index f9f89fc..d9fa673 100644
--- a/ChangeLog
+++ b/ChangeLog
@@ -1,3 +1,14 @@
+2014-02-04 Roland McGrath <roland@hack.frob.com>
+ Adhemerval Zanella <azanella@linux.vnet.ibm.com>
+
+ * sysdeps/powerpc/Makefile [$(config-machine) ends with 'le']
+ (abilist-pattern): New variable, set to %-le.abilist.
+
+ * Makerules (abilist-pattern): New variable.
+ (vpath): Use $(abilist-pattern) in place of %.abilist.
+ (check-abi-% pattern rule): Likewise.
+ (check-abi, update-abi): Likewise.
+
2014-02-04 Eric Wong <normalperson@yhbt.net>
* sysdeps/x86_64/fpu/libm-test-ulps: Update.
diff --git a/Makerules b/Makerules
index b7e556f..b46b09b 100644
--- a/Makerules
+++ b/Makerules
@@ -1175,6 +1175,14 @@ ifeq ($(build-shared),yes)
LC_ALL=C $(OBJDUMP) --dynamic-syms $< > $@T
mv -f $@T $@
+# A sysdeps/.../Makefile can set abilist-pattern to something like
+# %-foo.abilist to look for libc-foo.abilist instead of libc.abilist.
+# This makes sense if multiple ABIs can be most cleanly supported by a
+# configuration without using separate sysdeps directories for each.
+ifdef abilist-pattern
+vpath $(abilist-pattern) $(+sysdep_dirs)
+endif
+
vpath %.abilist $(+sysdep_dirs)
# The .PRECIOUS rule prevents the files built by an implicit rule whose
@@ -1184,18 +1192,42 @@ vpath %.abilist $(+sysdep_dirs)
.PRECIOUS: %.symlist
generated += $(extra-libs:=.symlist)
+ifdef abilist-pattern
+check-abi-%: $(common-objpfx)config.make $(abilist-pattern) $(objpfx)%.symlist
+ $(check-abi-pattern)
+check-abi-%: $(common-objpfx)config.make $(abilist-pattern) \
+ $(common-objpfx)%.symlist
+ $(check-abi-pattern)
+endif
check-abi-%: $(common-objpfx)config.make %.abilist $(objpfx)%.symlist
$(check-abi)
check-abi-%: $(common-objpfx)config.make %.abilist $(common-objpfx)%.symlist
$(check-abi)
+define check-abi-pattern
+ diff -p -U 0 $(filter $(abilist-pattern),$^) $(filter %.symlist,$^)
+endef
define check-abi
diff -p -U 0 $(filter %.abilist,$^) $(filter %.symlist,$^)
endef
+ifdef abilist-pattern
+update-abi-%: $(objpfx)%.symlist $(abilist-pattern)
+ $(update-abi-pattern)
+update-abi-%: $(common-objpfx)%.symlist $(abilist-pattern)
+ $(update-abi-pattern)
+endif
update-abi-%: $(objpfx)%.symlist %.abilist
$(update-abi)
update-abi-%: $(common-objpfx)%.symlist %.abilist
$(update-abi)
+define update-abi-pattern
+@if cmp -s $^ 2> /dev/null; \
+ then \
+ echo '+++ $(filter $(abilist-pattern),$^) is unchanged'; \
+ else cp -f $^; \
+ echo '*** Now check $(filter $(abilist-pattern),$^) changes for correctness ***'; \
+ fi
+endef
define update-abi
@if cmp -s $^ 2> /dev/null; \
then \
diff --git a/sysdeps/powerpc/Makefile b/sysdeps/powerpc/Makefile
index f75e625..b11edd7 100644
--- a/sysdeps/powerpc/Makefile
+++ b/sysdeps/powerpc/Makefile
@@ -27,3 +27,7 @@ ifeq ($(subdir),misc)
sysdep_headers += sys/platform/ppc.h
tests += test-gettimebase
endif
+
+ifneq (,$(filter %le,$(config-machine)))
+abilist-pattern = %-le.abilist
+endif
http://sourceware.org/git/gitweb.cgi?p=glibc.git;a=commitdiff;h=13674005345deeac71debaa994fe89cecf6cdb2a
commit 13674005345deeac71debaa994fe89cecf6cdb2a
Author: Siddhesh Poyarekar <siddhesh@redhat.com>
Date: Mon Feb 3 12:36:15 2014 +0530
Make bench.out in json format
diff --git a/benchtests/Makefile b/benchtests/Makefile
index 7f7145a..0e0704a 100644
--- a/benchtests/Makefile
+++ b/benchtests/Makefile
@@ -115,11 +115,13 @@ bench-set: $(binaries-benchset)
done
bench-func: $(binaries-bench)
- { ./machine-info.sh; \
+ { echo "{"; \
+ ./machine-info.sh; \
for run in $^; do \
echo "Running $${run}" >&2; \
$(run-bench) $(DETAILED_OPT); \
- done; } > $(objpfx)bench.out-tmp; \
+ done; \
+ echo "}"; } > $(objpfx)bench.out-tmp; \
if [ -f $(objpfx)bench.out ]; then \
mv -f $(objpfx)bench.out $(objpfx)bench.out.old; \
fi; \
diff --git a/benchtests/machine-info.sh b/benchtests/machine-info.sh
index aa09da5..041da30 100755
--- a/benchtests/machine-info.sh
+++ b/benchtests/machine-info.sh
@@ -1,13 +1,12 @@
#!/bin/sh
# Simple script to get some basic machine information
-{ sed -n -e 's/\(vendor_id\)[ \t]\+:/1. \1:/p' \
- -e 's/\(cpu family\)[ \t]\+:/2. \1:/p' \
- -e 's/\(model\)[ \t]\+:/3. \1:/p' \
- -e 's/\(cpu cores\)[ \t]\+:/4. \1:/p' \
- -e 's/\(cache size\)[ \t]\+:/6. \1:/p' \
- -e 's/MemTotal:[ \t]\+\(.*\)/7. memory: \1/p' \
- -e 's/SwapTotal:[ \t]\+\(.*\)/8. swap: \1/p' \
- /proc/cpuinfo /proc/meminfo; \
- echo 5. processors: $(grep -c 'processor' /proc/cpuinfo); } |
- sort -u
+sed -n -e 's/vendor_id[ \t]\+:\(.*\)/ "vendor-id": \1,/p' \
+ -e 's/cpu family[ \t]\+:\(.*\)/ "cpu-family": \1,/p' \
+ -e 's/\(model\)[ \t]\+:\(.*\)/ "\1": \1,/p' \
+ -e 's/cpu cores[ \t]\+:\(.*\)/ "cpu-cores": \1,/p' \
+ -e 's/cache size[ \t]\+:\([0-9]\+\).*/ "cache-size": \1,/p' \
+ -e 's/MemTotal:[ \t]\+\([0-9]\+\).*/ "memory": \1,/p' \
+ -e 's/SwapTotal:[ \t]\+\([0-9]\+\).*/ "swap": \1,/p' \
+ /proc/cpuinfo /proc/meminfo | sort -u
+echo " \"processors\": $(grep -c 'processor' /proc/cpuinfo),"
http://sourceware.org/git/gitweb.cgi?p=glibc.git;a=commitdiff;h=1d68d06ad65bca949ddeeacfce1d5be34c05c30b
commit 1d68d06ad65bca949ddeeacfce1d5be34c05c30b
Author: Siddhesh Poyarekar <siddhesh@redhat.com>
Date: Fri Jan 17 18:14:57 2014 +0530
Add machine info
diff --git a/benchtests/Makefile b/benchtests/Makefile
index 9e6c58e..7f7145a 100644
--- a/benchtests/Makefile
+++ b/benchtests/Makefile
@@ -115,7 +115,8 @@ bench-set: $(binaries-benchset)
done
bench-func: $(binaries-bench)
- { for run in $^; do \
+ { ./machine-info.sh; \
+ for run in $^; do \
echo "Running $${run}" >&2; \
$(run-bench) $(DETAILED_OPT); \
done; } > $(objpfx)bench.out-tmp; \
diff --git a/benchtests/machine-info.sh b/benchtests/machine-info.sh
new file mode 100755
index 0000000..aa09da5
--- /dev/null
+++ b/benchtests/machine-info.sh
@@ -0,0 +1,13 @@
+#!/bin/sh
+# Simple script to get some basic machine information
+
+{ sed -n -e 's/\(vendor_id\)[ \t]\+:/1. \1:/p' \
+ -e 's/\(cpu family\)[ \t]\+:/2. \1:/p' \
+ -e 's/\(model\)[ \t]\+:/3. \1:/p' \
+ -e 's/\(cpu cores\)[ \t]\+:/4. \1:/p' \
+ -e 's/\(cache size\)[ \t]\+:/6. \1:/p' \
+ -e 's/MemTotal:[ \t]\+\(.*\)/7. memory: \1/p' \
+ -e 's/SwapTotal:[ \t]\+\(.*\)/8. swap: \1/p' \
+ /proc/cpuinfo /proc/meminfo; \
+ echo 5. processors: $(grep -c 'processor' /proc/cpuinfo); } |
+ sort -u
http://sourceware.org/git/gitweb.cgi?p=glibc.git;a=commitdiff;h=b7b08b0cafeef894193e8201e4307d776851c6d1
commit b7b08b0cafeef894193e8201e4307d776851c6d1
Author: Siddhesh Poyarekar <siddhesh@redhat.com>
Date: Thu Jan 16 15:09:10 2014 +0530
Remove bench-modf.c
diff --git a/benchtests/bench-modf.c b/benchtests/bench-modf.c
deleted file mode 100644
index 407360c..0000000
--- a/benchtests/bench-modf.c
+++ /dev/null
@@ -1,44 +0,0 @@
-/* Copyright (C) 2013-2014 Free Software Foundation, Inc.
- This file is part of the GNU C Library.
-
- The GNU C Library is free software; you can redistribute it and/or
- modify it under the terms of the GNU Lesser General Public
- License as published by the Free Software Foundation; either
- version 2.1 of the License, or (at your option) any later version.
-
- The GNU C Library is distributed in the hope that it will be useful,
- but WITHOUT ANY WARRANTY; without even the implied warranty of
- MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
- Lesser General Public License for more details.
-
- You should have received a copy of the GNU Lesser General Public
- License along with the GNU C Library; if not, see
- <http://www.gnu.org/licenses/>. */
-
-extern double modf (double, double *);
-
-#define CALL_BENCH_FUNC(j, i) modf (in[j].arg0, &i);
-
-struct args
-{
- volatile double arg0;
-} in[] =
-{
- { 42.42 },
- { -42.42 }
-};
-
-#define NUM_VARIANTS 1
-#define NUM_SAMPLES(v) (sizeof (in) / sizeof (struct args))
-
-static volatile double ret = 0.0;
-#define BENCH_FUNC(v, j) \
-({ \
- double iptr; \
- ret = CALL_BENCH_FUNC (j, iptr); \
-})
-
-#define FUNCNAME "modf"
-#define VARIANT(v) FUNCNAME "()"
-
-#include "bench-skeleton.c"
diff --git a/benchtests/modf-inputs b/benchtests/modf-inputs
new file mode 100644
index 0000000..4fcc99b
--- /dev/null
+++ b/benchtests/modf-inputs
@@ -0,0 +1,4 @@
+## includes: math.h
+## args: double:<double *>
+42.0
+-42.0
http://sourceware.org/git/gitweb.cgi?p=glibc.git;a=commitdiff;h=12387852c7e6d76c7f109366f5e94040d0330175
commit 12387852c7e6d76c7f109366f5e94040d0330175
Author: Siddhesh Poyarekar <siddhesh@redhat.com>
Date: Wed Jan 15 12:48:09 2014 +0530
Detailed benchmark numbers
Store timings per input.
diff --git a/benchtests/Makefile b/benchtests/Makefile
index 792f61f..9e6c58e 100644
--- a/benchtests/Makefile
+++ b/benchtests/Makefile
@@ -84,6 +84,12 @@ ifdef USE_CLOCK_GETTIME
CPPFLAGS-nonlib += -DUSE_CLOCK_GETTIME
endif
+DETAILED_OPT :=
+
+ifdef DETAILED
+DETAILED_OPT := -d
+endif
+
# This makes sure CPPFLAGS-nonlib and CFLAGS-nonlib are passed
# for all these modules.
cpp-srcs-left := $(binaries-benchset:=.c) $(binaries-bench:=.c)
@@ -111,7 +117,7 @@ bench-set: $(binaries-benchset)
bench-func: $(binaries-bench)
{ for run in $^; do \
echo "Running $${run}" >&2; \
- $(run-bench); \
+ $(run-bench) $(DETAILED_OPT); \
done; } > $(objpfx)bench.out-tmp; \
if [ -f $(objpfx)bench.out ]; then \
mv -f $(objpfx)bench.out $(objpfx)bench.out.old; \
diff --git a/benchtests/bench-skeleton.c b/benchtests/bench-skeleton.c
index 4290e76..1a124a2 100644
--- a/benchtests/bench-skeleton.c
+++ b/benchtests/bench-skeleton.c
@@ -18,6 +18,7 @@
#include <string.h>
#include <stdint.h>
+#include <stdbool.h>
#include <stdio.h>
#include <time.h>
#include <inttypes.h>
@@ -48,6 +49,10 @@ main (int argc, char **argv)
unsigned long i, k;
struct timespec runtime;
timing_t start, end;
+ bool detailed = false;
+
+ if (argc == 2 && !strcmp (argv[1], "-d"))
+ detailed = true;
startup();
@@ -59,6 +64,9 @@ main (int argc, char **argv)
iters = 1000 * res;
+ if (detailed)
+ printf ("%s\n", FUNCNAME);
+
for (int v = 0; v < NUM_VARIANTS; v++)
{
/* Run for approximately DURATION seconds. */
@@ -67,6 +75,7 @@ main (int argc, char **argv)
double d_total_i = 0;
timing_t total = 0, max = 0, min = 0x7fffffffffffffff;
+ int64_t c = 0;
while (1)
{
for (i = 0; i < NUM_SAMPLES (v); i++)
@@ -86,9 +95,13 @@ main (int argc, char **argv)
min = cur;
TIMING_ACCUM (total, cur);
+ /* Accumulate timings for the value. In the end we will divide
+ by the total iterations. */
+ RESULT_ACCUM (cur, v, i, c * iters, (c + 1) * iters);
d_total_i += iters;
}
+ c++;
struct timespec curtime;
memset (&curtime, 0, sizeof (curtime));
@@ -104,8 +117,17 @@ main (int argc, char **argv)
d_total_s = total;
d_iters = iters;
- TIMING_PRINT_STATS (VARIANT (v), d_total_s, d_iters, d_total_i, max,
- min);
+ if (!detailed)
+ {
+ TIMING_PRINT_STATS (VARIANT (v), d_total_s, d_iters, d_total_i, max,
+ min);
+ }
+ else
+ {
+ printf ("\t%s\n", VARIANT (v));
+ for (int i = 0; i < NUM_SAMPLES (v); i++)
+ printf ("\t\t%g\n", RESULT (v, i));
+ }
}
return 0;
diff --git a/scripts/bench.py b/scripts/bench.py
index 81ffc15..11f616f 100755
--- a/scripts/bench.py
+++ b/scripts/bench.py
@@ -50,6 +50,7 @@ STRUCT_TEMPLATE = '''
struct args
{
%(args)s
+ double timing;
};
struct _variants
@@ -80,6 +81,9 @@ struct _variants variants[%(num_variants)d] = {
# Epilogue for the generated source file.
EPILOGUE = '''
+#define RESULT(__v, __i) (variants[(__v)].in[(__i)].timing)
+#define RESULT_ACCUM(r, v, i, old, new) \\
+ ((RESULT ((v), (i))) = (RESULT ((v), (i)) * (old) + (r)) / ((new) + 1))
#define BENCH_FUNC(i, j) ({%(getret)s CALL_BENCH_FUNC (i, j);})
#define FUNCNAME "%(func)s"
#include "bench-skeleton.c"'''
@@ -168,7 +172,7 @@ def _print_arg_data(func, directives, all_vals):
# Now print the values.
variants = []
for (k, vals), i in zip(all_vals.items(), itertools.count()):
- out = [' {%s},' % v for v in vals]
+ out = [' {%s, 0},' % v for v in vals]
# Members for the variants structure list that we will
# print later.
http://sourceware.org/git/gitweb.cgi?p=glibc.git;a=commitdiff;h=5f2f18db8382f26580b23004e6f2f87b9b80318b
commit 5f2f18db8382f26580b23004e6f2f87b9b80318b
Author: Siddhesh Poyarekar <siddhesh@redhat.com>
Date: Fri Dec 6 13:51:09 2013 +0530
Implement benchmarking script in python
diff --git a/benchtests/Makefile b/benchtests/Makefile
index 8bfb039..792f61f 100644
--- a/benchtests/Makefile
+++ b/benchtests/Makefile
@@ -127,5 +127,5 @@ $(objpfx)bench-%.c: %-inputs $(bench-deps)
{ if [ -n "$($*-INCLUDE)" ]; then \
cat $($*-INCLUDE); \
fi; \
- $(..)scripts/bench.pl $(patsubst %-inputs,%,$<); } > $@-tmp
+ $(..)scripts/bench.py $(patsubst %-inputs,%,$<); } > $@-tmp
mv -f $@-tmp $@
diff --git a/benchtests/README b/benchtests/README
index a5fd8da..2a940fa 100644
--- a/benchtests/README
+++ b/benchtests/README
@@ -8,7 +8,9 @@ basic performance properties of the function.
Running the benchmark:
=====================
-The benchmark can be executed by invoking make as follows:
+The benchmark needs python 2.7 or later in addition to the
+dependencies required to build the GNU C Library. One may run the
+benchmark by invoking make as follows:
$ make bench
diff --git a/scripts/bench.pl b/scripts/bench.pl
deleted file mode 100755
index 569cd51..0000000
--- a/scripts/bench.pl
+++ /dev/null
@@ -1,205 +0,0 @@
-#! /usr/bin/perl -w
-# Copyright (C) 2013-2014 Free Software Foundation, Inc.
-# This file is part of the GNU C Library.
-
-# The GNU C Library is free software; you can redistribute it and/or
-# modify it under the terms of the GNU Lesser General Public
-# License as published by the Free Software Foundation; either
-# version 2.1 of the License, or (at your option) any later version.
-
-# The GNU C Library is distributed in the hope that it will be useful,
-# but WITHOUT ANY WARRANTY; without even the implied warranty of
-# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
-# Lesser General Public License for more details.
-
-# You should have received a copy of the GNU Lesser General Public
-# License along with the GNU C Library; if not, see
-# <http://www.gnu.org/licenses/>.
-
-
-use strict;
-use warnings;
-# Generate a benchmark source file for a given input.
-
-if (@ARGV < 1) {
- die "Usage: bench.pl <function>"
-}
-
-my $func = $ARGV[0];
-my @args;
-my $ret = "void";
-my $getret = "";
-
-# We create a hash of inputs for each variant of the test.
-my $variant = "";
-my @curvals;
-my %vals;
-my @include_headers;
-my @include_sources;
-my $incl;
-
-open INPUTS, "<$func-inputs" or die $!;
-
-LINE:while (<INPUTS>) {
- chomp;
-
- # Directives.
- if (/^## ([\w-]+): (.*)/) {
- # Function argument types.
- if ($1 eq "args") {
- @args = split(":", $2);
- }
-
- # Function return type.
- elsif ($1 eq "ret") {
- $ret = $2;
- }
-
- elsif ($1 eq "includes") {
- @include_headers = split (",", $2);
- }
-
- elsif ($1 eq "include-sources") {
- @include_sources = split (",", $2);
- }
-
- # New variant. This is the only directive allowed in the body of the
- # inputs to separate inputs into variants. All others should be at the
- # top or else all hell will break loose.
- elsif ($1 eq "name") {
-
- # Save values in the previous variant.
- my @copy = @curvals;
- $vals{$variant} = \@copy;
-
- # Prepare for the next.
- $variant=$2;
- undef @curvals;
- next LINE;
- }
-
- else {
- die "Unknown directive: ".$1;
- }
- }
-
- # Skip over comments and blank lines.
- if (/^#/ || /^$/) {
- next LINE;
- }
- push (@curvals, $_);
-}
-
-
-my $bench_func = "#define CALL_BENCH_FUNC(v, i) $func (";
-
-# Output variables. These include the return value as well as any pointers
-# that may get passed into the function, denoted by the <> around the type.
-my $outvars = "";
-
-if ($ret ne "void") {
- $outvars = "static $ret volatile ret;\n";
-}
-
-# Print the definitions and macros.
-foreach $incl (@include_headers) {
- print "#include <" . $incl . ">\n";
-}
-
-# Print the source files.
-foreach $incl (@include_sources) {
- print "#include \"" . $incl . "\"\n";
-}
-
-if (@args > 0) {
- # Save values in the last variant.
- $vals{$variant} = \@curvals;
- my $struct =
- "struct _variants
- {
- const char *name;
- int count;
- struct args *in;
- };\n";
-
- my $arg_struct = "struct args {";
-
- my $num = 0;
- my $arg;
- foreach $arg (@args) {
- if ($num > 0) {
- $bench_func = "$bench_func,";
- }
-
- $_ = $arg;
- if (/<(.*)\*>/) {
- # Output variables. These have to be pointers, so dereference once by
- # dropping one *.
- $outvars = $outvars . "static $1 out$num;\n";
- $bench_func = "$bench_func &out$num";
- }
- else {
- $arg_struct = "$arg_struct $arg volatile arg$num;";
- $bench_func = "$bench_func variants[v].in[i].arg$num";
- }
-
- $num = $num + 1;
- }
-
- $arg_struct = $arg_struct . "};\n";
- $bench_func = $bench_func . ");\n";
-
- print $bench_func;
- print $arg_struct;
- print $struct;
-
- my $c = 0;
- my $key;
-
- # Print the input arrays.
- foreach $key (keys %vals) {
- my @arr = @{$vals{$key}};
-
- print "struct args in" . $c . "[" . @arr . "] = {\n";
- foreach (@arr) {
- print "{$_},\n";
- }
- print "};\n\n";
- $c += 1;
- }
-
- # The variants. Each variant then points to the appropriate input array we
- # defined above.
- print "struct _variants variants[" . (keys %vals) . "] = {\n";
- $c = 0;
- foreach $key (keys %vals) {
- print "{\"$func($key)\", " . @{$vals{$key}} . ", in$c},\n";
- $c += 1;
- }
- print "};\n\n";
- # Finally, print the last set of macros.
- print "#define NUM_VARIANTS $c\n";
- print "#define NUM_SAMPLES(i) (variants[i].count)\n";
- print "#define VARIANT(i) (variants[i].name)\n";
-}
-else {
- print $bench_func . ");\n";
- print "#define NUM_VARIANTS (1)\n";
- print "#define NUM_SAMPLES(v) (1)\n";
- print "#define VARIANT(v) FUNCNAME \"()\"\n"
-}
-
-# Print the output variable definitions.
-print "$outvars\n";
-
-# In some cases not storing a return value seems to result in the function call
-# being optimized out.
-if ($ret ne "void") {
- $getret = "ret = ";
-}
-
-# And we're done.
-print "#define BENCH_FUNC(i, j) ({$getret CALL_BENCH_FUNC (i, j);})\n";
-
-print "#define FUNCNAME \"$func\"\n";
-print "#include \"bench-skeleton.c\"\n";
diff --git a/scripts/bench.py b/scripts/bench.py
new file mode 100755
index 0000000..81ffc15
--- /dev/null
+++ b/scripts/bench.py
@@ -0,0 +1,299 @@
+#!/usr/bin/python
+# Copyright (C) 2014 Free Software Foundation, Inc.
+# This file is part of the GNU C Library.
+#
+# The GNU C Library is free software; you can redistribute it and/or
+# modify it under the terms of the GNU Lesser General Public
+# License as published by the Free Software Foundation; either
+# version 2.1 of the License, or (at your option) any later version.
+#
+# The GNU C Library is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
+# Lesser General Public License for more details.
+#
+# You should have received a copy of the GNU Lesser General Public
+# License along with the GNU C Library; if not, see
+# <http://www.gnu.org/licenses/>.
+
+"""Benchmark program generator script
+
+This script takes a function name as input and generates a program using
+an input file located in the benchtests directory. The name of the
+input file should be of the form foo-inputs where 'foo' is the name of
+the function.
+"""
+
+from __future__ import print_function
+import sys
+import os
+import itertools
+
+# Macro definitions for functions that take no arguments. For functions
+# that take arguments, the STRUCT_TEMPLATE, ARGS_TEMPLATE and
+# VARIANTS_TEMPLATE are used instead.
+DEFINES_TEMPLATE = '''
+#define CALL_BENCH_FUNC(v, i) %(func)s ()
+#define NUM_VARIANTS (1)
+#define NUM_SAMPLES(v) (1)
+#define VARIANT(v) FUNCNAME "()"
+'''
+
+# Structures to store arguments for the function call. A function may
+# have its inputs partitioned to represent distinct performance
+# characteristics or distinct flavors of the function. Each such
+# variant is represented by the _VARIANT structure. The ARGS structure
+# represents a single set of arguments.
+STRUCT_TEMPLATE = '''
+#define CALL_BENCH_FUNC(v, i) %(func)s (%(func_args)s)
+
+struct args
+{
+%(args)s
+};
+
+struct _variants
+{
+ const char *name;
+ int count;
+ struct args *in;
+};
+'''
+
+# The actual input arguments.
+ARGS_TEMPLATE = '''
+struct args in%(argnum)d[%(num_args)d] = {
+%(args)s
+};
+'''
+
+# The actual variants, along with macros defined to access the variants.
+VARIANTS_TEMPLATE = '''
+struct _variants variants[%(num_variants)d] = {
+%(variants)s
+};
+
+#define NUM_VARIANTS %(num_variants)d
+#define NUM_SAMPLES(i) (variants[i].count)
+#define VARIANT(i) (variants[i].name)
+'''
+
+# Epilogue for the generated source file.
+EPILOGUE = '''
+#define BENCH_FUNC(i, j) ({%(getret)s CALL_BENCH_FUNC (i, j);})
+#define FUNCNAME "%(func)s"
+#include "bench-skeleton.c"'''
+
+
+def gen_source(func, directives, all_vals):
+ """Generate source for the function
+
+ Generate the C source for the function from the values and
+ directives.
+
+ Args:
+ func: The function name
+ directives: A dictionary of directives applicable to this function
+ all_vals: A dictionary input values
+ """
+ # The includes go in first.
+ for header in directives['includes']:
+ print('#include <%s>' % header)
+
+ for header in directives['include-sources']:
+ print('#include "%s"' % header)
+
+ # Print macros. This branches out to a separate routine if
+ # the function takes arguments.
+ if not directives['args']:
+ print(DEFINES_TEMPLATE % {'func': func})
+ outargs = []
+ else:
+ outargs = _print_arg_data(func, directives, all_vals)
+
+ # Print the output variable definitions if necessary.
+ for out in outargs:
+ print(out)
+
+ # If we have a return value from the function, make sure it is
+ # assigned to prevent the compiler from optimizing out the
+ # call.
+ if directives['ret']:
+ print('static %s volatile ret;' % directives['ret'])
+ getret = 'ret = '
+ else:
+ getret = ''
+
+ print(EPILOGUE % {'getret': getret, 'func': func})
+
+
+def _print_arg_data(func, directives, all_vals):
+ """Print argument data
+
+ This is a helper function for gen_source that prints structure and
+ values for arguments and their variants and returns output arguments
+ if any are found.
+
+ Args:
+ func: Function name
+ directives: A dictionary of directives applicable to this function
+ all_vals: A dictionary input values
+
+ Returns:
+ Returns a list of definitions for function arguments that act as
+ output parameters.
+ """
+ # First, all of the definitions. We process writing of
+ # CALL_BENCH_FUNC, struct args and also the output arguments
+ # together in a single traversal of the arguments list.
+ func_args = []
+ arg_struct = []
+ outargs = []
+
+ for arg, i in zip(directives['args'], itertools.count()):
+ if arg[0] == '<' and arg[-1] == '>':
+ pos = arg.rfind('*')
+ if pos == -1:
+ die('Output argument must be a pointer type')
+
+ outargs.append('static %s out%d;' % (arg[1:pos], i))
+ func_args.append(' &out%d' % i)
+ else:
+ arg_struct.append(' %s volatile arg%d;' % (arg, i))
+ func_args.append('variants[v].in[i].arg%d' % i)
+
+ print(STRUCT_TEMPLATE % {'args' : '\n'.join(arg_struct), 'func': func,
+ 'func_args': ', '.join(func_args)})
+
+ # Now print the values.
+ variants = []
+ for (k, vals), i in zip(all_vals.items(), itertools.count()):
+ out = [' {%s},' % v for v in vals]
+
+ # Members for the variants structure list that we will
+ # print later.
+ variants.append(' {"%s(%s)", %d, in%d},' % (func, k, len(vals), i))
+ print(ARGS_TEMPLATE % {'argnum': i, 'num_args': len(vals),
+ 'args': '\n'.join(out)})
+
+ # Print the variants and the last set of macros.
+ print(VARIANTS_TEMPLATE % {'num_variants': len(all_vals),
+ 'variants': '\n'.join(variants)})
+ return outargs
+
+
+def _process_directive(d_name, d_val):
+ """Process a directive.
+
+ Evaluate the directive name and value passed and return the
+ processed value. This is a helper function for parse_file.
+
+ Args:
+ d_name: Name of the directive
+ d_value: The string value to process
+
+ Returns:
+ The processed value, which may be the string as it is or an object
+ that describes the directive.
+ """
+ # Process the directive values if necessary. name and ret don't
+ # need any processing.
+ if d_name.startswith('include'):
+ d_val = d_val.split(',')
+ elif d_name == 'args':
+ d_val = d_val.split(':')
+
+ # Return the values.
+ return d_val
+
+
+def parse_file(func):
+ """Parse an input file
+
+ Given a function name, open and parse an input file for the function
+ and get the necessary parameters for the generated code and the list
+ of inputs.
+
+ Args:
+ func: The function name
+
+ Returns:
+ A tuple of two elements, one a dictionary of directives and the
+ other a dictionary of all input values.
+ """
+ all_vals = {}
+ # Valid directives.
+ directives = {
+ 'name': '',
+ 'args': [],
+ 'includes': [],
+ 'include-sources': [],
+ 'ret': ''
+ }
+
+ try:
+ with open('%s-inputs' % func) as f:
+ for line in f:
+ # Look for directives and parse it if found.
+ if line.startswith('##'):
+ try:
+ d_name, d_val = line[2:].split(':', 1)
+ d_name = d_name.strip()
+ d_val = d_val.strip()
+ directives[d_name] = _process_directive(d_name, d_val)
+ except (IndexError, KeyError):
+ die('Invalid directive: %s' % line[2:])
+
+ # Skip blank lines and comments.
+ line = line.split('#', 1)[0].rstrip()
+ if not line:
+ continue
+
+ # Otherwise, we're an input. Add to the appropriate
+ # input set.
+ cur_name = directives['name']
+ all_vals.setdefault(cur_name, [])
+ all_vals[cur_name].append(line)
+ except IOError as ex:
+ die("Failed to open input file (%s): %s" % (ex.filename, ex.strerror))
+
+ return directives, all_vals
+
+
+def die(msg):
+ """Exit with an error
+
+ Prints an error message to the standard error stream and exits with
+ a non-zero status.
+
+ Args:
+ msg: The error message to print to standard error.
+ """
+ print('%s\n' % msg, file=sys.stderr)
+ sys.exit(os.EX_DATAERR)
+
+
+def main(args):
+ """Main function
+
+ Use the first command line argument as function name and parse its
+ input file to generate C source that calls the function repeatedly
+ for the input.
+
+ Args:
+ args: The command line arguments with the program name dropped.
+
+ Returns:
+ os.EX_USAGE on error and os.EX_OK on success.
+ """
+ if len(args) != 1:
+ print('Usage: %s <function>' % sys.argv[0])
+ return os.EX_USAGE
+
+ directives, all_vals = parse_file(args[0])
+ gen_source(args[0], directives, all_vals)
+ return os.EX_OK
+
+
+if __name__ == '__main__':
+ sys.exit(main(sys.argv[1:]))
diff --git a/scripts/pylint b/scripts/pylint
new file mode 100755
index 0000000..49a775e
--- /dev/null
+++ b/scripts/pylint
@@ -0,0 +1,5 @@
+#!/bin/sh
+# Simple wrapper around the pylint program that uses the pylintrc file to
+# validate the source code in files passed on command line.
+
+exec pylint --rcfile "${0%/*}/pylintrc" "$@"
diff --git a/scripts/pylintrc b/scripts/pylintrc
new file mode 100644
index 0000000..a05ddfd
--- /dev/null
+++ b/scripts/pylintrc
@@ -0,0 +1,274 @@
+[MASTER]
+
+# Specify a configuration file.
+#rcfile=
+
+# Python code to execute, usually for sys.path manipulation such as
+# pygtk.require().
+#init-hook=
+
+# Profiled execution.
+profile=no
+
+# Add files or directories to the blacklist. They should be base names, not
+# paths.
+ignore=CVS
+
+# Pickle collected data for later comparisons.
+persistent=yes
+
+# List of plugins (as comma separated values of python modules names) to load,
+# usually to register additional checkers.
+load-plugins=
+
+
+[MESSAGES CONTROL]
+
+# Enable the message, report, category or checker with the given id(s). You can
+# either give multiple identifier separated by comma (,) or put this option
+# multiple time. See also the "--disable" option for examples.
+#enable=
+
+# Disable the message, report, category or checker with the given id(s). You
+# can either give multiple identifiers separated by comma (,) or put this
+# option multiple times (only on the command line, not in the configuration
+# file where it should appear only once).You can also use "--disable=all" to
+# disable everything first and then reenable specific checks. For example, if
+# you want to run only the similarities checker, you can use "--disable=all
+# --enable=similarities". If you want to run only the classes checker, but have
+# no Warning level messages displayed, use"--disable=all --enable=classes
+# --disable=W"
+#disable=
+
+
+[REPORTS]
+
+# Set the output format. Available formats are text, parseable, colorized, msvs
+# (visual studio) and html. You can also give a reporter class, eg
+# mypackage.mymodule.MyReporterClass.
+output-format=text
+
+# Put messages in a separate file for each module / package specified on the
+# command line instead of printing them on stdout. Reports (if any) will be
+# written in a file name "pylint_global.[txt|html]".
+files-output=no
+
+# Tells whether to display a full report or only the messages
+reports=yes
+
+# Python expression which should return a note less than 10 (10 is the highest
+# note). You have access to the variables errors warning, statement which
+# respectively contain the number of errors / warnings messages and the total
+# number of statements analyzed. This is used by the global evaluation report
+# (RP0004).
+evaluation=10.0 - ((float(5 * error + warning + refactor + convention) / statement) * 10)
+
+# Add a comment according to your evaluation note. This is used by the global
+# evaluation report (RP0004).
+comment=no
+
+# Template used to display messages. This is a python new-style format string
+# used to format the massage information. See doc for all details
+#msg-template=
+
+
+[MISCELLANEOUS]
+
+# List of note tags to take in consideration, separated by a comma.
+notes=FIXME,XXX,TODO
+
+
+[SIMILARITIES]
+
+# Minimum lines number of a similarity.
+min-similarity-lines=4
+
+# Ignore comments when computing similarities.
+ignore-comments=yes
+
+# Ignore docstrings when computing similarities.
+ignore-docstrings=yes
+
+# Ignore imports when computing similarities.
+ignore-imports=no
+
+
+[BASIC]
+
+# Required attributes for module, separated by a comma
+required-attributes=
+
+# List of builtins function names that should not be used, separated by a comma
+bad-functions=map,filter,apply,input
+
+# Regular expression which should only match correct module names
+module-rgx=(([a-z_][a-z0-9_]*)|([A-Z][a-zA-Z0-9]+))$
+
+# Regular expression which should only match correct module level names
+const-rgx=(([A-Z_][A-Z0-9_]*)|(__.*__))$
+
+# Regular expression which should only match correct class names
+class-rgx=[A-Z_][a-zA-Z0-9]+$
+
+# Regular expression which should only match correct function names
+function-rgx=[a-z_][a-z0-9_]{2,30}$
+
+# Regular expression which should only match correct method names
+method-rgx=[a-z_][a-z0-9_]{2,30}$
+
+# Regular expression which should only match correct instance attribute names
+attr-rgx=[a-z_][a-z0-9_]{2,30}$
+
+# Regular expression which should only match correct argument names
+argument-rgx=[a-z_][a-z0-9_]{2,30}$
+
+# Regular expression which should only match correct variable names
+variable-rgx=[a-z_][a-z0-9_]{2,30}$
+
+# Regular expression which should only match correct attribute names in class
+# bodies
+class-attribute-rgx=([A-Za-z_][A-Za-z0-9_]{2,30}|(__.*__))$
+
+# Regular expression which should only match correct list comprehension /
+# generator expression variable names
+inlinevar-rgx=[A-Za-z_][A-Za-z0-9_]*$
+
+# Good variable names which should always be accepted, separated by a comma
+# f is a useful name for a file descriptor
+good-names=f,i,j,k,ex,Run,_
+
+# Bad variable names which should always be refused, separated by a comma
+bad-names=foo,bar,baz,toto,tutu,tata
+
+# Regular expression which should only match function or class names that do
+# not require a docstring.
+no-docstring-rgx=__.*__
+
+# Minimum line length for functions/classes that require docstrings, shorter
+# ones are exempt.
+docstring-min-length=-1
+
+
+[VARIABLES]
+
+# Tells whether we should check for unused import in __init__ files.
+init-import=no
+
+# A regular expression matching the beginning of the name of dummy variables
+# (i.e. not used).
+dummy-variables-rgx=_$|dummy
+
+# List of additional names supposed to be defined in builtins. Remember that
+# you should avoid to define new builtins when possible.
+additional-builtins=
+
+
+[FORMAT]
+
+# Maximum number of characters on a single line.
+max-line-length=79
+
+# Regexp for a line that is allowed to be longer than the limit.
+ignore-long-lines=^\s*(# )?<?https?://\S+>?$
+
+# Maximum number of lines in a module
+max-module-lines=1000
+
+# String used as indentation unit. This is usually " " (4 spaces) or "\t" (1
+# tab).
+indent-string=' '
+
+
+[TYPECHECK]
+
+# Tells whether missing members accessed in mixin class should be ignored. A
+# mixin class is detected if its name ends with "mixin" (case insensitive).
+ignore-mixin-members=yes
+
+# List of classes names for which member attributes should not be checked
+# (useful for classes with attributes dynamically set).
+ignored-classes=SQLObject
+
+# When zope mode is activated, add a predefined set of Zope acquired attributes
+# to generated-members.
+zope=no
+
+# List of members which are set dynamically and missed by pylint inference
+# system, and so shouldn't trigger E0201 when accessed. Python regular
+# expressions are accepted.
+generated-members=REQUEST,acl_users,aq_parent
+
+
+[CLASSES]
+
+# List of interface methods to ignore, separated by a comma. This is used for
+# instance to not check methods defines in Zope's Interface base class.
+ignore-iface-methods=isImplementedBy,deferred,extends,names,namesAndDescriptions,queryDescriptionFor,getBases,getDescriptionFor,getDoc,getName,getTaggedValue,getTaggedValueTags,isEqualOrExtendedBy,setTaggedValue,isImplementedByInstancesOf,adaptWith,is_implemented_by
+
+# List of method names used to declare (i.e. assign) instance attributes.
+defining-attr-methods=__init__,__new__,setUp
+
+# List of valid names for the first argument in a class method.
+valid-classmethod-first-arg=cls
+
+# List of valid names for the first argument in a metaclass class method.
+valid-metaclass-classmethod-first-arg=mcs
+
+
+[IMPORTS]
+
+# Deprecated modules which should not be used, separated by a comma
+deprecated-modules=regsub,TERMIOS,Bastion,rexec
+
+# Create a graph of every (i.e. internal and external) dependencies in the
+# given file (report RP0402 must not be disabled)
+import-graph=
+
+# Create a graph of external dependencies in the given file (report RP0402 must
+# not be disabled)
+ext-import-graph=
+
+# Create a graph of internal dependencies in the given file (report RP0402 must
+# not be disabled)
+int-import-graph=
+
+
+[DESIGN]
+
+# Maximum number of arguments for function / method
+max-args=5
+
+# Argument names that match this expression will be ignored. Default to name
+# with leading underscore
+ignored-argument-names=_.*
+
+# Maximum number of locals for function / method body
+max-locals=15
+
+# Maximum number of return / yield for function / method body
+max-returns=6
+
+# Maximum number of branch for function / method body
+max-branches=12
+
+# Maximum number of statements in function / method body
+max-statements=50
+
+# Maximum number of parents for a class (see R0901).
+max-parents=7
+
+# Maximum number of attributes for a class (see R0902).
+max-attributes=7
+
+# Minimum number of public methods for a class (see R0903).
+min-public-methods=2
+
+# Maximum number of public methods for a class (see R0904).
+max-public-methods=20
+
+
+[EXCEPTIONS]
+
+# Exceptions that will emit a warning when being caught. Defaults to
+# "Exception"
+overgeneral-exceptions=Exception
http://sourceware.org/git/gitweb.cgi?p=glibc.git;a=commitdiff;h=f7f684602ff498d9f81e07c5fe37338c8a806a81
commit f7f684602ff498d9f81e07c5fe37338c8a806a81
Author: Siddhesh Poyarekar <siddhesh@redhat.com>
Date: Tue Oct 8 16:36:19 2013 +0530
TMP: probes for math functions
Temporary probes at various branch points in the functions.
diff --git a/sysdeps/ieee754/dbl-64/e_asin.c b/sysdeps/ieee754/dbl-64/e_asin.c
index 5bb5aeb..d425fd7 100644
--- a/sysdeps/ieee754/dbl-64/e_asin.c
+++ b/sysdeps/ieee754/dbl-64/e_asin.c
@@ -40,17 +40,18 @@
#include "MathLib.h"
#include "uasncs.h"
#include <math_private.h>
+#include <stap-probe.h>
#ifndef SECTION
# define SECTION
#endif
-void __doasin(double x, double dx, double w[]);
-void __dubsin(double x, double dx, double v[]);
-void __dubcos(double x, double dx, double v[]);
-void __docos(double x, double dx, double v[]);
-double __sin32(double x, double res, double res1);
-double __cos32(double x, double res, double res1);
+void __doasin (double x, double dx, double w[]);
+void __dubsin (double x, double dx, double v[]);
+void __dubcos (double x, double dx, double v[]);
+void __docos (double x, double dx, double v[]);
+double __sin32 (double x, double res, double res1);
+double __cos32 (double x, double res, double res1);
/***************************************************************************/
/* An ultimate asin routine. Given an IEEE double machine number x */
@@ -58,584 +59,1044 @@ double __cos32(double x, double res, double res1);
/***************************************************************************/
double
SECTION
-__ieee754_asin(double x){
- double x1,x2,xx,s1,s2,res1,p,t,res,r,cor,cc,y,c,z,w[2];
- mynumber u,v;
- int4 k,m,n;
+__ieee754_asin (double x)
+{
+ double x1, x2, xx, s1, s2, res1, p, t, res, r, cor, cc, y, c, z, w[2];
+ mynumber u, v;
+ int4 k, m, n;
u.x = x;
m = u.i[HIGH_HALF];
- k = 0x7fffffff&m; /* no sign */
+ k = 0x7fffffff & m; /* no sign */
- if (k < 0x3e500000) return x; /* for x->0 => sin(x)=x */
+ if (k < 0x3e500000)
+ return x; /* for x->0 => sin(x)=x */
/*----------------------2^-26 <= |x| < 2^ -3 -----------------*/
- else
- if (k < 0x3fc00000) {
- x2 = x*x;
- t = (((((f6*x2 + f5)*x2 + f4)*x2 + f3)*x2 + f2)*x2 + f1)*(x2*x);
- res = x+t; /* res=arcsin(x) according to Taylor series */
- cor = (x-res)+t;
- if (res == res+1.025*cor) return res;
- else {
- x1 = x+big;
- xx = x*x;
- x1 -= big;
- x2 = x - x1;
- p = x1*x1*x1;
- s1 = a1.x*p;
- s2 = ((((((c7*xx + c6)*xx + c5)*xx + c4)*xx + c3)*xx + c2)*xx*xx*x +
- ((a1.x+a2.x)*x2*x2+ 0.5*x1*x)*x2) + a2.x*p;
- res1 = x+s1;
- s2 = ((x-res1)+s1)+s2;
- res = res1+s2;
- cor = (res1-res)+s2;
- if (res == res+1.00014*cor) return res;
- else {
- __doasin(x,0,w);
- if (w[0]==(w[0]+1.00000001*w[1])) return w[0];
- else {
- y=ABS(x);
- res=ABS(w[0]);
- res1=ABS(w[0]+1.1*w[1]);
- return (m>0)?__sin32(y,res,res1):-__sin32(y,res,res1);
- }
- }
+ else if (k < 0x3fc00000)
+ {
+ x2 = x * x;
+ t =
+ (((((f6 * x2 + f5) * x2 + f4) * x2 + f3) * x2 + f2) * x2 +
+ f1) * (x2 * x);
+ res = x + t; /* res=arcsin(x) according to Taylor series */
+ cor = (x - res) + t;
+ if (res == res + 1.025 * cor)
+ {
+ LIBC_PROBE (asin_probe, 2, 1, &x);
+ return res;
+ }
+ else
+ {
+ x1 = x + big;
+ xx = x * x;
+ x1 -= big;
+ x2 = x - x1;
+ p = x1 * x1 * x1;
+ s1 = a1.x * p;
+ s2 =
+ ((((((c7 * xx + c6) * xx + c5) * xx + c4) * xx + c3) * xx +
+ c2) * xx * xx * x + ((a1.x + a2.x) * x2 * x2 +
+ 0.5 * x1 * x) * x2) + a2.x * p;
+ res1 = x + s1;
+ s2 = ((x - res1) + s1) + s2;
+ res = res1 + s2;
+ cor = (res1 - res) + s2;
+ if (res == res + 1.00014 * cor)
+ {
+ LIBC_PROBE (asin_probe, 2, 2, &x);
+ return res;
+ }
+ else
+ {
+ __doasin (x, 0, w);
+ if (w[0] == (w[0] + 1.00000001 * w[1]))
+ {
+ LIBC_PROBE (asin_probe, 2, 3, &x);
+ return w[0];
+ }
+ else
+ {
+ y = ABS (x);
+ res = ABS (w[0]);
+ res1 = ABS (w[0] + 1.1 * w[1]);
+ return (m > 0) ? __sin32 (y, res, res1) : -__sin32 (y, res,
+ res1);
+ }
+ }
+ }
}
- }
/*---------------------0.125 <= |x| < 0.5 -----------------------------*/
- else if (k < 0x3fe00000) {
- if (k<0x3fd00000) n = 11*((k&0x000fffff)>>15);
- else n = 11*((k&0x000fffff)>>14)+352;
- if (m>0) xx = x - asncs.x[n];
- else xx = -x - asncs.x[n];
- t = asncs.x[n+1]*xx;
- p=xx*xx*(asncs.x[n+2]+xx*(asncs.x[n+3]+xx*(asncs.x[n+4]+xx*(asncs.x[n+5]
- +xx*asncs.x[n+6]))))+asncs.x[n+7];
- t+=p;
- res =asncs.x[n+8] +t;
- cor = (asncs.x[n+8]-res)+t;
- if (res == res+1.05*cor) return (m>0)?res:-res;
- else {
- r=asncs.x[n+8]+xx*asncs.x[n+9];
- t=((asncs.x[n+8]-r)+xx*asncs.x[n+9])+(p+xx*asncs.x[n+10]);
- res = r+t;
- cor = (r-res)+t;
- if (res == res+1.0005*cor) return (m>0)?res:-res;
- else {
- res1=res+1.1*cor;
- z=0.5*(res1-res);
- __dubsin(res,z,w);
- z=(w[0]-ABS(x))+w[1];
- if (z>1.0e-27) return (m>0)?min(res,res1):-min(res,res1);
- else if (z<-1.0e-27) return (m>0)?max(res,res1):-max(res,res1);
- else {
- y=ABS(x);
- return (m>0)?__sin32(y,res,res1):-__sin32(y,res,res1);
- }
- }
- }
- } /* else if (k < 0x3fe00000) */
+ else if (k < 0x3fe00000)
+ {
+ if (k < 0x3fd00000)
+ n = 11 * ((k & 0x000fffff) >> 15);
+ else
+ n = 11 * ((k & 0x000fffff) >> 14) + 352;
+ if (m > 0)
+ xx = x - asncs.x[n];
+ else
+ xx = -x - asncs.x[n];
+ t = asncs.x[n + 1] * xx;
+ p =
+ xx * xx * (asncs.x[n + 2] +
+ xx * (asncs.x[n + 3] +
+ xx * (asncs.x[n + 4] +
+ xx * (asncs.x[n + 5] +
+ xx * asncs.x[n + 6])))) + asncs.x[n + 7];
+ t += p;
+ res = asncs.x[n + 8] + t;
+ cor = (asncs.x[n + 8] - res) + t;
+ if (res == res + 1.05 * cor)
+{
+ LIBC_PROBE (asin_probe, 2, 4, &x);
+ return (m > 0) ? res : -res;
+ }
+ else
+ {
+ r = asncs.x[n + 8] + xx * asncs.x[n + 9];
+ t =
+ ((asncs.x[n + 8] - r) + xx * asncs.x[n + 9]) + (p +
+ xx * asncs.x[n +
+ 10]);
+ res = r + t;
+ cor = (r - res) + t;
+ if (res == res + 1.0005 * cor)
+ {
+ LIBC_PROBE (asin_probe, 2, 5, &x);
+ return (m > 0) ? res : -res;
+ }
+ else
+ {
+ res1 = res + 1.1 * cor;
+ z = 0.5 * (res1 - res);
+ __dubsin (res, z, w);
+ z = (w[0] - ABS (x)) + w[1];
+ if (z > 1.0e-27)
+ {
+ LIBC_PROBE (asin_probe, 2, 6, &x);
+ return (m > 0) ? min (res, res1) : -min (res, res1);
+ }
+ else if (z < -1.0e-27)
+ {
+ LIBC_PROBE (asin_probe, 2, 7, &x);
+ return (m > 0) ? max (res, res1) : -max (res, res1);
+ }
+ else
+ {
+ y = ABS (x);
+ return (m > 0) ? __sin32 (y, res, res1) : -__sin32 (y, res,
+ res1);
+ }
+ }
+ }
+ } /* else if (k < 0x3fe00000) */
/*-------------------- 0.5 <= |x| < 0.75 -----------------------------*/
- else
- if (k < 0x3fe80000) {
- n = 1056+((k&0x000fe000)>>11)*3;
- if (m>0) xx = x - asncs.x[n];
- else xx = -x - asncs.x[n];
- t = asncs.x[n+1]*xx;
- p=xx*xx*(asncs.x[n+2]+xx*(asncs.x[n+3]+xx*(asncs.x[n+4]+xx*(asncs.x[n+5]
- +xx*(asncs.x[n+6]+xx*asncs.x[n+7])))))+asncs.x[n+8];
- t+=p;
- res =asncs.x[n+9] +t;
- cor = (asncs.x[n+9]-res)+t;
- if (res == res+1.01*cor) return (m>0)?res:-res;
- else {
- r=asncs.x[n+9]+xx*asncs.x[n+10];
- t=((asncs.x[n+9]-r)+xx*asncs.x[n+10])+(p+xx*asncs.x[n+11]);
- res = r+t;
- cor = (r-res)+t;
- if (res == res+1.0005*cor) return (m>0)?res:-res;
- else {
- res1=res+1.1*cor;
- z=0.5*(res1-res);
- __dubsin(res,z,w);
- z=(w[0]-ABS(x))+w[1];
- if (z>1.0e-27) return (m>0)?min(res,res1):-min(res,res1);
- else if (z<-1.0e-27) return (m>0)?max(res,res1):-max(res,res1);
- else {
- y=ABS(x);
- return (m>0)?__sin32(y,res,res1):-__sin32(y,res,res1);
- }
- }
- }
- } /* else if (k < 0x3fe80000) */
+ else if (k < 0x3fe80000)
+ {
+ n = 1056 + ((k & 0x000fe000) >> 11) * 3;
+ if (m > 0)
+ xx = x - asncs.x[n];
+ else
+ xx = -x - asncs.x[n];
+ t = asncs.x[n + 1] * xx;
+ p =
+ xx * xx * (asncs.x[n + 2] +
+ xx * (asncs.x[n + 3] +
+ xx * (asncs.x[n + 4] +
+ xx * (asncs.x[n + 5] +
+ xx * (asncs.x[n + 6] +
+ xx * asncs.x[n + 7]))))) +
+ asncs.x[n + 8];
+ t += p;
+ res = asncs.x[n + 9] + t;
+ cor = (asncs.x[n + 9] - res) + t;
+ if (res == res + 1.01 * cor)
+ {
+ LIBC_PROBE (asin_probe, 2, 8, &x);
+ return (m > 0) ? res : -res;
+ }
+ else
+ {
+ r = asncs.x[n + 9] + xx * asncs.x[n + 10];
+ t =
+ ((asncs.x[n + 9] - r) + xx * asncs.x[n + 10]) + (p +
+ xx * asncs.x[n +
+ 11]);
+ res = r + t;
+ cor = (r - res) + t;
+ if (res == res + 1.0005 * cor)
+ {
+ LIBC_PROBE (asin_probe, 2, 9, &x);
+ return (m > 0) ? res : -res;
+ }
+ else
+ {
+ res1 = res + 1.1 * cor;
+ z = 0.5 * (res1 - res);
+ __dubsin (res, z, w);
+ z = (w[0] - ABS (x)) + w[1];
+ if (z > 1.0e-27)
+ {
+ LIBC_PROBE (asin_probe, 2, 10, &x);
+ return (m > 0) ? min (res, res1) : -min (res, res1);
+ }
+ else if (z < -1.0e-27)
+ {
+ LIBC_PROBE (asin_probe, 2, 11, &x);
+ return (m > 0) ? max (res, res1) : -max (res, res1);
+ }
+ else
+ {
+ y = ABS (x);
+ return (m > 0) ? __sin32 (y, res, res1) : -__sin32 (y, res,
+ res1);
+ }
+ }
+ }
+ } /* else if (k < 0x3fe80000) */
/*--------------------- 0.75 <= |x|< 0.921875 ----------------------*/
- else
- if (k < 0x3fed8000) {
- n = 992+((k&0x000fe000)>>13)*13;
- if (m>0) xx = x - asncs.x[n];
- else xx = -x - asncs.x[n];
- t = asncs.x[n+1]*xx;
- p=xx*xx*(asncs.x[n+2]+xx*(asncs.x[n+3]+xx*(asncs.x[n+4]+xx*(asncs.x[n+5]
- +xx*(asncs.x[n+6]+xx*(asncs.x[n+7]+xx*asncs.x[n+8]))))))+asncs.x[n+9];
- t+=p;
- res =asncs.x[n+10] +t;
- cor = (asncs.x[n+10]-res)+t;
- if (res == res+1.01*cor) return (m>0)?res:-res;
- else {
- r=asncs.x[n+10]+xx*asncs.x[n+11];
- t=((asncs.x[n+10]-r)+xx*asncs.x[n+11])+(p+xx*asncs.x[n+12]);
- res = r+t;
- cor = (r-res)+t;
- if (res == res+1.0008*cor) return (m>0)?res:-res;
- else {
- res1=res+1.1*cor;
- z=0.5*(res1-res);
- y=hp0.x-res;
- z=((hp0.x-y)-res)+(hp1.x-z);
- __dubcos(y,z,w);
- z=(w[0]-ABS(x))+w[1];
- if (z>1.0e-27) return (m>0)?min(res,res1):-min(res,res1);
- else if (z<-1.0e-27) return (m>0)?max(res,res1):-max(res,res1);
- else {
- y=ABS(x);
- return (m>0)?__sin32(y,res,res1):-__sin32(y,res,res1);
- }
- }
- }
- } /* else if (k < 0x3fed8000) */
+ else if (k < 0x3fed8000)
+ {
+ n = 992 + ((k & 0x000fe000) >> 13) * 13;
+ if (m > 0)
+ xx = x - asncs.x[n];
+ else
+ xx = -x - asncs.x[n];
+ t = asncs.x[n + 1] * xx;
+ p =
+ xx * xx * (asncs.x[n + 2] +
+ xx * (asncs.x[n + 3] +
+ xx * (asncs.x[n + 4] +
+ xx * (asncs.x[n + 5] +
+ xx * (asncs.x[n + 6] +
+ xx * (asncs.x[n + 7] +
+ xx * asncs.x[n + 8])))))) +
+ asncs.x[n + 9];
+ t += p;
+ res = asncs.x[n + 10] + t;
+ cor = (asncs.x[n + 10] - res) + t;
+ if (res == res + 1.01 * cor)
+ {
+ LIBC_PROBE (asin_probe, 2, 12, &x);
+ return (m > 0) ? res : -res;
+ }
+ else
+ {
+ r = asncs.x[n + 10] + xx * asncs.x[n + 11];
+ t =
+ ((asncs.x[n + 10] - r) + xx * asncs.x[n + 11]) + (p +
+ xx * asncs.x[n +
+ 12]);
+ res = r + t;
+ cor = (r - res) + t;
+ if (res == res + 1.0008 * cor)
+ {
+ LIBC_PROBE (asin_probe, 2, 13, &x);
+ return (m > 0) ? res : -res;
+ }
+ else
+ {
+ res1 = res + 1.1 * cor;
+ z = 0.5 * (res1 - res);
+ y = hp0.x - res;
+ z = ((hp0.x - y) - res) + (hp1.x - z);
+ __dubcos (y, z, w);
+ z = (w[0] - ABS (x)) + w[1];
+ if (z > 1.0e-27)
+ {
+ LIBC_PROBE (asin_probe, 2, 14, &x);
+ return (m > 0) ? min (res, res1) : -min (res, res1);
+ }
+ else if (z < -1.0e-27)
+ {
+ LIBC_PROBE (asin_probe, 2, 15, &x);
+ return (m > 0) ? max (res, res1) : -max (res, res1);
+ }
+ else
+ {
+ y = ABS (x);
+ return (m > 0) ? __sin32 (y, res, res1) : -__sin32 (y, res,
+ res1);
+ }
+ }
+ }
+ } /* else if (k < 0x3fed8000) */
/*-------------------0.921875 <= |x| < 0.953125 ------------------------*/
- else
- if (k < 0x3fee8000) {
- n = 884+((k&0x000fe000)>>13)*14;
- if (m>0) xx = x - asncs.x[n];
- else xx = -x - asncs.x[n];
- t = asncs.x[n+1]*xx;
- p=xx*xx*(asncs.x[n+2]+xx*(asncs.x[n+3]+xx*(asncs.x[n+4]+
- xx*(asncs.x[n+5]+xx*(asncs.x[n+6]
- +xx*(asncs.x[n+7]+xx*(asncs.x[n+8]+
- xx*asncs.x[n+9])))))))+asncs.x[n+10];
- t+=p;
- res =asncs.x[n+11] +t;
- cor = (asncs.x[n+11]-res)+t;
- if (res == res+1.01*cor) return (m>0)?res:-res;
- else {
- r=asncs.x[n+11]+xx*asncs.x[n+12];
- t=((asncs.x[n+11]-r)+xx*asncs.x[n+12])+(p+xx*asncs.x[n+13]);
- res = r+t;
- cor = (r-res)+t;
- if (res == res+1.0007*cor) return (m>0)?res:-res;
- else {
- res1=res+1.1*cor;
- z=0.5*(res1-res);
- y=(hp0.x-res)-z;
- z=y+hp1.x;
- y=(y-z)+hp1.x;
- __dubcos(z,y,w);
- z=(w[0]-ABS(x))+w[1];
- if (z>1.0e-27) return (m>0)?min(res,res1):-min(res,res1);
- else if (z<-1.0e-27) return (m>0)?max(res,res1):-max(res,res1);
- else {
- y=ABS(x);
- return (m>0)?__sin32(y,res,res1):-__sin32(y,res,res1);
- }
- }
- }
- } /* else if (k < 0x3fee8000) */
+ else if (k < 0x3fee8000)
+ {
+ n = 884 + ((k & 0x000fe000) >> 13) * 14;
+ if (m > 0)
+ xx = x - asncs.x[n];
+ else
+ xx = -x - asncs.x[n];
+ t = asncs.x[n + 1] * xx;
+ p =
+ xx * xx * (asncs.x[n + 2] +
+ xx * (asncs.x[n + 3] +
+ xx * (asncs.x[n + 4] +
+ xx * (asncs.x[n + 5] +
+ xx * (asncs.x[n + 6] +
+ xx * (asncs.x[n + 7] +
+ xx * (asncs.x[n + 8] +
+ xx * asncs.x[n +
+ 9])))))))
+ + asncs.x[n + 10];
+ t += p;
+ res = asncs.x[n + 11] + t;
+ cor = (asncs.x[n + 11] - res) + t;
+ if (res == res + 1.01 * cor)
+ {
+ LIBC_PROBE (asin_probe, 2, 16, &x);
+ return (m > 0) ? res : -res;
+ }
+ else
+ {
+ r = asncs.x[n + 11] + xx * asncs.x[n + 12];
+ t =
+ ((asncs.x[n + 11] - r) + xx * asncs.x[n + 12]) + (p +
+ xx * asncs.x[n +
+ 13]);
+ res = r + t;
+ cor = (r - res) + t;
+ if (res == res + 1.0007 * cor)
+ {
+ LIBC_PROBE (asin_probe, 2, 17, &x);
+ return (m > 0) ? res : -res;
+ }
+ else
+ {
+ res1 = res + 1.1 * cor;
+ z = 0.5 * (res1 - res);
+ y = (hp0.x - res) - z;
+ z = y + hp1.x;
+ y = (y - z) + hp1.x;
+ __dubcos (z, y, w);
+ z = (w[0] - ABS (x)) + w[1];
+ if (z > 1.0e-27)
+ {
+ LIBC_PROBE (asin_probe, 2, 18, &x);
+ return (m > 0) ? min (res, res1) : -min (res, res1);
+ }
+ else if (z < -1.0e-27)
+ {
+ LIBC_PROBE (asin_probe, 2, 19, &x);
+ return (m > 0) ? max (res, res1) : -max (res, res1);
+ }
+ else
+ {
+ y = ABS (x);
+ return (m > 0) ? __sin32 (y, res, res1) : -__sin32 (y, res,
+ res1);
+ }
+ }
+ }
+ } /* else if (k < 0x3fee8000) */
/*--------------------0.953125 <= |x| < 0.96875 ------------------------*/
- else
- if (k < 0x3fef0000) {
- n = 768+((k&0x000fe000)>>13)*15;
- if (m>0) xx = x - asncs.x[n];
- else xx = -x - asncs.x[n];
- t = asncs.x[n+1]*xx;
- p=xx*xx*(asncs.x[n+2]+xx*(asncs.x[n+3]+xx*(asncs.x[n+4]+
- xx*(asncs.x[n+5]+xx*(asncs.x[n+6]
- +xx*(asncs.x[n+7]+xx*(asncs.x[n+8]+
- xx*(asncs.x[n+9]+xx*asncs.x[n+10]))))))))+asncs.x[n+11];
- t+=p;
- res =asncs.x[n+12] +t;
- cor = (asncs.x[n+12]-res)+t;
- if (res == res+1.01*cor) return (m>0)?res:-res;
- else {
- r=asncs.x[n+12]+xx*asncs.x[n+13];
- t=((asncs.x[n+12]-r)+xx*asncs.x[n+13])+(p+xx*asncs.x[n+14]);
- res = r+t;
- cor = (r-res)+t;
- if (res == res+1.0007*cor) return (m>0)?res:-res;
- else {
- res1=res+1.1*cor;
- z=0.5*(res1-res);
- y=(hp0.x-res)-z;
- z=y+hp1.x;
- y=(y-z)+hp1.x;
- __dubcos(z,y,w);
- z=(w[0]-ABS(x))+w[1];
- if (z>1.0e-27) return (m>0)?min(res,res1):-min(res,res1);
- else if (z<-1.0e-27) return (m>0)?max(res,res1):-max(res,res1);
- else {
- y=ABS(x);
- return (m>0)?__sin32(y,res,res1):-__sin32(y,res,res1);
- }
- }
- }
- } /* else if (k < 0x3fef0000) */
+ else if (k < 0x3fef0000)
+ {
+ n = 768 + ((k & 0x000fe000) >> 13) * 15;
+ if (m > 0)
+ xx = x - asncs.x[n];
+ else
+ xx = -x - asncs.x[n];
+ t = asncs.x[n + 1] * xx;
+ p =
+ xx * xx * (asncs.x[n + 2] +
+ xx * (asncs.x[n + 3] +
+ xx * (asncs.x[n + 4] +
+ xx * (asncs.x[n + 5] +
+ xx * (asncs.x[n + 6] +
+ xx * (asncs.x[n + 7] +
+ xx * (asncs.x[n + 8] +
+ xx * (asncs.x[n + 9] +
+ xx * asncs.x[n +
+ 10]))))))))
+ + asncs.x[n + 11];
+ t += p;
+ res = asncs.x[n + 12] + t;
+ cor = (asncs.x[n + 12] - res) + t;
+ if (res == res + 1.01 * cor)
+ {
+ LIBC_PROBE (asin_probe, 2, 20, &x);
+ return (m > 0) ? res : -res;
+ }
+ else
+ {
+ r = asncs.x[n + 12] + xx * asncs.x[n + 13];
+ t =
+ ((asncs.x[n + 12] - r) + xx * asncs.x[n + 13]) + (p +
+ xx * asncs.x[n +
+ 14]);
+ res = r + t;
+ cor = (r - res) + t;
+ if (res == res + 1.0007 * cor)
+ {
+ LIBC_PROBE (asin_probe, 2, 21, &x);
+ return (m > 0) ? res : -res;
+ }
+ else
+ {
+ res1 = res + 1.1 * cor;
+ z = 0.5 * (res1 - res);
+ y = (hp0.x - res) - z;
+ z = y + hp1.x;
+ y = (y - z) + hp1.x;
+ __dubcos (z, y, w);
+ z = (w[0] - ABS (x)) + w[1];
+ if (z > 1.0e-27)
+ {
+ LIBC_PROBE (asin_probe, 2, 22, &x);
+ return (m > 0) ? min (res, res1) : -min (res, res1);
+ }
+ else if (z < -1.0e-27)
+ {
+ LIBC_PROBE (asin_probe, 2, 23, &x);
+ return (m > 0) ? max (res, res1) : -max (res, res1);
+ }
+ else
+ {
+ y = ABS (x);
+ return (m > 0) ? __sin32 (y, res, res1) : -__sin32 (y, res,
+ res1);
+ }
+ }
+ }
+ } /* else if (k < 0x3fef0000) */
/*--------------------0.96875 <= |x| < 1 --------------------------------*/
- else
- if (k<0x3ff00000) {
- z = 0.5*((m>0)?(1.0-x):(1.0+x));
- v.x=z;
- k=v.i[HIGH_HALF];
- t=inroot[(k&0x001fffff)>>14]*powtwo[511-(k>>21)];
- r=1.0-t*t*z;
- t = t*(rt0+r*(rt1+r*(rt2+r*rt3)));
- c=t*z;
- t=c*(1.5-0.5*t*c);
- y=(c+t24)-t24;
- cc = (z-y*y)/(t+y);
- p=(((((f6*z+f5)*z+f4)*z+f3)*z+f2)*z+f1)*z;
- cor = (hp1.x - 2.0*cc)-2.0*(y+cc)*p;
- res1 = hp0.x - 2.0*y;
- res =res1 + cor;
- if (res == res+1.003*((res1-res)+cor)) return (m>0)?res:-res;
- else {
- c=y+cc;
- cc=(y-c)+cc;
- __doasin(c,cc,w);
- res1=hp0.x-2.0*w[0];
- cor=((hp0.x-res1)-2.0*w[0])+(hp1.x-2.0*w[1]);
- res = res1+cor;
- cor = (res1-res)+cor;
- if (res==(res+1.0000001*cor)) return (m>0)?res:-res;
- else {
- y=ABS(x);
- res1=res+1.1*cor;
- return (m>0)?__sin32(y,res,res1):-__sin32(y,res,res1);
- }
- }
- } /* else if (k < 0x3ff00000) */
+ else if (k < 0x3ff00000)
+ {
+ z = 0.5 * ((m > 0) ? (1.0 - x) : (1.0 + x));
+ v.x = z;
+ k = v.i[HIGH_HALF];
+ t = inroot[(k & 0x001fffff) >> 14] * powtwo[511 - (k >> 21)];
+ r = 1.0 - t * t * z;
+ t = t * (rt0 + r * (rt1 + r * (rt2 + r * rt3)));
+ c = t * z;
+ t = c * (1.5 - 0.5 * t * c);
+ y = (c + t24) - t24;
+ cc = (z - y * y) / (t + y);
+ p = (((((f6 * z + f5) * z + f4) * z + f3) * z + f2) * z + f1) * z;
+ cor = (hp1.x - 2.0 * cc) - 2.0 * (y + cc) * p;
+ res1 = hp0.x - 2.0 * y;
+ res = res1 + cor;
+ if (res == res + 1.003 * ((res1 - res) + cor))
+ {
+ LIBC_PROBE (asin_probe, 2, 24, &x);
+ return (m > 0) ? res : -res;
+ }
+ else
+ {
+ c = y + cc;
+ cc = (y - c) + cc;
+ __doasin (c, cc, w);
+ res1 = hp0.x - 2.0 * w[0];
+ cor = ((hp0.x - res1) - 2.0 * w[0]) + (hp1.x - 2.0 * w[1]);
+ res = res1 + cor;
+ cor = (res1 - res) + cor;
+ if (res == (res + 1.0000001 * cor))
+ {
+ LIBC_PROBE (asin_probe, 2, 25, &x);
+ return (m > 0) ? res : -res;
+ }
+ else
+ {
+ y = ABS (x);
+ res1 = res + 1.1 * cor;
+ return (m > 0) ? __sin32 (y, res, res1) : -__sin32 (y, res,
+ res1);
+ }
+ }
+ } /* else if (k < 0x3ff00000) */
/*---------------------------- |x|>=1 -------------------------------*/
- else if (k==0x3ff00000 && u.i[LOW_HALF]==0) return (m>0)?hp0.x:-hp0.x;
+ else if (k == 0x3ff00000 && u.i[LOW_HALF] == 0)
+ return (m > 0) ? hp0.x : -hp0.x;
+ else if (k > 0x7ff00000 || (k == 0x7ff00000 && u.i[LOW_HALF] != 0))
+ return x;
else
- if (k>0x7ff00000 || (k == 0x7ff00000 && u.i[LOW_HALF] != 0)) return x;
- else {
- u.i[HIGH_HALF]=0x7ff00000;
- v.i[HIGH_HALF]=0x7ff00000;
- u.i[LOW_HALF]=0;
- v.i[LOW_HALF]=0;
- return u.x/v.x; /* NaN */
- }
+ {
+ u.i[HIGH_HALF] = 0x7ff00000;
+ v.i[HIGH_HALF] = 0x7ff00000;
+ u.i[LOW_HALF] = 0;
+ v.i[LOW_HALF] = 0;
+ return u.x / v.x; /* NaN */
+ }
}
+
#ifndef __ieee754_asin
strong_alias (__ieee754_asin, __asin_finite)
#endif
-
/*******************************************************************/
/* */
/* End of arcsine, below is arccosine */
/* */
/*******************************************************************/
-
double
SECTION
-__ieee754_acos(double x)
+__ieee754_acos (double x)
{
- double x1,x2,xx,s1,s2,res1,p,t,res,r,cor,cc,y,c,z,w[2],eps;
- mynumber u,v;
- int4 k,m,n;
+ double x1, x2, xx, s1, s2, res1, p, t, res, r, cor, cc, y, c, z, w[2], eps;
+ mynumber u, v;
+ int4 k, m, n;
u.x = x;
m = u.i[HIGH_HALF];
- k = 0x7fffffff&m;
+ k = 0x7fffffff & m;
/*------------------- |x|<2.77556*10^-17 ----------------------*/
- if (k < 0x3c880000) return hp0.x;
+ if (k < 0x3c880000)
+ return hp0.x;
/*----------------- 2.77556*10^-17 <= |x| < 2^-3 --------------*/
- else
- if (k < 0x3fc00000) {
- x2 = x*x;
- t = (((((f6*x2 + f5)*x2 + f4)*x2 + f3)*x2 + f2)*x2 + f1)*(x2*x);
- r=hp0.x-x;
- cor=(((hp0.x-r)-x)+hp1.x)-t;
- res = r+cor;
- cor = (r-res)+cor;
- if (res == res+1.004*cor) return res;
- else {
- x1 = x+big;
- xx = x*x;
- x1 -= big;
- x2 = x - x1;
- p = x1*x1*x1;
- s1 = a1.x*p;
- s2 = ((((((c7*xx + c6)*xx + c5)*xx + c4)*xx + c3)*xx + c2)*xx*xx*x +
- ((a1.x+a2.x)*x2*x2+ 0.5*x1*x)*x2) + a2.x*p;
- res1 = x+s1;
- s2 = ((x-res1)+s1)+s2;
- r=hp0.x-res1;
- cor=(((hp0.x-r)-res1)+hp1.x)-s2;
- res = r+cor;
- cor = (r-res)+cor;
- if (res == res+1.00004*cor) return res;
- else {
- __doasin(x,0,w);
- r=hp0.x-w[0];
- cor=((hp0.x-r)-w[0])+(hp1.x-w[1]);
- res=r+cor;
- cor=(r-res)+cor;
- if (res ==(res +1.00000001*cor)) return res;
- else {
- res1=res+1.1*cor;
- return __cos32(x,res,res1);
- }
- }
- }
- } /* else if (k < 0x3fc00000) */
+ else if (k < 0x3fc00000)
+ {
+ x2 = x * x;
+ t =
+ (((((f6 * x2 + f5) * x2 + f4) * x2 + f3) * x2 + f2) * x2 +
+ f1) * (x2 * x);
+ r = hp0.x - x;
+ cor = (((hp0.x - r) - x) + hp1.x) - t;
+ res = r + cor;
+ cor = (r - res) + cor;
+ if (res == res + 1.004 * cor)
+ {
+ LIBC_PROBE (acos_probe, 2, 1, &x);
+ return res;
+ }
+ else
+ {
+ x1 = x + big;
+ xx = x * x;
+ x1 -= big;
+ x2 = x - x1;
+ p = x1 * x1 * x1;
+ s1 = a1.x * p;
+ s2 =
+ ((((((c7 * xx + c6) * xx + c5) * xx + c4) * xx + c3) * xx +
+ c2) * xx * xx * x + ((a1.x + a2.x) * x2 * x2 +
+ 0.5 * x1 * x) * x2) + a2.x * p;
+ res1 = x + s1;
+ s2 = ((x - res1) + s1) + s2;
+ r = hp0.x - res1;
+ cor = (((hp0.x - r) - res1) + hp1.x) - s2;
+ res = r + cor;
+ cor = (r - res) + cor;
+ if (res == res + 1.00004 * cor)
+ {
+ LIBC_PROBE (acos_probe, 2, 2, &x);
+ return res;
+ }
+ else
+ {
+ __doasin (x, 0, w);
+ r = hp0.x - w[0];
+ cor = ((hp0.x - r) - w[0]) + (hp1.x - w[1]);
+ res = r + cor;
+ cor = (r - res) + cor;
+ if (res == (res + 1.00000001 * cor))
+ {
+ LIBC_PROBE (acos_probe, 2, 3, &x);
+ return res;
+ }
+ else
+ {
+ res1 = res + 1.1 * cor;
+ return __cos32 (x, res, res1);
+ }
+ }
+ }
+ } /* else if (k < 0x3fc00000) */
/*---------------------- 0.125 <= |x| < 0.5 --------------------*/
- else
- if (k < 0x3fe00000) {
- if (k<0x3fd00000) n = 11*((k&0x000fffff)>>15);
- else n = 11*((k&0x000fffff)>>14)+352;
- if (m>0) xx = x - asncs.x[n];
- else xx = -x - asncs.x[n];
- t = asncs.x[n+1]*xx;
- p=xx*xx*(asncs.x[n+2]+xx*(asncs.x[n+3]+xx*(asncs.x[n+4]+
- xx*(asncs.x[n+5]+xx*asncs.x[n+6]))))+asncs.x[n+7];
- t+=p;
- y = (m>0)?(hp0.x-asncs.x[n+8]):(hp0.x+asncs.x[n+8]);
- t = (m>0)?(hp1.x-t):(hp1.x+t);
- res = y+t;
- if (res == res+1.02*((y-res)+t)) return res;
- else {
- r=asncs.x[n+8]+xx*asncs.x[n+9];
- t=((asncs.x[n+8]-r)+xx*asncs.x[n+9])+(p+xx*asncs.x[n+10]);
- if (m>0)
- {p = hp0.x-r; t = (((hp0.x-p)-r)-t)+hp1.x; }
+ else if (k < 0x3fe00000)
+ {
+ if (k < 0x3fd00000)
+ n = 11 * ((k & 0x000fffff) >> 15);
else
- {p = hp0.x+r; t = ((hp0.x-p)+r)+(hp1.x+t); }
- res = p+t;
- cor = (p-res)+t;
- if (res == (res+1.0002*cor)) return res;
- else {
- res1=res+1.1*cor;
- z=0.5*(res1-res);
- __docos(res,z,w);
- z=(w[0]-x)+w[1];
- if (z>1.0e-27) return max(res,res1);
- else if (z<-1.0e-27) return min(res,res1);
- else return __cos32(x,res,res1);
- }
- }
- } /* else if (k < 0x3fe00000) */
+ n = 11 * ((k & 0x000fffff) >> 14) + 352;
+ if (m > 0)
+ xx = x - asncs.x[n];
+ else
+ xx = -x - asncs.x[n];
+ t = asncs.x[n + 1] * xx;
+ p =
+ xx * xx * (asncs.x[n + 2] +
+ xx * (asncs.x[n + 3] +
+ xx * (asncs.x[n + 4] +
+ xx * (asncs.x[n + 5] +
+ xx * asncs.x[n + 6])))) + asncs.x[n + 7];
+ t += p;
+ y = (m > 0) ? (hp0.x - asncs.x[n + 8]) : (hp0.x + asncs.x[n + 8]);
+ t = (m > 0) ? (hp1.x - t) : (hp1.x + t);
+ res = y + t;
+ if (res == res + 1.02 * ((y - res) + t))
+ {
+ LIBC_PROBE (acos_probe, 2, 4, &x);
+ return res;
+ }
+ else
+ {
+ r = asncs.x[n + 8] + xx * asncs.x[n + 9];
+ t =
+ ((asncs.x[n + 8] - r) + xx * asncs.x[n + 9]) + (p +
+ xx * asncs.x[n +
+ 10]);
+ if (m > 0)
+ {
+ p = hp0.x - r;
+ t = (((hp0.x - p) - r) - t) + hp1.x;
+ }
+ else
+ {
+ p = hp0.x + r;
+ t = ((hp0.x - p) + r) + (hp1.x + t);
+ }
+ res = p + t;
+ cor = (p - res) + t;
+ if (res == (res + 1.0002 * cor))
+ {
+ LIBC_PROBE (acos_probe, 2, 5, &x);
+ return res;
+ }
+ else
+ {
+ res1 = res + 1.1 * cor;
+ z = 0.5 * (res1 - res);
+ __docos (res, z, w);
+ z = (w[0] - x) + w[1];
+ if (z > 1.0e-27)
+ {
+ LIBC_PROBE (acos_probe, 2, 6, &x);
+ return max (res, res1);
+ }
+ else if (z < -1.0e-27)
+ {
+ LIBC_PROBE (acos_probe, 2, 7, &x);
+ return min (res, res1);
+ }
+ else
+ return __cos32 (x, res, res1);
+ }
+ }
+ } /* else if (k < 0x3fe00000) */
/*--------------------------- 0.5 <= |x| < 0.75 ---------------------*/
- else
- if (k < 0x3fe80000) {
- n = 1056+((k&0x000fe000)>>11)*3;
- if (m>0) {xx = x - asncs.x[n]; eps=1.04; }
- else {xx = -x - asncs.x[n]; eps=1.02; }
- t = asncs.x[n+1]*xx;
- p=xx*xx*(asncs.x[n+2]+xx*(asncs.x[n+3]+xx*(asncs.x[n+4]+
- xx*(asncs.x[n+5]+xx*(asncs.x[n+6]+
- xx*asncs.x[n+7])))))+asncs.x[n+8];
- t+=p;
- y = (m>0)?(hp0.x-asncs.x[n+9]):(hp0.x+asncs.x[n+9]);
- t = (m>0)?(hp1.x-t):(hp1.x+t);
- res = y+t;
- if (res == res+eps*((y-res)+t)) return res;
- else {
- r=asncs.x[n+9]+xx*asncs.x[n+10];
- t=((asncs.x[n+9]-r)+xx*asncs.x[n+10])+(p+xx*asncs.x[n+11]);
- if (m>0) {p = hp0.x-r; t = (((hp0.x-p)-r)-t)+hp1.x; eps=1.0004; }
- else {p = hp0.x+r; t = ((hp0.x-p)+r)+(hp1.x+t); eps=1.0002; }
- res = p+t;
- cor = (p-res)+t;
- if (res == (res+eps*cor)) return res;
- else {
- res1=res+1.1*cor;
- z=0.5*(res1-res);
- __docos(res,z,w);
- z=(w[0]-x)+w[1];
- if (z>1.0e-27) return max(res,res1);
- else if (z<-1.0e-27) return min(res,res1);
- else return __cos32(x,res,res1);
- }
- }
- } /* else if (k < 0x3fe80000) */
+ else if (k < 0x3fe80000)
+ {
+ n = 1056 + ((k & 0x000fe000) >> 11) * 3;
+ if (m > 0)
+ {
+ xx = x - asncs.x[n];
+ eps = 1.04;
+ }
+ else
+ {
+ xx = -x - asncs.x[n];
+ eps = 1.02;
+ }
+ t = asncs.x[n + 1] * xx;
+ p =
+ xx * xx * (asncs.x[n + 2] +
+ xx * (asncs.x[n + 3] +
+ xx * (asncs.x[n + 4] +
+ xx * (asncs.x[n + 5] +
+ xx * (asncs.x[n + 6] +
+ xx * asncs.x[n + 7]))))) +
+ asncs.x[n + 8];
+ t += p;
+ y = (m > 0) ? (hp0.x - asncs.x[n + 9]) : (hp0.x + asncs.x[n + 9]);
+ t = (m > 0) ? (hp1.x - t) : (hp1.x + t);
+ res = y + t;
+ if (res == res + eps * ((y - res) + t))
+ {
+ LIBC_PROBE (acos_probe, 2, 8, &x);
+ return res;
+ }
+ else
+ {
+ r = asncs.x[n + 9] + xx * asncs.x[n + 10];
+ t =
+ ((asncs.x[n + 9] - r) + xx * asncs.x[n + 10]) + (p +
+ xx * asncs.x[n +
+ 11]);
+ if (m > 0)
+ {
+ p = hp0.x - r;
+ t = (((hp0.x - p) - r) - t) + hp1.x;
+ eps = 1.0004;
+ }
+ else
+ {
+ p = hp0.x + r;
+ t = ((hp0.x - p) + r) + (hp1.x + t);
+ eps = 1.0002;
+ }
+ res = p + t;
+ cor = (p - res) + t;
+ if (res == (res + eps * cor))
+ {
+ LIBC_PROBE (acos_probe, 2, 9, &x);
+ return res;
+ }
+ else
+ {
+ res1 = res + 1.1 * cor;
+ z = 0.5 * (res1 - res);
+ __docos (res, z, w);
+ z = (w[0] - x) + w[1];
+ if (z > 1.0e-27)
+ {
+ LIBC_PROBE (acos_probe, 2, 10, &x);
+ return max (res, res1);
+ }
+ else if (z < -1.0e-27)
+ {
+ LIBC_PROBE (acos_probe, 2, 11, &x);
+ return min (res, res1);
+ }
+ else
+ return __cos32 (x, res, res1);
+ }
+ }
+ } /* else if (k < 0x3fe80000) */
/*------------------------- 0.75 <= |x| < 0.921875 -------------*/
- else
- if (k < 0x3fed8000) {
- n = 992+((k&0x000fe000)>>13)*13;
- if (m>0) {xx = x - asncs.x[n]; eps = 1.04; }
- else {xx = -x - asncs.x[n]; eps = 1.01; }
- t = asncs.x[n+1]*xx;
- p=xx*xx*(asncs.x[n+2]+xx*(asncs.x[n+3]+xx*(asncs.x[n+4]+
- xx*(asncs.x[n+5]+xx*(asncs.x[n+6]+xx*(asncs.x[n+7]+
- xx*asncs.x[n+8]))))))+asncs.x[n+9];
- t+=p;
- y = (m>0)?(hp0.x-asncs.x[n+10]):(hp0.x+asncs.x[n+10]);
- t = (m>0)?(hp1.x-t):(hp1.x+t);
- res = y+t;
- if (res == res+eps*((y-res)+t)) return res;
- else {
- r=asncs.x[n+10]+xx*asncs.x[n+11];
- t=((asncs.x[n+10]-r)+xx*asncs.x[n+11])+(p+xx*asncs.x[n+12]);
- if (m>0) {p = hp0.x-r; t = (((hp0.x-p)-r)-t)+hp1.x; eps=1.0032; }
- else {p = hp0.x+r; t = ((hp0.x-p)+r)+(hp1.x+t); eps=1.0008; }
- res = p+t;
- cor = (p-res)+t;
- if (res == (res+eps*cor)) return res;
- else {
- res1=res+1.1*cor;
- z=0.5*(res1-res);
- __docos(res,z,w);
- z=(w[0]-x)+w[1];
- if (z>1.0e-27) return max(res,res1);
- else if (z<-1.0e-27) return min(res,res1);
- else return __cos32(x,res,res1);
- }
- }
- } /* else if (k < 0x3fed8000) */
+ else if (k < 0x3fed8000)
+ {
+ n = 992 + ((k & 0x000fe000) >> 13) * 13;
+ if (m > 0)
+ {
+ xx = x - asncs.x[n];
+ eps = 1.04;
+ }
+ else
+ {
+ xx = -x - asncs.x[n];
+ eps = 1.01;
+ }
+ t = asncs.x[n + 1] * xx;
+ p =
+ xx * xx * (asncs.x[n + 2] +
+ xx * (asncs.x[n + 3] +
+ xx * (asncs.x[n + 4] +
+ xx * (asncs.x[n + 5] +
+ xx * (asncs.x[n + 6] +
+ xx * (asncs.x[n + 7] +
+ xx * asncs.x[n + 8])))))) +
+ asncs.x[n + 9];
+ t += p;
+ y = (m > 0) ? (hp0.x - asncs.x[n + 10]) : (hp0.x + asncs.x[n + 10]);
+ t = (m > 0) ? (hp1.x - t) : (hp1.x + t);
+ res = y + t;
+ if (res == res + eps * ((y - res) + t))
+ {
+ LIBC_PROBE (acos_probe, 2, 12, &x);
+ return res;
+ }
+ else
+ {
+ r = asncs.x[n + 10] + xx * asncs.x[n + 11];
+ t =
+ ((asncs.x[n + 10] - r) + xx * asncs.x[n + 11]) + (p +
+ xx * asncs.x[n +
+ 12]);
+ if (m > 0)
+ {
+ p = hp0.x - r;
+ t = (((hp0.x - p) - r) - t) + hp1.x;
+ eps = 1.0032;
+ }
+ else
+ {
+ p = hp0.x + r;
+ t = ((hp0.x - p) + r) + (hp1.x + t);
+ eps = 1.0008;
+ }
+ res = p + t;
+ cor = (p - res) + t;
+ if (res == (res + eps * cor))
+ {
+ LIBC_PROBE (acos_probe, 2, 13, &x);
+ return res;
+ }
+ else
+ {
+ res1 = res + 1.1 * cor;
+ z = 0.5 * (res1 - res);
+ __docos (res, z, w);
+ z = (w[0] - x) + w[1];
+ if (z > 1.0e-27)
+ {
+ LIBC_PROBE (acos_probe, 2, 14, &x);
+ return max (res, res1);
+ }
+ else if (z < -1.0e-27)
+ {
+ LIBC_PROBE (acos_probe, 2, 15, &x);
+ return min (res, res1);
+ }
+ else
+ return __cos32 (x, res, res1);
+ }
+ }
+ } /* else if (k < 0x3fed8000) */
/*-------------------0.921875 <= |x| < 0.953125 ------------------*/
- else
- if (k < 0x3fee8000) {
- n = 884+((k&0x000fe000)>>13)*14;
- if (m>0) {xx = x - asncs.x[n]; eps=1.04; }
- else {xx = -x - asncs.x[n]; eps =1.005; }
- t = asncs.x[n+1]*xx;
- p=xx*xx*(asncs.x[n+2]+xx*(asncs.x[n+3]+xx*(asncs.x[n+4]+
- xx*(asncs.x[n+5]+xx*(asncs.x[n+6]
- +xx*(asncs.x[n+7]+xx*(asncs.x[n+8]+
- xx*asncs.x[n+9])))))))+asncs.x[n+10];
- t+=p;
- y = (m>0)?(hp0.x-asncs.x[n+11]):(hp0.x+asncs.x[n+11]);
- t = (m>0)?(hp1.x-t):(hp1.x+t);
- res = y+t;
- if (res == res+eps*((y-res)+t)) return res;
- else {
- r=asncs.x[n+11]+xx*asncs.x[n+12];
- t=((asncs.x[n+11]-r)+xx*asncs.x[n+12])+(p+xx*asncs.x[n+13]);
- if (m>0) {p = hp0.x-r; t = (((hp0.x-p)-r)-t)+hp1.x; eps=1.0030; }
- else {p = hp0.x+r; t = ((hp0.x-p)+r)+(hp1.x+t); eps=1.0005; }
- res = p+t;
- cor = (p-res)+t;
- if (res == (res+eps*cor)) return res;
- else {
- res1=res+1.1*cor;
- z=0.5*(res1-res);
- __docos(res,z,w);
- z=(w[0]-x)+w[1];
- if (z>1.0e-27) return max(res,res1);
- else if (z<-1.0e-27) return min(res,res1);
- else return __cos32(x,res,res1);
- }
- }
- } /* else if (k < 0x3fee8000) */
+ else if (k < 0x3fee8000)
+ {
+ n = 884 + ((k & 0x000fe000) >> 13) * 14;
+ if (m > 0)
+ {
+ xx = x - asncs.x[n];
+ eps = 1.04;
+ }
+ else
+ {
+ xx = -x - asncs.x[n];
+ eps = 1.005;
+ }
+ t = asncs.x[n + 1] * xx;
+ p =
+ xx * xx * (asncs.x[n + 2] +
+ xx * (asncs.x[n + 3] +
+ xx * (asncs.x[n + 4] +
+ xx * (asncs.x[n + 5] +
+ xx * (asncs.x[n + 6] +
+ xx * (asncs.x[n + 7] +
+ xx * (asncs.x[n + 8] +
+ xx * asncs.x[n +
+ 9])))))))
+ + asncs.x[n + 10];
+ t += p;
+ y = (m > 0) ? (hp0.x - asncs.x[n + 11]) : (hp0.x + asncs.x[n + 11]);
+ t = (m > 0) ? (hp1.x - t) : (hp1.x + t);
+ res = y + t;
+ if (res == res + eps * ((y - res) + t))
+ {
+ LIBC_PROBE (acos_probe, 2, 16, &x);
+ return res;
+ }
+ else
+ {
+ r = asncs.x[n + 11] + xx * asncs.x[n + 12];
+ t =
+ ((asncs.x[n + 11] - r) + xx * asncs.x[n + 12]) + (p +
+ xx * asncs.x[n +
+ 13]);
+ if (m > 0)
+ {
+ p = hp0.x - r;
+ t = (((hp0.x - p) - r) - t) + hp1.x;
+ eps = 1.0030;
+ }
+ else
+ {
+ p = hp0.x + r;
+ t = ((hp0.x - p) + r) + (hp1.x + t);
+ eps = 1.0005;
+ }
+ res = p + t;
+ cor = (p - res) + t;
+ if (res == (res + eps * cor))
+ {
+ LIBC_PROBE (acos_probe, 2, 17, &x);
+ return res;
+ }
+ else
+ {
+ res1 = res + 1.1 * cor;
+ z = 0.5 * (res1 - res);
+ __docos (res, z, w);
+ z = (w[0] - x) + w[1];
+ if (z > 1.0e-27)
+ {
+ LIBC_PROBE (acos_probe, 2, 18, &x);
+ return max (res, res1);
+ }
+ else if (z < -1.0e-27)
+ {
+ LIBC_PROBE (acos_probe, 2, 19, &x);
+ return min (res, res1);
+ }
+ else
+ return __cos32 (x, res, res1);
+ }
+ }
+ } /* else if (k < 0x3fee8000) */
/*--------------------0.953125 <= |x| < 0.96875 ----------------*/
- else
- if (k < 0x3fef0000) {
- n = 768+((k&0x000fe000)>>13)*15;
- if (m>0) {xx = x - asncs.x[n]; eps=1.04; }
- else {xx = -x - asncs.x[n]; eps=1.005;}
- t = asncs.x[n+1]*xx;
- p=xx*xx*(asncs.x[n+2]+xx*(asncs.x[n+3]+xx*(asncs.x[n+4]+
- xx*(asncs.x[n+5]+xx*(asncs.x[n+6]
- +xx*(asncs.x[n+7]+xx*(asncs.x[n+8]+xx*(asncs.x[n+9]+
- xx*asncs.x[n+10]))))))))+asncs.x[n+11];
- t+=p;
- y = (m>0)?(hp0.x-asncs.x[n+12]):(hp0.x+asncs.x[n+12]);
- t = (m>0)?(hp1.x-t):(hp1.x+t);
- res = y+t;
- if (res == res+eps*((y-res)+t)) return res;
- else {
- r=asncs.x[n+12]+xx*asncs.x[n+13];
- t=((asncs.x[n+12]-r)+xx*asncs.x[n+13])+(p+xx*asncs.x[n+14]);
- if (m>0) {p = hp0.x-r; t = (((hp0.x-p)-r)-t)+hp1.x; eps=1.0030; }
- else {p = hp0.x+r; t = ((hp0.x-p)+r)+(hp1.x+t); eps=1.0005; }
- res = p+t;
- cor = (p-res)+t;
- if (res == (res+eps*cor)) return res;
- else {
- res1=res+1.1*cor;
- z=0.5*(res1-res);
- __docos(res,z,w);
- z=(w[0]-x)+w[1];
- if (z>1.0e-27) return max(res,res1);
- else if (z<-1.0e-27) return min(res,res1);
- else return __cos32(x,res,res1);
- }
- }
- } /* else if (k < 0x3fef0000) */
+ else if (k < 0x3fef0000)
+ {
+ n = 768 + ((k & 0x000fe000) >> 13) * 15;
+ if (m > 0)
+ {
+ xx = x - asncs.x[n];
+ eps = 1.04;
+ }
+ else
+ {
+ xx = -x - asncs.x[n];
+ eps = 1.005;
+ }
+ t = asncs.x[n + 1] * xx;
+ p =
+ xx * xx * (asncs.x[n + 2] +
+ xx * (asncs.x[n + 3] +
+ xx * (asncs.x[n + 4] +
+ xx * (asncs.x[n + 5] +
+ xx * (asncs.x[n + 6] +
+ xx * (asncs.x[n + 7] +
+ xx * (asncs.x[n + 8] +
+ xx * (asncs.x[n + 9] +
+ xx * asncs.x[n +
+ 10]))))))))
+ + asncs.x[n + 11];
+ t += p;
+ y = (m > 0) ? (hp0.x - asncs.x[n + 12]) : (hp0.x + asncs.x[n + 12]);
+ t = (m > 0) ? (hp1.x - t) : (hp1.x + t);
+ res = y + t;
+ if (res == res + eps * ((y - res) + t))
+ {
+ LIBC_PROBE (acos_probe, 2, 20, &x);
+ return res;
+ }
+ else
+ {
+ r = asncs.x[n + 12] + xx * asncs.x[n + 13];
+ t =
+ ((asncs.x[n + 12] - r) + xx * asncs.x[n + 13]) + (p +
+ xx * asncs.x[n +
+ 14]);
+ if (m > 0)
+ {
+ p = hp0.x - r;
+ t = (((hp0.x - p) - r) - t) + hp1.x;
+ eps = 1.0030;
+ }
+ else
+ {
+ p = hp0.x + r;
+ t = ((hp0.x - p) + r) + (hp1.x + t);
+ eps = 1.0005;
+ }
+ res = p + t;
+ cor = (p - res) + t;
+ if (res == (res + eps * cor))
+ {
+ LIBC_PROBE (acos_probe, 2, 21, &x);
+ return res;
+ }
+ else
+ {
+ res1 = res + 1.1 * cor;
+ z = 0.5 * (res1 - res);
+ __docos (res, z, w);
+ z = (w[0] - x) + w[1];
+ if (z > 1.0e-27)
+ {
+ LIBC_PROBE (acos_probe, 2, 22, &x);
+ return max (res, res1);
+ }
+ else if (z < -1.0e-27)
+ {
+ LIBC_PROBE (acos_probe, 2, 23, &x);
+ return min (res, res1);
+ }
+ else
+ return __cos32 (x, res, res1);
+ }
+ }
+ } /* else if (k < 0x3fef0000) */
/*-----------------0.96875 <= |x| < 1 ---------------------------*/
- else
- if (k<0x3ff00000) {
- z = 0.5*((m>0)?(1.0-x):(1.0+x));
- v.x=z;
- k=v.i[HIGH_HALF];
- t=inroot[(k&0x001fffff)>>14]*powtwo[511-(k>>21)];
- r=1.0-t*t*z;
- t = t*(rt0+r*(rt1+r*(rt2+r*rt3)));
- c=t*z;
- t=c*(1.5-0.5*t*c);
- y = (t27*c+c)-t27*c;
- cc = (z-y*y)/(t+y);
- p=(((((f6*z+f5)*z+f4)*z+f3)*z+f2)*z+f1)*z;
- if (m<0) {
- cor = (hp1.x - cc)-(y+cc)*p;
- res1 = hp0.x - y;
- res =res1 + cor;
- if (res == res+1.002*((res1-res)+cor)) return (res+res);
- else {
- c=y+cc;
- cc=(y-c)+cc;
- __doasin(c,cc,w);
- res1=hp0.x-w[0];
- cor=((hp0.x-res1)-w[0])+(hp1.x-w[1]);
- res = res1+cor;
- cor = (res1-res)+cor;
- if (res==(res+1.000001*cor)) return (res+res);
- else {
- res=res+res;
- res1=res+1.2*cor;
- return __cos32(x,res,res1);
- }
- }
- }
- else {
- cor = cc+p*(y+cc);
- res = y + cor;
- if (res == res+1.03*((y-res)+cor)) return (res+res);
- else {
- c=y+cc;
- cc=(y-c)+cc;
- __doasin(c,cc,w);
- res = w[0];
- cor=w[1];
- if (res==(res+1.000001*cor)) return (res+res);
- else {
- res=res+res;
- res1=res+1.2*cor;
- return __cos32(x,res,res1);
- }
- }
- }
- } /* else if (k < 0x3ff00000) */
+ else if (k < 0x3ff00000)
+ {
+ z = 0.5 * ((m > 0) ? (1.0 - x) : (1.0 + x));
+ v.x = z;
+ k = v.i[HIGH_HALF];
+ t = inroot[(k & 0x001fffff) >> 14] * powtwo[511 - (k >> 21)];
+ r = 1.0 - t * t * z;
+ t = t * (rt0 + r * (rt1 + r * (rt2 + r * rt3)));
+ c = t * z;
+ t = c * (1.5 - 0.5 * t * c);
+ y = (t27 * c + c) - t27 * c;
+ cc = (z - y * y) / (t + y);
+ p = (((((f6 * z + f5) * z + f4) * z + f3) * z + f2) * z + f1) * z;
+ if (m < 0)
+ {
+ cor = (hp1.x - cc) - (y + cc) * p;
+ res1 = hp0.x - y;
+ res = res1 + cor;
+ if (res == res + 1.002 * ((res1 - res) + cor))
+ {
+ LIBC_PROBE (acos_probe, 2, 24, &x);
+ return (res + res);
+ }
+ else
+ {
+ c = y + cc;
+ cc = (y - c) + cc;
+ __doasin (c, cc, w);
+ res1 = hp0.x - w[0];
+ cor = ((hp0.x - res1) - w[0]) + (hp1.x - w[1]);
+ res = res1 + cor;
+ cor = (res1 - res) + cor;
+ if (res == (res + 1.000001 * cor))
+ {
+ LIBC_PROBE (acos_probe, 2, 25, &x);
+ return (res + res);
+ }
+ else
+ {
+ res = res + res;
+ res1 = res + 1.2 * cor;
+ return __cos32 (x, res, res1);
+ }
+ }
+ }
+ else
+ {
+ cor = cc + p * (y + cc);
+ res = y + cor;
+ if (res == res + 1.03 * ((y - res) + cor))
+ {
+ LIBC_PROBE (acos_probe, 2, 26, &x);
+ return (res + res);
+ }
+ else
+ {
+ c = y + cc;
+ cc = (y - c) + cc;
+ __doasin (c, cc, w);
+ res = w[0];
+ cor = w[1];
+ if (res == (res + 1.000001 * cor))
+ {
+ LIBC_PROBE (acos_probe, 2, 27, &x);
+ return (res + res);
+ }
+ else
+ {
+ res = res + res;
+ res1 = res + 1.2 * cor;
+ return __cos32 (x, res, res1);
+ }
+ }
+ }
+ } /* else if (k < 0x3ff00000) */
/*---------------------------- |x|>=1 -----------------------*/
+ else if (k == 0x3ff00000 && u.i[LOW_HALF] == 0)
+ return (m > 0) ? 0 : 2.0 * hp0.x;
+ else if (k > 0x7ff00000 || (k == 0x7ff00000 && u.i[LOW_HALF] != 0))
+ return x;
else
- if (k==0x3ff00000 && u.i[LOW_HALF]==0) return (m>0)?0:2.0*hp0.x;
- else
- if (k>0x7ff00000 || (k == 0x7ff00000 && u.i[LOW_HALF] != 0)) return x;
- else {
- u.i[HIGH_HALF]=0x7ff00000;
- v.i[HIGH_HALF]=0x7ff00000;
- u.i[LOW_HALF]=0;
- v.i[LOW_HALF]=0;
- return u.x/v.x;
- }
+ {
+ u.i[HIGH_HALF] = 0x7ff00000;
+ v.i[HIGH_HALF] = 0x7ff00000;
+ u.i[LOW_HALF] = 0;
+ v.i[LOW_HALF] = 0;
+ return u.x / v.x;
+ }
}
+
#ifndef __ieee754_acos
strong_alias (__ieee754_acos, __acos_finite)
#endif
diff --git a/sysdeps/ieee754/dbl-64/e_atanh.c b/sysdeps/ieee754/dbl-64/e_atanh.c
index 21bb990..c12473f 100644
--- a/sysdeps/ieee754/dbl-64/e_atanh.c
+++ b/sysdeps/ieee754/dbl-64/e_atanh.c
@@ -38,6 +38,7 @@
#include <inttypes.h>
#include <math.h>
#include <math_private.h>
+#include <stap-probe.h>
static const double huge = 1e300;
@@ -56,9 +57,13 @@ __ieee754_atanh (double x)
t = xa + xa;
t = 0.5 * __log1p (t + t * xa / (1.0 - xa));
+ LIBC_PROBE (atanh_probe, 2, 1, &x);
}
else if (__builtin_expect (isless (xa, 1.0), 1))
+ {
+ LIBC_PROBE (atanh_probe, 2, 2, &x);
t = 0.5 * __log1p ((xa + xa) / (1.0 - xa));
+ }
else
{
if (isgreater (xa, 1.0))
diff --git a/sysdeps/ieee754/dbl-64/e_cosh.c b/sysdeps/ieee754/dbl-64/e_cosh.c
index 6caf943..798591d 100644
--- a/sysdeps/ieee754/dbl-64/e_cosh.c
+++ b/sysdeps/ieee754/dbl-64/e_cosh.c
@@ -33,6 +33,7 @@
#include <math.h>
#include <math_private.h>
+#include <stap-probe.h>
static const double one = 1.0, half = 0.5, huge = 1.0e300;
@@ -55,11 +56,13 @@ __ieee754_cosh (double x)
{
t = __expm1 (fabs (x));
w = one + t;
+ LIBC_PROBE (cosh_probe, 2, 1, &x);
if (ix < 0x3c800000)
return w; /* cosh(tiny) = 1 */
return one + (t * t) / (w + w);
}
+ LIBC_PROBE (cosh_probe, 2, 2, &x);
/* |x| in [0.5*ln2,22], return (exp(|x|)+1/exp(|x|)/2; */
t = __ieee754_exp (fabs (x));
return half * t + half / t;
@@ -67,7 +70,10 @@ __ieee754_cosh (double x)
/* |x| in [22, log(maxdouble)] return half*exp(|x|) */
if (ix < 0x40862e42)
+ {
+ LIBC_PROBE (cosh_probe, 2, 3, &x);
return half * __ieee754_exp (fabs (x));
+ }
/* |x| in [log(maxdouble), overflowthresold] */
GET_LOW_WORD (lx, x);
@@ -75,6 +81,7 @@ __ieee754_cosh (double x)
{
w = __ieee754_exp (half * fabs (x));
t = half * w;
+ LIBC_PROBE (cosh_probe, 2, 4, &x);
return t * w;
}
diff --git a/sysdeps/ieee754/dbl-64/e_pow.c b/sysdeps/ieee754/dbl-64/e_pow.c
index 1c5f4b3..4664f7d 100644
--- a/sysdeps/ieee754/dbl-64/e_pow.c
+++ b/sysdeps/ieee754/dbl-64/e_pow.c
@@ -42,6 +42,7 @@
#include "upow.tbl"
#include <math_private.h>
#include <fenv.h>
+#include <stap-probe.h>
#ifndef SECTION
# define SECTION
@@ -65,6 +66,7 @@ __ieee754_pow (double x, double y)
double z, a, aa, error, t, a1, a2, y1, y2;
mynumber u, v;
int k;
+ int retcode = -1;
int4 qx, qy;
v.x = y;
u.x = x;
@@ -110,7 +112,16 @@ __ieee754_pow (double x, double y)
a2 = (a - a1) + aa;
error = error * ABS (y);
t = __exp1 (a1, a2, 1.9e16 * error); /* return -10 or 0 if wasn't computed exactly */
- retval = (t > 0) ? t : power1 (x, y);
+ if (t > 0)
+ {
+ retval = t;
+ retcode = 1;
+ LIBC_PROBE (pow_probe, 3, &x, &y, &retcode);
+ }
+ else
+ {
+ retval = power1 (x, y);
+ }
return retval;
}
@@ -140,6 +151,8 @@ __ieee754_pow (double x, double y)
/* if x<0 */
if (u.i[HIGH_HALF] < 0)
{
+ retcode = 2;
+ LIBC_PROBE (pow_probe, 3, &x, &y, &retcode);
k = checkint (y);
if (k == 0)
{
@@ -199,6 +212,7 @@ static double
SECTION
power1 (double x, double y)
{
+ int retcode = 3;
double z, a, aa, error, t, a1, a2, y1, y2;
z = my_log2 (x, &aa, &error);
t = y * CN;
@@ -213,7 +227,13 @@ power1 (double x, double y)
a2 = (a - a1) + aa;
error = error * ABS (y);
t = __exp1 (a1, a2, 1.9e16 * error);
- return (t >= 0) ? t : __slowpow (x, y, z);
+ if (t >= 0)
+ {
+ LIBC_PROBE (pow_probe, 3, &x, &y, &retcode);
+ return t;
+ }
+ else
+ return __slowpow (x, y, z);
}
/* Compute log(x) (x is left argument). The result is the returned double + the
diff --git a/sysdeps/ieee754/dbl-64/e_sinh.c b/sysdeps/ieee754/dbl-64/e_sinh.c
index 851b510..f3e1a8f 100644
--- a/sysdeps/ieee754/dbl-64/e_sinh.c
+++ b/sysdeps/ieee754/dbl-64/e_sinh.c
@@ -34,6 +34,7 @@ static char rcsid[] = "$NetBSD: e_sinh.c,v 1.7 1995/05/10 20:46:13 jtc Exp $";
#include <math.h>
#include <math_private.h>
+#include <stap-probe.h>
static const double one = 1.0, shuge = 1.0e307;
@@ -63,6 +64,7 @@ __ieee754_sinh (double x)
return x;
/* sinh(tiny) = tiny with inexact */
t = __expm1 (fabs (x));
+ LIBC_PROBE (sinh_probe, 2, 1, &x);
if (ix < 0x3ff00000)
return h * (2.0 * t - t * t / (t + one));
return h * (t + t / (t + one));
@@ -70,12 +72,16 @@ __ieee754_sinh (double x)
/* |x| in [22, log(maxdouble)] return 0.5*exp(|x|) */
if (ix < 0x40862e42)
+ {
+ LIBC_PROBE (sinh_probe, 2, 2, &x);
return h * __ieee754_exp (fabs (x));
+ }
/* |x| in [log(maxdouble), overflowthresold] */
GET_LOW_WORD (lx, x);
if (ix < 0x408633ce || ((ix == 0x408633ce) && (lx <= (u_int32_t) 0x8fb9f87d)))
{
+ LIBC_PROBE (sinh_probe, 2, 3, &x);
w = __ieee754_exp (0.5 * fabs (x));
t = h * w;
return t * w;
diff --git a/sysdeps/ieee754/dbl-64/s_asinh.c b/sysdeps/ieee754/dbl-64/s_asinh.c
index 5500746..143122b 100644
--- a/sysdeps/ieee754/dbl-64/s_asinh.c
+++ b/sysdeps/ieee754/dbl-64/s_asinh.c
@@ -23,6 +23,7 @@
#include <math.h>
#include <math_private.h>
+#include <stap-probe.h>
static const double
one = 1.00000000000000000000e+00, /* 0x3FF00000, 0x00000000 */
@@ -46,6 +47,7 @@ __asinh (double x)
if (ix >= 0x7ff00000)
return x + x; /* x is inf or NaN */
w = __ieee754_log (fabs (x)) + ln2;
+ LIBC_PROBE (asinh_probe, 2, 1, &x);
}
else
{
@@ -54,11 +56,13 @@ __asinh (double x)
{
w = __ieee754_log (2.0 * xa + one / (__ieee754_sqrt (xa * xa + one) +
xa));
+ LIBC_PROBE (asinh_probe, 2, 2, &x);
}
else /* 2.0 > |x| > 2**-28 */
{
double t = xa * xa;
w = __log1p (xa + t / (one + __ieee754_sqrt (one + t)));
+ LIBC_PROBE (asinh_probe, 2, 3, &x);
}
}
return __copysign (w, x);
diff --git a/sysdeps/ieee754/dbl-64/s_atan.c b/sysdeps/ieee754/dbl-64/s_atan.c
index 0aa145c..456ffea 100644
--- a/sysdeps/ieee754/dbl-64/s_atan.c
+++ b/sysdeps/ieee754/dbl-64/s_atan.c
@@ -97,7 +97,10 @@ atan (double x)
yy *= x * v;
if ((y = x + (yy - U1 * x)) == x + (yy + U1 * x))
+ {
+ LIBC_PROBE (atan_probe, 2, 1, &x);
return y;
+ }
EMULV (x, x, v, vv, t1, t2, t3, t4, t5); /* v+vv=x^2 */
@@ -119,7 +122,10 @@ atan (double x)
t8);
ADD2 (x, 0, s2, ss2, s1, ss1, t1, t2);
if ((y = s1 + (ss1 - U5 * s1)) == s1 + (ss1 + U5 * s1))
+ {
+ LIBC_PROBE (atan_probe, 2, 2, &x);
return y;
+ }
return atanMp (x, pr);
}
@@ -151,7 +157,10 @@ atan (double x)
u2 = U24;
} /* 3/4 <= u <= 1 */
if ((y = t1 + (yy - u2 * t1)) == t1 + (yy + u2 * t1))
+ {
+ LIBC_PROBE (atan_probe, 2, 3, &x);
return __signArctan (x, y);
+ }
z = u - hij[i][0].d;
@@ -171,7 +180,10 @@ atan (double x)
MUL2 (z, 0, s2, ss2, s1, ss1, t1, t2, t3, t4, t5, t6, t7, t8);
ADD2 (hij[i][1].d, hij[i][2].d, s1, ss1, s2, ss2, t1, t2);
if ((y = s2 + (ss2 - U6 * s2)) == s2 + (ss2 + U6 * s2))
+ {
+ LIBC_PROBE (atan_probe, 2, 4, &x);
return __signArctan (x, y);
+ }
return atanMp (x, pr);
}
@@ -199,7 +211,10 @@ atan (double x)
else
u3 = U32; /* w >= 1/2 */
if ((y = t1 + (yy - u3)) == t1 + (yy + u3))
+ {
+ LIBC_PROBE (atan_probe, 2, 5, &x);
return __signArctan (x, y);
+ }
DIV2 (1, 0, u, 0, w, ww, t1, t2, t3, t4, t5, t6, t7, t8, t9,
t10);
@@ -223,7 +238,10 @@ atan (double x)
ADD2 (hij[i][1].d, hij[i][2].d, s1, ss1, s2, ss2, t1, t2);
SUB2 (HPI, HPI1, s2, ss2, s1, ss1, t1, t2);
if ((y = s1 + (ss1 - U7)) == s1 + (ss1 + U7))
+ {
+ LIBC_PROBE (atan_probe, 2, 6, &x);
return __signArctan (x, y);
+ }
return atanMp (x, pr);
}
@@ -246,7 +264,10 @@ atan (double x)
ESUB (HPI, w, t3, cor);
yy = ((HPI1 + cor) - ww) - yy;
if ((y = t3 + (yy - U4)) == t3 + (yy + U4))
+ {
+ LIBC_PROBE (atan_probe, 2, 7, &x);
return __signArctan (x, y);
+ }
DIV2 (1, 0, u, 0, w, ww, t1, t2, t3, t4, t5, t6, t7, t8,
t9, t10);
@@ -271,7 +292,10 @@ atan (double x)
SUB2 (HPI, HPI1, s1, ss1, s2, ss2, t1, t2);
if ((y = s2 + (ss2 - U8)) == s2 + (ss2 + U8))
+ {
+ LIBC_PROBE (atan_probe, 2, 8, &x);
return __signArctan (x, y);
+ }
return atanMp (x, pr);
}
diff --git a/sysdeps/ieee754/dbl-64/s_sin.c b/sysdeps/ieee754/dbl-64/s_sin.c
index 6105e9f..7210daf 100644
--- a/sysdeps/ieee754/dbl-64/s_sin.c
+++ b/sysdeps/ieee754/dbl-64/s_sin.c
@@ -303,7 +303,7 @@ __sin (double x)
t = POLYNOMIAL (xx) * (xx * x);
res = x + t;
cor = (x - res) + t;
- retval = (res == res + 1.07 * cor) ? res : slow (x);
+ if (res == res + 1.07 * cor) { LIBC_PROBE (sin_probe, 2, 1, &x); retval = res; } else retval = slow (x);
} /* else if (k < 0x3fd00000) */
/*---------------------------- 0.25<|x|< 0.855469---------------------- */
else if (k < 0x3feb6000)
@@ -322,7 +322,7 @@ __sin (double x)
cor = (ssn + s * ccs - sn * c) + cs * s;
res = sn + cor;
cor = (sn - res) + cor;
- retval = (res == res + 1.096 * cor) ? res : slow1 (x);
+ if (res == res + 1.096 * cor) { LIBC_PROBE (sin_probe, 2, 2, &x); retval = res; } else retval = slow1 (x);
} /* else if (k < 0x3feb6000) */
/*----------------------- 0.855469 <|x|<2.426265 ----------------------*/
@@ -341,7 +341,7 @@ __sin (double x)
y = (-hp1) - (y + (u.x - big));
}
res = do_cos (u, y, &cor);
- retval = (res == res + 1.020 * cor) ? ((m > 0) ? res : -res) : slow2 (x);
+ if (res == res + 1.020 * cor) { LIBC_PROBE (sin_probe, 2, 3, &x); retval = ((m > 0) ? res : -res); } else retval = slow2 (x);
} /* else if (k < 0x400368fd) */
/*-------------------------- 2.426265<|x|< 105414350 ----------------------*/
@@ -372,7 +372,7 @@ __sin (double x)
/* Taylor series. */
res = TAYLOR_SIN (xx, a, da, cor);
cor = (cor > 0) ? 1.02 * cor + eps : 1.02 * cor - eps;
- retval = (res == res + cor) ? res : sloww (a, da, x);
+ if (res == res + cor) { LIBC_PROBE (sin_probe, 2, 4, &x); retval = res; } else retval = sloww (a, da, x);
}
else
{
@@ -388,8 +388,7 @@ __sin (double x)
y = a - (u.x - big);
res = do_sin (u, y, da, &cor);
cor = (cor > 0) ? 1.035 * cor + eps : 1.035 * cor - eps;
- retval = ((res == res + cor) ? ((m) ? res : -res)
- : sloww1 (a, da, x, m));
+ if (res == res + cor) { LIBC_PROBE (sin_probe, 2, 5, &x); retval = ((m) ? res : -res); } else retval = sloww1 (a, da, x, m);
}
break;
@@ -404,8 +403,7 @@ __sin (double x)
y = a - (u.x - big) + da;
res = do_cos (u, y, &cor);
cor = (cor > 0) ? 1.025 * cor + eps : 1.025 * cor - eps;
- retval = ((res == res + cor) ? ((n & 2) ? -res : res)
- : sloww2 (a, da, x, n));
+ if (res == res + cor) { LIBC_PROBE (sin_probe, 2, 6, &x); retval = ((n & 2) ? -res : res); } else retval = sloww2 (a, da, x, n);
break;
}
} /* else if (k < 0x419921FB ) */
@@ -443,7 +441,7 @@ __sin (double x)
/* Taylor series. */
res = TAYLOR_SIN (xx, a, da, cor);
cor = (cor > 0) ? 1.02 * cor + eps : 1.02 * cor - eps;
- retval = (res == res + cor) ? res : bsloww (a, da, x, n);
+ if (res == res + cor) { LIBC_PROBE (sin_probe, 2, 7, &x); retval = res; } else retval = bsloww (a, da, x, n);
}
else
{
@@ -462,8 +460,7 @@ __sin (double x)
y = a - (u.x - big);
res = do_sin (u, y, db, &cor);
cor = (cor > 0) ? 1.035 * cor + eps : 1.035 * cor - eps;
- retval = ((res == res + cor) ? ((m) ? res : -res)
- : bsloww1 (a, da, x, n));
+ if (res == res + cor) { LIBC_PROBE (sin_probe, 2, 8, &x); retval = ((m) ? res : -res); } else retval = bsloww1 (a, da, x, n);
}
break;
@@ -478,8 +475,7 @@ __sin (double x)
y = a - (u.x - big) + da;
res = do_cos (u, y, &cor);
cor = (cor > 0) ? 1.025 * cor + eps : 1.025 * cor - eps;
- retval = ((res == res + cor) ? ((n & 2) ? -res : res)
- : bsloww2 (a, da, x, n));
+ if (res == res + cor) { LIBC_PROBE (sin_probe, 2, 9, &x); retval = ((n & 2) ? -res : res); } else retval = bsloww2 (a, da, x, n);
break;
}
} /* else if (k < 0x42F00000 ) */
@@ -532,7 +528,7 @@ __cos (double x)
u.x = big + y;
y = y - (u.x - big);
res = do_cos (u, y, &cor);
- retval = (res == res + 1.020 * cor) ? res : cslow2 (x);
+ if (res == res + 1.020 * cor) { LIBC_PROBE (cos_probe, 2, 1, &x); retval = res; } else retval = cslow2 (x);
} /* else if (k < 0x3feb6000) */
else if (k < 0x400368fd)
@@ -545,7 +541,7 @@ __cos (double x)
{
res = TAYLOR_SIN (xx, a, da, cor);
cor = (cor > 0) ? 1.02 * cor + 1.0e-31 : 1.02 * cor - 1.0e-31;
- retval = (res == res + cor) ? res : csloww (a, da, x);
+ if (res == res + cor) { LIBC_PROBE (cos_probe, 2, 2, &x); retval = res; } else retval = csloww (a, da, x);
}
else
{
@@ -563,8 +559,7 @@ __cos (double x)
y = a - (u.x - big);
res = do_sin (u, y, da, &cor);
cor = (cor > 0) ? 1.035 * cor + 1.0e-31 : 1.035 * cor - 1.0e-31;
- retval = ((res == res + cor) ? ((m) ? res : -res)
- : csloww1 (a, da, x, m));
+ if (res == res + cor) { LIBC_PROBE (cos_probe, 2, 3, &x); retval = ((m) ? res : -res); } else retval = csloww1 (a, da, x, m);
}
} /* else if (k < 0x400368fd) */
@@ -596,7 +591,7 @@ __cos (double x)
{
res = TAYLOR_SIN (xx, a, da, cor);
cor = (cor > 0) ? 1.02 * cor + eps : 1.02 * cor - eps;
- retval = (res == res + cor) ? res : csloww (a, da, x);
+ if (res == res + cor) { LIBC_PROBE (cos_probe, 2, 4, &x); retval = res; } else retval = csloww (a, da, x);
}
else
{
@@ -614,8 +609,7 @@ __cos (double x)
y = a - (u.x - big);
res = do_sin (u, y, da, &cor);
cor = (cor > 0) ? 1.035 * cor + eps : 1.035 * cor - eps;
- retval = ((res == res + cor) ? ((m) ? res : -res)
- : csloww1 (a, da, x, m));
+ if (res == res + cor) { LIBC_PROBE (cos_probe, 2, 5, &x); retval = ((m) ? res : -res); } else retval = csloww1 (a, da, x, m);
}
break;
@@ -630,8 +624,7 @@ __cos (double x)
y = a - (u.x - big) + da;
res = do_cos (u, y, &cor);
cor = (cor > 0) ? 1.025 * cor + eps : 1.025 * cor - eps;
- retval = ((res == res + cor) ? ((n) ? -res : res)
- : csloww2 (a, da, x, n));
+ if (res == res + cor) { LIBC_PROBE (cos_probe, 2, 6, &x); retval = ((n) ? -res : res); } else retval = csloww2 (a, da, x, n);
break;
}
} /* else if (k < 0x419921FB ) */
@@ -667,7 +660,7 @@ __cos (double x)
{
res = TAYLOR_SIN (xx, a, da, cor);
cor = (cor > 0) ? 1.02 * cor + eps : 1.02 * cor - eps;
- retval = (res == res + cor) ? res : bsloww (a, da, x, n);
+ if (res == res + cor) { LIBC_PROBE (cos_probe, 2, 7, &x); retval = res; } else retval = bsloww (a, da, x, n);
}
else
{
@@ -686,8 +679,7 @@ __cos (double x)
y = a - (u.x - big);
res = do_sin (u, y, db, &cor);
cor = (cor > 0) ? 1.035 * cor + eps : 1.035 * cor - eps;
- retval = ((res == res + cor) ? ((m) ? res : -res)
- : bsloww1 (a, da, x, n));
+ if (res == res + cor) { LIBC_PROBE (cos_probe, 2, 8, &x); retval = ((m) ? res : -res); } else retval = bsloww1 (a, da, x, n);
}
break;
@@ -702,8 +694,7 @@ __cos (double x)
y = a - (u.x - big) + da;
res = do_cos (u, y, &cor);
cor = (cor > 0) ? 1.025 * cor + eps : 1.025 * cor - eps;
- retval = ((res == res + cor) ? ((n) ? -res : res)
- : bsloww2 (a, da, x, n));
+ if (res == res + cor) { LIBC_PROBE (cos_probe, 2, 9, &x); retval = ((n) ? -res : res); } else retval = bsloww2 (a, da, x, n);
break;
}
} /* else if (k < 0x42F00000 ) */
@@ -734,12 +725,18 @@ slow (double x)
double res, cor, w[2];
res = TAYLOR_SLOW (x, 0, cor);
if (res == res + 1.0007 * cor)
- return res;
+ {
+ LIBC_PROBE (sin_probe, 2, 10, &x);
+ return res;
+ }
else
{
__dubsin (ABS (x), 0, w);
if (w[0] == w[0] + 1.000000001 * w[1])
+ {
+ LIBC_PROBE (sin_probe, 2, 11, &x);
return (x > 0) ? w[0] : -w[0];
+ }
else
return (x > 0) ? __mpsin (x, 0, false) : -__mpsin (-x, 0, false);
}
@@ -761,12 +758,18 @@ slow1 (double x)
y = y - (u.x - big);
res = do_sin_slow (u, y, 0, 0, &cor);
if (res == res + cor)
+ {
+ LIBC_PROBE (sin_probe, 2, 12, &x);
return (x > 0) ? res : -res;
+ }
else
{
__dubsin (ABS (x), 0, w);
if (w[0] == w[0] + 1.000000005 * w[1])
+ {
+ LIBC_PROBE (sin_probe, 2, 13, &x);
return (x > 0) ? w[0] : -w[0];
+ }
else
return (x > 0) ? __mpsin (x, 0, false) : -__mpsin (-x, 0, false);
}
@@ -799,7 +802,8 @@ slow2 (double x)
}
res = do_cos_slow (u, y, del, 0, &cor);
if (res == res + cor)
- return (x > 0) ? res : -res;
+ { LIBC_PROBE (sin_probe, 2, 14, &x);
+ return (x > 0) ? res : -res; }
else
{
y = ABS (x) - hp0;
@@ -807,7 +811,8 @@ slow2 (double x)
y2 = (y - y1) - hp1;
__docos (y1, y2, w);
if (w[0] == w[0] + 1.000000005 * w[1])
- return (x > 0) ? w[0] : -w[0];
+ { LIBC_PROBE (sin_probe, 2, 15, &x);
+ return (x > 0) ? w[0] : -w[0]; }
else
return (x > 0) ? __mpsin (x, 0, false) : -__mpsin (-x, 0, false);
}
@@ -835,7 +840,8 @@ sloww (double x, double dx, double orig)
cor = 1.0005 * cor - ABS (orig) * 3.1e-30;
if (res == res + cor)
- return res;
+ { LIBC_PROBE (sin_probe, 2, 16, &orig);
+ return res;}
else
{
(x > 0) ? __dubsin (x, dx, w) : __dubsin (-x, -dx, w);
@@ -845,7 +851,8 @@ sloww (double x, double dx, double orig)
cor = 1.000000001 * w[1] - ABS (orig) * 1.1e-30;
if (w[0] == w[0] + cor)
- return (x > 0) ? w[0] : -w[0];
+ { LIBC_PROBE (sin_probe, 2, 17, &orig);
+ return (x > 0) ? w[0] : -w[0]; }
else
{
t = (orig * hpinv + toint);
@@ -871,7 +878,8 @@ sloww (double x, double dx, double orig)
cor = 1.000000001 * w[1] - ABS (orig) * 1.1e-40;
if (w[0] == w[0] + cor)
- return (a > 0) ? w[0] : -w[0];
+ { LIBC_PROBE (sin_probe, 2, 18, &orig);
+ return (a > 0) ? w[0] : -w[0]; }
else
return __mpsin (orig, 0, true);
}
@@ -897,7 +905,8 @@ sloww1 (double x, double dx, double orig, int m)
res = do_sin_slow (u, y, dx, 3.1e-30 * ABS (orig), &cor);
if (res == res + cor)
- return (m > 0) ? res : -res;
+ { LIBC_PROBE (sin_probe, 2, 19, &orig);
+ return (m > 0) ? res : -res; }
else
{
__dubsin (x, dx, w);
@@ -908,7 +917,8 @@ sloww1 (double x, double dx, double orig, int m)
cor = 1.000000005 * w[1] - 1.1e-30 * ABS (orig);
if (w[0] == w[0] + cor)
- return (m > 0) ? w[0] : -w[0];
+ { LIBC_PROBE (sin_probe, 2, 20, &orig);
+ return (m > 0) ? w[0] : -w[0]; }
else
return __mpsin (orig, 0, true);
}
@@ -933,7 +943,8 @@ sloww2 (double x, double dx, double orig, int n)
res = do_cos_slow (u, y, dx, 3.1e-30 * ABS (orig), &cor);
if (res == res + cor)
- return (n & 2) ? -res : res;
+ { LIBC_PROBE (sin_probe, 2, 21, &orig);
+ return (n & 2) ? -res : res; }
else
{
__docos (x, dx, w);
@@ -944,7 +955,8 @@ sloww2 (double x, double dx, double orig, int n)
cor = 1.000000005 * w[1] - 1.1e-30 * ABS (orig);
if (w[0] == w[0] + cor)
- return (n & 2) ? -w[0] : w[0];
+ { LIBC_PROBE (sin_probe, 2, 22, &orig);
+ return (n & 2) ? -w[0] : w[0]; }
else
return __mpsin (orig, 0, true);
}
@@ -967,7 +979,8 @@ bsloww (double x, double dx, double orig, int n)
res = TAYLOR_SLOW (x, dx, cor);
cor = (cor > 0) ? 1.0005 * cor + 1.1e-24 : 1.0005 * cor - 1.1e-24;
if (res == res + cor)
- return res;
+ { LIBC_PROBE (sincos_probe, 2, 1, &orig);
+ return res; }
else
{
(x > 0) ? __dubsin (x, dx, w) : __dubsin (-x, -dx, w);
@@ -976,7 +989,8 @@ bsloww (double x, double dx, double orig, int n)
else
cor = 1.000000001 * w[1] - 1.1e-24;
if (w[0] == w[0] + cor)
- return (x > 0) ? w[0] : -w[0];
+ { LIBC_PROBE (sincos_probe, 2, 2, &orig);
+ return (x > 0) ? w[0] : -w[0]; }
else
return (n & 1) ? __mpcos (orig, 0, true) : __mpsin (orig, 0, true);
}
@@ -1002,7 +1016,8 @@ bsloww1 (double x, double dx, double orig, int n)
dx = (x > 0) ? dx : -dx;
res = do_sin_slow (u, y, dx, 1.1e-24, &cor);
if (res == res + cor)
- return (x > 0) ? res : -res;
+ { LIBC_PROBE (sincos_probe, 2, 3, &orig);
+ return (x > 0) ? res : -res; }
else
{
__dubsin (ABS (x), dx, w);
@@ -1013,7 +1028,8 @@ bsloww1 (double x, double dx, double orig, int n)
cor = 1.000000005 * w[1] - 1.1e-24;
if (w[0] == w[0] + cor)
- return (x > 0) ? w[0] : -w[0];
+ { LIBC_PROBE (sincos_probe, 2, 4, &orig);
+ return (x > 0) ? w[0] : -w[0]; }
else
return (n & 1) ? __mpcos (orig, 0, true) : __mpsin (orig, 0, true);
}
@@ -1039,7 +1055,8 @@ bsloww2 (double x, double dx, double orig, int n)
dx = (x > 0) ? dx : -dx;
res = do_cos_slow (u, y, dx, 1.1e-24, &cor);
if (res == res + cor)
- return (n & 2) ? -res : res;
+ { LIBC_PROBE (sincos_probe, 2, 5, &orig);
+ return (n & 2) ? -res : res; }
else
{
__docos (ABS (x), dx, w);
@@ -1050,7 +1067,8 @@ bsloww2 (double x, double dx, double orig, int n)
cor = 1.000000005 * w[1] - 1.1e-24;
if (w[0] == w[0] + cor)
- return (n & 2) ? -w[0] : w[0];
+ { LIBC_PROBE (sincos_probe, 2, 6, &orig);
+ return (n & 2) ? -w[0] : w[0]; }
else
return (n & 1) ? __mpsin (orig, 0, true) : __mpcos (orig, 0, true);
}
@@ -1073,13 +1091,15 @@ cslow2 (double x)
y = y - (u.x - big);
res = do_cos_slow (u, y, 0, 0, &cor);
if (res == res + cor)
- return res;
+ { LIBC_PROBE (cos_probe, 2, 10, &x);
+ return res; }
else
{
y = ABS (x);
__docos (y, 0, w);
if (w[0] == w[0] + 1.000000005 * w[1])
- return w[0];
+ { LIBC_PROBE (cos_probe, 2, 11, &x);
+ return w[0]; }
else
return __mpcos (x, 0, false);
}
@@ -1110,7 +1130,8 @@ csloww (double x, double dx, double orig)
cor = 1.0005 * cor - ABS (orig) * 3.1e-30;
if (res == res + cor)
- return res;
+ { LIBC_PROBE (cos_probe, 2, 12, &orig);
+ return res; }
else
{
(x > 0) ? __dubsin (x, dx, w) : __dubsin (-x, -dx, w);
@@ -1121,7 +1142,8 @@ csloww (double x, double dx, double orig)
cor = 1.000000001 * w[1] - ABS (orig) * 1.1e-30;
if (w[0] == w[0] + cor)
- return (x > 0) ? w[0] : -w[0];
+ { LIBC_PROBE (cos_probe, 2, 13, &orig);
+ return (x > 0) ? w[0] : -w[0]; }
else
{
t = (orig * hpinv + toint);
@@ -1148,7 +1170,8 @@ csloww (double x, double dx, double orig)
cor = 1.000000001 * w[1] - ABS (orig) * 1.1e-40;
if (w[0] == w[0] + cor)
- return (a > 0) ? w[0] : -w[0];
+ { LIBC_PROBE (cos_probe, 2, 14, &orig);
+ return (a > 0) ? w[0] : -w[0]; }
else
return __mpcos (orig, 0, true);
}
@@ -1174,7 +1197,8 @@ csloww1 (double x, double dx, double orig, int m)
res = do_sin_slow (u, y, dx, 3.1e-30 * ABS (orig), &cor);
if (res == res + cor)
- return (m > 0) ? res : -res;
+ { LIBC_PROBE (cos_probe, 2, 15, &orig);
+ return (m > 0) ? res : -res; }
else
{
__dubsin (x, dx, w);
@@ -1183,7 +1207,8 @@ csloww1 (double x, double dx, double orig, int m)
else
cor = 1.000000005 * w[1] - 1.1e-30 * ABS (orig);
if (w[0] == w[0] + cor)
- return (m > 0) ? w[0] : -w[0];
+ { LIBC_PROBE (cos_probe, 2, 16, &orig);
+ return (m > 0) ? w[0] : -w[0]; }
else
return __mpcos (orig, 0, true);
}
@@ -1209,7 +1234,8 @@ csloww2 (double x, double dx, double orig, int n)
res = do_cos_slow (u, y, dx, 3.1e-30 * ABS (orig), &cor);
if (res == res + cor)
- return (n) ? -res : res;
+ { LIBC_PROBE (cos_probe, 2, 17, &orig);
+ return (n) ? -res : res; }
else
{
__docos (x, dx, w);
@@ -1218,7 +1244,8 @@ csloww2 (double x, double dx, double orig, int n)
else
cor = 1.000000005 * w[1] - 1.1e-30 * ABS (orig);
if (w[0] == w[0] + cor)
- return (n) ? -w[0] : w[0];
+ { LIBC_PROBE (cos_probe, 2, 18, &orig);
+ return (n) ? -w[0] : w[0]; }
else
return __mpcos (orig, 0, true);
}
diff --git a/sysdeps/ieee754/dbl-64/s_tanh.c b/sysdeps/ieee754/dbl-64/s_tanh.c
index 23cfcde..4286a71 100644
--- a/sysdeps/ieee754/dbl-64/s_tanh.c
+++ b/sysdeps/ieee754/dbl-64/s_tanh.c
@@ -40,6 +40,7 @@ static char rcsid[] = "$NetBSD: s_tanh.c,v 1.7 1995/05/10 20:48:22 jtc Exp $";
#include <math.h>
#include <math_private.h>
+#include <stap-probe.h>
static const double one = 1.0, two = 2.0, tiny = 1.0e-300;
@@ -73,11 +74,13 @@ __tanh (double x)
{
t = __expm1 (two * fabs (x));
z = one - two / (t + two);
+ LIBC_PROBE (tanh_probe, 2, 1, &x);
}
else
{
t = __expm1 (-two * fabs (x));
z = -t / (t + two);
+ LIBC_PROBE (tanh_probe, 2, 2, &x);
}
/* |x| > 22, return +-1 */
}
diff --git a/sysdeps/ieee754/dbl-64/wordsize-64/e_acosh.c b/sysdeps/ieee754/dbl-64/wordsize-64/e_acosh.c
index 26268f2..8cb4702 100644
--- a/sysdeps/ieee754/dbl-64/wordsize-64/e_acosh.c
+++ b/sysdeps/ieee754/dbl-64/wordsize-64/e_acosh.c
@@ -26,6 +26,7 @@
#include <math.h>
#include <math_private.h>
+#include <stap-probe.h>
static const double
one = 1.0,
@@ -46,17 +47,22 @@ __ieee754_acosh (double x)
/* x is inf of NaN */
return x + x;
else
+ {
+ LIBC_PROBE (acosh_probe, 2, 1, &x);
return __ieee754_log (x) + ln2;/* acosh(huge)=log(2x) */
+ }
}
/* 2**28 > x > 2 */
double t = x * x;
+ LIBC_PROBE (acosh_probe, 2, 2, &x);
return __ieee754_log (2.0 * x - one / (x + __ieee754_sqrt (t - one)));
}
else if (__builtin_expect (hx > INT64_C (0x3ff0000000000000), 1))
{
/* 1<x<2 */
double t = x - one;
+ LIBC_PROBE (acosh_probe, 2, 3, &x);
return __log1p (t + __ieee754_sqrt (2.0 * t + t * t));
}
else if (__builtin_expect (hx == INT64_C (0x3ff0000000000000), 1))
diff --git a/sysdeps/ieee754/dbl-64/wordsize-64/e_cosh.c b/sysdeps/ieee754/dbl-64/wordsize-64/e_cosh.c
index 8459352..ecf8210 100644
--- a/sysdeps/ieee754/dbl-64/wordsize-64/e_cosh.c
+++ b/sysdeps/ieee754/dbl-64/wordsize-64/e_cosh.c
@@ -33,6 +33,7 @@
#include <math.h>
#include <math_private.h>
+#include <stap-probe.h>
static const double one = 1.0, half=0.5, huge = 1.0e300;
@@ -52,17 +53,23 @@ __ieee754_cosh (double x)
if(ix<0x3fd62e43) {
t = __expm1(fabs(x));
w = one+t;
+ LIBC_PROBE (cosh_probe, 2, 1, &x);
if (ix<0x3c800000) return w; /* cosh(tiny) = 1 */
return one+(t*t)/(w+w);
}
+ LIBC_PROBE (cosh_probe, 2, 2, &x);
/* |x| in [0.5*ln2,22], return (exp(|x|)+1/exp(|x|)/2; */
t = __ieee754_exp(fabs(x));
return half*t+half/t;
}
/* |x| in [22, log(maxdouble)] return half*exp(|x|) */
- if (ix < 0x40862e42) return half*__ieee754_exp(fabs(x));
+ if (ix < 0x40862e42)
+ {
+ LIBC_PROBE (cosh_probe, 2, 3, &x);
+ return half*__ieee754_exp(fabs(x));
+ }
/* |x| in [log(maxdouble), overflowthresold] */
int64_t fix;
@@ -71,6 +78,7 @@ __ieee754_cosh (double x)
if (fix <= UINT64_C(0x408633ce8fb9f87d)) {
w = __ieee754_exp(half*fabs(x));
t = half*w;
+ LIBC_PROBE (cosh_probe, 2, 4, &x);
return t*w;
}
-----------------------------------------------------------------------
hooks/post-receive
--
GNU C Library master sources